diff --git a/public/v2/assets/css/dashboard.css b/public/v2/assets/css/dashboard.css new file mode 100755 index 0000000000..1010475819 --- /dev/null +++ b/public/v2/assets/css/dashboard.css @@ -0,0 +1,18610 @@ +@charset "UTF-8"; +/** +Dashboard UI + */ +/*! + * Bootstrap v4.1.0 (https://getbootstrap.com/) + * Copyright 2011-2018 The Bootstrap Authors + * Copyright 2011-2018 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +:root { + --blue: #467fcf; + --indigo: #6574cd; + --purple: #a55eea; + --pink: #f66d9b; + --red: #cd201f; + --orange: #fd9644; + --yellow: #f1c40f; + --green: #5eba00; + --teal: #2bcbba; + --cyan: #17a2b8; + --white: #fff; + --gray: #868e96; + --gray-dark: #343a40; + --azure: #45aaf2; + --lime: #7bd235; + --primary: #467fcf; + --secondary: #868e96; + --success: #5eba00; + --info: #45aaf2; + --warning: #f1c40f; + --danger: #cd201f; + --light: #f8f9fa; + --dark: #343a40; + --breakpoint-xs: 0; + --breakpoint-sm: 576px; + --breakpoint-md: 768px; + --breakpoint-lg: 992px; + --breakpoint-xl: 1280px; + --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol"; + --font-family-monospace: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +*, +*::before, +*::after { + box-sizing: border-box; +} + +html { + font-family: sans-serif; + line-height: 1.15; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; + -ms-overflow-style: scrollbar; + -webkit-tap-highlight-color: transparent; +} + +@-ms-viewport { + width: device-width; +} + +article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section { + display: block; +} + +body { + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.5; + color: #495057; + text-align: left; + background-color: #f5f7fb; +} + +[tabindex="-1"]:focus { + outline: 0 !important; +} + +hr { + box-sizing: content-box; + height: 0; + overflow: visible; +} + +h1, h2, h3, h4, h5, h6 { + margin-top: 0; + margin-bottom: 0.66em; +} + +p { + margin-top: 0; + margin-bottom: 1rem; +} + +abbr[title], +abbr[data-original-title] { + text-decoration: underline; + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; + cursor: help; + border-bottom: 0; +} + +address { + margin-bottom: 1rem; + font-style: normal; + line-height: inherit; +} + +ol, +ul, +dl { + margin-top: 0; + margin-bottom: 1rem; +} + +ol ol, +ul ul, +ol ul, +ul ol { + margin-bottom: 0; +} + +dt { + font-weight: 700; +} + +dd { + margin-bottom: .5rem; + margin-left: 0; +} + +blockquote { + margin: 0 0 1rem; +} + +dfn { + font-style: italic; +} + +b, +strong { + font-weight: bolder; +} + +small { + font-size: 80%; +} + +sub, +sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} + +sub { + bottom: -.25em; +} + +sup { + top: -.5em; +} + +a { + color: #467fcf; + text-decoration: none; + background-color: transparent; + -webkit-text-decoration-skip: objects; +} + +a:hover { + color: #295a9f; + text-decoration: underline; +} + +a:not([href]):not([tabindex]) { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):focus { + outline: 0; +} + +pre, +code, +kbd, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +pre { + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + -ms-overflow-style: scrollbar; +} + +figure { + margin: 0 0 1rem; +} + +img { + vertical-align: middle; + border-style: none; +} + +svg:not(:root) { + overflow: hidden; +} + +table { + border-collapse: collapse; +} + +caption { + padding-top: 0.75rem; + padding-bottom: 0.75rem; + color: #9aa0ac; + text-align: left; + caption-side: bottom; +} + +th { + text-align: inherit; +} + +label { + display: inline-block; + margin-bottom: 0.5rem; +} + +button { + border-radius: 0; +} + +button:focus { + outline: 1px dotted; + outline: 5px auto -webkit-focus-ring-color; +} + +input, +button, +select, +optgroup, +textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height: inherit; +} + +button, +input { + overflow: visible; +} + +button, +select { + text-transform: none; +} + +button, +html [type="button"], +[type="reset"], +[type="submit"] { + -webkit-appearance: button; +} + +button::-moz-focus-inner, +[type="button"]::-moz-focus-inner, +[type="reset"]::-moz-focus-inner, +[type="submit"]::-moz-focus-inner { + padding: 0; + border-style: none; +} + +input[type="radio"], +input[type="checkbox"] { + box-sizing: border-box; + padding: 0; +} + +input[type="date"], +input[type="time"], +input[type="datetime-local"], +input[type="month"] { + -webkit-appearance: listbox; +} + +textarea { + overflow: auto; + resize: vertical; +} + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; +} + +legend { + display: block; + width: 100%; + max-width: 100%; + padding: 0; + margin-bottom: .5rem; + font-size: 1.5rem; + line-height: inherit; + color: inherit; + white-space: normal; +} + +progress { + vertical-align: baseline; +} + +[type="number"]::-webkit-inner-spin-button, +[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +[type="search"] { + outline-offset: -2px; + -webkit-appearance: none; +} + +[type="search"]::-webkit-search-cancel-button, +[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +::-webkit-file-upload-button { + font: inherit; + -webkit-appearance: button; +} + +output { + display: inline-block; +} + +summary { + display: list-item; + cursor: pointer; +} + +template { + display: none; +} + +[hidden] { + display: none !important; +} + +h1, h2, h3, h4, h5, h6, +.h1, .h2, .h3, .h4, .h5, .h6 { + margin-bottom: 0.66em; + font-family: inherit; + font-weight: 600; + line-height: 1.1; + color: inherit; +} + +h1, .h1 { + font-size: 2rem; +} + +h2, .h2 { + font-size: 1.75rem; +} + +h3, .h3 { + font-size: 1.5rem; +} + +h4, .h4 { + font-size: 1.125rem; +} + +h5, .h5 { + font-size: 1rem; +} + +h6, .h6 { + font-size: 0.875rem; +} + +.lead { + font-size: 1.171875rem; + font-weight: 300; +} + +.display-1 { + font-size: 4.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-2 { + font-size: 4rem; + font-weight: 300; + line-height: 1.1; +} + +.display-3 { + font-size: 3.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-4 { + font-size: 3rem; + font-weight: 300; + line-height: 1.1; +} + +hr { + margin-top: 1rem; + margin-bottom: 1rem; + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +small, +.small { + font-size: 87.5%; + font-weight: 400; +} + +mark, +.mark { + padding: 0.2em; + background-color: #fcf8e3; +} + +.list-unstyled { + padding-left: 0; + list-style: none; +} + +.list-inline { + padding-left: 0; + list-style: none; +} + +.list-inline-item { + display: inline-block; +} + +.list-inline-item:not(:last-child) { + margin-right: 0.5rem; +} + +.initialism { + font-size: 90%; + text-transform: uppercase; +} + +.blockquote { + margin-bottom: 1rem; + font-size: 1.171875rem; +} + +.blockquote-footer { + display: block; + font-size: 80%; + color: #868e96; +} + +.blockquote-footer::before { + content: "\2014 \00A0"; +} + +.img-fluid { + max-width: 100%; + height: auto; +} + +.img-thumbnail { + padding: 0.25rem; + background-color: #fff; + border: 1px solid #dee2e6; + border-radius: 3px; + max-width: 100%; + height: auto; +} + +.figure { + display: inline-block; +} + +.figure-img { + margin-bottom: 0.5rem; + line-height: 1; +} + +.figure-caption { + font-size: 90%; + color: #868e96; +} + +code, +kbd, +pre, +samp { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +code { + font-size: 85%; + color: inherit; + word-break: break-word; +} + +a > code { + color: inherit; +} + +kbd { + padding: 0.2rem 0.4rem; + font-size: 85%; + color: #fff; + background-color: #343a40; + border-radius: 3px; +} + +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: 700; +} + +pre { + display: block; + font-size: 85%; + color: #212529; +} + +pre code { + font-size: inherit; + color: inherit; + word-break: normal; +} + +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} + +.container { + width: 100%; + padding-right: 0.75rem; + padding-left: 0.75rem; + margin-right: auto; + margin-left: auto; +} + +@media (min-width: 576px) { + .container { + max-width: 540px; + } +} + +@media (min-width: 768px) { + .container { + max-width: 720px; + } +} + +@media (min-width: 992px) { + .container { + max-width: 960px; + } +} + +@media (min-width: 1280px) { + .container { + max-width: 1200px; + } +} + +.container-fluid { + width: 100%; + padding-right: 0.75rem; + padding-left: 0.75rem; + margin-right: auto; + margin-left: auto; +} + +.row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-right: -0.75rem; + margin-left: -0.75rem; +} + +.no-gutters { + margin-right: 0; + margin-left: 0; +} + +.no-gutters > .col, +.no-gutters > [class*="col-"] { + padding-right: 0; + padding-left: 0; +} + +.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col, +.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm, +.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md, +.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg, +.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl, +.col-xl-auto { + position: relative; + width: 100%; + min-height: 1px; + padding-right: 0.75rem; + padding-left: 0.75rem; +} + +.col { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; +} + +.col-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; +} + +.col-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; +} + +.col-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; +} + +.col-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; +} + +.col-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; +} + +.col-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; +} + +.col-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; +} + +.col-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; +} + +.col-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; +} + +.col-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; +} + +.col-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; +} + +.col-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; +} + +.col-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; +} + +.order-first { + -ms-flex-order: -1; + order: -1; +} + +.order-last { + -ms-flex-order: 13; + order: 13; +} + +.order-0 { + -ms-flex-order: 0; + order: 0; +} + +.order-1 { + -ms-flex-order: 1; + order: 1; +} + +.order-2 { + -ms-flex-order: 2; + order: 2; +} + +.order-3 { + -ms-flex-order: 3; + order: 3; +} + +.order-4 { + -ms-flex-order: 4; + order: 4; +} + +.order-5 { + -ms-flex-order: 5; + order: 5; +} + +.order-6 { + -ms-flex-order: 6; + order: 6; +} + +.order-7 { + -ms-flex-order: 7; + order: 7; +} + +.order-8 { + -ms-flex-order: 8; + order: 8; +} + +.order-9 { + -ms-flex-order: 9; + order: 9; +} + +.order-10 { + -ms-flex-order: 10; + order: 10; +} + +.order-11 { + -ms-flex-order: 11; + order: 11; +} + +.order-12 { + -ms-flex-order: 12; + order: 12; +} + +.offset-1 { + margin-left: 8.33333333%; +} + +.offset-2 { + margin-left: 16.66666667%; +} + +.offset-3 { + margin-left: 25%; +} + +.offset-4 { + margin-left: 33.33333333%; +} + +.offset-5 { + margin-left: 41.66666667%; +} + +.offset-6 { + margin-left: 50%; +} + +.offset-7 { + margin-left: 58.33333333%; +} + +.offset-8 { + margin-left: 66.66666667%; +} + +.offset-9 { + margin-left: 75%; +} + +.offset-10 { + margin-left: 83.33333333%; +} + +.offset-11 { + margin-left: 91.66666667%; +} + +@media (min-width: 576px) { + .col-sm { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-sm-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-sm-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-sm-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-sm-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-sm-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-sm-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-sm-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-sm-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-sm-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-sm-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-sm-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-sm-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-sm-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-sm-first { + -ms-flex-order: -1; + order: -1; + } + .order-sm-last { + -ms-flex-order: 13; + order: 13; + } + .order-sm-0 { + -ms-flex-order: 0; + order: 0; + } + .order-sm-1 { + -ms-flex-order: 1; + order: 1; + } + .order-sm-2 { + -ms-flex-order: 2; + order: 2; + } + .order-sm-3 { + -ms-flex-order: 3; + order: 3; + } + .order-sm-4 { + -ms-flex-order: 4; + order: 4; + } + .order-sm-5 { + -ms-flex-order: 5; + order: 5; + } + .order-sm-6 { + -ms-flex-order: 6; + order: 6; + } + .order-sm-7 { + -ms-flex-order: 7; + order: 7; + } + .order-sm-8 { + -ms-flex-order: 8; + order: 8; + } + .order-sm-9 { + -ms-flex-order: 9; + order: 9; + } + .order-sm-10 { + -ms-flex-order: 10; + order: 10; + } + .order-sm-11 { + -ms-flex-order: 11; + order: 11; + } + .order-sm-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-sm-0 { + margin-left: 0; + } + .offset-sm-1 { + margin-left: 8.33333333%; + } + .offset-sm-2 { + margin-left: 16.66666667%; + } + .offset-sm-3 { + margin-left: 25%; + } + .offset-sm-4 { + margin-left: 33.33333333%; + } + .offset-sm-5 { + margin-left: 41.66666667%; + } + .offset-sm-6 { + margin-left: 50%; + } + .offset-sm-7 { + margin-left: 58.33333333%; + } + .offset-sm-8 { + margin-left: 66.66666667%; + } + .offset-sm-9 { + margin-left: 75%; + } + .offset-sm-10 { + margin-left: 83.33333333%; + } + .offset-sm-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 768px) { + .col-md { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-md-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-md-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-md-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-md-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-md-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-md-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-md-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-md-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-md-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-md-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-md-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-md-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-md-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-md-first { + -ms-flex-order: -1; + order: -1; + } + .order-md-last { + -ms-flex-order: 13; + order: 13; + } + .order-md-0 { + -ms-flex-order: 0; + order: 0; + } + .order-md-1 { + -ms-flex-order: 1; + order: 1; + } + .order-md-2 { + -ms-flex-order: 2; + order: 2; + } + .order-md-3 { + -ms-flex-order: 3; + order: 3; + } + .order-md-4 { + -ms-flex-order: 4; + order: 4; + } + .order-md-5 { + -ms-flex-order: 5; + order: 5; + } + .order-md-6 { + -ms-flex-order: 6; + order: 6; + } + .order-md-7 { + -ms-flex-order: 7; + order: 7; + } + .order-md-8 { + -ms-flex-order: 8; + order: 8; + } + .order-md-9 { + -ms-flex-order: 9; + order: 9; + } + .order-md-10 { + -ms-flex-order: 10; + order: 10; + } + .order-md-11 { + -ms-flex-order: 11; + order: 11; + } + .order-md-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-md-0 { + margin-left: 0; + } + .offset-md-1 { + margin-left: 8.33333333%; + } + .offset-md-2 { + margin-left: 16.66666667%; + } + .offset-md-3 { + margin-left: 25%; + } + .offset-md-4 { + margin-left: 33.33333333%; + } + .offset-md-5 { + margin-left: 41.66666667%; + } + .offset-md-6 { + margin-left: 50%; + } + .offset-md-7 { + margin-left: 58.33333333%; + } + .offset-md-8 { + margin-left: 66.66666667%; + } + .offset-md-9 { + margin-left: 75%; + } + .offset-md-10 { + margin-left: 83.33333333%; + } + .offset-md-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 992px) { + .col-lg { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-lg-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-lg-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-lg-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-lg-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-lg-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-lg-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-lg-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-lg-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-lg-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-lg-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-lg-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-lg-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-lg-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-lg-first { + -ms-flex-order: -1; + order: -1; + } + .order-lg-last { + -ms-flex-order: 13; + order: 13; + } + .order-lg-0 { + -ms-flex-order: 0; + order: 0; + } + .order-lg-1 { + -ms-flex-order: 1; + order: 1; + } + .order-lg-2 { + -ms-flex-order: 2; + order: 2; + } + .order-lg-3 { + -ms-flex-order: 3; + order: 3; + } + .order-lg-4 { + -ms-flex-order: 4; + order: 4; + } + .order-lg-5 { + -ms-flex-order: 5; + order: 5; + } + .order-lg-6 { + -ms-flex-order: 6; + order: 6; + } + .order-lg-7 { + -ms-flex-order: 7; + order: 7; + } + .order-lg-8 { + -ms-flex-order: 8; + order: 8; + } + .order-lg-9 { + -ms-flex-order: 9; + order: 9; + } + .order-lg-10 { + -ms-flex-order: 10; + order: 10; + } + .order-lg-11 { + -ms-flex-order: 11; + order: 11; + } + .order-lg-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-lg-0 { + margin-left: 0; + } + .offset-lg-1 { + margin-left: 8.33333333%; + } + .offset-lg-2 { + margin-left: 16.66666667%; + } + .offset-lg-3 { + margin-left: 25%; + } + .offset-lg-4 { + margin-left: 33.33333333%; + } + .offset-lg-5 { + margin-left: 41.66666667%; + } + .offset-lg-6 { + margin-left: 50%; + } + .offset-lg-7 { + margin-left: 58.33333333%; + } + .offset-lg-8 { + margin-left: 66.66666667%; + } + .offset-lg-9 { + margin-left: 75%; + } + .offset-lg-10 { + margin-left: 83.33333333%; + } + .offset-lg-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 1280px) { + .col-xl { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-xl-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-xl-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-xl-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-xl-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-xl-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-xl-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-xl-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-xl-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-xl-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-xl-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-xl-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-xl-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-xl-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-xl-first { + -ms-flex-order: -1; + order: -1; + } + .order-xl-last { + -ms-flex-order: 13; + order: 13; + } + .order-xl-0 { + -ms-flex-order: 0; + order: 0; + } + .order-xl-1 { + -ms-flex-order: 1; + order: 1; + } + .order-xl-2 { + -ms-flex-order: 2; + order: 2; + } + .order-xl-3 { + -ms-flex-order: 3; + order: 3; + } + .order-xl-4 { + -ms-flex-order: 4; + order: 4; + } + .order-xl-5 { + -ms-flex-order: 5; + order: 5; + } + .order-xl-6 { + -ms-flex-order: 6; + order: 6; + } + .order-xl-7 { + -ms-flex-order: 7; + order: 7; + } + .order-xl-8 { + -ms-flex-order: 8; + order: 8; + } + .order-xl-9 { + -ms-flex-order: 9; + order: 9; + } + .order-xl-10 { + -ms-flex-order: 10; + order: 10; + } + .order-xl-11 { + -ms-flex-order: 11; + order: 11; + } + .order-xl-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-xl-0 { + margin-left: 0; + } + .offset-xl-1 { + margin-left: 8.33333333%; + } + .offset-xl-2 { + margin-left: 16.66666667%; + } + .offset-xl-3 { + margin-left: 25%; + } + .offset-xl-4 { + margin-left: 33.33333333%; + } + .offset-xl-5 { + margin-left: 41.66666667%; + } + .offset-xl-6 { + margin-left: 50%; + } + .offset-xl-7 { + margin-left: 58.33333333%; + } + .offset-xl-8 { + margin-left: 66.66666667%; + } + .offset-xl-9 { + margin-left: 75%; + } + .offset-xl-10 { + margin-left: 83.33333333%; + } + .offset-xl-11 { + margin-left: 91.66666667%; + } +} + +.table, .text-wrap table { + width: 100%; + max-width: 100%; + margin-bottom: 1rem; + background-color: transparent; +} + +.table th, .text-wrap table th, +.table td, +.text-wrap table td { + padding: 0.75rem; + vertical-align: top; + border-top: 1px solid #dee2e6; +} + +.table thead th, .text-wrap table thead th { + vertical-align: bottom; + border-bottom: 2px solid #dee2e6; +} + +.table tbody + tbody, .text-wrap table tbody + tbody { + border-top: 2px solid #dee2e6; +} + +.table .table, .text-wrap table .table, .table .text-wrap table, .text-wrap .table table, .text-wrap table table { + background-color: #f5f7fb; +} + +.table-sm th, +.table-sm td { + padding: 0.3rem; +} + +.table-bordered, .text-wrap table { + border: 1px solid #dee2e6; +} + +.table-bordered th, .text-wrap table th, +.table-bordered td, +.text-wrap table td { + border: 1px solid #dee2e6; +} + +.table-bordered thead th, .text-wrap table thead th, +.table-bordered thead td, +.text-wrap table thead td { + border-bottom-width: 2px; +} + +.table-borderless th, +.table-borderless td, +.table-borderless thead th, +.table-borderless tbody + tbody { + border: 0; +} + +.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-hover tbody tr:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-primary, +.table-primary > th, +.table-primary > td { + background-color: #cbdbf2; +} + +.table-hover .table-primary:hover { + background-color: #b7cded; +} + +.table-hover .table-primary:hover > td, +.table-hover .table-primary:hover > th { + background-color: #b7cded; +} + +.table-secondary, +.table-secondary > th, +.table-secondary > td { + background-color: #dddfe2; +} + +.table-hover .table-secondary:hover { + background-color: #cfd2d6; +} + +.table-hover .table-secondary:hover > td, +.table-hover .table-secondary:hover > th { + background-color: #cfd2d6; +} + +.table-success, +.table-success > th, +.table-success > td { + background-color: #d2ecb8; +} + +.table-hover .table-success:hover { + background-color: #c5e7a4; +} + +.table-hover .table-success:hover > td, +.table-hover .table-success:hover > th { + background-color: #c5e7a4; +} + +.table-info, +.table-info > th, +.table-info > td { + background-color: #cbe7fb; +} + +.table-hover .table-info:hover { + background-color: #b3dcf9; +} + +.table-hover .table-info:hover > td, +.table-hover .table-info:hover > th { + background-color: #b3dcf9; +} + +.table-warning, +.table-warning > th, +.table-warning > td { + background-color: #fbeebc; +} + +.table-hover .table-warning:hover { + background-color: #fae8a4; +} + +.table-hover .table-warning:hover > td, +.table-hover .table-warning:hover > th { + background-color: #fae8a4; +} + +.table-danger, +.table-danger > th, +.table-danger > td { + background-color: #f1c1c0; +} + +.table-hover .table-danger:hover { + background-color: #ecacab; +} + +.table-hover .table-danger:hover > td, +.table-hover .table-danger:hover > th { + background-color: #ecacab; +} + +.table-light, +.table-light > th, +.table-light > td { + background-color: #fdfdfe; +} + +.table-hover .table-light:hover { + background-color: #ececf6; +} + +.table-hover .table-light:hover > td, +.table-hover .table-light:hover > th { + background-color: #ececf6; +} + +.table-dark, +.table-dark > th, +.table-dark > td { + background-color: #c6c8ca; +} + +.table-hover .table-dark:hover { + background-color: #b9bbbe; +} + +.table-hover .table-dark:hover > td, +.table-hover .table-dark:hover > th { + background-color: #b9bbbe; +} + +.table-active, +.table-active > th, +.table-active > td { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover > td, +.table-hover .table-active:hover > th { + background-color: rgba(0, 0, 0, 0.04); +} + +.table .thead-dark th, .text-wrap table .thead-dark th { + color: #f5f7fb; + background-color: #212529; + border-color: #32383e; +} + +.table .thead-light th, .text-wrap table .thead-light th { + color: #495057; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.table-dark { + color: #f5f7fb; + background-color: #212529; +} + +.table-dark th, +.table-dark td, +.table-dark thead th { + border-color: #32383e; +} + +.table-dark.table-bordered, .text-wrap table.table-dark { + border: 0; +} + +.table-dark.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(255, 255, 255, 0.05); +} + +.table-dark.table-hover tbody tr:hover { + background-color: rgba(255, 255, 255, 0.075); +} + +@media (max-width: 575.98px) { + .table-responsive-sm { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-sm > .table-bordered, .text-wrap .table-responsive-sm > table { + border: 0; + } +} + +@media (max-width: 767.98px) { + .table-responsive-md { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-md > .table-bordered, .text-wrap .table-responsive-md > table { + border: 0; + } +} + +@media (max-width: 991.98px) { + .table-responsive-lg { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-lg > .table-bordered, .text-wrap .table-responsive-lg > table { + border: 0; + } +} + +@media (max-width: 1279.98px) { + .table-responsive-xl { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-xl > .table-bordered, .text-wrap .table-responsive-xl > table { + border: 0; + } +} + +.table-responsive { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; +} + +.table-responsive > .table-bordered, .text-wrap .table-responsive > table { + border: 0; +} + +.form-control { + display: block; + width: 100%; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.6; + color: #495057; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .form-control { + transition: none; + } +} + +.form-control::-ms-expand { + background-color: transparent; + border: 0; +} + +.form-control:focus { + color: #495057; + background-color: #fff; + border-color: #1991eb; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.form-control::-webkit-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-moz-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:disabled, .form-control[readonly] { + background-color: #f8f9fa; + opacity: 1; +} + +select.form-control:not([size]):not([multiple]) { + height: 2.375rem; +} + +select.form-control:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.form-control-file, +.form-control-range { + display: block; + width: 100%; +} + +.col-form-label { + padding-top: calc(0.375rem + 1px); + padding-bottom: calc(0.375rem + 1px); + margin-bottom: 0; + font-size: inherit; + line-height: 1.6; +} + +.col-form-label-lg { + padding-top: calc(0.5rem + 1px); + padding-bottom: calc(0.5rem + 1px); + font-size: 1.125rem; + line-height: 1.44444444; +} + +.col-form-label-sm { + padding-top: calc(0.25rem + 1px); + padding-bottom: calc(0.25rem + 1px); + font-size: 0.875rem; + line-height: 1.14285714; +} + +.form-control-plaintext { + display: block; + width: 100%; + padding-top: 0.375rem; + padding-bottom: 0.375rem; + margin-bottom: 0; + line-height: 1.6; + color: #495057; + background-color: transparent; + border: solid transparent; + border-width: 1px 0; +} + +.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control, +.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-prepend > .form-control-plaintext.btn, +.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control, +.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-prepend > .form-control-plaintext.btn, +.input-group-lg > .input-group-append > .form-control-plaintext.btn { + padding-right: 0; + padding-left: 0; +} + +.form-control-sm, .input-group-sm > .form-control, +.input-group-sm > .input-group-prepend > .input-group-text, +.input-group-sm > .input-group-append > .input-group-text, +.input-group-sm > .input-group-prepend > .btn, +.input-group-sm > .input-group-append > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.14285714; + border-radius: 3px; +} + +select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(1.8125rem + 2px); +} + +.form-control-lg, .input-group-lg > .form-control, +.input-group-lg > .input-group-prepend > .input-group-text, +.input-group-lg > .input-group-append > .input-group-text, +.input-group-lg > .input-group-prepend > .btn, +.input-group-lg > .input-group-append > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.44444444; + border-radius: 3px; +} + +select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(2.6875rem + 2px); +} + +.form-group { + margin-bottom: 1rem; +} + +.form-text { + display: block; + margin-top: 0.25rem; +} + +.form-row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-right: -5px; + margin-left: -5px; +} + +.form-row > .col, +.form-row > [class*="col-"] { + padding-right: 5px; + padding-left: 5px; +} + +.form-check { + position: relative; + display: block; + padding-left: 1.25rem; +} + +.form-check-input { + position: absolute; + margin-top: 0.3rem; + margin-left: -1.25rem; +} + +.form-check-input:disabled ~ .form-check-label { + color: #9aa0ac; +} + +.form-check-label { + margin-bottom: 0; +} + +.form-check-inline { + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + padding-left: 0; + margin-right: 0.75rem; +} + +.form-check-inline .form-check-input { + position: static; + margin-top: 0; + margin-right: 0.3125rem; + margin-left: 0; +} + +.valid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #5eba00; +} + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(94, 186, 0, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:valid, .form-control.is-valid, .was-validated +.custom-select:valid, +.custom-select.is-valid { + border-color: #5eba00; +} + +.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated +.custom-select:valid:focus, +.custom-select.is-valid:focus { + border-color: #5eba00; + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .form-control:valid ~ .valid-feedback, +.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback, +.form-control.is-valid ~ .valid-tooltip, .was-validated +.custom-select:valid ~ .valid-feedback, +.was-validated +.custom-select:valid ~ .valid-tooltip, +.custom-select.is-valid ~ .valid-feedback, +.custom-select.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { + color: #5eba00; +} + +.was-validated .form-check-input:valid ~ .valid-feedback, +.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback, +.form-check-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label { + color: #5eba00; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before { + background-color: #9eff3b; +} + +.was-validated .custom-control-input:valid ~ .valid-feedback, +.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback, +.custom-control-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before { + background-color: #78ed00; +} + +.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label { + border-color: #5eba00; +} + +.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:valid ~ .valid-feedback, +.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback, +.custom-file-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.invalid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #cd201f; +} + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(205, 32, 31, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated +.custom-select:invalid, +.custom-select.is-invalid { + border-color: #cd201f; +} + +.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated +.custom-select:invalid:focus, +.custom-select.is-invalid:focus { + border-color: #cd201f; + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .form-control:invalid ~ .invalid-feedback, +.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback, +.form-control.is-invalid ~ .invalid-tooltip, .was-validated +.custom-select:invalid ~ .invalid-feedback, +.was-validated +.custom-select:invalid ~ .invalid-tooltip, +.custom-select.is-invalid ~ .invalid-feedback, +.custom-select.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { + color: #cd201f; +} + +.was-validated .form-check-input:invalid ~ .invalid-feedback, +.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback, +.form-check-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label { + color: #cd201f; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before { + background-color: #ec8080; +} + +.was-validated .custom-control-input:invalid ~ .invalid-feedback, +.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback, +.custom-control-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before { + background-color: #e23e3d; +} + +.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label { + border-color: #cd201f; +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:invalid ~ .invalid-feedback, +.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback, +.custom-file-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.form-inline { + display: -ms-flexbox; + display: flex; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; +} + +.form-inline .form-check { + width: 100%; +} + +@media (min-width: 576px) { + .form-inline label { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + margin-bottom: 0; + } + .form-inline .form-group { + display: -ms-flexbox; + display: flex; + -ms-flex: 0 0 auto; + flex: 0 0 auto; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; + margin-bottom: 0; + } + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .form-inline .form-control-plaintext { + display: inline-block; + } + .form-inline .input-group, + .form-inline .custom-select { + width: auto; + } + .form-inline .form-check { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: auto; + padding-left: 0; + } + .form-inline .form-check-input { + position: relative; + margin-top: 0; + margin-right: 0.25rem; + margin-left: 0; + } + .form-inline .custom-control { + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + } + .form-inline .custom-control-label { + margin-bottom: 0; + } +} + +.btn { + display: inline-block; + font-weight: 400; + text-align: center; + white-space: nowrap; + vertical-align: middle; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + border: 1px solid transparent; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.84615385; + border-radius: 3px; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .btn { + transition: none; + } +} + +.btn:hover, .btn:focus { + text-decoration: none; +} + +.btn:focus, .btn.focus { + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.btn.disabled, .btn:disabled { + opacity: 0.65; +} + +.btn:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active { + background-image: none; +} + +a.btn.disabled, +fieldset:disabled a.btn { + pointer-events: none; +} + +.btn-primary { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-primary:focus, .btn-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-primary.disabled, .btn-primary:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, +.show > .btn-primary.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-secondary { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-success { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-success:focus, .btn-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-success.disabled, .btn-success:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, +.show > .btn-success.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-info { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-info:focus, .btn-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-info.disabled, .btn-info:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, +.show > .btn-info.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-warning { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-warning:focus, .btn-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-warning.disabled, .btn-warning:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, +.show > .btn-warning.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-danger { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-danger:focus, .btn-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-danger.disabled, .btn-danger:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, +.show > .btn-danger.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-light { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:hover { + color: #495057; + background-color: #e2e6ea; + border-color: #dae0e5; +} + +.btn-light:focus, .btn-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-light.disabled, .btn-light:disabled { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, +.show > .btn-light.dropdown-toggle { + color: #495057; + background-color: #dae0e5; + border-color: #d3d9df; +} + +.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-dark:focus, .btn-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-dark.disabled, .btn-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, +.show > .btn-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-primary { + color: #467fcf; + background-color: transparent; + background-image: none; + border-color: #467fcf; +} + +.btn-outline-primary:hover { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:focus, .btn-outline-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-primary.disabled, .btn-outline-primary:disabled { + color: #467fcf; + background-color: transparent; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, +.show > .btn-outline-primary.dropdown-toggle { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-secondary { + color: #868e96; + background-color: transparent; + background-image: none; + border-color: #868e96; +} + +.btn-outline-secondary:hover { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:focus, .btn-outline-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-secondary.disabled, .btn-outline-secondary:disabled { + color: #868e96; + background-color: transparent; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, +.show > .btn-outline-secondary.dropdown-toggle { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-success { + color: #5eba00; + background-color: transparent; + background-image: none; + border-color: #5eba00; +} + +.btn-outline-success:hover { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:focus, .btn-outline-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-success.disabled, .btn-outline-success:disabled { + color: #5eba00; + background-color: transparent; +} + +.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, +.show > .btn-outline-success.dropdown-toggle { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-info { + color: #45aaf2; + background-color: transparent; + background-image: none; + border-color: #45aaf2; +} + +.btn-outline-info:hover { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:focus, .btn-outline-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-info.disabled, .btn-outline-info:disabled { + color: #45aaf2; + background-color: transparent; +} + +.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, +.show > .btn-outline-info.dropdown-toggle { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-warning { + color: #f1c40f; + background-color: transparent; + background-image: none; + border-color: #f1c40f; +} + +.btn-outline-warning:hover { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:focus, .btn-outline-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-warning.disabled, .btn-outline-warning:disabled { + color: #f1c40f; + background-color: transparent; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, +.show > .btn-outline-warning.dropdown-toggle { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-danger { + color: #cd201f; + background-color: transparent; + background-image: none; + border-color: #cd201f; +} + +.btn-outline-danger:hover { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:focus, .btn-outline-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-danger.disabled, .btn-outline-danger:disabled { + color: #cd201f; + background-color: transparent; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, +.show > .btn-outline-danger.dropdown-toggle { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-light { + color: #f8f9fa; + background-color: transparent; + background-image: none; + border-color: #f8f9fa; +} + +.btn-outline-light:hover { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:focus, .btn-outline-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-light.disabled, .btn-outline-light:disabled { + color: #f8f9fa; + background-color: transparent; +} + +.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, +.show > .btn-outline-light.dropdown-toggle { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-dark { + color: #343a40; + background-color: transparent; + background-image: none; + border-color: #343a40; +} + +.btn-outline-dark:hover { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:focus, .btn-outline-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-dark.disabled, .btn-outline-dark:disabled { + color: #343a40; + background-color: transparent; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, +.show > .btn-outline-dark.dropdown-toggle { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-link { + font-weight: 400; + color: #467fcf; + background-color: transparent; +} + +.btn-link:hover { + color: #295a9f; + text-decoration: underline; + background-color: transparent; + border-color: transparent; +} + +.btn-link:focus, .btn-link.focus { + text-decoration: underline; + border-color: transparent; + box-shadow: none; +} + +.btn-link:disabled, .btn-link.disabled { + color: #868e96; + pointer-events: none; +} + +.btn-lg, .btn-group-lg > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.625; + border-radius: 3px; +} + +.btn-sm, .btn-group-sm > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.33333333; + border-radius: 3px; +} + +.btn-block { + display: block; + width: 100%; +} + +.btn-block + .btn-block { + margin-top: 0.5rem; +} + +input[type="submit"].btn-block, +input[type="reset"].btn-block, +input[type="button"].btn-block { + width: 100%; +} + +.fade { + transition: opacity 0.15s linear; +} + +@media screen and (prefers-reduced-motion: reduce) { + .fade { + transition: none; + } +} + +.fade:not(.show) { + opacity: 0; +} + +.collapse:not(.show) { + display: none; +} + +.collapsing { + position: relative; + height: 0; + overflow: hidden; + transition: height 0.35s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .collapsing { + transition: none; + } +} + +.dropup, +.dropright, +.dropdown, +.dropleft { + position: relative; +} + +.dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid; + border-right: 0.3em solid transparent; + border-bottom: 0; + border-left: 0.3em solid transparent; +} + +.dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropdown-menu { + position: absolute; + top: 100%; + left: 0; + z-index: 1000; + display: none; + float: left; + min-width: 10rem; + padding: 0.5rem 0; + margin: 0.125rem 0 0; + font-size: 0.9375rem; + color: #495057; + text-align: left; + list-style: none; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.dropdown-menu-right { + right: 0; + left: auto; +} + +.dropup .dropdown-menu { + top: auto; + bottom: 100%; + margin-top: 0; + margin-bottom: 0.125rem; +} + +.dropup .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0; + border-right: 0.3em solid transparent; + border-bottom: 0.3em solid; + border-left: 0.3em solid transparent; +} + +.dropup .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropright .dropdown-menu { + top: 0; + right: auto; + left: 100%; + margin-top: 0; + margin-left: 0.125rem; +} + +.dropright .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0; + border-bottom: 0.3em solid transparent; + border-left: 0.3em solid; +} + +.dropright .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropright .dropdown-toggle::after { + vertical-align: 0; +} + +.dropleft .dropdown-menu { + top: 0; + right: 100%; + left: auto; + margin-top: 0; + margin-right: 0.125rem; +} + +.dropleft .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; +} + +.dropleft .dropdown-toggle::after { + display: none; +} + +.dropleft .dropdown-toggle::before { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0.3em solid; + border-bottom: 0.3em solid transparent; +} + +.dropleft .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropleft .dropdown-toggle::before { + vertical-align: 0; +} + +.dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] { + right: auto; + bottom: auto; +} + +.dropdown-divider { + height: 0; + margin: 0.5rem 0; + overflow: hidden; + border-top: 1px solid #e9ecef; +} + +.dropdown-item { + display: block; + width: 100%; + padding: 0.25rem 1.5rem; + clear: both; + font-weight: 400; + color: #212529; + text-align: inherit; + white-space: nowrap; + background-color: transparent; + border: 0; +} + +.dropdown-item:hover, .dropdown-item:focus { + color: #16181b; + text-decoration: none; + background-color: #f8f9fa; +} + +.dropdown-item.active, .dropdown-item:active { + color: #fff; + text-decoration: none; + background-color: #467fcf; +} + +.dropdown-item.disabled, .dropdown-item:disabled { + color: #868e96; + background-color: transparent; +} + +.dropdown-menu.show { + display: block; +} + +.dropdown-header { + display: block; + padding: 0.5rem 1.5rem; + margin-bottom: 0; + font-size: 0.875rem; + color: #868e96; + white-space: nowrap; +} + +.dropdown-item-text { + display: block; + padding: 0.25rem 1.5rem; + color: #212529; +} + +.btn-group, +.btn-group-vertical { + position: relative; + display: -ms-inline-flexbox; + display: inline-flex; + vertical-align: middle; +} + +.btn-group > .btn, +.btn-group-vertical > .btn { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; +} + +.btn-group > .btn:hover, +.btn-group-vertical > .btn:hover { + z-index: 1; +} + +.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active, +.btn-group-vertical > .btn:focus, +.btn-group-vertical > .btn:active, +.btn-group-vertical > .btn.active { + z-index: 1; +} + +.btn-group .btn + .btn, +.btn-group .btn + .btn-group, +.btn-group .btn-group + .btn, +.btn-group .btn-group + .btn-group, +.btn-group-vertical .btn + .btn, +.btn-group-vertical .btn + .btn-group, +.btn-group-vertical .btn-group + .btn, +.btn-group-vertical .btn-group + .btn-group { + margin-left: -1px; +} + +.btn-toolbar { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.btn-toolbar .input-group { + width: auto; +} + +.btn-group > .btn:first-child { + margin-left: 0; +} + +.btn-group > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group > .btn-group:not(:last-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.btn-group > .btn:not(:first-child), +.btn-group > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.dropdown-toggle-split { + padding-right: 0.5625rem; + padding-left: 0.5625rem; +} + +.dropdown-toggle-split::after, +.dropup .dropdown-toggle-split::after, +.dropright .dropdown-toggle-split::after { + margin-left: 0; +} + +.dropleft .dropdown-toggle-split::before { + margin-right: 0; +} + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { + padding-right: 0.375rem; + padding-left: 0.375rem; +} + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { + padding-right: 0.75rem; + padding-left: 0.75rem; +} + +.btn-group-vertical { + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: center; + justify-content: center; +} + +.btn-group-vertical .btn, +.btn-group-vertical .btn-group { + width: 100%; +} + +.btn-group-vertical > .btn + .btn, +.btn-group-vertical > .btn + .btn-group, +.btn-group-vertical > .btn-group + .btn, +.btn-group-vertical > .btn-group + .btn-group { + margin-top: -1px; + margin-left: 0; +} + +.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group-vertical > .btn-group:not(:last-child) > .btn { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group-vertical > .btn:not(:first-child), +.btn-group-vertical > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.btn-group-toggle > .btn, +.btn-group-toggle > .btn-group > .btn { + margin-bottom: 0; +} + +.btn-group-toggle > .btn input[type="radio"], +.btn-group-toggle > .btn input[type="checkbox"], +.btn-group-toggle > .btn-group > .btn input[type="radio"], +.btn-group-toggle > .btn-group > .btn input[type="checkbox"] { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; +} + +.input-group { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: stretch; + align-items: stretch; + width: 100%; +} + +.input-group > .form-control, +.input-group > .custom-select, +.input-group > .custom-file { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + width: 1%; + margin-bottom: 0; +} + +.input-group > .form-control:focus, +.input-group > .custom-select:focus, +.input-group > .custom-file:focus { + z-index: 3; +} + +.input-group > .form-control + .form-control, +.input-group > .form-control + .custom-select, +.input-group > .form-control + .custom-file, +.input-group > .custom-select + .form-control, +.input-group > .custom-select + .custom-select, +.input-group > .custom-select + .custom-file, +.input-group > .custom-file + .form-control, +.input-group > .custom-file + .custom-select, +.input-group > .custom-file + .custom-file { + margin-left: -1px; +} + +.input-group > .form-control:not(:last-child), +.input-group > .custom-select:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .form-control:not(:first-child), +.input-group > .custom-select:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .custom-file { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.input-group > .custom-file:not(:last-child) .custom-file-label, +.input-group > .custom-file:not(:last-child) .custom-file-label::after { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .custom-file:not(:first-child) .custom-file-label, +.input-group > .custom-file:not(:first-child) .custom-file-label::after { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group-prepend, +.input-group-append { + display: -ms-flexbox; + display: flex; +} + +.input-group-prepend .btn, +.input-group-append .btn { + position: relative; + z-index: 2; +} + +.input-group-prepend .btn + .btn, +.input-group-prepend .btn + .input-group-text, +.input-group-prepend .input-group-text + .input-group-text, +.input-group-prepend .input-group-text + .btn, +.input-group-append .btn + .btn, +.input-group-append .btn + .input-group-text, +.input-group-append .input-group-text + .input-group-text, +.input-group-append .input-group-text + .btn { + margin-left: -1px; +} + +.input-group-prepend { + margin-right: -1px; +} + +.input-group-append { + margin-left: -1px; +} + +.input-group-text { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + padding: 0.375rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.6; + color: #495057; + text-align: center; + white-space: nowrap; + background-color: #fbfbfc; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.input-group-text input[type="radio"], +.input-group-text input[type="checkbox"] { + margin-top: 0; +} + +.input-group > .input-group-prepend > .btn, +.input-group > .input-group-prepend > .input-group-text, +.input-group > .input-group-append:not(:last-child) > .btn, +.input-group > .input-group-append:not(:last-child) > .input-group-text, +.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), +.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .input-group-append > .btn, +.input-group > .input-group-append > .input-group-text, +.input-group > .input-group-prepend:not(:first-child) > .btn, +.input-group > .input-group-prepend:not(:first-child) > .input-group-text, +.input-group > .input-group-prepend:first-child > .btn:not(:first-child), +.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.custom-control { + position: relative; + display: block; + min-height: 1.5rem; + padding-left: 1.5rem; +} + +.custom-control-inline { + display: -ms-inline-flexbox; + display: inline-flex; + margin-right: 1rem; +} + +.custom-control-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-control-input:checked ~ .custom-control-label::before { + color: #fff; + background-color: #467fcf; +} + +.custom-control-input:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-control-input:active ~ .custom-control-label::before { + color: #fff; + background-color: #d4e1f4; +} + +.custom-control-input:disabled ~ .custom-control-label { + color: #868e96; +} + +.custom-control-input:disabled ~ .custom-control-label::before { + background-color: #e9ecef; +} + +.custom-control-label { + margin-bottom: 0; +} + +.custom-control-label::before { + position: absolute; + top: 0.25rem; + left: 0; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + content: ""; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background-color: #dee2e6; +} + +.custom-control-label::after { + position: absolute; + top: 0.25rem; + left: 0; + display: block; + width: 1rem; + height: 1rem; + content: ""; + background-repeat: no-repeat; + background-position: center center; + background-size: 50% 50%; +} + +.custom-checkbox .custom-control-label::before { + border-radius: 3px; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-radio .custom-control-label::before { + border-radius: 50%; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E"); +} + +.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-select { + display: inline-block; + width: 100%; + height: 2.375rem; + padding: 0.5rem 1.75rem 0.5rem 0.75rem; + line-height: 1.5; + color: #495057; + vertical-align: middle; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat right 0.75rem center; + background-size: 8px 10px; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-select:focus { + border-color: #1991eb; + outline: 0; + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(25, 145, 235, 0.5); +} + +.custom-select:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.custom-select[multiple], .custom-select[size]:not([size="1"]) { + height: auto; + padding-right: 0.75rem; + background-image: none; +} + +.custom-select:disabled { + color: #868e96; + background-color: #e9ecef; +} + +.custom-select::-ms-expand { + opacity: 0; +} + +.custom-select-sm { + height: calc(1.8125rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 75%; +} + +.custom-select-lg { + height: calc(2.6875rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 125%; +} + +.custom-file { + position: relative; + display: inline-block; + width: 100%; + height: 2.375rem; + margin-bottom: 0; +} + +.custom-file-input { + position: relative; + z-index: 2; + width: 100%; + height: 2.375rem; + margin: 0; + opacity: 0; +} + +.custom-file-input:focus ~ .custom-file-label { + border-color: #1991eb; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-file-input:focus ~ .custom-file-label::after { + border-color: #1991eb; +} + +.custom-file-input:lang(en) ~ .custom-file-label::after { + content: "Browse"; +} + +.custom-file-label { + position: absolute; + top: 0; + right: 0; + left: 0; + z-index: 1; + height: 2.375rem; + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.custom-file-label::after { + position: absolute; + top: 0; + right: 0; + bottom: 0; + z-index: 3; + display: block; + height: calc(2.375rem - 1px * 2); + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + content: "Browse"; + background-color: #fbfbfc; + border-left: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 0 3px 3px 0; +} + +.custom-range { + width: 100%; + padding-left: 0; + background-color: transparent; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-range:focus { + outline: none; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-thumb { + width: 1rem; + height: 1rem; + margin-top: -0.25rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -webkit-appearance: none; + appearance: none; +} + +.custom-range::-webkit-slider-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-webkit-slider-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-webkit-slider-runnable-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-moz-range-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -moz-appearance: none; + appearance: none; +} + +.custom-range::-moz-range-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-moz-range-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-moz-range-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-ms-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + appearance: none; +} + +.custom-range::-ms-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-ms-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-ms-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: transparent; + border-color: transparent; + border-width: 0.5rem; +} + +.custom-range::-ms-fill-lower { + background-color: #dee2e6; + border-radius: 1rem; +} + +.custom-range::-ms-fill-upper { + margin-right: 15px; + background-color: #dee2e6; + border-radius: 1rem; +} + +.nav { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding-left: 0; + margin-bottom: 0; + list-style: none; +} + +.nav-link { + display: block; + padding: 0.5rem 1rem; +} + +.nav-link:hover, .nav-link:focus { + text-decoration: none; +} + +.nav-link.disabled { + color: #868e96; +} + +.nav-tabs { + border-bottom: 1px solid #dee2e6; +} + +.nav-tabs .nav-item { + margin-bottom: -1px; +} + +.nav-tabs .nav-link { + border: 1px solid transparent; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { + border-color: #e9ecef #e9ecef #dee2e6; +} + +.nav-tabs .nav-link.disabled { + color: #868e96; + background-color: transparent; + border-color: transparent; +} + +.nav-tabs .nav-link.active, +.nav-tabs .nav-item.show .nav-link { + color: #495057; + background-color: transparent; + border-color: #dee2e6 #dee2e6 transparent; +} + +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.nav-pills .nav-link { + border-radius: 3px; +} + +.nav-pills .nav-link.active, +.nav-pills .show > .nav-link { + color: #fff; + background-color: #467fcf; +} + +.nav-fill .nav-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + text-align: center; +} + +.nav-justified .nav-item { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + text-align: center; +} + +.tab-content > .tab-pane { + display: none; +} + +.tab-content > .active { + display: block; +} + +.navbar { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 0.5rem 1rem; +} + +.navbar > .container, +.navbar > .container-fluid { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.navbar-brand { + display: inline-block; + padding-top: 0.359375rem; + padding-bottom: 0.359375rem; + margin-right: 1rem; + font-size: 1.125rem; + line-height: inherit; + white-space: nowrap; +} + +.navbar-brand:hover, .navbar-brand:focus { + text-decoration: none; +} + +.navbar-nav { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + list-style: none; +} + +.navbar-nav .nav-link { + padding-right: 0; + padding-left: 0; +} + +.navbar-nav .dropdown-menu { + position: static; + float: none; +} + +.navbar-text { + display: inline-block; + padding-top: 0.5rem; + padding-bottom: 0.5rem; +} + +.navbar-collapse { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; + -ms-flex-positive: 1; + flex-grow: 1; + -ms-flex-align: center; + align-items: center; +} + +.navbar-toggler { + padding: 0.25rem 0.75rem; + font-size: 1.125rem; + line-height: 1; + background-color: transparent; + border: 1px solid transparent; + border-radius: 3px; +} + +.navbar-toggler:hover, .navbar-toggler:focus { + text-decoration: none; +} + +.navbar-toggler:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + content: ""; + background: no-repeat center center; + background-size: 100% 100%; +} + +@media (max-width: 575.98px) { + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 576px) { + .navbar-expand-sm { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-sm .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-sm .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-sm .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-sm .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-sm .navbar-toggler { + display: none; + } +} + +@media (max-width: 767.98px) { + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 768px) { + .navbar-expand-md { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-md .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-md .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-md .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-md .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-md .navbar-toggler { + display: none; + } +} + +@media (max-width: 991.98px) { + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 992px) { + .navbar-expand-lg { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-lg .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-lg .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-lg .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-lg .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-lg .navbar-toggler { + display: none; + } +} + +@media (max-width: 1279.98px) { + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 1280px) { + .navbar-expand-xl { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-xl .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-xl .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-xl .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-xl .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-xl .navbar-toggler { + display: none; + } +} + +.navbar-expand { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + padding-right: 0; + padding-left: 0; +} + +.navbar-expand .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; +} + +.navbar-expand .navbar-nav .dropdown-menu { + position: absolute; +} + +.navbar-expand .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; +} + +.navbar-expand .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; +} + +.navbar-expand .navbar-toggler { + display: none; +} + +.navbar-light .navbar-brand { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-nav .nav-link { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus { + color: rgba(0, 0, 0, 0.7); +} + +.navbar-light .navbar-nav .nav-link.disabled { + color: rgba(0, 0, 0, 0.3); +} + +.navbar-light .navbar-nav .show > .nav-link, +.navbar-light .navbar-nav .active > .nav-link, +.navbar-light .navbar-nav .nav-link.show, +.navbar-light .navbar-nav .nav-link.active { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-toggler { + color: rgba(0, 0, 0, 0.5); + border-color: rgba(0, 0, 0, 0.1); +} + +.navbar-light .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-light .navbar-text { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-text a { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-dark .navbar-brand { + color: #fff; +} + +.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus { + color: #fff; +} + +.navbar-dark .navbar-nav .nav-link { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus { + color: rgba(255, 255, 255, 0.75); +} + +.navbar-dark .navbar-nav .nav-link.disabled { + color: rgba(255, 255, 255, 0.25); +} + +.navbar-dark .navbar-nav .show > .nav-link, +.navbar-dark .navbar-nav .active > .nav-link, +.navbar-dark .navbar-nav .nav-link.show, +.navbar-dark .navbar-nav .nav-link.active { + color: #fff; +} + +.navbar-dark .navbar-toggler { + color: rgba(255, 255, 255, 0.5); + border-color: rgba(255, 255, 255, 0.1); +} + +.navbar-dark .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-dark .navbar-text { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-text a { + color: #fff; +} + +.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus { + color: #fff; +} + +.card { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + min-width: 0; + word-wrap: break-word; + background-color: #fff; + background-clip: border-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.card > hr { + margin-right: 0; + margin-left: 0; +} + +.card > .list-group:first-child .list-group-item:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.card > .list-group:last-child .list-group-item:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1.5rem; +} + +.card-title { + margin-bottom: 1.5rem; +} + +.card-subtitle { + margin-top: -0.75rem; + margin-bottom: 0; +} + +.card-text:last-child { + margin-bottom: 0; +} + +.card-link:hover { + text-decoration: none; +} + +.card-link + .card-link { + margin-left: 1.5rem; +} + +.card-header { + padding: 1.5rem 1.5rem; + margin-bottom: 0; + background-color: rgba(0, 0, 0, 0.03); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-header:first-child { + border-radius: calc(3px - 1px) calc(3px - 1px) 0 0; +} + +.card-header + .list-group .list-group-item:first-child { + border-top: 0; +} + +.card-footer { + padding: 1.5rem 1.5rem; + background-color: rgba(0, 0, 0, 0.03); + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-footer:last-child { + border-radius: 0 0 calc(3px - 1px) calc(3px - 1px); +} + +.card-header-tabs { + margin-right: -0.75rem; + margin-bottom: -1.5rem; + margin-left: -0.75rem; + border-bottom: 0; +} + +.card-header-pills { + margin-right: -0.75rem; + margin-left: -0.75rem; +} + +.card-img-overlay { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + padding: 1.25rem; +} + +.card-img { + width: 100%; + border-radius: calc(3px - 1px); +} + +.card-img-top { + width: 100%; + border-top-left-radius: calc(3px - 1px); + border-top-right-radius: calc(3px - 1px); +} + +.card-img-bottom { + width: 100%; + border-bottom-right-radius: calc(3px - 1px); + border-bottom-left-radius: calc(3px - 1px); +} + +.card-deck { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-deck .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-deck { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + margin-right: -0.75rem; + margin-left: -0.75rem; + } + .card-deck .card { + display: -ms-flexbox; + display: flex; + -ms-flex: 1 0 0%; + flex: 1 0 0%; + -ms-flex-direction: column; + flex-direction: column; + margin-right: 0.75rem; + margin-bottom: 0; + margin-left: 0.75rem; + } +} + +.card-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-group > .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-group { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + } + .card-group > .card { + -ms-flex: 1 0 0%; + flex: 1 0 0%; + margin-bottom: 0; + } + .card-group > .card + .card { + margin-left: 0; + border-left: 0; + } + .card-group > .card:first-child { + border-top-right-radius: 0; + border-bottom-right-radius: 0; + } + .card-group > .card:first-child .card-img-top, + .card-group > .card:first-child .card-header { + border-top-right-radius: 0; + } + .card-group > .card:first-child .card-img-bottom, + .card-group > .card:first-child .card-footer { + border-bottom-right-radius: 0; + } + .card-group > .card:last-child { + border-top-left-radius: 0; + border-bottom-left-radius: 0; + } + .card-group > .card:last-child .card-img-top, + .card-group > .card:last-child .card-header { + border-top-left-radius: 0; + } + .card-group > .card:last-child .card-img-bottom, + .card-group > .card:last-child .card-footer { + border-bottom-left-radius: 0; + } + .card-group > .card:only-child { + border-radius: 3px; + } + .card-group > .card:only-child .card-img-top, + .card-group > .card:only-child .card-header { + border-top-left-radius: 3px; + border-top-right-radius: 3px; + } + .card-group > .card:only-child .card-img-bottom, + .card-group > .card:only-child .card-footer { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) { + border-radius: 0; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer { + border-radius: 0; + } +} + +.card-columns .card { + margin-bottom: 1.5rem; +} + +@media (min-width: 576px) { + .card-columns { + -webkit-column-count: 3; + -moz-column-count: 3; + column-count: 3; + -webkit-column-gap: 1.25rem; + -moz-column-gap: 1.25rem; + column-gap: 1.25rem; + orphans: 1; + widows: 1; + } + .card-columns .card { + display: inline-block; + width: 100%; + } +} + +.accordion .card:not(:first-of-type):not(:last-of-type) { + border-bottom: 0; + border-radius: 0; +} + +.accordion .card:not(:first-of-type) .card-header:first-child { + border-radius: 0; +} + +.accordion .card:first-of-type { + border-bottom: 0; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.accordion .card:last-of-type { + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.breadcrumb { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding: 0.75rem 1rem; + margin-bottom: 1rem; + list-style: none; + background-color: #e9ecef; + border-radius: 3px; +} + +.breadcrumb-item + .breadcrumb-item { + padding-left: 0.5rem; +} + +.breadcrumb-item + .breadcrumb-item::before { + display: inline-block; + padding-right: 0.5rem; + color: #868e96; + content: "/"; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: underline; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: none; +} + +.breadcrumb-item.active { + color: #868e96; +} + +.pagination { + display: -ms-flexbox; + display: flex; + padding-left: 0; + list-style: none; + border-radius: 3px; +} + +.page-link { + position: relative; + display: block; + padding: 0.5rem 0.75rem; + margin-left: -1px; + line-height: 1.25; + color: #495057; + background-color: #fff; + border: 1px solid #dee2e6; +} + +.page-link:hover { + z-index: 2; + color: #295a9f; + text-decoration: none; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.page-link:focus { + z-index: 2; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.page-link:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.page-item:first-child .page-link { + margin-left: 0; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.page-item.active .page-link { + z-index: 1; + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.page-item.disabled .page-link { + color: #ced4da; + pointer-events: none; + cursor: auto; + background-color: #fff; + border-color: #dee2e6; +} + +.pagination-lg .page-link { + padding: 0.75rem 1.5rem; + font-size: 1.125rem; + line-height: 1.5; +} + +.pagination-lg .page-item:first-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-lg .page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pagination-sm .page-link { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.5; +} + +.pagination-sm .page-item:first-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-sm .page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.badge { + display: inline-block; + padding: 0.25em 0.4em; + font-size: 75%; + font-weight: 600; + line-height: 1; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: 3px; +} + +.badge:empty { + display: none; +} + +.btn .badge { + position: relative; + top: -1px; +} + +.badge-pill { + padding-right: 0.6em; + padding-left: 0.6em; + border-radius: 10rem; +} + +.badge-primary { + color: #fff; + background-color: #467fcf; +} + +.badge-primary[href]:hover, .badge-primary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #2f66b3; +} + +.badge-secondary { + color: #fff; + background-color: #868e96; +} + +.badge-secondary[href]:hover, .badge-secondary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #6c757d; +} + +.badge-success { + color: #fff; + background-color: #5eba00; +} + +.badge-success[href]:hover, .badge-success[href]:focus { + color: #fff; + text-decoration: none; + background-color: #448700; +} + +.badge-info { + color: #fff; + background-color: #45aaf2; +} + +.badge-info[href]:hover, .badge-info[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1594ef; +} + +.badge-warning { + color: #fff; + background-color: #f1c40f; +} + +.badge-warning[href]:hover, .badge-warning[href]:focus { + color: #fff; + text-decoration: none; + background-color: #c29d0b; +} + +.badge-danger { + color: #fff; + background-color: #cd201f; +} + +.badge-danger[href]:hover, .badge-danger[href]:focus { + color: #fff; + text-decoration: none; + background-color: #a11918; +} + +.badge-light { + color: #495057; + background-color: #f8f9fa; +} + +.badge-light[href]:hover, .badge-light[href]:focus { + color: #495057; + text-decoration: none; + background-color: #dae0e5; +} + +.badge-dark { + color: #fff; + background-color: #343a40; +} + +.badge-dark[href]:hover, .badge-dark[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1d2124; +} + +.jumbotron { + padding: 2rem 1rem; + margin-bottom: 2rem; + background-color: #e9ecef; + border-radius: 3px; +} + +@media (min-width: 576px) { + .jumbotron { + padding: 4rem 2rem; + } +} + +.jumbotron-fluid { + padding-right: 0; + padding-left: 0; + border-radius: 0; +} + +.alert { + position: relative; + padding: 0.75rem 1.25rem; + margin-bottom: 1rem; + border: 1px solid transparent; + border-radius: 3px; +} + +.alert-heading { + color: inherit; +} + +.alert-link { + font-weight: 600; +} + +.alert-dismissible { + padding-right: 3.90625rem; +} + +.alert-dismissible .close { + position: absolute; + top: 0; + right: 0; + padding: 0.75rem 1.25rem; + color: inherit; +} + +.alert-primary { + color: #24426c; + background-color: #dae5f5; + border-color: #cbdbf2; +} + +.alert-primary hr { + border-top-color: #b7cded; +} + +.alert-primary .alert-link { + color: #172b46; +} + +.alert-secondary { + color: #464a4e; + background-color: #e7e8ea; + border-color: #dddfe2; +} + +.alert-secondary hr { + border-top-color: #cfd2d6; +} + +.alert-secondary .alert-link { + color: #2e3133; +} + +.alert-success { + color: #316100; + background-color: #dff1cc; + border-color: #d2ecb8; +} + +.alert-success hr { + border-top-color: #c5e7a4; +} + +.alert-success .alert-link { + color: #172e00; +} + +.alert-info { + color: #24587e; + background-color: #daeefc; + border-color: #cbe7fb; +} + +.alert-info hr { + border-top-color: #b3dcf9; +} + +.alert-info .alert-link { + color: #193c56; +} + +.alert-warning { + color: #7d6608; + background-color: #fcf3cf; + border-color: #fbeebc; +} + +.alert-warning hr { + border-top-color: #fae8a4; +} + +.alert-warning .alert-link { + color: #4d3f05; +} + +.alert-danger { + color: #6b1110; + background-color: #f5d2d2; + border-color: #f1c1c0; +} + +.alert-danger hr { + border-top-color: #ecacab; +} + +.alert-danger .alert-link { + color: #3f0a09; +} + +.alert-light { + color: #818182; + background-color: #fefefe; + border-color: #fdfdfe; +} + +.alert-light hr { + border-top-color: #ececf6; +} + +.alert-light .alert-link { + color: #686868; +} + +.alert-dark { + color: #1b1e21; + background-color: #d6d8d9; + border-color: #c6c8ca; +} + +.alert-dark hr { + border-top-color: #b9bbbe; +} + +.alert-dark .alert-link { + color: #040505; +} + +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 0 0; + } +} + +@keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 0 0; + } +} + +.progress { + display: -ms-flexbox; + display: flex; + height: 1rem; + overflow: hidden; + font-size: 0.703125rem; + background-color: #e9ecef; + border-radius: 3px; +} + +.progress-bar { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + color: #fff; + text-align: center; + white-space: nowrap; + background-color: #467fcf; + transition: width 0.6s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .progress-bar { + transition: none; + } +} + +.progress-bar-striped { + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: 1rem 1rem; +} + +.progress-bar-animated { + -webkit-animation: progress-bar-stripes 1s linear infinite; + animation: progress-bar-stripes 1s linear infinite; +} + +.media { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; +} + +.media-body { + -ms-flex: 1; + flex: 1; +} + +.list-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; +} + +.list-group-item-action { + width: 100%; + color: #495057; + text-align: inherit; +} + +.list-group-item-action:hover, .list-group-item-action:focus { + color: #495057; + text-decoration: none; + background-color: #f8f9fa; +} + +.list-group-item-action:active { + color: #495057; + background-color: #e9ecef; +} + +.list-group-item { + position: relative; + display: block; + padding: 0.75rem 1.25rem; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.list-group-item:hover, .list-group-item:focus { + z-index: 1; + text-decoration: none; +} + +.list-group-item.disabled, .list-group-item:disabled { + color: #868e96; + background-color: #fff; +} + +.list-group-item.active { + z-index: 2; + color: #467fcf; + background-color: #f8fafd; + border-color: rgba(0, 40, 100, 0.12); +} + +.list-group-flush .list-group-item { + border-right: 0; + border-left: 0; + border-radius: 0; +} + +.list-group-flush:first-child .list-group-item:first-child { + border-top: 0; +} + +.list-group-flush:last-child .list-group-item:last-child { + border-bottom: 0; +} + +.list-group-item-primary { + color: #24426c; + background-color: #cbdbf2; +} + +.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { + color: #24426c; + background-color: #b7cded; +} + +.list-group-item-primary.list-group-item-action.active { + color: #fff; + background-color: #24426c; + border-color: #24426c; +} + +.list-group-item-secondary { + color: #464a4e; + background-color: #dddfe2; +} + +.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { + color: #464a4e; + background-color: #cfd2d6; +} + +.list-group-item-secondary.list-group-item-action.active { + color: #fff; + background-color: #464a4e; + border-color: #464a4e; +} + +.list-group-item-success { + color: #316100; + background-color: #d2ecb8; +} + +.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { + color: #316100; + background-color: #c5e7a4; +} + +.list-group-item-success.list-group-item-action.active { + color: #fff; + background-color: #316100; + border-color: #316100; +} + +.list-group-item-info { + color: #24587e; + background-color: #cbe7fb; +} + +.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { + color: #24587e; + background-color: #b3dcf9; +} + +.list-group-item-info.list-group-item-action.active { + color: #fff; + background-color: #24587e; + border-color: #24587e; +} + +.list-group-item-warning { + color: #7d6608; + background-color: #fbeebc; +} + +.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { + color: #7d6608; + background-color: #fae8a4; +} + +.list-group-item-warning.list-group-item-action.active { + color: #fff; + background-color: #7d6608; + border-color: #7d6608; +} + +.list-group-item-danger { + color: #6b1110; + background-color: #f1c1c0; +} + +.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { + color: #6b1110; + background-color: #ecacab; +} + +.list-group-item-danger.list-group-item-action.active { + color: #fff; + background-color: #6b1110; + border-color: #6b1110; +} + +.list-group-item-light { + color: #818182; + background-color: #fdfdfe; +} + +.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { + color: #818182; + background-color: #ececf6; +} + +.list-group-item-light.list-group-item-action.active { + color: #fff; + background-color: #818182; + border-color: #818182; +} + +.list-group-item-dark { + color: #1b1e21; + background-color: #c6c8ca; +} + +.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { + color: #1b1e21; + background-color: #b9bbbe; +} + +.list-group-item-dark.list-group-item-action.active { + color: #fff; + background-color: #1b1e21; + border-color: #1b1e21; +} + +.close { + float: right; + font-size: 1.40625rem; + font-weight: 700; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + opacity: .5; +} + +.close:hover, .close:focus { + color: #000; + text-decoration: none; + opacity: .75; +} + +.close:not(:disabled):not(.disabled) { + cursor: pointer; +} + +button.close { + padding: 0; + background-color: transparent; + border: 0; + -webkit-appearance: none; +} + +.modal-open { + overflow: hidden; +} + +.modal { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1050; + display: none; + overflow: hidden; + outline: 0; +} + +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} + +.modal-dialog { + position: relative; + width: auto; + margin: 0.5rem; + pointer-events: none; +} + +.modal.fade .modal-dialog { + transition: -webkit-transform 0.3s ease-out; + transition: transform 0.3s ease-out; + transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out; + -webkit-transform: translate(0, -25%); + transform: translate(0, -25%); +} + +@media screen and (prefers-reduced-motion: reduce) { + .modal.fade .modal-dialog { + transition: none; + } +} + +.modal.show .modal-dialog { + -webkit-transform: translate(0, 0); + transform: translate(0, 0); +} + +.modal-dialog-centered { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + min-height: calc(100% - (0.5rem * 2)); +} + +.modal-content { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + width: 100%; + pointer-events: auto; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 0, 0, 0.2); + border-radius: 3px; + outline: 0; +} + +.modal-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1040; + background-color: #000; +} + +.modal-backdrop.fade { + opacity: 0; +} + +.modal-backdrop.show { + opacity: 0.5; +} + +.modal-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 1rem; + border-bottom: 1px solid #e9ecef; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.modal-header .close { + padding: 1rem; + margin: -1rem -1rem -1rem auto; +} + +.modal-title { + margin-bottom: 0; + line-height: 1.5; +} + +.modal-body { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1rem; +} + +.modal-footer { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: end; + justify-content: flex-end; + padding: 1rem; + border-top: 1px solid #e9ecef; +} + +.modal-footer > :not(:first-child) { + margin-left: .25rem; +} + +.modal-footer > :not(:last-child) { + margin-right: .25rem; +} + +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} + +@media (min-width: 576px) { + .modal-dialog { + max-width: 500px; + margin: 1.75rem auto; + } + .modal-dialog-centered { + min-height: calc(100% - (1.75rem * 2)); + } + .modal-sm { + max-width: 300px; + } +} + +@media (min-width: 992px) { + .modal-lg { + max-width: 800px; + } +} + +.tooltip { + position: absolute; + z-index: 1070; + display: block; + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + opacity: 0; +} + +.tooltip.show { + opacity: 0.9; +} + +.tooltip .arrow { + position: absolute; + display: block; + width: 0.8rem; + height: 0.4rem; +} + +.tooltip .arrow::before { + position: absolute; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] { + padding: 0.4rem 0; +} + +.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow { + bottom: 0; +} + +.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before { + top: 0; + border-width: 0.4rem 0.4rem 0; + border-top-color: #000; +} + +.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] { + padding: 0 0.4rem; +} + +.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow { + left: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before { + right: 0; + border-width: 0.4rem 0.4rem 0.4rem 0; + border-right-color: #000; +} + +.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] { + padding: 0.4rem 0; +} + +.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow { + top: 0; +} + +.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before { + bottom: 0; + border-width: 0 0.4rem 0.4rem; + border-bottom-color: #000; +} + +.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] { + padding: 0 0.4rem; +} + +.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow { + right: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before { + left: 0; + border-width: 0.4rem 0 0.4rem 0.4rem; + border-left-color: #000; +} + +.tooltip-inner { + max-width: 200px; + padding: 0.25rem 0.5rem; + color: #fff; + text-align: center; + background-color: #000; + border-radius: 3px; +} + +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1060; + display: block; + max-width: 276px; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #dee3eb; + border-radius: 3px; +} + +.popover .arrow { + position: absolute; + display: block; + width: 0.5rem; + height: 0.5rem; + margin: 0 3px; +} + +.popover .arrow::before, .popover .arrow::after { + position: absolute; + display: block; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-popover-top, .bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.5rem; +} + +.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow { + bottom: calc((0.5rem + 1px) * -1); +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before, +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + border-width: 0.5rem 0.25rem 0; +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before { + bottom: 0; + border-top-color: #dee3eb; +} + + +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + bottom: 1px; + border-top-color: #fff; +} + +.bs-popover-right, .bs-popover-auto[x-placement^="right"] { + margin-left: 0.5rem; +} + +.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow { + left: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before, +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + border-width: 0.25rem 0.5rem 0.25rem 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before { + left: 0; + border-right-color: #dee3eb; +} + + +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + left: 1px; + border-right-color: #fff; +} + +.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] { + margin-top: 0.5rem; +} + +.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow { + top: calc((0.5rem + 1px) * -1); +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before, +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + border-width: 0 0.25rem 0.5rem 0.25rem; +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before { + top: 0; + border-bottom-color: #dee3eb; +} + + +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + top: 1px; + border-bottom-color: #fff; +} + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before { + position: absolute; + top: 0; + left: 50%; + display: block; + width: 0.5rem; + margin-left: -0.25rem; + content: ""; + border-bottom: 1px solid #f7f7f7; +} + +.bs-popover-left, .bs-popover-auto[x-placement^="left"] { + margin-right: 0.5rem; +} + +.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow { + right: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before, +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + border-width: 0.25rem 0 0.25rem 0.5rem; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before { + right: 0; + border-left-color: #dee3eb; +} + + +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + right: 1px; + border-left-color: #fff; +} + +.popover-header { + padding: 0.5rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + color: inherit; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-top-left-radius: calc(3px - 1px); + border-top-right-radius: calc(3px - 1px); +} + +.popover-header:empty { + display: none; +} + +.popover-body { + padding: 0.75rem 1rem; + color: #6e7687; +} + +.carousel { + position: relative; +} + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; +} + +.carousel-item { + position: relative; + display: none; + -ms-flex-align: center; + align-items: center; + width: 100%; + transition: -webkit-transform 0.6s ease; + transition: transform 0.6s ease; + transition: transform 0.6s ease, -webkit-transform 0.6s ease; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000px; + perspective: 1000px; +} + +@media screen and (prefers-reduced-motion: reduce) { + .carousel-item { + transition: none; + } +} + +.carousel-item.active, +.carousel-item-next, +.carousel-item-prev { + display: block; +} + +.carousel-item-next, +.carousel-item-prev { + position: absolute; + top: 0; +} + +.carousel-item-next.carousel-item-left, +.carousel-item-prev.carousel-item-right { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next.carousel-item-left, + .carousel-item-prev.carousel-item-right { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-item-next, +.active.carousel-item-right { + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next, + .active.carousel-item-right { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +.carousel-item-prev, +.active.carousel-item-left { + -webkit-transform: translateX(-100%); + transform: translateX(-100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-prev, + .active.carousel-item-left { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +.carousel-fade .carousel-item { + opacity: 0; + transition-duration: .6s; + transition-property: opacity; +} + +.carousel-fade .carousel-item.active, +.carousel-fade .carousel-item-next.carousel-item-left, +.carousel-fade .carousel-item-prev.carousel-item-right { + opacity: 1; +} + +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-right { + opacity: 0; +} + +.carousel-fade .carousel-item-next, +.carousel-fade .carousel-item-prev, +.carousel-fade .carousel-item.active, +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-prev { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-fade .carousel-item-next, + .carousel-fade .carousel-item-prev, + .carousel-fade .carousel-item.active, + .carousel-fade .active.carousel-item-left, + .carousel-fade .active.carousel-item-prev { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-control-prev, +.carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: 15%; + color: #fff; + text-align: center; + opacity: 0.5; +} + +.carousel-control-prev:hover, .carousel-control-prev:focus, +.carousel-control-next:hover, +.carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity: .9; +} + +.carousel-control-prev { + left: 0; +} + +.carousel-control-next { + right: 0; +} + +.carousel-control-prev-icon, +.carousel-control-next-icon { + display: inline-block; + width: 20px; + height: 20px; + background: transparent no-repeat center center; + background-size: 100% 100%; +} + +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E"); +} + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E"); +} + +.carousel-indicators { + position: absolute; + right: 0; + bottom: 10px; + left: 0; + z-index: 15; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + padding-left: 0; + margin-right: 15%; + margin-left: 15%; + list-style: none; +} + +.carousel-indicators li { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; + width: 30px; + height: 3px; + margin-right: 3px; + margin-left: 3px; + text-indent: -999px; + background-color: rgba(255, 255, 255, 0.5); +} + +.carousel-indicators li::before { + position: absolute; + top: -10px; + left: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators li::after { + position: absolute; + bottom: -10px; + left: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators .active { + background-color: #fff; +} + +.carousel-caption { + position: absolute; + right: 15%; + bottom: 20px; + left: 15%; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; +} + +.align-baseline { + vertical-align: baseline !important; +} + +.align-top { + vertical-align: top !important; +} + +.align-middle { + vertical-align: middle !important; +} + +.align-bottom { + vertical-align: bottom !important; +} + +.align-text-bottom { + vertical-align: text-bottom !important; +} + +.align-text-top { + vertical-align: text-top !important; +} + +.bg-primary { + background-color: #467fcf !important; +} + +a.bg-primary:hover, a.bg-primary:focus, +button.bg-primary:hover, +button.bg-primary:focus { + background-color: #2f66b3 !important; +} + +.bg-secondary { + background-color: #868e96 !important; +} + +a.bg-secondary:hover, a.bg-secondary:focus, +button.bg-secondary:hover, +button.bg-secondary:focus { + background-color: #6c757d !important; +} + +.bg-success { + background-color: #5eba00 !important; +} + +a.bg-success:hover, a.bg-success:focus, +button.bg-success:hover, +button.bg-success:focus { + background-color: #448700 !important; +} + +.bg-info { + background-color: #45aaf2 !important; +} + +a.bg-info:hover, a.bg-info:focus, +button.bg-info:hover, +button.bg-info:focus { + background-color: #1594ef !important; +} + +.bg-warning { + background-color: #f1c40f !important; +} + +a.bg-warning:hover, a.bg-warning:focus, +button.bg-warning:hover, +button.bg-warning:focus { + background-color: #c29d0b !important; +} + +.bg-danger { + background-color: #cd201f !important; +} + +a.bg-danger:hover, a.bg-danger:focus, +button.bg-danger:hover, +button.bg-danger:focus { + background-color: #a11918 !important; +} + +.bg-light { + background-color: #f8f9fa !important; +} + +a.bg-light:hover, a.bg-light:focus, +button.bg-light:hover, +button.bg-light:focus { + background-color: #dae0e5 !important; +} + +.bg-dark { + background-color: #343a40 !important; +} + +a.bg-dark:hover, a.bg-dark:focus, +button.bg-dark:hover, +button.bg-dark:focus { + background-color: #1d2124 !important; +} + +.bg-white { + background-color: #fff !important; +} + +.bg-transparent { + background-color: transparent !important; +} + +.border { + border: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-top { + border-top: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-right { + border-right: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-bottom { + border-bottom: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-left { + border-left: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-0 { + border: 0 !important; +} + +.border-top-0 { + border-top: 0 !important; +} + +.border-right-0 { + border-right: 0 !important; +} + +.border-bottom-0 { + border-bottom: 0 !important; +} + +.border-left-0 { + border-left: 0 !important; +} + +.border-primary { + border-color: #467fcf !important; +} + +.border-secondary { + border-color: #868e96 !important; +} + +.border-success { + border-color: #5eba00 !important; +} + +.border-info { + border-color: #45aaf2 !important; +} + +.border-warning { + border-color: #f1c40f !important; +} + +.border-danger { + border-color: #cd201f !important; +} + +.border-light { + border-color: #f8f9fa !important; +} + +.border-dark { + border-color: #343a40 !important; +} + +.border-white { + border-color: #fff !important; +} + +.rounded { + border-radius: 3px !important; +} + +.rounded-top { + border-top-left-radius: 3px !important; + border-top-right-radius: 3px !important; +} + +.rounded-right { + border-top-right-radius: 3px !important; + border-bottom-right-radius: 3px !important; +} + +.rounded-bottom { + border-bottom-right-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-left { + border-top-left-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-circle { + border-radius: 50% !important; +} + +.rounded-0 { + border-radius: 0 !important; +} + +.clearfix::after { + display: block; + clear: both; + content: ""; +} + +.d-none { + display: none !important; +} + +.d-inline { + display: inline !important; +} + +.d-inline-block { + display: inline-block !important; +} + +.d-block { + display: block !important; +} + +.d-table { + display: table !important; +} + +.d-table-row { + display: table-row !important; +} + +.d-table-cell { + display: table-cell !important; +} + +.d-flex { + display: -ms-flexbox !important; + display: flex !important; +} + +.d-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; +} + +@media (min-width: 576px) { + .d-sm-none { + display: none !important; + } + .d-sm-inline { + display: inline !important; + } + .d-sm-inline-block { + display: inline-block !important; + } + .d-sm-block { + display: block !important; + } + .d-sm-table { + display: table !important; + } + .d-sm-table-row { + display: table-row !important; + } + .d-sm-table-cell { + display: table-cell !important; + } + .d-sm-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-sm-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 768px) { + .d-md-none { + display: none !important; + } + .d-md-inline { + display: inline !important; + } + .d-md-inline-block { + display: inline-block !important; + } + .d-md-block { + display: block !important; + } + .d-md-table { + display: table !important; + } + .d-md-table-row { + display: table-row !important; + } + .d-md-table-cell { + display: table-cell !important; + } + .d-md-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-md-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 992px) { + .d-lg-none { + display: none !important; + } + .d-lg-inline { + display: inline !important; + } + .d-lg-inline-block { + display: inline-block !important; + } + .d-lg-block { + display: block !important; + } + .d-lg-table { + display: table !important; + } + .d-lg-table-row { + display: table-row !important; + } + .d-lg-table-cell { + display: table-cell !important; + } + .d-lg-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-lg-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 1280px) { + .d-xl-none { + display: none !important; + } + .d-xl-inline { + display: inline !important; + } + .d-xl-inline-block { + display: inline-block !important; + } + .d-xl-block { + display: block !important; + } + .d-xl-table { + display: table !important; + } + .d-xl-table-row { + display: table-row !important; + } + .d-xl-table-cell { + display: table-cell !important; + } + .d-xl-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-xl-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media print { + .d-print-none { + display: none !important; + } + .d-print-inline { + display: inline !important; + } + .d-print-inline-block { + display: inline-block !important; + } + .d-print-block { + display: block !important; + } + .d-print-table { + display: table !important; + } + .d-print-table-row { + display: table-row !important; + } + .d-print-table-cell { + display: table-cell !important; + } + .d-print-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-print-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +.embed-responsive { + position: relative; + display: block; + width: 100%; + padding: 0; + overflow: hidden; +} + +.embed-responsive::before { + display: block; + content: ""; +} + +.embed-responsive .embed-responsive-item, +.embed-responsive iframe, +.embed-responsive embed, +.embed-responsive object, +.embed-responsive video { + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 100%; + height: 100%; + border: 0; +} + +.embed-responsive-21by9::before { + padding-top: 42.85714286%; +} + +.embed-responsive-16by9::before { + padding-top: 56.25%; +} + +.embed-responsive-4by3::before { + padding-top: 75%; +} + +.embed-responsive-1by1::before { + padding-top: 100%; +} + +.flex-row { + -ms-flex-direction: row !important; + flex-direction: row !important; +} + +.flex-column { + -ms-flex-direction: column !important; + flex-direction: column !important; +} + +.flex-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; +} + +.flex-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; +} + +.flex-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; +} + +.flex-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; +} + +.flex-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; +} + +.flex-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; +} + +.flex-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; +} + +.flex-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; +} + +.flex-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; +} + +.flex-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; +} + +.justify-content-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; +} + +.justify-content-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; +} + +.justify-content-center { + -ms-flex-pack: center !important; + justify-content: center !important; +} + +.justify-content-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; +} + +.justify-content-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; +} + +.align-items-start { + -ms-flex-align: start !important; + align-items: flex-start !important; +} + +.align-items-end { + -ms-flex-align: end !important; + align-items: flex-end !important; +} + +.align-items-center { + -ms-flex-align: center !important; + align-items: center !important; +} + +.align-items-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; +} + +.align-items-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; +} + +.align-content-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; +} + +.align-content-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; +} + +.align-content-center { + -ms-flex-line-pack: center !important; + align-content: center !important; +} + +.align-content-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; +} + +.align-content-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; +} + +.align-content-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; +} + +.align-self-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; +} + +.align-self-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; +} + +.align-self-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; +} + +.align-self-center { + -ms-flex-item-align: center !important; + align-self: center !important; +} + +.align-self-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; +} + +.align-self-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; +} + +@media (min-width: 576px) { + .flex-sm-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-sm-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-sm-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-sm-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-sm-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-sm-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-sm-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-sm-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-sm-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-sm-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-sm-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-sm-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-sm-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-sm-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-sm-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-sm-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-sm-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-sm-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-sm-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-sm-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-sm-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-sm-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-sm-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-sm-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-sm-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-sm-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-sm-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-sm-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-sm-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-sm-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-sm-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-sm-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-sm-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-sm-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 768px) { + .flex-md-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-md-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-md-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-md-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-md-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-md-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-md-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-md-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-md-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-md-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-md-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-md-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-md-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-md-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-md-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-md-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-md-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-md-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-md-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-md-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-md-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-md-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-md-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-md-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-md-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-md-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-md-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-md-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-md-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-md-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-md-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-md-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-md-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-md-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 992px) { + .flex-lg-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-lg-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-lg-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-lg-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-lg-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-lg-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-lg-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-lg-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-lg-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-lg-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-lg-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-lg-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-lg-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-lg-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-lg-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-lg-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-lg-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-lg-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-lg-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-lg-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-lg-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-lg-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-lg-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-lg-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-lg-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-lg-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-lg-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-lg-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-lg-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-lg-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-lg-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-lg-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-lg-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-lg-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 1280px) { + .flex-xl-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-xl-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-xl-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-xl-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-xl-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-xl-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-xl-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-xl-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-xl-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-xl-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-xl-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-xl-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-xl-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-xl-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-xl-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-xl-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-xl-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-xl-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-xl-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-xl-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-xl-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-xl-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-xl-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-xl-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-xl-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-xl-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-xl-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-xl-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-xl-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-xl-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-xl-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-xl-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-xl-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-xl-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +.float-left { + float: left !important; +} + +.float-right { + float: right !important; +} + +.float-none { + float: none !important; +} + +@media (min-width: 576px) { + .float-sm-left { + float: left !important; + } + .float-sm-right { + float: right !important; + } + .float-sm-none { + float: none !important; + } +} + +@media (min-width: 768px) { + .float-md-left { + float: left !important; + } + .float-md-right { + float: right !important; + } + .float-md-none { + float: none !important; + } +} + +@media (min-width: 992px) { + .float-lg-left { + float: left !important; + } + .float-lg-right { + float: right !important; + } + .float-lg-none { + float: none !important; + } +} + +@media (min-width: 1280px) { + .float-xl-left { + float: left !important; + } + .float-xl-right { + float: right !important; + } + .float-xl-none { + float: none !important; + } +} + +.position-static { + position: static !important; +} + +.position-relative { + position: relative !important; +} + +.position-absolute { + position: absolute !important; +} + +.position-fixed { + position: fixed !important; +} + +.position-sticky { + position: -webkit-sticky !important; + position: sticky !important; +} + +.fixed-top { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index: 1030; +} + +.fixed-bottom { + position: fixed; + right: 0; + bottom: 0; + left: 0; + z-index: 1030; +} + +@supports ((position: -webkit-sticky) or (position: sticky)) { + .sticky-top { + position: -webkit-sticky; + position: sticky; + top: 0; + z-index: 1020; + } +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border: 0; +} + +.sr-only-focusable:active, .sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + overflow: visible; + clip: auto; + white-space: normal; +} + +.shadow-sm { + box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; +} + +.shadow { + box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; +} + +.shadow-lg { + box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.w-25 { + width: 25% !important; +} + +.w-50 { + width: 50% !important; +} + +.w-75 { + width: 75% !important; +} + +.w-100 { + width: 100% !important; +} + +.w-auto { + width: auto !important; +} + +.w-0 { + width: 0 !important; +} + +.w-1 { + width: 0.25rem !important; +} + +.w-2 { + width: 0.5rem !important; +} + +.w-3 { + width: 0.75rem !important; +} + +.w-4 { + width: 1rem !important; +} + +.w-5 { + width: 1.5rem !important; +} + +.w-6 { + width: 2rem !important; +} + +.w-7 { + width: 3rem !important; +} + +.w-8 { + width: 4rem !important; +} + +.w-9 { + width: 6rem !important; +} + +.h-25 { + height: 25% !important; +} + +.h-50 { + height: 50% !important; +} + +.h-75 { + height: 75% !important; +} + +.h-100 { + height: 100% !important; +} + +.h-auto { + height: auto !important; +} + +.h-0 { + height: 0 !important; +} + +.h-1 { + height: 0.25rem !important; +} + +.h-2 { + height: 0.5rem !important; +} + +.h-3 { + height: 0.75rem !important; +} + +.h-4 { + height: 1rem !important; +} + +.h-5 { + height: 1.5rem !important; +} + +.h-6 { + height: 2rem !important; +} + +.h-7 { + height: 3rem !important; +} + +.h-8 { + height: 4rem !important; +} + +.h-9 { + height: 6rem !important; +} + +.mw-100 { + max-width: 100% !important; +} + +.mh-100 { + max-height: 100% !important; +} + +.m-0 { + margin: 0 !important; +} + +.mt-0, +.my-0 { + margin-top: 0 !important; +} + +.mr-0, +.mx-0 { + margin-right: 0 !important; +} + +.mb-0, +.my-0 { + margin-bottom: 0 !important; +} + +.ml-0, +.mx-0 { + margin-left: 0 !important; +} + +.m-1 { + margin: 0.25rem !important; +} + +.mt-1, +.my-1 { + margin-top: 0.25rem !important; +} + +.mr-1, +.mx-1 { + margin-right: 0.25rem !important; +} + +.mb-1, +.my-1 { + margin-bottom: 0.25rem !important; +} + +.ml-1, +.mx-1 { + margin-left: 0.25rem !important; +} + +.m-2 { + margin: 0.5rem !important; +} + +.mt-2, +.my-2 { + margin-top: 0.5rem !important; +} + +.mr-2, +.mx-2 { + margin-right: 0.5rem !important; +} + +.mb-2, +.my-2 { + margin-bottom: 0.5rem !important; +} + +.ml-2, +.mx-2 { + margin-left: 0.5rem !important; +} + +.m-3 { + margin: 0.75rem !important; +} + +.mt-3, +.my-3 { + margin-top: 0.75rem !important; +} + +.mr-3, +.mx-3 { + margin-right: 0.75rem !important; +} + +.mb-3, +.my-3 { + margin-bottom: 0.75rem !important; +} + +.ml-3, +.mx-3 { + margin-left: 0.75rem !important; +} + +.m-4 { + margin: 1rem !important; +} + +.mt-4, +.my-4 { + margin-top: 1rem !important; +} + +.mr-4, +.mx-4 { + margin-right: 1rem !important; +} + +.mb-4, +.my-4 { + margin-bottom: 1rem !important; +} + +.ml-4, +.mx-4 { + margin-left: 1rem !important; +} + +.m-5 { + margin: 1.5rem !important; +} + +.mt-5, +.my-5 { + margin-top: 1.5rem !important; +} + +.mr-5, +.mx-5 { + margin-right: 1.5rem !important; +} + +.mb-5, +.my-5 { + margin-bottom: 1.5rem !important; +} + +.ml-5, +.mx-5 { + margin-left: 1.5rem !important; +} + +.m-6 { + margin: 2rem !important; +} + +.mt-6, +.my-6 { + margin-top: 2rem !important; +} + +.mr-6, +.mx-6 { + margin-right: 2rem !important; +} + +.mb-6, +.my-6 { + margin-bottom: 2rem !important; +} + +.ml-6, +.mx-6 { + margin-left: 2rem !important; +} + +.m-7 { + margin: 3rem !important; +} + +.mt-7, +.my-7 { + margin-top: 3rem !important; +} + +.mr-7, +.mx-7 { + margin-right: 3rem !important; +} + +.mb-7, +.my-7 { + margin-bottom: 3rem !important; +} + +.ml-7, +.mx-7 { + margin-left: 3rem !important; +} + +.m-8 { + margin: 4rem !important; +} + +.mt-8, +.my-8 { + margin-top: 4rem !important; +} + +.mr-8, +.mx-8 { + margin-right: 4rem !important; +} + +.mb-8, +.my-8 { + margin-bottom: 4rem !important; +} + +.ml-8, +.mx-8 { + margin-left: 4rem !important; +} + +.m-9 { + margin: 6rem !important; +} + +.mt-9, +.my-9 { + margin-top: 6rem !important; +} + +.mr-9, +.mx-9 { + margin-right: 6rem !important; +} + +.mb-9, +.my-9 { + margin-bottom: 6rem !important; +} + +.ml-9, +.mx-9 { + margin-left: 6rem !important; +} + +.p-0 { + padding: 0 !important; +} + +.pt-0, +.py-0 { + padding-top: 0 !important; +} + +.pr-0, +.px-0 { + padding-right: 0 !important; +} + +.pb-0, +.py-0 { + padding-bottom: 0 !important; +} + +.pl-0, +.px-0 { + padding-left: 0 !important; +} + +.p-1 { + padding: 0.25rem !important; +} + +.pt-1, +.py-1 { + padding-top: 0.25rem !important; +} + +.pr-1, +.px-1 { + padding-right: 0.25rem !important; +} + +.pb-1, +.py-1 { + padding-bottom: 0.25rem !important; +} + +.pl-1, +.px-1 { + padding-left: 0.25rem !important; +} + +.p-2 { + padding: 0.5rem !important; +} + +.pt-2, +.py-2 { + padding-top: 0.5rem !important; +} + +.pr-2, +.px-2 { + padding-right: 0.5rem !important; +} + +.pb-2, +.py-2 { + padding-bottom: 0.5rem !important; +} + +.pl-2, +.px-2 { + padding-left: 0.5rem !important; +} + +.p-3 { + padding: 0.75rem !important; +} + +.pt-3, +.py-3 { + padding-top: 0.75rem !important; +} + +.pr-3, +.px-3 { + padding-right: 0.75rem !important; +} + +.pb-3, +.py-3 { + padding-bottom: 0.75rem !important; +} + +.pl-3, +.px-3 { + padding-left: 0.75rem !important; +} + +.p-4 { + padding: 1rem !important; +} + +.pt-4, +.py-4 { + padding-top: 1rem !important; +} + +.pr-4, +.px-4 { + padding-right: 1rem !important; +} + +.pb-4, +.py-4 { + padding-bottom: 1rem !important; +} + +.pl-4, +.px-4 { + padding-left: 1rem !important; +} + +.p-5 { + padding: 1.5rem !important; +} + +.pt-5, +.py-5 { + padding-top: 1.5rem !important; +} + +.pr-5, +.px-5 { + padding-right: 1.5rem !important; +} + +.pb-5, +.py-5 { + padding-bottom: 1.5rem !important; +} + +.pl-5, +.px-5 { + padding-left: 1.5rem !important; +} + +.p-6 { + padding: 2rem !important; +} + +.pt-6, +.py-6 { + padding-top: 2rem !important; +} + +.pr-6, +.px-6 { + padding-right: 2rem !important; +} + +.pb-6, +.py-6 { + padding-bottom: 2rem !important; +} + +.pl-6, +.px-6 { + padding-left: 2rem !important; +} + +.p-7 { + padding: 3rem !important; +} + +.pt-7, +.py-7 { + padding-top: 3rem !important; +} + +.pr-7, +.px-7 { + padding-right: 3rem !important; +} + +.pb-7, +.py-7 { + padding-bottom: 3rem !important; +} + +.pl-7, +.px-7 { + padding-left: 3rem !important; +} + +.p-8 { + padding: 4rem !important; +} + +.pt-8, +.py-8 { + padding-top: 4rem !important; +} + +.pr-8, +.px-8 { + padding-right: 4rem !important; +} + +.pb-8, +.py-8 { + padding-bottom: 4rem !important; +} + +.pl-8, +.px-8 { + padding-left: 4rem !important; +} + +.p-9 { + padding: 6rem !important; +} + +.pt-9, +.py-9 { + padding-top: 6rem !important; +} + +.pr-9, +.px-9 { + padding-right: 6rem !important; +} + +.pb-9, +.py-9 { + padding-bottom: 6rem !important; +} + +.pl-9, +.px-9 { + padding-left: 6rem !important; +} + +.m-auto { + margin: auto !important; +} + +.mt-auto, +.my-auto { + margin-top: auto !important; +} + +.mr-auto, +.mx-auto { + margin-right: auto !important; +} + +.mb-auto, +.my-auto { + margin-bottom: auto !important; +} + +.ml-auto, +.mx-auto { + margin-left: auto !important; +} + +@media (min-width: 576px) { + .m-sm-0 { + margin: 0 !important; + } + .mt-sm-0, + .my-sm-0 { + margin-top: 0 !important; + } + .mr-sm-0, + .mx-sm-0 { + margin-right: 0 !important; + } + .mb-sm-0, + .my-sm-0 { + margin-bottom: 0 !important; + } + .ml-sm-0, + .mx-sm-0 { + margin-left: 0 !important; + } + .m-sm-1 { + margin: 0.25rem !important; + } + .mt-sm-1, + .my-sm-1 { + margin-top: 0.25rem !important; + } + .mr-sm-1, + .mx-sm-1 { + margin-right: 0.25rem !important; + } + .mb-sm-1, + .my-sm-1 { + margin-bottom: 0.25rem !important; + } + .ml-sm-1, + .mx-sm-1 { + margin-left: 0.25rem !important; + } + .m-sm-2 { + margin: 0.5rem !important; + } + .mt-sm-2, + .my-sm-2 { + margin-top: 0.5rem !important; + } + .mr-sm-2, + .mx-sm-2 { + margin-right: 0.5rem !important; + } + .mb-sm-2, + .my-sm-2 { + margin-bottom: 0.5rem !important; + } + .ml-sm-2, + .mx-sm-2 { + margin-left: 0.5rem !important; + } + .m-sm-3 { + margin: 0.75rem !important; + } + .mt-sm-3, + .my-sm-3 { + margin-top: 0.75rem !important; + } + .mr-sm-3, + .mx-sm-3 { + margin-right: 0.75rem !important; + } + .mb-sm-3, + .my-sm-3 { + margin-bottom: 0.75rem !important; + } + .ml-sm-3, + .mx-sm-3 { + margin-left: 0.75rem !important; + } + .m-sm-4 { + margin: 1rem !important; + } + .mt-sm-4, + .my-sm-4 { + margin-top: 1rem !important; + } + .mr-sm-4, + .mx-sm-4 { + margin-right: 1rem !important; + } + .mb-sm-4, + .my-sm-4 { + margin-bottom: 1rem !important; + } + .ml-sm-4, + .mx-sm-4 { + margin-left: 1rem !important; + } + .m-sm-5 { + margin: 1.5rem !important; + } + .mt-sm-5, + .my-sm-5 { + margin-top: 1.5rem !important; + } + .mr-sm-5, + .mx-sm-5 { + margin-right: 1.5rem !important; + } + .mb-sm-5, + .my-sm-5 { + margin-bottom: 1.5rem !important; + } + .ml-sm-5, + .mx-sm-5 { + margin-left: 1.5rem !important; + } + .m-sm-6 { + margin: 2rem !important; + } + .mt-sm-6, + .my-sm-6 { + margin-top: 2rem !important; + } + .mr-sm-6, + .mx-sm-6 { + margin-right: 2rem !important; + } + .mb-sm-6, + .my-sm-6 { + margin-bottom: 2rem !important; + } + .ml-sm-6, + .mx-sm-6 { + margin-left: 2rem !important; + } + .m-sm-7 { + margin: 3rem !important; + } + .mt-sm-7, + .my-sm-7 { + margin-top: 3rem !important; + } + .mr-sm-7, + .mx-sm-7 { + margin-right: 3rem !important; + } + .mb-sm-7, + .my-sm-7 { + margin-bottom: 3rem !important; + } + .ml-sm-7, + .mx-sm-7 { + margin-left: 3rem !important; + } + .m-sm-8 { + margin: 4rem !important; + } + .mt-sm-8, + .my-sm-8 { + margin-top: 4rem !important; + } + .mr-sm-8, + .mx-sm-8 { + margin-right: 4rem !important; + } + .mb-sm-8, + .my-sm-8 { + margin-bottom: 4rem !important; + } + .ml-sm-8, + .mx-sm-8 { + margin-left: 4rem !important; + } + .m-sm-9 { + margin: 6rem !important; + } + .mt-sm-9, + .my-sm-9 { + margin-top: 6rem !important; + } + .mr-sm-9, + .mx-sm-9 { + margin-right: 6rem !important; + } + .mb-sm-9, + .my-sm-9 { + margin-bottom: 6rem !important; + } + .ml-sm-9, + .mx-sm-9 { + margin-left: 6rem !important; + } + .p-sm-0 { + padding: 0 !important; + } + .pt-sm-0, + .py-sm-0 { + padding-top: 0 !important; + } + .pr-sm-0, + .px-sm-0 { + padding-right: 0 !important; + } + .pb-sm-0, + .py-sm-0 { + padding-bottom: 0 !important; + } + .pl-sm-0, + .px-sm-0 { + padding-left: 0 !important; + } + .p-sm-1 { + padding: 0.25rem !important; + } + .pt-sm-1, + .py-sm-1 { + padding-top: 0.25rem !important; + } + .pr-sm-1, + .px-sm-1 { + padding-right: 0.25rem !important; + } + .pb-sm-1, + .py-sm-1 { + padding-bottom: 0.25rem !important; + } + .pl-sm-1, + .px-sm-1 { + padding-left: 0.25rem !important; + } + .p-sm-2 { + padding: 0.5rem !important; + } + .pt-sm-2, + .py-sm-2 { + padding-top: 0.5rem !important; + } + .pr-sm-2, + .px-sm-2 { + padding-right: 0.5rem !important; + } + .pb-sm-2, + .py-sm-2 { + padding-bottom: 0.5rem !important; + } + .pl-sm-2, + .px-sm-2 { + padding-left: 0.5rem !important; + } + .p-sm-3 { + padding: 0.75rem !important; + } + .pt-sm-3, + .py-sm-3 { + padding-top: 0.75rem !important; + } + .pr-sm-3, + .px-sm-3 { + padding-right: 0.75rem !important; + } + .pb-sm-3, + .py-sm-3 { + padding-bottom: 0.75rem !important; + } + .pl-sm-3, + .px-sm-3 { + padding-left: 0.75rem !important; + } + .p-sm-4 { + padding: 1rem !important; + } + .pt-sm-4, + .py-sm-4 { + padding-top: 1rem !important; + } + .pr-sm-4, + .px-sm-4 { + padding-right: 1rem !important; + } + .pb-sm-4, + .py-sm-4 { + padding-bottom: 1rem !important; + } + .pl-sm-4, + .px-sm-4 { + padding-left: 1rem !important; + } + .p-sm-5 { + padding: 1.5rem !important; + } + .pt-sm-5, + .py-sm-5 { + padding-top: 1.5rem !important; + } + .pr-sm-5, + .px-sm-5 { + padding-right: 1.5rem !important; + } + .pb-sm-5, + .py-sm-5 { + padding-bottom: 1.5rem !important; + } + .pl-sm-5, + .px-sm-5 { + padding-left: 1.5rem !important; + } + .p-sm-6 { + padding: 2rem !important; + } + .pt-sm-6, + .py-sm-6 { + padding-top: 2rem !important; + } + .pr-sm-6, + .px-sm-6 { + padding-right: 2rem !important; + } + .pb-sm-6, + .py-sm-6 { + padding-bottom: 2rem !important; + } + .pl-sm-6, + .px-sm-6 { + padding-left: 2rem !important; + } + .p-sm-7 { + padding: 3rem !important; + } + .pt-sm-7, + .py-sm-7 { + padding-top: 3rem !important; + } + .pr-sm-7, + .px-sm-7 { + padding-right: 3rem !important; + } + .pb-sm-7, + .py-sm-7 { + padding-bottom: 3rem !important; + } + .pl-sm-7, + .px-sm-7 { + padding-left: 3rem !important; + } + .p-sm-8 { + padding: 4rem !important; + } + .pt-sm-8, + .py-sm-8 { + padding-top: 4rem !important; + } + .pr-sm-8, + .px-sm-8 { + padding-right: 4rem !important; + } + .pb-sm-8, + .py-sm-8 { + padding-bottom: 4rem !important; + } + .pl-sm-8, + .px-sm-8 { + padding-left: 4rem !important; + } + .p-sm-9 { + padding: 6rem !important; + } + .pt-sm-9, + .py-sm-9 { + padding-top: 6rem !important; + } + .pr-sm-9, + .px-sm-9 { + padding-right: 6rem !important; + } + .pb-sm-9, + .py-sm-9 { + padding-bottom: 6rem !important; + } + .pl-sm-9, + .px-sm-9 { + padding-left: 6rem !important; + } + .m-sm-auto { + margin: auto !important; + } + .mt-sm-auto, + .my-sm-auto { + margin-top: auto !important; + } + .mr-sm-auto, + .mx-sm-auto { + margin-right: auto !important; + } + .mb-sm-auto, + .my-sm-auto { + margin-bottom: auto !important; + } + .ml-sm-auto, + .mx-sm-auto { + margin-left: auto !important; + } +} + +@media (min-width: 768px) { + .m-md-0 { + margin: 0 !important; + } + .mt-md-0, + .my-md-0 { + margin-top: 0 !important; + } + .mr-md-0, + .mx-md-0 { + margin-right: 0 !important; + } + .mb-md-0, + .my-md-0 { + margin-bottom: 0 !important; + } + .ml-md-0, + .mx-md-0 { + margin-left: 0 !important; + } + .m-md-1 { + margin: 0.25rem !important; + } + .mt-md-1, + .my-md-1 { + margin-top: 0.25rem !important; + } + .mr-md-1, + .mx-md-1 { + margin-right: 0.25rem !important; + } + .mb-md-1, + .my-md-1 { + margin-bottom: 0.25rem !important; + } + .ml-md-1, + .mx-md-1 { + margin-left: 0.25rem !important; + } + .m-md-2 { + margin: 0.5rem !important; + } + .mt-md-2, + .my-md-2 { + margin-top: 0.5rem !important; + } + .mr-md-2, + .mx-md-2 { + margin-right: 0.5rem !important; + } + .mb-md-2, + .my-md-2 { + margin-bottom: 0.5rem !important; + } + .ml-md-2, + .mx-md-2 { + margin-left: 0.5rem !important; + } + .m-md-3 { + margin: 0.75rem !important; + } + .mt-md-3, + .my-md-3 { + margin-top: 0.75rem !important; + } + .mr-md-3, + .mx-md-3 { + margin-right: 0.75rem !important; + } + .mb-md-3, + .my-md-3 { + margin-bottom: 0.75rem !important; + } + .ml-md-3, + .mx-md-3 { + margin-left: 0.75rem !important; + } + .m-md-4 { + margin: 1rem !important; + } + .mt-md-4, + .my-md-4 { + margin-top: 1rem !important; + } + .mr-md-4, + .mx-md-4 { + margin-right: 1rem !important; + } + .mb-md-4, + .my-md-4 { + margin-bottom: 1rem !important; + } + .ml-md-4, + .mx-md-4 { + margin-left: 1rem !important; + } + .m-md-5 { + margin: 1.5rem !important; + } + .mt-md-5, + .my-md-5 { + margin-top: 1.5rem !important; + } + .mr-md-5, + .mx-md-5 { + margin-right: 1.5rem !important; + } + .mb-md-5, + .my-md-5 { + margin-bottom: 1.5rem !important; + } + .ml-md-5, + .mx-md-5 { + margin-left: 1.5rem !important; + } + .m-md-6 { + margin: 2rem !important; + } + .mt-md-6, + .my-md-6 { + margin-top: 2rem !important; + } + .mr-md-6, + .mx-md-6 { + margin-right: 2rem !important; + } + .mb-md-6, + .my-md-6 { + margin-bottom: 2rem !important; + } + .ml-md-6, + .mx-md-6 { + margin-left: 2rem !important; + } + .m-md-7 { + margin: 3rem !important; + } + .mt-md-7, + .my-md-7 { + margin-top: 3rem !important; + } + .mr-md-7, + .mx-md-7 { + margin-right: 3rem !important; + } + .mb-md-7, + .my-md-7 { + margin-bottom: 3rem !important; + } + .ml-md-7, + .mx-md-7 { + margin-left: 3rem !important; + } + .m-md-8 { + margin: 4rem !important; + } + .mt-md-8, + .my-md-8 { + margin-top: 4rem !important; + } + .mr-md-8, + .mx-md-8 { + margin-right: 4rem !important; + } + .mb-md-8, + .my-md-8 { + margin-bottom: 4rem !important; + } + .ml-md-8, + .mx-md-8 { + margin-left: 4rem !important; + } + .m-md-9 { + margin: 6rem !important; + } + .mt-md-9, + .my-md-9 { + margin-top: 6rem !important; + } + .mr-md-9, + .mx-md-9 { + margin-right: 6rem !important; + } + .mb-md-9, + .my-md-9 { + margin-bottom: 6rem !important; + } + .ml-md-9, + .mx-md-9 { + margin-left: 6rem !important; + } + .p-md-0 { + padding: 0 !important; + } + .pt-md-0, + .py-md-0 { + padding-top: 0 !important; + } + .pr-md-0, + .px-md-0 { + padding-right: 0 !important; + } + .pb-md-0, + .py-md-0 { + padding-bottom: 0 !important; + } + .pl-md-0, + .px-md-0 { + padding-left: 0 !important; + } + .p-md-1 { + padding: 0.25rem !important; + } + .pt-md-1, + .py-md-1 { + padding-top: 0.25rem !important; + } + .pr-md-1, + .px-md-1 { + padding-right: 0.25rem !important; + } + .pb-md-1, + .py-md-1 { + padding-bottom: 0.25rem !important; + } + .pl-md-1, + .px-md-1 { + padding-left: 0.25rem !important; + } + .p-md-2 { + padding: 0.5rem !important; + } + .pt-md-2, + .py-md-2 { + padding-top: 0.5rem !important; + } + .pr-md-2, + .px-md-2 { + padding-right: 0.5rem !important; + } + .pb-md-2, + .py-md-2 { + padding-bottom: 0.5rem !important; + } + .pl-md-2, + .px-md-2 { + padding-left: 0.5rem !important; + } + .p-md-3 { + padding: 0.75rem !important; + } + .pt-md-3, + .py-md-3 { + padding-top: 0.75rem !important; + } + .pr-md-3, + .px-md-3 { + padding-right: 0.75rem !important; + } + .pb-md-3, + .py-md-3 { + padding-bottom: 0.75rem !important; + } + .pl-md-3, + .px-md-3 { + padding-left: 0.75rem !important; + } + .p-md-4 { + padding: 1rem !important; + } + .pt-md-4, + .py-md-4 { + padding-top: 1rem !important; + } + .pr-md-4, + .px-md-4 { + padding-right: 1rem !important; + } + .pb-md-4, + .py-md-4 { + padding-bottom: 1rem !important; + } + .pl-md-4, + .px-md-4 { + padding-left: 1rem !important; + } + .p-md-5 { + padding: 1.5rem !important; + } + .pt-md-5, + .py-md-5 { + padding-top: 1.5rem !important; + } + .pr-md-5, + .px-md-5 { + padding-right: 1.5rem !important; + } + .pb-md-5, + .py-md-5 { + padding-bottom: 1.5rem !important; + } + .pl-md-5, + .px-md-5 { + padding-left: 1.5rem !important; + } + .p-md-6 { + padding: 2rem !important; + } + .pt-md-6, + .py-md-6 { + padding-top: 2rem !important; + } + .pr-md-6, + .px-md-6 { + padding-right: 2rem !important; + } + .pb-md-6, + .py-md-6 { + padding-bottom: 2rem !important; + } + .pl-md-6, + .px-md-6 { + padding-left: 2rem !important; + } + .p-md-7 { + padding: 3rem !important; + } + .pt-md-7, + .py-md-7 { + padding-top: 3rem !important; + } + .pr-md-7, + .px-md-7 { + padding-right: 3rem !important; + } + .pb-md-7, + .py-md-7 { + padding-bottom: 3rem !important; + } + .pl-md-7, + .px-md-7 { + padding-left: 3rem !important; + } + .p-md-8 { + padding: 4rem !important; + } + .pt-md-8, + .py-md-8 { + padding-top: 4rem !important; + } + .pr-md-8, + .px-md-8 { + padding-right: 4rem !important; + } + .pb-md-8, + .py-md-8 { + padding-bottom: 4rem !important; + } + .pl-md-8, + .px-md-8 { + padding-left: 4rem !important; + } + .p-md-9 { + padding: 6rem !important; + } + .pt-md-9, + .py-md-9 { + padding-top: 6rem !important; + } + .pr-md-9, + .px-md-9 { + padding-right: 6rem !important; + } + .pb-md-9, + .py-md-9 { + padding-bottom: 6rem !important; + } + .pl-md-9, + .px-md-9 { + padding-left: 6rem !important; + } + .m-md-auto { + margin: auto !important; + } + .mt-md-auto, + .my-md-auto { + margin-top: auto !important; + } + .mr-md-auto, + .mx-md-auto { + margin-right: auto !important; + } + .mb-md-auto, + .my-md-auto { + margin-bottom: auto !important; + } + .ml-md-auto, + .mx-md-auto { + margin-left: auto !important; + } +} + +@media (min-width: 992px) { + .m-lg-0 { + margin: 0 !important; + } + .mt-lg-0, + .my-lg-0 { + margin-top: 0 !important; + } + .mr-lg-0, + .mx-lg-0 { + margin-right: 0 !important; + } + .mb-lg-0, + .my-lg-0 { + margin-bottom: 0 !important; + } + .ml-lg-0, + .mx-lg-0 { + margin-left: 0 !important; + } + .m-lg-1 { + margin: 0.25rem !important; + } + .mt-lg-1, + .my-lg-1 { + margin-top: 0.25rem !important; + } + .mr-lg-1, + .mx-lg-1 { + margin-right: 0.25rem !important; + } + .mb-lg-1, + .my-lg-1 { + margin-bottom: 0.25rem !important; + } + .ml-lg-1, + .mx-lg-1 { + margin-left: 0.25rem !important; + } + .m-lg-2 { + margin: 0.5rem !important; + } + .mt-lg-2, + .my-lg-2 { + margin-top: 0.5rem !important; + } + .mr-lg-2, + .mx-lg-2 { + margin-right: 0.5rem !important; + } + .mb-lg-2, + .my-lg-2 { + margin-bottom: 0.5rem !important; + } + .ml-lg-2, + .mx-lg-2 { + margin-left: 0.5rem !important; + } + .m-lg-3 { + margin: 0.75rem !important; + } + .mt-lg-3, + .my-lg-3 { + margin-top: 0.75rem !important; + } + .mr-lg-3, + .mx-lg-3 { + margin-right: 0.75rem !important; + } + .mb-lg-3, + .my-lg-3 { + margin-bottom: 0.75rem !important; + } + .ml-lg-3, + .mx-lg-3 { + margin-left: 0.75rem !important; + } + .m-lg-4 { + margin: 1rem !important; + } + .mt-lg-4, + .my-lg-4 { + margin-top: 1rem !important; + } + .mr-lg-4, + .mx-lg-4 { + margin-right: 1rem !important; + } + .mb-lg-4, + .my-lg-4 { + margin-bottom: 1rem !important; + } + .ml-lg-4, + .mx-lg-4 { + margin-left: 1rem !important; + } + .m-lg-5 { + margin: 1.5rem !important; + } + .mt-lg-5, + .my-lg-5 { + margin-top: 1.5rem !important; + } + .mr-lg-5, + .mx-lg-5 { + margin-right: 1.5rem !important; + } + .mb-lg-5, + .my-lg-5 { + margin-bottom: 1.5rem !important; + } + .ml-lg-5, + .mx-lg-5 { + margin-left: 1.5rem !important; + } + .m-lg-6 { + margin: 2rem !important; + } + .mt-lg-6, + .my-lg-6 { + margin-top: 2rem !important; + } + .mr-lg-6, + .mx-lg-6 { + margin-right: 2rem !important; + } + .mb-lg-6, + .my-lg-6 { + margin-bottom: 2rem !important; + } + .ml-lg-6, + .mx-lg-6 { + margin-left: 2rem !important; + } + .m-lg-7 { + margin: 3rem !important; + } + .mt-lg-7, + .my-lg-7 { + margin-top: 3rem !important; + } + .mr-lg-7, + .mx-lg-7 { + margin-right: 3rem !important; + } + .mb-lg-7, + .my-lg-7 { + margin-bottom: 3rem !important; + } + .ml-lg-7, + .mx-lg-7 { + margin-left: 3rem !important; + } + .m-lg-8 { + margin: 4rem !important; + } + .mt-lg-8, + .my-lg-8 { + margin-top: 4rem !important; + } + .mr-lg-8, + .mx-lg-8 { + margin-right: 4rem !important; + } + .mb-lg-8, + .my-lg-8 { + margin-bottom: 4rem !important; + } + .ml-lg-8, + .mx-lg-8 { + margin-left: 4rem !important; + } + .m-lg-9 { + margin: 6rem !important; + } + .mt-lg-9, + .my-lg-9 { + margin-top: 6rem !important; + } + .mr-lg-9, + .mx-lg-9 { + margin-right: 6rem !important; + } + .mb-lg-9, + .my-lg-9 { + margin-bottom: 6rem !important; + } + .ml-lg-9, + .mx-lg-9 { + margin-left: 6rem !important; + } + .p-lg-0 { + padding: 0 !important; + } + .pt-lg-0, + .py-lg-0 { + padding-top: 0 !important; + } + .pr-lg-0, + .px-lg-0 { + padding-right: 0 !important; + } + .pb-lg-0, + .py-lg-0 { + padding-bottom: 0 !important; + } + .pl-lg-0, + .px-lg-0 { + padding-left: 0 !important; + } + .p-lg-1 { + padding: 0.25rem !important; + } + .pt-lg-1, + .py-lg-1 { + padding-top: 0.25rem !important; + } + .pr-lg-1, + .px-lg-1 { + padding-right: 0.25rem !important; + } + .pb-lg-1, + .py-lg-1 { + padding-bottom: 0.25rem !important; + } + .pl-lg-1, + .px-lg-1 { + padding-left: 0.25rem !important; + } + .p-lg-2 { + padding: 0.5rem !important; + } + .pt-lg-2, + .py-lg-2 { + padding-top: 0.5rem !important; + } + .pr-lg-2, + .px-lg-2 { + padding-right: 0.5rem !important; + } + .pb-lg-2, + .py-lg-2 { + padding-bottom: 0.5rem !important; + } + .pl-lg-2, + .px-lg-2 { + padding-left: 0.5rem !important; + } + .p-lg-3 { + padding: 0.75rem !important; + } + .pt-lg-3, + .py-lg-3 { + padding-top: 0.75rem !important; + } + .pr-lg-3, + .px-lg-3 { + padding-right: 0.75rem !important; + } + .pb-lg-3, + .py-lg-3 { + padding-bottom: 0.75rem !important; + } + .pl-lg-3, + .px-lg-3 { + padding-left: 0.75rem !important; + } + .p-lg-4 { + padding: 1rem !important; + } + .pt-lg-4, + .py-lg-4 { + padding-top: 1rem !important; + } + .pr-lg-4, + .px-lg-4 { + padding-right: 1rem !important; + } + .pb-lg-4, + .py-lg-4 { + padding-bottom: 1rem !important; + } + .pl-lg-4, + .px-lg-4 { + padding-left: 1rem !important; + } + .p-lg-5 { + padding: 1.5rem !important; + } + .pt-lg-5, + .py-lg-5 { + padding-top: 1.5rem !important; + } + .pr-lg-5, + .px-lg-5 { + padding-right: 1.5rem !important; + } + .pb-lg-5, + .py-lg-5 { + padding-bottom: 1.5rem !important; + } + .pl-lg-5, + .px-lg-5 { + padding-left: 1.5rem !important; + } + .p-lg-6 { + padding: 2rem !important; + } + .pt-lg-6, + .py-lg-6 { + padding-top: 2rem !important; + } + .pr-lg-6, + .px-lg-6 { + padding-right: 2rem !important; + } + .pb-lg-6, + .py-lg-6 { + padding-bottom: 2rem !important; + } + .pl-lg-6, + .px-lg-6 { + padding-left: 2rem !important; + } + .p-lg-7 { + padding: 3rem !important; + } + .pt-lg-7, + .py-lg-7 { + padding-top: 3rem !important; + } + .pr-lg-7, + .px-lg-7 { + padding-right: 3rem !important; + } + .pb-lg-7, + .py-lg-7 { + padding-bottom: 3rem !important; + } + .pl-lg-7, + .px-lg-7 { + padding-left: 3rem !important; + } + .p-lg-8 { + padding: 4rem !important; + } + .pt-lg-8, + .py-lg-8 { + padding-top: 4rem !important; + } + .pr-lg-8, + .px-lg-8 { + padding-right: 4rem !important; + } + .pb-lg-8, + .py-lg-8 { + padding-bottom: 4rem !important; + } + .pl-lg-8, + .px-lg-8 { + padding-left: 4rem !important; + } + .p-lg-9 { + padding: 6rem !important; + } + .pt-lg-9, + .py-lg-9 { + padding-top: 6rem !important; + } + .pr-lg-9, + .px-lg-9 { + padding-right: 6rem !important; + } + .pb-lg-9, + .py-lg-9 { + padding-bottom: 6rem !important; + } + .pl-lg-9, + .px-lg-9 { + padding-left: 6rem !important; + } + .m-lg-auto { + margin: auto !important; + } + .mt-lg-auto, + .my-lg-auto { + margin-top: auto !important; + } + .mr-lg-auto, + .mx-lg-auto { + margin-right: auto !important; + } + .mb-lg-auto, + .my-lg-auto { + margin-bottom: auto !important; + } + .ml-lg-auto, + .mx-lg-auto { + margin-left: auto !important; + } +} + +@media (min-width: 1280px) { + .m-xl-0 { + margin: 0 !important; + } + .mt-xl-0, + .my-xl-0 { + margin-top: 0 !important; + } + .mr-xl-0, + .mx-xl-0 { + margin-right: 0 !important; + } + .mb-xl-0, + .my-xl-0 { + margin-bottom: 0 !important; + } + .ml-xl-0, + .mx-xl-0 { + margin-left: 0 !important; + } + .m-xl-1 { + margin: 0.25rem !important; + } + .mt-xl-1, + .my-xl-1 { + margin-top: 0.25rem !important; + } + .mr-xl-1, + .mx-xl-1 { + margin-right: 0.25rem !important; + } + .mb-xl-1, + .my-xl-1 { + margin-bottom: 0.25rem !important; + } + .ml-xl-1, + .mx-xl-1 { + margin-left: 0.25rem !important; + } + .m-xl-2 { + margin: 0.5rem !important; + } + .mt-xl-2, + .my-xl-2 { + margin-top: 0.5rem !important; + } + .mr-xl-2, + .mx-xl-2 { + margin-right: 0.5rem !important; + } + .mb-xl-2, + .my-xl-2 { + margin-bottom: 0.5rem !important; + } + .ml-xl-2, + .mx-xl-2 { + margin-left: 0.5rem !important; + } + .m-xl-3 { + margin: 0.75rem !important; + } + .mt-xl-3, + .my-xl-3 { + margin-top: 0.75rem !important; + } + .mr-xl-3, + .mx-xl-3 { + margin-right: 0.75rem !important; + } + .mb-xl-3, + .my-xl-3 { + margin-bottom: 0.75rem !important; + } + .ml-xl-3, + .mx-xl-3 { + margin-left: 0.75rem !important; + } + .m-xl-4 { + margin: 1rem !important; + } + .mt-xl-4, + .my-xl-4 { + margin-top: 1rem !important; + } + .mr-xl-4, + .mx-xl-4 { + margin-right: 1rem !important; + } + .mb-xl-4, + .my-xl-4 { + margin-bottom: 1rem !important; + } + .ml-xl-4, + .mx-xl-4 { + margin-left: 1rem !important; + } + .m-xl-5 { + margin: 1.5rem !important; + } + .mt-xl-5, + .my-xl-5 { + margin-top: 1.5rem !important; + } + .mr-xl-5, + .mx-xl-5 { + margin-right: 1.5rem !important; + } + .mb-xl-5, + .my-xl-5 { + margin-bottom: 1.5rem !important; + } + .ml-xl-5, + .mx-xl-5 { + margin-left: 1.5rem !important; + } + .m-xl-6 { + margin: 2rem !important; + } + .mt-xl-6, + .my-xl-6 { + margin-top: 2rem !important; + } + .mr-xl-6, + .mx-xl-6 { + margin-right: 2rem !important; + } + .mb-xl-6, + .my-xl-6 { + margin-bottom: 2rem !important; + } + .ml-xl-6, + .mx-xl-6 { + margin-left: 2rem !important; + } + .m-xl-7 { + margin: 3rem !important; + } + .mt-xl-7, + .my-xl-7 { + margin-top: 3rem !important; + } + .mr-xl-7, + .mx-xl-7 { + margin-right: 3rem !important; + } + .mb-xl-7, + .my-xl-7 { + margin-bottom: 3rem !important; + } + .ml-xl-7, + .mx-xl-7 { + margin-left: 3rem !important; + } + .m-xl-8 { + margin: 4rem !important; + } + .mt-xl-8, + .my-xl-8 { + margin-top: 4rem !important; + } + .mr-xl-8, + .mx-xl-8 { + margin-right: 4rem !important; + } + .mb-xl-8, + .my-xl-8 { + margin-bottom: 4rem !important; + } + .ml-xl-8, + .mx-xl-8 { + margin-left: 4rem !important; + } + .m-xl-9 { + margin: 6rem !important; + } + .mt-xl-9, + .my-xl-9 { + margin-top: 6rem !important; + } + .mr-xl-9, + .mx-xl-9 { + margin-right: 6rem !important; + } + .mb-xl-9, + .my-xl-9 { + margin-bottom: 6rem !important; + } + .ml-xl-9, + .mx-xl-9 { + margin-left: 6rem !important; + } + .p-xl-0 { + padding: 0 !important; + } + .pt-xl-0, + .py-xl-0 { + padding-top: 0 !important; + } + .pr-xl-0, + .px-xl-0 { + padding-right: 0 !important; + } + .pb-xl-0, + .py-xl-0 { + padding-bottom: 0 !important; + } + .pl-xl-0, + .px-xl-0 { + padding-left: 0 !important; + } + .p-xl-1 { + padding: 0.25rem !important; + } + .pt-xl-1, + .py-xl-1 { + padding-top: 0.25rem !important; + } + .pr-xl-1, + .px-xl-1 { + padding-right: 0.25rem !important; + } + .pb-xl-1, + .py-xl-1 { + padding-bottom: 0.25rem !important; + } + .pl-xl-1, + .px-xl-1 { + padding-left: 0.25rem !important; + } + .p-xl-2 { + padding: 0.5rem !important; + } + .pt-xl-2, + .py-xl-2 { + padding-top: 0.5rem !important; + } + .pr-xl-2, + .px-xl-2 { + padding-right: 0.5rem !important; + } + .pb-xl-2, + .py-xl-2 { + padding-bottom: 0.5rem !important; + } + .pl-xl-2, + .px-xl-2 { + padding-left: 0.5rem !important; + } + .p-xl-3 { + padding: 0.75rem !important; + } + .pt-xl-3, + .py-xl-3 { + padding-top: 0.75rem !important; + } + .pr-xl-3, + .px-xl-3 { + padding-right: 0.75rem !important; + } + .pb-xl-3, + .py-xl-3 { + padding-bottom: 0.75rem !important; + } + .pl-xl-3, + .px-xl-3 { + padding-left: 0.75rem !important; + } + .p-xl-4 { + padding: 1rem !important; + } + .pt-xl-4, + .py-xl-4 { + padding-top: 1rem !important; + } + .pr-xl-4, + .px-xl-4 { + padding-right: 1rem !important; + } + .pb-xl-4, + .py-xl-4 { + padding-bottom: 1rem !important; + } + .pl-xl-4, + .px-xl-4 { + padding-left: 1rem !important; + } + .p-xl-5 { + padding: 1.5rem !important; + } + .pt-xl-5, + .py-xl-5 { + padding-top: 1.5rem !important; + } + .pr-xl-5, + .px-xl-5 { + padding-right: 1.5rem !important; + } + .pb-xl-5, + .py-xl-5 { + padding-bottom: 1.5rem !important; + } + .pl-xl-5, + .px-xl-5 { + padding-left: 1.5rem !important; + } + .p-xl-6 { + padding: 2rem !important; + } + .pt-xl-6, + .py-xl-6 { + padding-top: 2rem !important; + } + .pr-xl-6, + .px-xl-6 { + padding-right: 2rem !important; + } + .pb-xl-6, + .py-xl-6 { + padding-bottom: 2rem !important; + } + .pl-xl-6, + .px-xl-6 { + padding-left: 2rem !important; + } + .p-xl-7 { + padding: 3rem !important; + } + .pt-xl-7, + .py-xl-7 { + padding-top: 3rem !important; + } + .pr-xl-7, + .px-xl-7 { + padding-right: 3rem !important; + } + .pb-xl-7, + .py-xl-7 { + padding-bottom: 3rem !important; + } + .pl-xl-7, + .px-xl-7 { + padding-left: 3rem !important; + } + .p-xl-8 { + padding: 4rem !important; + } + .pt-xl-8, + .py-xl-8 { + padding-top: 4rem !important; + } + .pr-xl-8, + .px-xl-8 { + padding-right: 4rem !important; + } + .pb-xl-8, + .py-xl-8 { + padding-bottom: 4rem !important; + } + .pl-xl-8, + .px-xl-8 { + padding-left: 4rem !important; + } + .p-xl-9 { + padding: 6rem !important; + } + .pt-xl-9, + .py-xl-9 { + padding-top: 6rem !important; + } + .pr-xl-9, + .px-xl-9 { + padding-right: 6rem !important; + } + .pb-xl-9, + .py-xl-9 { + padding-bottom: 6rem !important; + } + .pl-xl-9, + .px-xl-9 { + padding-left: 6rem !important; + } + .m-xl-auto { + margin: auto !important; + } + .mt-xl-auto, + .my-xl-auto { + margin-top: auto !important; + } + .mr-xl-auto, + .mx-xl-auto { + margin-right: auto !important; + } + .mb-xl-auto, + .my-xl-auto { + margin-bottom: auto !important; + } + .ml-xl-auto, + .mx-xl-auto { + margin-left: auto !important; + } +} + +.text-monospace { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +.text-justify { + text-align: justify !important; +} + +.text-nowrap { + white-space: nowrap !important; +} + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +.text-left { + text-align: left !important; +} + +.text-right { + text-align: right !important; +} + +.text-center { + text-align: center !important; +} + +@media (min-width: 576px) { + .text-sm-left { + text-align: left !important; + } + .text-sm-right { + text-align: right !important; + } + .text-sm-center { + text-align: center !important; + } +} + +@media (min-width: 768px) { + .text-md-left { + text-align: left !important; + } + .text-md-right { + text-align: right !important; + } + .text-md-center { + text-align: center !important; + } +} + +@media (min-width: 992px) { + .text-lg-left { + text-align: left !important; + } + .text-lg-right { + text-align: right !important; + } + .text-lg-center { + text-align: center !important; + } +} + +@media (min-width: 1280px) { + .text-xl-left { + text-align: left !important; + } + .text-xl-right { + text-align: right !important; + } + .text-xl-center { + text-align: center !important; + } +} + +.text-lowercase { + text-transform: lowercase !important; +} + +.text-uppercase { + text-transform: uppercase !important; +} + +.text-capitalize { + text-transform: capitalize !important; +} + +.font-weight-light { + font-weight: 300 !important; +} + +.font-weight-normal { + font-weight: 400 !important; +} + +.font-weight-bold { + font-weight: 700 !important; +} + +.font-italic { + font-style: italic !important; +} + +.text-white { + color: #fff !important; +} + +.text-primary { + color: #467fcf !important; +} + +a.text-primary:hover, a.text-primary:focus { + color: #2f66b3 !important; +} + +.text-secondary { + color: #868e96 !important; +} + +a.text-secondary:hover, a.text-secondary:focus { + color: #6c757d !important; +} + +.text-success { + color: #5eba00 !important; +} + +a.text-success:hover, a.text-success:focus { + color: #448700 !important; +} + +.text-info { + color: #45aaf2 !important; +} + +a.text-info:hover, a.text-info:focus { + color: #1594ef !important; +} + +.text-warning { + color: #f1c40f !important; +} + +a.text-warning:hover, a.text-warning:focus { + color: #c29d0b !important; +} + +.text-danger { + color: #cd201f !important; +} + +a.text-danger:hover, a.text-danger:focus { + color: #a11918 !important; +} + +.text-light { + color: #f8f9fa !important; +} + +a.text-light:hover, a.text-light:focus { + color: #dae0e5 !important; +} + +.text-dark { + color: #343a40 !important; +} + +a.text-dark:hover, a.text-dark:focus { + color: #1d2124 !important; +} + +.text-body { + color: #495057 !important; +} + +.text-muted { + color: #9aa0ac !important; +} + +.text-black-50 { + color: rgba(0, 0, 0, 0.5) !important; +} + +.text-white-50 { + color: rgba(255, 255, 255, 0.5) !important; +} + +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} + +.visible { + visibility: visible !important; +} + +.invisible { + visibility: hidden !important; +} + +@media print { + *, + *::before, + *::after { + text-shadow: none !important; + box-shadow: none !important; + } + a:not(.btn) { + text-decoration: underline; + } + abbr[title]::after { + content: " (" attr(title) ")"; + } + pre { + white-space: pre-wrap !important; + } + pre, + blockquote { + border: 1px solid #adb5bd; + page-break-inside: avoid; + } + thead { + display: table-header-group; + } + tr, + img { + page-break-inside: avoid; + } + p, + h2, + h3 { + orphans: 3; + widows: 3; + } + h2, + h3 { + page-break-after: avoid; + } + @page { + size: a3; + } + body { + min-width: 992px !important; + } + .container { + min-width: 992px !important; + } + .navbar { + display: none; + } + .badge { + border: 1px solid #000; + } + .table, .text-wrap table { + border-collapse: collapse !important; + } + + .table td, + .text-wrap table td, .table th, .text-wrap table th { + background-color: #fff !important; + } + .table-bordered th, .text-wrap table th, + .table-bordered td, + .text-wrap table td { + border: 1px solid #dee2e6 !important; + } +} + +html { + font-size: 16px; + height: 100%; + direction: ltr; +} + +body { + direction: ltr; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; + -webkit-tap-highlight-color: transparent; + -webkit-text-size-adjust: none; + -ms-touch-action: manipulation; + touch-action: manipulation; + -webkit-font-feature-settings: "liga" 0; + font-feature-settings: "liga" 0; + height: 100%; + overflow-y: scroll; + position: relative; +} + +@media print { + body { + background: none; + } +} + +body *::-webkit-scrollbar { + width: 6px; + height: 6px; + transition: .3s background; +} + +body *::-webkit-scrollbar-thumb { + background: #ced4da; +} + +body *:hover::-webkit-scrollbar-thumb { + background: #adb5bd; +} + +.lead { + line-height: 1.4; +} + +a { + -webkit-text-decoration-skip: ink; + text-decoration-skip: ink; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a, +.h1 a, .h2 a, .h3 a, .h4 a, .h5 a, .h6 a { + color: inherit; +} + +strong, +b { + font-weight: 600; +} + +p, +ul, +ol, +blockquote { + margin-bottom: 1em; +} + +blockquote { + font-style: italic; + color: #6e7687; + padding-left: 2rem; + border-left: 2px solid rgba(0, 40, 100, 0.12); +} + +blockquote p { + margin-bottom: 1rem; +} + +blockquote cite { + display: block; + text-align: right; +} + +blockquote cite:before { + content: '— '; +} + +code { + background: rgba(0, 0, 0, 0.025); + border: 1px solid rgba(0, 0, 0, 0.05); + border-radius: 3px; + padding: 3px; +} + +pre code { + padding: 0; + border-radius: 0; + border: none; + background: none; +} + +hr { + margin-top: 2rem; + margin-bottom: 2rem; +} + +pre { + color: #343a40; + padding: 1rem; + overflow: auto; + font-size: 85%; + line-height: 1.45; + background-color: #f8fafc; + border-radius: 3px; + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + text-shadow: 0 1px white; + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} + +img { + max-width: 100%; +} + +.text-wrap { + font-size: 1rem; + line-height: 1.66; +} + +.text-wrap > :first-child { + margin-top: 0; +} + +.text-wrap > :last-child { + margin-bottom: 0; +} + +.text-wrap > h1, .text-wrap > h2, .text-wrap > h3, .text-wrap > h4, .text-wrap > h5, .text-wrap > h6 { + margin-top: 1em; +} + +.section-nav { + background-color: #f8f9fa; + margin: 1rem 0; + padding: .5rem 1rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + list-style: none; +} + +.section-nav:before { + content: 'Table of contents:'; + display: block; + font-weight: 600; +} + +@media print { + .container { + max-width: none; + } +} + +.row-cards > .col, +.row-cards > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.row-deck > .col, +.row-deck > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-align: stretch; + align-items: stretch; +} + +.row-deck > .col .card, +.row-deck > [class*='col-'] .card { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.col-text { + max-width: 48rem; +} + +.col-login { + max-width: 24rem; +} + +.gutters-0 { + margin-right: 0; + margin-left: 0; +} + +.gutters-0 > .col, +.gutters-0 > [class*="col-"] { + padding-right: 0; + padding-left: 0; +} + +.gutters-0 .card { + margin-bottom: 0; +} + +.gutters-xs { + margin-right: -0.25rem; + margin-left: -0.25rem; +} + +.gutters-xs > .col, +.gutters-xs > [class*="col-"] { + padding-right: 0.25rem; + padding-left: 0.25rem; +} + +.gutters-xs .card { + margin-bottom: 0.5rem; +} + +.gutters-sm { + margin-right: -0.5rem; + margin-left: -0.5rem; +} + +.gutters-sm > .col, +.gutters-sm > [class*="col-"] { + padding-right: 0.5rem; + padding-left: 0.5rem; +} + +.gutters-sm .card { + margin-bottom: 1rem; +} + +.gutters-lg { + margin-right: -1rem; + margin-left: -1rem; +} + +.gutters-lg > .col, +.gutters-lg > [class*="col-"] { + padding-right: 1rem; + padding-left: 1rem; +} + +.gutters-lg .card { + margin-bottom: 2rem; +} + +.gutters-xl { + margin-right: -1.5rem; + margin-left: -1.5rem; +} + +.gutters-xl > .col, +.gutters-xl > [class*="col-"] { + padding-right: 1.5rem; + padding-left: 1.5rem; +} + +.gutters-xl .card { + margin-bottom: 3rem; +} + +.page { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + min-height: 100%; +} + +body.fixed-header .page { + padding-top: 4.5rem; +} + +@media (min-width: 1600px) { + body.aside-opened .page { + margin-right: 22rem; + } +} + +.page-main { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.page-content { + margin: .75rem 0; +} + +@media (min-width: 768px) { + .page-content { + margin: 1.5rem 0; + } +} + +.page-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + margin: 1.5rem 0 1.5rem; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.page-title { + margin: 0; + font-size: 1.5rem; + font-weight: 400; + line-height: 2.5rem; +} + +.page-title-icon { + color: #9aa0ac; + font-size: 1.25rem; +} + +.page-subtitle { + font-size: 0.8125rem; + color: #6e7687; + margin-left: 2rem; +} + +.page-subtitle a { + color: inherit; +} + +.page-options { + margin-left: auto; +} + +.page-breadcrumb { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; +} + +.page-description { + margin: .25rem 0 0; + color: #6e7687; +} + +.page-description a { + color: inherit; +} + +.page-single { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + padding: 1rem 0; +} + +.content-heading { + font-weight: 400; + margin: 2rem 0 1.5rem; + font-size: 1.25rem; + line-height: 1.25; +} + +.content-heading:first-child { + margin-top: 0; +} + +.aside { + position: fixed; + top: 0; + right: 0; + bottom: 0; + width: 22rem; + background: #ffffff; + border-left: 1px solid rgba(0, 40, 100, 0.12); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + z-index: 100; + visibility: hidden; + box-shadow: 0 0 5px 2px rgba(0, 0, 0, 0.05); +} + +@media (min-width: 1600px) { + body.aside-opened .aside { + visibility: visible; + } +} + +.aside-body { + padding: 1.5rem; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + overflow: auto; +} + +.aside-footer { + padding: 1rem 1.5rem; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.aside-header { + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.header { + padding-top: .75rem; + padding-bottom: .75rem; + background: #fff; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +body.fixed-header .header { + position: fixed; + top: 0; + left: 0; + right: 0; + z-index: 1030; +} + +@media print { + .header { + display: none; + } +} + +.header .dropdown-menu { + margin-top: .75rem; +} + +.nav-unread { + position: absolute; + top: .25rem; + right: .25rem; + background: #cd201f; + width: .5rem; + height: .5rem; + border-radius: 50%; +} + +.header-brand { + color: inherit; + margin-right: 1rem; + font-size: 1.25rem; + white-space: nowrap; + font-weight: 600; + padding: 0; + transition: .3s opacity; + line-height: 2rem; +} + +.header-brand:hover { + opacity: .8; + color: inherit; + text-decoration: none; +} + +.header-brand-img { + height: 2rem; + line-height: 2rem; + vertical-align: bottom; + margin-right: .5rem; + width: auto; +} + +.header-avatar { + width: 2rem; + height: 2rem; + display: inline-block; + vertical-align: bottom; + border-radius: 50%; +} + +.header-btn { + display: inline-block; + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + font-size: 1rem; +} + +.header-btn.has-new { + position: relative; +} + +.header-btn.has-new:before { + content: ''; + width: 6px; + height: 6px; + background: #cd201f; + position: absolute; + top: 4px; + right: 4px; + border-radius: 50%; +} + +.header-toggler { + width: 2rem; + height: 2rem; + position: relative; + color: #9aa0ac; +} + +.header-toggler:hover { + color: #6e7687; +} + +.header-toggler-icon { + position: absolute; + width: 1rem; + height: 2px; + color: inherit; + background: currentColor; + border-radius: 3px; + top: 50%; + left: 50%; + margin: -2px 0 0 -.5rem; + box-shadow: 0 5px currentColor, 0 -5px currentColor; +} + +.footer { + background: #fff; + border-top: 1px solid rgba(0, 40, 100, 0.12); + font-size: 0.875rem; + padding: 1.25rem 0; + color: #9aa0ac; +} + +.footer a:not(.btn) { + color: #6e7687; +} + +@media print { + .footer { + display: none; + } +} + +.bg-blue-lightest { + background-color: #edf2fa !important; +} + +a.bg-blue-lightest:hover, a.bg-blue-lightest:focus, +button.bg-blue-lightest:hover, +button.bg-blue-lightest:focus { + background-color: #c5d5ef !important; +} + +.bg-blue-lighter { + background-color: #c8d9f1 !important; +} + +a.bg-blue-lighter:hover, a.bg-blue-lighter:focus, +button.bg-blue-lighter:hover, +button.bg-blue-lighter:focus { + background-color: #9fbde7 !important; +} + +.bg-blue-light { + background-color: #7ea5dd !important; +} + +a.bg-blue-light:hover, a.bg-blue-light:focus, +button.bg-blue-light:hover, +button.bg-blue-light:focus { + background-color: #5689d2 !important; +} + +.bg-blue-dark { + background-color: #3866a6 !important; +} + +a.bg-blue-dark:hover, a.bg-blue-dark:focus, +button.bg-blue-dark:hover, +button.bg-blue-dark:focus { + background-color: #2b4f80 !important; +} + +.bg-blue-darker { + background-color: #1c3353 !important; +} + +a.bg-blue-darker:hover, a.bg-blue-darker:focus, +button.bg-blue-darker:hover, +button.bg-blue-darker:focus { + background-color: #0f1c2d !important; +} + +.bg-blue-darkest { + background-color: #0e1929 !important; +} + +a.bg-blue-darkest:hover, a.bg-blue-darkest:focus, +button.bg-blue-darkest:hover, +button.bg-blue-darkest:focus { + background-color: #010203 !important; +} + +.bg-indigo-lightest { + background-color: #f0f1fa !important; +} + +a.bg-indigo-lightest:hover, a.bg-indigo-lightest:focus, +button.bg-indigo-lightest:hover, +button.bg-indigo-lightest:focus { + background-color: #cacded !important; +} + +.bg-indigo-lighter { + background-color: #d1d5f0 !important; +} + +a.bg-indigo-lighter:hover, a.bg-indigo-lighter:focus, +button.bg-indigo-lighter:hover, +button.bg-indigo-lighter:focus { + background-color: #abb2e3 !important; +} + +.bg-indigo-light { + background-color: #939edc !important; +} + +a.bg-indigo-light:hover, a.bg-indigo-light:focus, +button.bg-indigo-light:hover, +button.bg-indigo-light:focus { + background-color: #6c7bd0 !important; +} + +.bg-indigo-dark { + background-color: #515da4 !important; +} + +a.bg-indigo-dark:hover, a.bg-indigo-dark:focus, +button.bg-indigo-dark:hover, +button.bg-indigo-dark:focus { + background-color: #404a82 !important; +} + +.bg-indigo-darker { + background-color: #282e52 !important; +} + +a.bg-indigo-darker:hover, a.bg-indigo-darker:focus, +button.bg-indigo-darker:hover, +button.bg-indigo-darker:focus { + background-color: #171b30 !important; +} + +.bg-indigo-darkest { + background-color: #141729 !important; +} + +a.bg-indigo-darkest:hover, a.bg-indigo-darkest:focus, +button.bg-indigo-darkest:hover, +button.bg-indigo-darkest:focus { + background-color: #030407 !important; +} + +.bg-purple-lightest { + background-color: #f6effd !important; +} + +a.bg-purple-lightest:hover, a.bg-purple-lightest:focus, +button.bg-purple-lightest:hover, +button.bg-purple-lightest:focus { + background-color: #ddc2f7 !important; +} + +.bg-purple-lighter { + background-color: #e4cff9 !important; +} + +a.bg-purple-lighter:hover, a.bg-purple-lighter:focus, +button.bg-purple-lighter:hover, +button.bg-purple-lighter:focus { + background-color: #cba2f3 !important; +} + +.bg-purple-light { + background-color: #c08ef0 !important; +} + +a.bg-purple-light:hover, a.bg-purple-light:focus, +button.bg-purple-light:hover, +button.bg-purple-light:focus { + background-color: #a761ea !important; +} + +.bg-purple-dark { + background-color: #844bbb !important; +} + +a.bg-purple-dark:hover, a.bg-purple-dark:focus, +button.bg-purple-dark:hover, +button.bg-purple-dark:focus { + background-color: #6a3a99 !important; +} + +.bg-purple-darker { + background-color: #42265e !important; +} + +a.bg-purple-darker:hover, a.bg-purple-darker:focus, +button.bg-purple-darker:hover, +button.bg-purple-darker:focus { + background-color: #29173a !important; +} + +.bg-purple-darkest { + background-color: #21132f !important; +} + +a.bg-purple-darkest:hover, a.bg-purple-darkest:focus, +button.bg-purple-darkest:hover, +button.bg-purple-darkest:focus { + background-color: #08040b !important; +} + +.bg-pink-lightest { + background-color: #fef0f5 !important; +} + +a.bg-pink-lightest:hover, a.bg-pink-lightest:focus, +button.bg-pink-lightest:hover, +button.bg-pink-lightest:focus { + background-color: #fbc0d5 !important; +} + +.bg-pink-lighter { + background-color: #fcd3e1 !important; +} + +a.bg-pink-lighter:hover, a.bg-pink-lighter:focus, +button.bg-pink-lighter:hover, +button.bg-pink-lighter:focus { + background-color: #f9a3c0 !important; +} + +.bg-pink-light { + background-color: #f999b9 !important; +} + +a.bg-pink-light:hover, a.bg-pink-light:focus, +button.bg-pink-light:hover, +button.bg-pink-light:focus { + background-color: #f66998 !important; +} + +.bg-pink-dark { + background-color: #c5577c !important; +} + +a.bg-pink-dark:hover, a.bg-pink-dark:focus, +button.bg-pink-dark:hover, +button.bg-pink-dark:focus { + background-color: #ad3c62 !important; +} + +.bg-pink-darker { + background-color: #622c3e !important; +} + +a.bg-pink-darker:hover, a.bg-pink-darker:focus, +button.bg-pink-darker:hover, +button.bg-pink-darker:focus { + background-color: #3f1c28 !important; +} + +.bg-pink-darkest { + background-color: #31161f !important; +} + +a.bg-pink-darkest:hover, a.bg-pink-darkest:focus, +button.bg-pink-darkest:hover, +button.bg-pink-darkest:focus { + background-color: #0e0609 !important; +} + +.bg-red-lightest { + background-color: #fae9e9 !important; +} + +a.bg-red-lightest:hover, a.bg-red-lightest:focus, +button.bg-red-lightest:hover, +button.bg-red-lightest:focus { + background-color: #f1bfbf !important; +} + +.bg-red-lighter { + background-color: #f0bcbc !important; +} + +a.bg-red-lighter:hover, a.bg-red-lighter:focus, +button.bg-red-lighter:hover, +button.bg-red-lighter:focus { + background-color: #e79292 !important; +} + +.bg-red-light { + background-color: #dc6362 !important; +} + +a.bg-red-light:hover, a.bg-red-light:focus, +button.bg-red-light:hover, +button.bg-red-light:focus { + background-color: #d33a38 !important; +} + +.bg-red-dark { + background-color: #a41a19 !important; +} + +a.bg-red-dark:hover, a.bg-red-dark:focus, +button.bg-red-dark:hover, +button.bg-red-dark:focus { + background-color: #781312 !important; +} + +.bg-red-darker { + background-color: #520d0c !important; +} + +a.bg-red-darker:hover, a.bg-red-darker:focus, +button.bg-red-darker:hover, +button.bg-red-darker:focus { + background-color: #260605 !important; +} + +.bg-red-darkest { + background-color: #290606 !important; +} + +a.bg-red-darkest:hover, a.bg-red-darkest:focus, +button.bg-red-darkest:hover, +button.bg-red-darkest:focus { + background-color: black !important; +} + +.bg-orange-lightest { + background-color: #fff5ec !important; +} + +a.bg-orange-lightest:hover, a.bg-orange-lightest:focus, +button.bg-orange-lightest:hover, +button.bg-orange-lightest:focus { + background-color: peachpuff !important; +} + +.bg-orange-lighter { + background-color: #fee0c7 !important; +} + +a.bg-orange-lighter:hover, a.bg-orange-lighter:focus, +button.bg-orange-lighter:hover, +button.bg-orange-lighter:focus { + background-color: #fdc495 !important; +} + +.bg-orange-light { + background-color: #feb67c !important; +} + +a.bg-orange-light:hover, a.bg-orange-light:focus, +button.bg-orange-light:hover, +button.bg-orange-light:focus { + background-color: #fe9a49 !important; +} + +.bg-orange-dark { + background-color: #ca7836 !important; +} + +a.bg-orange-dark:hover, a.bg-orange-dark:focus, +button.bg-orange-dark:hover, +button.bg-orange-dark:focus { + background-color: #a2602b !important; +} + +.bg-orange-darker { + background-color: #653c1b !important; +} + +a.bg-orange-darker:hover, a.bg-orange-darker:focus, +button.bg-orange-darker:hover, +button.bg-orange-darker:focus { + background-color: #3d2410 !important; +} + +.bg-orange-darkest { + background-color: #331e0e !important; +} + +a.bg-orange-darkest:hover, a.bg-orange-darkest:focus, +button.bg-orange-darkest:hover, +button.bg-orange-darkest:focus { + background-color: #0b0603 !important; +} + +.bg-yellow-lightest { + background-color: #fef9e7 !important; +} + +a.bg-yellow-lightest:hover, a.bg-yellow-lightest:focus, +button.bg-yellow-lightest:hover, +button.bg-yellow-lightest:focus { + background-color: #fcedb6 !important; +} + +.bg-yellow-lighter { + background-color: #fbedb7 !important; +} + +a.bg-yellow-lighter:hover, a.bg-yellow-lighter:focus, +button.bg-yellow-lighter:hover, +button.bg-yellow-lighter:focus { + background-color: #f8e187 !important; +} + +.bg-yellow-light { + background-color: #f5d657 !important; +} + +a.bg-yellow-light:hover, a.bg-yellow-light:focus, +button.bg-yellow-light:hover, +button.bg-yellow-light:focus { + background-color: #f2ca27 !important; +} + +.bg-yellow-dark { + background-color: #c19d0c !important; +} + +a.bg-yellow-dark:hover, a.bg-yellow-dark:focus, +button.bg-yellow-dark:hover, +button.bg-yellow-dark:focus { + background-color: #917609 !important; +} + +.bg-yellow-darker { + background-color: #604e06 !important; +} + +a.bg-yellow-darker:hover, a.bg-yellow-darker:focus, +button.bg-yellow-darker:hover, +button.bg-yellow-darker:focus { + background-color: #302703 !important; +} + +.bg-yellow-darkest { + background-color: #302703 !important; +} + +a.bg-yellow-darkest:hover, a.bg-yellow-darkest:focus, +button.bg-yellow-darkest:hover, +button.bg-yellow-darkest:focus { + background-color: black !important; +} + +.bg-green-lightest { + background-color: #eff8e6 !important; +} + +a.bg-green-lightest:hover, a.bg-green-lightest:focus, +button.bg-green-lightest:hover, +button.bg-green-lightest:focus { + background-color: #d6edbe !important; +} + +.bg-green-lighter { + background-color: #cfeab3 !important; +} + +a.bg-green-lighter:hover, a.bg-green-lighter:focus, +button.bg-green-lighter:hover, +button.bg-green-lighter:focus { + background-color: #b6df8b !important; +} + +.bg-green-light { + background-color: #8ecf4d !important; +} + +a.bg-green-light:hover, a.bg-green-light:focus, +button.bg-green-light:hover, +button.bg-green-light:focus { + background-color: #75b831 !important; +} + +.bg-green-dark { + background-color: #4b9500 !important; +} + +a.bg-green-dark:hover, a.bg-green-dark:focus, +button.bg-green-dark:hover, +button.bg-green-dark:focus { + background-color: #316200 !important; +} + +.bg-green-darker { + background-color: #264a00 !important; +} + +a.bg-green-darker:hover, a.bg-green-darker:focus, +button.bg-green-darker:hover, +button.bg-green-darker:focus { + background-color: #0c1700 !important; +} + +.bg-green-darkest { + background-color: #132500 !important; +} + +a.bg-green-darkest:hover, a.bg-green-darkest:focus, +button.bg-green-darkest:hover, +button.bg-green-darkest:focus { + background-color: black !important; +} + +.bg-teal-lightest { + background-color: #eafaf8 !important; +} + +a.bg-teal-lightest:hover, a.bg-teal-lightest:focus, +button.bg-teal-lightest:hover, +button.bg-teal-lightest:focus { + background-color: #c1f0ea !important; +} + +.bg-teal-lighter { + background-color: #bfefea !important; +} + +a.bg-teal-lighter:hover, a.bg-teal-lighter:focus, +button.bg-teal-lighter:hover, +button.bg-teal-lighter:focus { + background-color: #96e5dd !important; +} + +.bg-teal-light { + background-color: #6bdbcf !important; +} + +a.bg-teal-light:hover, a.bg-teal-light:focus, +button.bg-teal-light:hover, +button.bg-teal-light:focus { + background-color: #42d1c2 !important; +} + +.bg-teal-dark { + background-color: #22a295 !important; +} + +a.bg-teal-dark:hover, a.bg-teal-dark:focus, +button.bg-teal-dark:hover, +button.bg-teal-dark:focus { + background-color: #19786e !important; +} + +.bg-teal-darker { + background-color: #11514a !important; +} + +a.bg-teal-darker:hover, a.bg-teal-darker:focus, +button.bg-teal-darker:hover, +button.bg-teal-darker:focus { + background-color: #082723 !important; +} + +.bg-teal-darkest { + background-color: #092925 !important; +} + +a.bg-teal-darkest:hover, a.bg-teal-darkest:focus, +button.bg-teal-darkest:hover, +button.bg-teal-darkest:focus { + background-color: black !important; +} + +.bg-cyan-lightest { + background-color: #e8f6f8 !important; +} + +a.bg-cyan-lightest:hover, a.bg-cyan-lightest:focus, +button.bg-cyan-lightest:hover, +button.bg-cyan-lightest:focus { + background-color: #c1e7ec !important; +} + +.bg-cyan-lighter { + background-color: #b9e3ea !important; +} + +a.bg-cyan-lighter:hover, a.bg-cyan-lighter:focus, +button.bg-cyan-lighter:hover, +button.bg-cyan-lighter:focus { + background-color: #92d3de !important; +} + +.bg-cyan-light { + background-color: #5dbecd !important; +} + +a.bg-cyan-light:hover, a.bg-cyan-light:focus, +button.bg-cyan-light:hover, +button.bg-cyan-light:focus { + background-color: #3aabbd !important; +} + +.bg-cyan-dark { + background-color: #128293 !important; +} + +a.bg-cyan-dark:hover, a.bg-cyan-dark:focus, +button.bg-cyan-dark:hover, +button.bg-cyan-dark:focus { + background-color: #0c5a66 !important; +} + +.bg-cyan-darker { + background-color: #09414a !important; +} + +a.bg-cyan-darker:hover, a.bg-cyan-darker:focus, +button.bg-cyan-darker:hover, +button.bg-cyan-darker:focus { + background-color: #03191d !important; +} + +.bg-cyan-darkest { + background-color: #052025 !important; +} + +a.bg-cyan-darkest:hover, a.bg-cyan-darkest:focus, +button.bg-cyan-darkest:hover, +button.bg-cyan-darkest:focus { + background-color: black !important; +} + +.bg-white-lightest { + background-color: white !important; +} + +a.bg-white-lightest:hover, a.bg-white-lightest:focus, +button.bg-white-lightest:hover, +button.bg-white-lightest:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-lighter { + background-color: white !important; +} + +a.bg-white-lighter:hover, a.bg-white-lighter:focus, +button.bg-white-lighter:hover, +button.bg-white-lighter:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-light { + background-color: white !important; +} + +a.bg-white-light:hover, a.bg-white-light:focus, +button.bg-white-light:hover, +button.bg-white-light:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-dark { + background-color: #cccccc !important; +} + +a.bg-white-dark:hover, a.bg-white-dark:focus, +button.bg-white-dark:hover, +button.bg-white-dark:focus { + background-color: #b3b2b2 !important; +} + +.bg-white-darker { + background-color: #666666 !important; +} + +a.bg-white-darker:hover, a.bg-white-darker:focus, +button.bg-white-darker:hover, +button.bg-white-darker:focus { + background-color: #4d4c4c !important; +} + +.bg-white-darkest { + background-color: #333333 !important; +} + +a.bg-white-darkest:hover, a.bg-white-darkest:focus, +button.bg-white-darkest:hover, +button.bg-white-darkest:focus { + background-color: #1a1919 !important; +} + +.bg-gray-lightest { + background-color: #f3f4f5 !important; +} + +a.bg-gray-lightest:hover, a.bg-gray-lightest:focus, +button.bg-gray-lightest:hover, +button.bg-gray-lightest:focus { + background-color: #d7dbde !important; +} + +.bg-gray-lighter { + background-color: #dbdde0 !important; +} + +a.bg-gray-lighter:hover, a.bg-gray-lighter:focus, +button.bg-gray-lighter:hover, +button.bg-gray-lighter:focus { + background-color: #c0c3c8 !important; +} + +.bg-gray-light { + background-color: #aab0b6 !important; +} + +a.bg-gray-light:hover, a.bg-gray-light:focus, +button.bg-gray-light:hover, +button.bg-gray-light:focus { + background-color: #8f979e !important; +} + +.bg-gray-dark { + background-color: #6b7278 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #53585d !important; +} + +.bg-gray-darker { + background-color: #36393c !important; +} + +a.bg-gray-darker:hover, a.bg-gray-darker:focus, +button.bg-gray-darker:hover, +button.bg-gray-darker:focus { + background-color: #1e2021 !important; +} + +.bg-gray-darkest { + background-color: #1b1c1e !important; +} + +a.bg-gray-darkest:hover, a.bg-gray-darkest:focus, +button.bg-gray-darkest:hover, +button.bg-gray-darkest:focus { + background-color: #030303 !important; +} + +.bg-gray-dark-lightest { + background-color: #ebebec !important; +} + +a.bg-gray-dark-lightest:hover, a.bg-gray-dark-lightest:focus, +button.bg-gray-dark-lightest:hover, +button.bg-gray-dark-lightest:focus { + background-color: #d1d1d3 !important; +} + +.bg-gray-dark-lighter { + background-color: #c2c4c6 !important; +} + +a.bg-gray-dark-lighter:hover, a.bg-gray-dark-lighter:focus, +button.bg-gray-dark-lighter:hover, +button.bg-gray-dark-lighter:focus { + background-color: #a8abad !important; +} + +.bg-gray-dark-light { + background-color: #717579 !important; +} + +a.bg-gray-dark-light:hover, a.bg-gray-dark-light:focus, +button.bg-gray-dark-light:hover, +button.bg-gray-dark-light:focus { + background-color: #585c5f !important; +} + +.bg-gray-dark-dark { + background-color: #2a2e33 !important; +} + +a.bg-gray-dark-dark:hover, a.bg-gray-dark-dark:focus, +button.bg-gray-dark-dark:hover, +button.bg-gray-dark-dark:focus { + background-color: #131517 !important; +} + +.bg-gray-dark-darker { + background-color: #15171a !important; +} + +a.bg-gray-dark-darker:hover, a.bg-gray-dark-darker:focus, +button.bg-gray-dark-darker:hover, +button.bg-gray-dark-darker:focus { + background-color: black !important; +} + +.bg-gray-dark-darkest { + background-color: #0a0c0d !important; +} + +a.bg-gray-dark-darkest:hover, a.bg-gray-dark-darkest:focus, +button.bg-gray-dark-darkest:hover, +button.bg-gray-dark-darkest:focus { + background-color: black !important; +} + +.bg-azure-lightest { + background-color: #ecf7fe !important; +} + +a.bg-azure-lightest:hover, a.bg-azure-lightest:focus, +button.bg-azure-lightest:hover, +button.bg-azure-lightest:focus { + background-color: #bce3fb !important; +} + +.bg-azure-lighter { + background-color: #c7e6fb !important; +} + +a.bg-azure-lighter:hover, a.bg-azure-lighter:focus, +button.bg-azure-lighter:hover, +button.bg-azure-lighter:focus { + background-color: #97d1f8 !important; +} + +.bg-azure-light { + background-color: #7dc4f6 !important; +} + +a.bg-azure-light:hover, a.bg-azure-light:focus, +button.bg-azure-light:hover, +button.bg-azure-light:focus { + background-color: #4daef3 !important; +} + +.bg-azure-dark { + background-color: #3788c2 !important; +} + +a.bg-azure-dark:hover, a.bg-azure-dark:focus, +button.bg-azure-dark:hover, +button.bg-azure-dark:focus { + background-color: #2c6c9a !important; +} + +.bg-azure-darker { + background-color: #1c4461 !important; +} + +a.bg-azure-darker:hover, a.bg-azure-darker:focus, +button.bg-azure-darker:hover, +button.bg-azure-darker:focus { + background-color: #112839 !important; +} + +.bg-azure-darkest { + background-color: #0e2230 !important; +} + +a.bg-azure-darkest:hover, a.bg-azure-darkest:focus, +button.bg-azure-darkest:hover, +button.bg-azure-darkest:focus { + background-color: #020609 !important; +} + +.bg-lime-lightest { + background-color: #f2fbeb !important; +} + +a.bg-lime-lightest:hover, a.bg-lime-lightest:focus, +button.bg-lime-lightest:hover, +button.bg-lime-lightest:focus { + background-color: #d6f3c1 !important; +} + +.bg-lime-lighter { + background-color: #d7f2c2 !important; +} + +a.bg-lime-lighter:hover, a.bg-lime-lighter:focus, +button.bg-lime-lighter:hover, +button.bg-lime-lighter:focus { + background-color: #bbe998 !important; +} + +.bg-lime-light { + background-color: #a3e072 !important; +} + +a.bg-lime-light:hover, a.bg-lime-light:focus, +button.bg-lime-light:hover, +button.bg-lime-light:focus { + background-color: #88d748 !important; +} + +.bg-lime-dark { + background-color: #62a82a !important; +} + +a.bg-lime-dark:hover, a.bg-lime-dark:focus, +button.bg-lime-dark:hover, +button.bg-lime-dark:focus { + background-color: #4a7f20 !important; +} + +.bg-lime-darker { + background-color: #315415 !important; +} + +a.bg-lime-darker:hover, a.bg-lime-darker:focus, +button.bg-lime-darker:hover, +button.bg-lime-darker:focus { + background-color: #192b0b !important; +} + +.bg-lime-darkest { + background-color: #192a0b !important; +} + +a.bg-lime-darkest:hover, a.bg-lime-darkest:focus, +button.bg-lime-darkest:hover, +button.bg-lime-darkest:focus { + background-color: #010200 !important; +} + +.display-1 i, +.display-2 i, +.display-3 i, +.display-4 i { + vertical-align: baseline; + font-size: 0.815em; +} + +.text-inherit { + color: inherit !important; +} + +.text-default { + color: #495057 !important; +} + +.text-muted-dark { + color: #6e7687 !important; +} + +.tracking-tight { + letter-spacing: -0.05em !important; +} + +.tracking-normal { + letter-spacing: 0 !important; +} + +.tracking-wide { + letter-spacing: 0.05em !important; +} + +.leading-none { + line-height: 1 !important; +} + +.leading-tight { + line-height: 1.25 !important; +} + +.leading-normal { + line-height: 1.5 !important; +} + +.leading-loose { + line-height: 2 !important; +} + +.bg-blue { + background-color: #467fcf !important; +} + +a.bg-blue:hover, a.bg-blue:focus, +button.bg-blue:hover, +button.bg-blue:focus { + background-color: #2f66b3 !important; +} + +.text-blue { + color: #467fcf !important; +} + +.bg-indigo { + background-color: #6574cd !important; +} + +a.bg-indigo:hover, a.bg-indigo:focus, +button.bg-indigo:hover, +button.bg-indigo:focus { + background-color: #3f51c1 !important; +} + +.text-indigo { + color: #6574cd !important; +} + +.bg-purple { + background-color: #a55eea !important; +} + +a.bg-purple:hover, a.bg-purple:focus, +button.bg-purple:hover, +button.bg-purple:focus { + background-color: #8c31e4 !important; +} + +.text-purple { + color: #a55eea !important; +} + +.bg-pink { + background-color: #f66d9b !important; +} + +a.bg-pink:hover, a.bg-pink:focus, +button.bg-pink:hover, +button.bg-pink:focus { + background-color: #f33d7a !important; +} + +.text-pink { + color: #f66d9b !important; +} + +.bg-red { + background-color: #cd201f !important; +} + +a.bg-red:hover, a.bg-red:focus, +button.bg-red:hover, +button.bg-red:focus { + background-color: #a11918 !important; +} + +.text-red { + color: #cd201f !important; +} + +.bg-orange { + background-color: #fd9644 !important; +} + +a.bg-orange:hover, a.bg-orange:focus, +button.bg-orange:hover, +button.bg-orange:focus { + background-color: #fc7a12 !important; +} + +.text-orange { + color: #fd9644 !important; +} + +.bg-yellow { + background-color: #f1c40f !important; +} + +a.bg-yellow:hover, a.bg-yellow:focus, +button.bg-yellow:hover, +button.bg-yellow:focus { + background-color: #c29d0b !important; +} + +.text-yellow { + color: #f1c40f !important; +} + +.bg-green { + background-color: #5eba00 !important; +} + +a.bg-green:hover, a.bg-green:focus, +button.bg-green:hover, +button.bg-green:focus { + background-color: #448700 !important; +} + +.text-green { + color: #5eba00 !important; +} + +.bg-teal { + background-color: #2bcbba !important; +} + +a.bg-teal:hover, a.bg-teal:focus, +button.bg-teal:hover, +button.bg-teal:focus { + background-color: #22a193 !important; +} + +.text-teal { + color: #2bcbba !important; +} + +.bg-cyan { + background-color: #17a2b8 !important; +} + +a.bg-cyan:hover, a.bg-cyan:focus, +button.bg-cyan:hover, +button.bg-cyan:focus { + background-color: #117a8b !important; +} + +.text-cyan { + color: #17a2b8 !important; +} + +.bg-white { + background-color: #fff !important; +} + +a.bg-white:hover, a.bg-white:focus, +button.bg-white:hover, +button.bg-white:focus { + background-color: #e6e5e5 !important; +} + +.text-white { + color: #fff !important; +} + +.bg-gray { + background-color: #868e96 !important; +} + +a.bg-gray:hover, a.bg-gray:focus, +button.bg-gray:hover, +button.bg-gray:focus { + background-color: #6c757d !important; +} + +.text-gray { + color: #868e96 !important; +} + +.bg-gray-dark { + background-color: #343a40 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #1d2124 !important; +} + +.text-gray-dark { + color: #343a40 !important; +} + +.bg-azure { + background-color: #45aaf2 !important; +} + +a.bg-azure:hover, a.bg-azure:focus, +button.bg-azure:hover, +button.bg-azure:focus { + background-color: #1594ef !important; +} + +.text-azure { + color: #45aaf2 !important; +} + +.bg-lime { + background-color: #7bd235 !important; +} + +a.bg-lime:hover, a.bg-lime:focus, +button.bg-lime:hover, +button.bg-lime:focus { + background-color: #63ad27 !important; +} + +.text-lime { + color: #7bd235 !important; +} + +.icon { + color: #9aa0ac !important; +} + +.icon i { + vertical-align: -1px; +} + +a.icon { + text-decoration: none; + cursor: pointer; +} + +a.icon:hover { + color: #495057 !important; +} + +.o-auto { + overflow: auto !important; +} + +.o-hidden { + overflow: hidden !important; +} + +.shadow { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.nav-link, +.nav-item { + padding: 0 .75rem; + min-width: 2rem; + transition: .3s color; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.nav-link .badge, +.nav-item .badge { + position: absolute; + top: 0; + right: 0; + padding: .2rem .25rem; + min-width: 1rem; +} + +.nav-tabs { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + color: #9aa0ac; + margin: 0 -.75rem; +} + +.nav-tabs .nav-link { + border: 0; + color: inherit; + border-bottom: 1px solid transparent; + margin-bottom: -1px; + transition: .3s border-color; + font-weight: 400; + padding: 1rem 0; +} + +.nav-tabs .nav-link:hover:not(.disabled) { + border-color: #6e7687; + color: #6e7687; +} + +.nav-tabs .nav-link.active { + border-color: #467fcf; + color: #467fcf; + background: transparent; +} + +.nav-tabs .nav-link.disabled { + opacity: .4; + cursor: default; + pointer-events: none; +} + +.nav-tabs .nav-item { + margin-bottom: 0; + position: relative; +} + +.nav-tabs .nav-item i { + margin-right: .25rem; + line-height: 1; + font-size: 0.875rem; + width: 0.875rem; + vertical-align: baseline; + display: inline-block; +} + +.nav-tabs .nav-item:hover .nav-submenu { + display: block; +} + +.nav-tabs .nav-submenu { + display: none; + position: absolute; + background: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-top: none; + z-index: 10; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 10rem; + border-radius: 0 0 3px 3px; +} + +.nav-tabs .nav-submenu .nav-item { + display: block; + padding: .5rem 1rem; + color: #9aa0ac; + margin: 0 !important; + cursor: pointer; + transition: .3s background; +} + +.nav-tabs .nav-submenu .nav-item.active { + color: #467fcf; +} + +.nav-tabs .nav-submenu .nav-item:hover { + color: #6e7687; + text-decoration: none; + background: rgba(0, 0, 0, 0.024); +} + +.btn { + cursor: pointer; + font-weight: 600; + letter-spacing: .03em; + font-size: 0.8125rem; + min-width: 2.375rem; +} + +.btn i { + font-size: 1rem; + vertical-align: -2px; +} + +.btn-icon { + padding-left: .5rem; + padding-right: .5rem; + text-align: center; +} + +.btn-secondary { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); + box-shadow: 0 1px 1px 0 rgba(0, 0, 0, 0.05); +} + +.btn-secondary:hover { + color: #495057; + background-color: #f6f6f6; + border-color: rgba(0, 20, 49, 0.12); +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: rgba(0, 15, 36, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-pill { + border-radius: 10rem; + padding-left: 1.5em; + padding-right: 1.5em; +} + +.btn-square { + border-radius: 0; +} + +.btn-facebook { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:hover { + color: #fff; + background-color: #30497c; + border-color: #2d4373; +} + +.btn-facebook:focus, .btn-facebook.focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-facebook.disabled, .btn-facebook:disabled { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:not(:disabled):not(.disabled):active, .btn-facebook:not(:disabled):not(.disabled).active, +.show > .btn-facebook.dropdown-toggle { + color: #fff; + background-color: #2d4373; + border-color: #293e6a; +} + +.btn-facebook:not(:disabled):not(.disabled):active:focus, .btn-facebook:not(:disabled):not(.disabled).active:focus, +.show > .btn-facebook.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-twitter { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:hover { + color: #fff; + background-color: #0d8ddc; + border-color: #0c85d0; +} + +.btn-twitter:focus, .btn-twitter.focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-twitter.disabled, .btn-twitter:disabled { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:not(:disabled):not(.disabled):active, .btn-twitter:not(:disabled):not(.disabled).active, +.show > .btn-twitter.dropdown-toggle { + color: #fff; + background-color: #0c85d0; + border-color: #0b7ec4; +} + +.btn-twitter:not(:disabled):not(.disabled):active:focus, .btn-twitter:not(:disabled):not(.disabled).active:focus, +.show > .btn-twitter.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-google { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:hover { + color: #fff; + background-color: #d03526; + border-color: #c63224; +} + +.btn-google:focus, .btn-google.focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-google.disabled, .btn-google:disabled { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:not(:disabled):not(.disabled):active, .btn-google:not(:disabled):not(.disabled).active, +.show > .btn-google.dropdown-toggle { + color: #fff; + background-color: #c63224; + border-color: #bb2f22; +} + +.btn-google:not(:disabled):not(.disabled):active:focus, .btn-google:not(:disabled):not(.disabled).active:focus, +.show > .btn-google.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-youtube { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:hover { + color: #fff; + background-color: #d90000; + border-color: #cc0000; +} + +.btn-youtube:focus, .btn-youtube.focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-youtube.disabled, .btn-youtube:disabled { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:not(:disabled):not(.disabled):active, .btn-youtube:not(:disabled):not(.disabled).active, +.show > .btn-youtube.dropdown-toggle { + color: #fff; + background-color: #cc0000; + border-color: #bf0000; +} + +.btn-youtube:not(:disabled):not(.disabled):active:focus, .btn-youtube:not(:disabled):not(.disabled).active:focus, +.show > .btn-youtube.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-vimeo { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:hover { + color: #fff; + background-color: #139ecb; + border-color: #1295bf; +} + +.btn-vimeo:focus, .btn-vimeo.focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-vimeo.disabled, .btn-vimeo:disabled { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:not(:disabled):not(.disabled):active, .btn-vimeo:not(:disabled):not(.disabled).active, +.show > .btn-vimeo.dropdown-toggle { + color: #fff; + background-color: #1295bf; + border-color: #108cb4; +} + +.btn-vimeo:not(:disabled):not(.disabled):active:focus, .btn-vimeo:not(:disabled):not(.disabled).active:focus, +.show > .btn-vimeo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-dribbble { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:hover { + color: #fff; + background-color: #e62a72; + border-color: #e51e6b; +} + +.btn-dribbble:focus, .btn-dribbble.focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-dribbble.disabled, .btn-dribbble:disabled { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:not(:disabled):not(.disabled):active, .btn-dribbble:not(:disabled):not(.disabled).active, +.show > .btn-dribbble.dropdown-toggle { + color: #fff; + background-color: #e51e6b; + border-color: #dc1a65; +} + +.btn-dribbble:not(:disabled):not(.disabled):active:focus, .btn-dribbble:not(:disabled):not(.disabled).active:focus, +.show > .btn-dribbble.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-github { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:hover { + color: #fff; + background-color: #040404; + border-color: black; +} + +.btn-github:focus, .btn-github.focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-github.disabled, .btn-github:disabled { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:not(:disabled):not(.disabled):active, .btn-github:not(:disabled):not(.disabled).active, +.show > .btn-github.dropdown-toggle { + color: #fff; + background-color: black; + border-color: black; +} + +.btn-github:not(:disabled):not(.disabled):active:focus, .btn-github:not(:disabled):not(.disabled).active:focus, +.show > .btn-github.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-instagram { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:hover { + color: #fff; + background-color: #de1f44; + border-color: #d31e40; +} + +.btn-instagram:focus, .btn-instagram.focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-instagram.disabled, .btn-instagram:disabled { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:not(:disabled):not(.disabled):active, .btn-instagram:not(:disabled):not(.disabled).active, +.show > .btn-instagram.dropdown-toggle { + color: #fff; + background-color: #d31e40; + border-color: #c81c3d; +} + +.btn-instagram:not(:disabled):not(.disabled):active:focus, .btn-instagram:not(:disabled):not(.disabled).active:focus, +.show > .btn-instagram.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-pinterest { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:hover { + color: #fff; + background-color: #980617; + border-color: #8c0615; +} + +.btn-pinterest:focus, .btn-pinterest.focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-pinterest.disabled, .btn-pinterest:disabled { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:not(:disabled):not(.disabled):active, .btn-pinterest:not(:disabled):not(.disabled).active, +.show > .btn-pinterest.dropdown-toggle { + color: #fff; + background-color: #8c0615; + border-color: #800513; +} + +.btn-pinterest:not(:disabled):not(.disabled):active:focus, .btn-pinterest:not(:disabled):not(.disabled).active:focus, +.show > .btn-pinterest.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-vk { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:hover { + color: #fff; + background-color: #527093; + border-color: #4d6a8b; +} + +.btn-vk:focus, .btn-vk.focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-vk.disabled, .btn-vk:disabled { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:not(:disabled):not(.disabled):active, .btn-vk:not(:disabled):not(.disabled).active, +.show > .btn-vk.dropdown-toggle { + color: #fff; + background-color: #4d6a8b; + border-color: #496482; +} + +.btn-vk:not(:disabled):not(.disabled):active:focus, .btn-vk:not(:disabled):not(.disabled).active:focus, +.show > .btn-vk.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-rss { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:hover { + color: #fff; + background-color: #d98c00; + border-color: #cc8400; +} + +.btn-rss:focus, .btn-rss.focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-rss.disabled, .btn-rss:disabled { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:not(:disabled):not(.disabled):active, .btn-rss:not(:disabled):not(.disabled).active, +.show > .btn-rss.dropdown-toggle { + color: #fff; + background-color: #cc8400; + border-color: #bf7c00; +} + +.btn-rss:not(:disabled):not(.disabled):active:focus, .btn-rss:not(:disabled):not(.disabled).active:focus, +.show > .btn-rss.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-flickr { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:hover { + color: #fff; + background-color: #0052b6; + border-color: #004ca9; +} + +.btn-flickr:focus, .btn-flickr.focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-flickr.disabled, .btn-flickr:disabled { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:not(:disabled):not(.disabled):active, .btn-flickr:not(:disabled):not(.disabled).active, +.show > .btn-flickr.dropdown-toggle { + color: #fff; + background-color: #004ca9; + border-color: #00469c; +} + +.btn-flickr:not(:disabled):not(.disabled):active:focus, .btn-flickr:not(:disabled):not(.disabled).active:focus, +.show > .btn-flickr.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-bitbucket { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:hover { + color: #fff; + background-color: #0043a6; + border-color: #003e99; +} + +.btn-bitbucket:focus, .btn-bitbucket.focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-bitbucket.disabled, .btn-bitbucket:disabled { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active, .btn-bitbucket:not(:disabled):not(.disabled).active, +.show > .btn-bitbucket.dropdown-toggle { + color: #fff; + background-color: #003e99; + border-color: #00388c; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active:focus, .btn-bitbucket:not(:disabled):not(.disabled).active:focus, +.show > .btn-bitbucket.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-blue { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-blue:focus, .btn-blue.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-blue.disabled, .btn-blue:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:not(:disabled):not(.disabled):active, .btn-blue:not(:disabled):not(.disabled).active, +.show > .btn-blue.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-blue:not(:disabled):not(.disabled):active:focus, .btn-blue:not(:disabled):not(.disabled).active:focus, +.show > .btn-blue.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-indigo { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:hover { + color: #fff; + background-color: #485ac4; + border-color: #3f51c1; +} + +.btn-indigo:focus, .btn-indigo.focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-indigo.disabled, .btn-indigo:disabled { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:not(:disabled):not(.disabled):active, .btn-indigo:not(:disabled):not(.disabled).active, +.show > .btn-indigo.dropdown-toggle { + color: #fff; + background-color: #3f51c1; + border-color: #3b4db7; +} + +.btn-indigo:not(:disabled):not(.disabled):active:focus, .btn-indigo:not(:disabled):not(.disabled).active:focus, +.show > .btn-indigo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-purple { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:hover { + color: #fff; + background-color: #923ce6; + border-color: #8c31e4; +} + +.btn-purple:focus, .btn-purple.focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-purple.disabled, .btn-purple:disabled { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:not(:disabled):not(.disabled):active, .btn-purple:not(:disabled):not(.disabled).active, +.show > .btn-purple.dropdown-toggle { + color: #fff; + background-color: #8c31e4; + border-color: #8526e3; +} + +.btn-purple:not(:disabled):not(.disabled):active:focus, .btn-purple:not(:disabled):not(.disabled).active:focus, +.show > .btn-purple.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-pink { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:hover { + color: #fff; + background-color: #f44982; + border-color: #f33d7a; +} + +.btn-pink:focus, .btn-pink.focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-pink.disabled, .btn-pink:disabled { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:not(:disabled):not(.disabled):active, .btn-pink:not(:disabled):not(.disabled).active, +.show > .btn-pink.dropdown-toggle { + color: #fff; + background-color: #f33d7a; + border-color: #f23172; +} + +.btn-pink:not(:disabled):not(.disabled):active:focus, .btn-pink:not(:disabled):not(.disabled).active:focus, +.show > .btn-pink.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-red { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-red:focus, .btn-red.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-red.disabled, .btn-red:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:not(:disabled):not(.disabled):active, .btn-red:not(:disabled):not(.disabled).active, +.show > .btn-red.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-red:not(:disabled):not(.disabled):active:focus, .btn-red:not(:disabled):not(.disabled).active:focus, +.show > .btn-red.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-orange { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:hover { + color: #fff; + background-color: #fd811e; + border-color: #fc7a12; +} + +.btn-orange:focus, .btn-orange.focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-orange.disabled, .btn-orange:disabled { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:not(:disabled):not(.disabled):active, .btn-orange:not(:disabled):not(.disabled).active, +.show > .btn-orange.dropdown-toggle { + color: #fff; + background-color: #fc7a12; + border-color: #fc7305; +} + +.btn-orange:not(:disabled):not(.disabled):active:focus, .btn-orange:not(:disabled):not(.disabled).active:focus, +.show > .btn-orange.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-yellow { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-yellow:focus, .btn-yellow.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-yellow.disabled, .btn-yellow:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:not(:disabled):not(.disabled):active, .btn-yellow:not(:disabled):not(.disabled).active, +.show > .btn-yellow.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-yellow:not(:disabled):not(.disabled):active:focus, .btn-yellow:not(:disabled):not(.disabled).active:focus, +.show > .btn-yellow.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-green { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-green:focus, .btn-green.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-green.disabled, .btn-green:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:not(:disabled):not(.disabled):active, .btn-green:not(:disabled):not(.disabled).active, +.show > .btn-green.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-green:not(:disabled):not(.disabled):active:focus, .btn-green:not(:disabled):not(.disabled).active:focus, +.show > .btn-green.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-teal { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:hover { + color: #fff; + background-color: #24ab9d; + border-color: #22a193; +} + +.btn-teal:focus, .btn-teal.focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-teal.disabled, .btn-teal:disabled { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:not(:disabled):not(.disabled):active, .btn-teal:not(:disabled):not(.disabled).active, +.show > .btn-teal.dropdown-toggle { + color: #fff; + background-color: #22a193; + border-color: #20968a; +} + +.btn-teal:not(:disabled):not(.disabled):active:focus, .btn-teal:not(:disabled):not(.disabled).active:focus, +.show > .btn-teal.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-cyan { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:hover { + color: #fff; + background-color: #138496; + border-color: #117a8b; +} + +.btn-cyan:focus, .btn-cyan.focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-cyan.disabled, .btn-cyan:disabled { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:not(:disabled):not(.disabled):active, .btn-cyan:not(:disabled):not(.disabled).active, +.show > .btn-cyan.dropdown-toggle { + color: #fff; + background-color: #117a8b; + border-color: #10707f; +} + +.btn-cyan:not(:disabled):not(.disabled):active:focus, .btn-cyan:not(:disabled):not(.disabled).active:focus, +.show > .btn-cyan.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-white { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:hover { + color: #495057; + background-color: #ececec; + border-color: #e6e5e5; +} + +.btn-white:focus, .btn-white.focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-white.disabled, .btn-white:disabled { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:not(:disabled):not(.disabled):active, .btn-white:not(:disabled):not(.disabled).active, +.show > .btn-white.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: #dfdfdf; +} + +.btn-white:not(:disabled):not(.disabled):active:focus, .btn-white:not(:disabled):not(.disabled).active:focus, +.show > .btn-white.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-gray { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-gray:focus, .btn-gray.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray.disabled, .btn-gray:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:not(:disabled):not(.disabled):active, .btn-gray:not(:disabled):not(.disabled).active, +.show > .btn-gray.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-gray:not(:disabled):not(.disabled):active:focus, .btn-gray:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-gray-dark:focus, .btn-gray-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-gray-dark.disabled, .btn-gray-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active, .btn-gray-dark:not(:disabled):not(.disabled).active, +.show > .btn-gray-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active:focus, .btn-gray-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-azure { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-azure:focus, .btn-azure.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-azure.disabled, .btn-azure:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:not(:disabled):not(.disabled):active, .btn-azure:not(:disabled):not(.disabled).active, +.show > .btn-azure.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-azure:not(:disabled):not(.disabled):active:focus, .btn-azure:not(:disabled):not(.disabled).active:focus, +.show > .btn-azure.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-lime { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:hover { + color: #fff; + background-color: #69b829; + border-color: #63ad27; +} + +.btn-lime:focus, .btn-lime.focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-lime.disabled, .btn-lime:disabled { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:not(:disabled):not(.disabled):active, .btn-lime:not(:disabled):not(.disabled).active, +.show > .btn-lime.dropdown-toggle { + color: #fff; + background-color: #63ad27; + border-color: #5da324; +} + +.btn-lime:not(:disabled):not(.disabled):active:focus, .btn-lime:not(:disabled):not(.disabled).active:focus, +.show > .btn-lime.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-option { + background: transparent; + color: #9aa0ac; +} + +.btn-option:hover { + color: #6e7687; +} + +.btn-option:focus { + box-shadow: none; + color: #6e7687; +} + +.btn-sm, .btn-group-sm > .btn { + font-size: 0.75rem; + min-width: 1.625rem; +} + +.btn-lg, .btn-group-lg > .btn { + font-size: 1rem; + min-width: 2.75rem; + font-weight: 400; +} + +.btn-list { + margin-bottom: -.5rem; + font-size: 0; +} + +.btn-list > .btn, +.btn-list > .dropdown { + margin-bottom: .5rem; +} + +.btn-list > .btn:not(:last-child), +.btn-list > .dropdown:not(:last-child) { + margin-right: .5rem; +} + +.btn-loading { + color: transparent !important; + pointer-events: none; + position: relative; +} + +.btn-loading:after { + content: ''; + -webkit-animation: loader 500ms infinite linear; + animation: loader 500ms infinite linear; + border: 2px solid #fff; + border-radius: 50%; + border-right-color: transparent !important; + border-top-color: transparent !important; + display: block; + height: 1.4em; + width: 1.4em; + position: absolute; + left: calc(50% - (1.4em / 2)); + top: calc(50% - (1.4em / 2)); + -webkit-transform-origin: center; + transform-origin: center; + position: absolute !important; +} + +.btn-loading.btn-sm:after, .btn-group-sm > .btn-loading.btn:after { + height: 1em; + width: 1em; + left: calc(50% - (1em / 2)); + top: calc(50% - (1em / 2)); +} + +.btn-loading.btn-secondary:after { + border-color: #495057; +} + +.alert { + font-size: 0.9375rem; +} + +.alert-icon { + padding-left: 3rem; +} + +.alert-icon > i { + color: inherit !important; + font-size: 1rem; + position: absolute; + top: 1rem; + left: 1rem; +} + +.alert-avatar { + padding-left: 3.75rem; +} + +.alert-avatar .avatar { + position: absolute; + top: .5rem; + left: .75rem; +} + +.close { + font-size: 1rem; + line-height: 1.5; + transition: .3s color; +} + +.close:before { + content: '\ea00'; + font-family: "feather"; +} + +.badge { + color: #fff; +} + +.badge-default { + background: #e9ecef; + color: #868e96; +} + +.table thead th, .text-wrap table thead th { + border-top: 0; + border-bottom-width: 1px; + padding-top: .5rem; + padding-bottom: .5rem; +} + +.table th, .text-wrap table th { + color: #9aa0ac; + text-transform: uppercase; + font-size: 0.875rem; + font-weight: 400; +} + +.table-md th, +.table-md td { + padding: .5rem; +} + +.table-vcenter td, +.table-vcenter th { + vertical-align: middle; +} + +.table-center td, +.table-center th { + text-align: center; +} + +.table-striped tbody tr:nth-of-type(odd) { + background: transparent; +} + +.table-striped tbody tr:nth-of-type(even) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-calendar { + margin: 0 0 .75rem; +} + +.table-calendar td, +.table-calendar th { + border: 0; + text-align: center; + padding: 0 !important; + width: 14.28571429%; + line-height: 2.5rem; +} + +.table-calendar td { + border-top: 0; +} + +.table-calendar-link { + line-height: 2rem; + min-width: calc(2rem + 2px); + display: inline-block; + border-radius: 3px; + background: #f8f9fa; + color: #495057; + font-weight: 600; + transition: .3s background, .3s color; + position: relative; +} + +.table-calendar-link:before { + content: ''; + width: 4px; + height: 4px; + position: absolute; + left: .25rem; + top: .25rem; + border-radius: 50px; + background: #467fcf; +} + +.table-calendar-link:hover { + color: #fff; + text-decoration: none; + background: #467fcf; + transition: .3s background; +} + +.table-calendar-link:hover:before { + background: #fff; +} + +.table-header { + cursor: pointer; + transition: .3s color; +} + +.table-header:hover { + color: #495057 !important; +} + +.table-header:after { + content: '\f0dc'; + font-family: FontAwesome; + display: inline-block; + margin-left: .5rem; + font-size: .75rem; +} + +.table-header-asc { + color: #495057 !important; +} + +.table-header-asc:after { + content: '\f0de'; +} + +.table-header-desc { + color: #495057 !important; +} + +.table-header-desc:after { + content: '\f0dd'; +} + +.page-breadcrumb { + background: none; + padding: 0; + margin: 1rem 0 0; + font-size: 0.875rem; +} + +@media (min-width: 768px) { + .page-breadcrumb { + margin: -.5rem 0 0; + } +} + +.page-breadcrumb .breadcrumb-item { + color: #9aa0ac; +} + +.page-breadcrumb .breadcrumb-item.active { + color: #6e7687; +} + +.pagination-simple .page-item .page-link { + background: none; + border: none; +} + +.pagination-simple .page-item.active .page-link { + color: #495057; + font-weight: 700; +} + +.pagination-pager .page-prev { + margin-right: auto; +} + +.pagination-pager .page-next { + margin-left: auto; +} + +.page-total-text { + margin-right: 1rem; + -ms-flex-item-align: center; + align-self: center; + color: #6e7687; +} + +.card { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + position: relative; + margin-bottom: 1.5rem; + width: 100%; +} + +.card .card { + box-shadow: none; +} + +@media print { + .card { + box-shadow: none; + border: none; + } +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + margin: 0; + padding: 1.5rem 1.5rem; + position: relative; +} + +.card-body + .card-body { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-body > :last-child { + margin-bottom: 0; +} + +@media print { + .card-body { + padding: 0; + } +} + +.card-body-scrollable { + overflow: auto; +} + +.card-footer, +.card-bottom { + padding: 1rem 1.5rem; + background: none; +} + +.card-footer { + border-top: 1px solid rgba(0, 40, 100, 0.12); + color: #6e7687; +} + +.card-header { + background: none; + padding: 0.5rem 1.5rem; + display: -ms-flexbox; + display: flex; + min-height: 3.5rem; + -ms-flex-align: center; + align-items: center; +} + +.card-header .card-title { + margin-bottom: 0; +} + +.card-header.border-0 + .card-body { + padding-top: 0; +} + +@media print { + .card-header { + display: none; + } +} + +.card-img-top { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.card-img-overlay { + background-color: rgba(0, 0, 0, 0.4); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-title { + font-size: 1.125rem; + line-height: 1.2; + font-weight: 400; + margin-bottom: 1.5rem; +} + +.card-title a { + color: inherit; +} + +.card-title:only-child { + margin-bottom: 0; +} + +.card-title small, +.card-subtitle { + color: #9aa0ac; + font-size: 0.875rem; + display: block; + margin: -.75rem 0 1rem; + line-height: 1.1; + font-weight: 400; +} + +.card-table { + margin-bottom: 0; +} + +.card-table tr:first-child td, +.card-table tr:first-child th { + border-top: 0; +} + +.card-table tr td:first-child, +.card-table tr th:first-child { + padding-left: 1.5rem; +} + +.card-table tr td:last-child, +.card-table tr th:last-child { + padding-right: 1.5rem; +} + +.card-body + .card-table { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-profile .card-header { + height: 9rem; + background-size: cover; +} + +.card-profile-img { + max-width: 6rem; + margin-top: -5rem; + margin-bottom: 1rem; + border: 3px solid #fff; + border-radius: 100%; + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.1); +} + +.card-link + .card-link { + margin-left: 1rem; +} + +.card-body + .card-list-group { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-list-group .list-group-item { + border-right: 0; + border-left: 0; + border-radius: 0; + padding-left: 1.5rem; + padding-right: 1.5rem; +} + +.card-list-group .list-group-item:last-child { + border-bottom: 0; +} + +.card-list-group .list-group-item:first-child { + border-top: 0; +} + +.card-header-tabs { + margin: -1.25rem 0; + border-bottom: 0; + line-height: 2rem; +} + +.card-header-tabs .nav-item { + margin-bottom: 1px; +} + +.card-header-pills { + margin: -.75rem 0; +} + +.card-aside { + -ms-flex-direction: row; + flex-direction: row; +} + +.card-aside-column { + min-width: 5rem; + width: 30%; + -ms-flex: 0 0 30%; + flex: 0 0 30%; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; + background: no-repeat center/cover; +} + +.card-value { + font-size: 2.5rem; + line-height: 3.4rem; + height: 3.4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + font-weight: 400; +} + +.card-value i { + vertical-align: middle; +} + +.card-chart-bg { + height: 4rem; + margin-top: -1rem; + position: relative; + z-index: 1; + overflow: hidden; +} + +.card-options { + margin-left: auto; + display: -ms-flexbox; + display: flex; + -ms-flex-order: 100; + order: 100; + margin-right: -.5rem; + color: #9aa0ac; + -ms-flex-item-align: center; + align-self: center; +} + +.card-options a:not(.btn) { + margin-left: .5rem; + color: #9aa0ac; + display: inline-block; + min-width: 1rem; +} + +.card-options a:not(.btn):hover { + text-decoration: none; + color: #6e7687; +} + +.card-options a:not(.btn) i { + font-size: 1rem; + vertical-align: middle; +} + +.card-options .dropdown-toggle:after { + display: none; +} + +/* +Card options + */ +.card-collapsed > :not(.card-header):not(.card-status) { + display: none; +} + +.card-collapsed .card-options-collapse i:before { + content: '\e92d'; +} + +.card-fullscreen .card-options-fullscreen i:before { + content: '\e992'; +} + +.card-fullscreen .card-options-remove { + display: none; +} + +/* +Card maps + */ +.card-map { + height: 15rem; + background: #e9ecef; +} + +.card-map-placeholder { + background: no-repeat center; +} + +/** +Card tabs + */ +.card-tabs { + display: -ms-flexbox; + display: flex; +} + +.card-tabs-bottom .card-tabs-item { + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-tabs-bottom .card-tabs-item.active { + border-top-color: #fff; +} + +.card-tabs-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: block; + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); + color: inherit; + overflow: hidden; +} + +a.card-tabs-item { + background: #fafbfc; +} + +a.card-tabs-item:hover { + text-decoration: none; + color: inherit; +} + +a.card-tabs-item:focus { + z-index: 1; +} + +a.card-tabs-item.active { + background: #fff; + border-bottom-color: #fff; +} + +.card-tabs-item + .card-tabs-item { + border-left: 1px solid rgba(0, 40, 100, 0.12); +} + +/** +Card status + */ +.card-status { + position: absolute; + top: -1px; + left: -1px; + right: -1px; + height: 3px; + border-radius: 3px 3px 0 0; + background: rgba(0, 40, 100, 0.12); +} + +.card-status-left { + right: auto; + bottom: 0; + height: auto; + width: 3px; + border-radius: 3px 0 0 3px; +} + +/** +Card icon + */ +.card-icon { + width: 3rem; + font-size: 2.5rem; + line-height: 3rem; + text-align: center; +} + +/** +Card fullscreen + */ +.card-fullscreen { + position: fixed; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: 1; + margin: 0; +} + +/** +Card alert + */ +.card-alert { + border-radius: 0; + margin: -1px -1px 0; +} + +.card-category { + font-size: 0.875rem; + text-transform: uppercase; + text-align: center; + font-weight: 600; + letter-spacing: .05em; + margin: 0 0 .5rem; +} + +.popover { + -webkit-filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); + filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); +} + +.popover.bs-popover-top, .popover.bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.625rem; +} + +.popover .arrow { + margin-left: calc(.25rem + 2px); +} + +.dropdown { + display: inline-block; +} + +.dropdown-menu { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 12rem; +} + +.dropdown-item { + color: #6e7687; +} + +.dropdown-menu-arrow:before { + position: absolute; + top: -6px; + left: 12px; + display: inline-block; + border-right: 5px solid transparent; + border-bottom: 5px solid rgba(0, 40, 100, 0.12); + border-left: 5px solid transparent; + border-bottom-color: rgba(0, 0, 0, 0.2); + content: ''; +} + +.dropdown-menu-arrow:after { + position: absolute; + top: -5px; + left: 12px; + display: inline-block; + border-right: 5px solid transparent; + border-bottom: 5px solid #fff; + border-left: 5px solid transparent; + content: ''; +} + +.dropdown-menu-arrow.dropdown-menu-right:before, .dropdown-menu-arrow.dropdown-menu-right:after { + left: auto; + right: 12px; +} + +.dropdown-toggle { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; +} + +.dropdown-toggle:after { + vertical-align: 0.155em; +} + +.dropdown-toggle:empty:after { + margin-left: 0; +} + +.dropdown-icon { + color: #9aa0ac; + margin-right: .5rem; + margin-left: -.5rem; + width: 1em; + display: inline-block; + text-align: center; + vertical-align: -1px; +} + +.list-inline-dots .list-inline-item + .list-inline-item:before { + content: '· '; + margin-left: -2px; + margin-right: 3px; +} + +.list-separated-item { + padding: 1rem 0; +} + +.list-separated-item:first-child { + padding-top: 0; +} + +.list-separated-item:last-child { + padding-bottom: 0; +} + +.list-separated-item + .list-separated-item { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item.active .icon { + color: inherit !important; +} + +.list-group-transparent .list-group-item { + background: none; + border: 0; + padding: .5rem 1rem; + border-radius: 3px; +} + +.list-group-transparent .list-group-item.active { + background: rgba(70, 127, 207, 0.06); + font-weight: 600; +} + +.avatar { + width: 2rem; + height: 2rem; + line-height: 2rem; + border-radius: 50%; + display: inline-block; + background: #ced4da no-repeat center/cover; + position: relative; + text-align: center; + color: #868e96; + font-weight: 600; + vertical-align: bottom; + font-size: .875rem; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.avatar i { + font-size: 125%; + vertical-align: sub; +} + +.avatar-status { + position: absolute; + right: -2px; + bottom: -2px; + width: .75rem; + height: .75rem; + border: 2px solid #fff; + background: #868e96; + border-radius: 50%; +} + +.avatar-sm { + width: 1.5rem; + height: 1.5rem; + line-height: 1.5rem; + font-size: .75rem; +} + +.avatar-md { + width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; + font-size: 1rem; +} + +.avatar-lg { + width: 3rem; + height: 3rem; + line-height: 3rem; + font-size: 1.25rem; +} + +.avatar-xl { + width: 4rem; + height: 4rem; + line-height: 4rem; + font-size: 1.75rem; +} + +.avatar-xxl { + width: 5rem; + height: 5rem; + line-height: 5rem; + font-size: 2rem; +} + +.avatar-placeholder { + background: #ced4da url('data:image/svg+xml;charset=utf8,') no-repeat center/80%; +} + +.avatar-list { + margin: 0 0 -.5rem; + padding: 0; + font-size: 0; +} + +.avatar-list .avatar { + margin-bottom: .5rem; +} + +.avatar-list .avatar:not(:last-child) { + margin-right: .5rem; +} + +.avatar-list-stacked .avatar { + margin-right: -.8em !important; +} + +.avatar-list-stacked .avatar { + box-shadow: 0 0 0 2px #fff; +} + +.avatar-blue { + background-color: #c8d9f1; + color: #467fcf; +} + +.avatar-indigo { + background-color: #d1d5f0; + color: #6574cd; +} + +.avatar-purple { + background-color: #e4cff9; + color: #a55eea; +} + +.avatar-pink { + background-color: #fcd3e1; + color: #f66d9b; +} + +.avatar-red { + background-color: #f0bcbc; + color: #cd201f; +} + +.avatar-orange { + background-color: #fee0c7; + color: #fd9644; +} + +.avatar-yellow { + background-color: #fbedb7; + color: #f1c40f; +} + +.avatar-green { + background-color: #cfeab3; + color: #5eba00; +} + +.avatar-teal { + background-color: #bfefea; + color: #2bcbba; +} + +.avatar-cyan { + background-color: #b9e3ea; + color: #17a2b8; +} + +.avatar-white { + background-color: white; + color: #fff; +} + +.avatar-gray { + background-color: #dbdde0; + color: #868e96; +} + +.avatar-gray-dark { + background-color: #c2c4c6; + color: #343a40; +} + +.avatar-azure { + background-color: #c7e6fb; + color: #45aaf2; +} + +.avatar-lime { + background-color: #d7f2c2; + color: #7bd235; +} + +.product-price { + font-size: 1rem; +} + +.product-price strong { + font-size: 1.5rem; +} + +@-webkit-keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 100%, 60% { + left: 100%; + right: -90%; + } +} + +@keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 100%, 60% { + left: 100%; + right: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 100%, 60% { + left: 107%; + right: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 100%, 60% { + left: 107%; + right: -8%; + } +} + +.progress { + position: relative; +} + +.progress-xs, +.progress-xs .progress-bar { + height: .25rem; +} + +.progress-sm, +.progress-sm .progress-bar { + height: .5rem; +} + +.progress-bar-indeterminate:after, .progress-bar-indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + left: 0; + will-change: left, right; + top: 0; + bottom: 0; +} + +.progress-bar-indeterminate:before { + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress-bar-indeterminate:after { + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +@keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +/** +Dimmer +*/ +.dimmer { + position: relative; +} + +.dimmer .loader { + display: none; + margin: 0 auto; + position: absolute; + top: 50%; + left: 0; + right: 0; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); +} + +.dimmer.active .loader { + display: block; +} + +.dimmer.active .dimmer-content { + opacity: .04; + pointer-events: none; +} + +/** +Loader +*/ +.loader { + display: block; + position: relative; + height: 2.5rem; + width: 2.5rem; + color: #467fcf; +} + +.loader:before, .loader:after { + width: 2.5rem; + height: 2.5rem; + margin: -1.25rem 0 0 -1.25rem; + position: absolute; + content: ''; + top: 50%; + left: 50%; +} + +.loader:before { + border-radius: 50%; + border: 3px solid currentColor; + opacity: .15; +} + +.loader:after { + -webkit-animation: loader .6s linear; + animation: loader .6s linear; + -webkit-animation-iteration-count: infinite; + animation-iteration-count: infinite; + border-radius: 50%; + border: 3px solid; + border-color: transparent; + border-top-color: currentColor; + box-shadow: 0 0 0 1px transparent; +} + +.icons-list { + list-style: none; + margin: 0 -1px -1px 0; + padding: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.icons-list > li { + -ms-flex: 1 0 4rem; + flex: 1 0 4rem; +} + +.icons-list-wrap { + overflow: hidden; +} + +.icons-list-item { + text-align: center; + height: 4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + border-right: 1px solid rgba(0, 40, 100, 0.12); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.icons-list-item i { + font-size: 1.25rem; +} + +.img-gallery { + margin-right: -.25rem; + margin-left: -.25rem; + margin-bottom: -.5rem; +} + +.img-gallery > .col, +.img-gallery > [class*="col-"] { + padding-left: .25rem; + padding-right: .25rem; + padding-bottom: .5rem; +} + +.link-overlay { + position: relative; +} + +.link-overlay:hover .link-overlay-bg { + opacity: 1; +} + +.link-overlay-bg { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + background: rgba(70, 127, 207, 0.8); + display: -ms-flexbox; + display: flex; + color: #fff; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + font-size: 1.25rem; + opacity: 0; + transition: .3s opacity; +} + +.media-icon { + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + border-radius: 100%; +} + +.media-list { + margin: 0; + padding: 0; + list-style: none; +} + +textarea[cols] { + height: auto; +} + +.form-group { + display: block; +} + +.form-label { + display: block; + margin-bottom: .375rem; + font-weight: 600; + font-size: 0.875rem; +} + +.form-label-small { + float: right; + font-weight: 400; + font-size: 87.5%; +} + +.form-footer { + margin-top: 2rem; +} + +.custom-control { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.custom-controls-stacked .custom-control { + margin-bottom: .25rem; +} + +.custom-control-label { + vertical-align: middle; +} + +.custom-control-label:before { + border: 1px solid rgba(0, 40, 100, 0.12); + background-color: #fff; + background-size: .5rem; +} + +.custom-control-description { + line-height: 1.5rem; +} + +.input-group-prepend, +.input-group-append, +.input-group-btn { + font-size: 0.9375rem; +} + +.input-group-prepend > .btn, +.input-group-append > .btn, +.input-group-btn > .btn { + height: 100%; + border-color: rgba(0, 40, 100, 0.12); +} + +.input-group-prepend > .input-group-text { + border-right: 0; +} + +.input-group-append > .input-group-text { + border-left: 0; +} + +/** +Icon input + */ +.input-icon { + position: relative; +} + +.input-icon .form-control:not(:last-child) { + padding-right: 2.5rem; +} + +.input-icon .form-control:not(:first-child) { + padding-left: 2.5rem; +} + +.input-icon-addon { + position: absolute; + top: 0; + bottom: 0; + left: 0; + color: #9aa0ac; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + min-width: 2.5rem; + pointer-events: none; +} + +.input-icon-addon:last-child { + left: auto; + right: 0; +} + +.form-fieldset { + background: #f8f9fa; + border: 1px solid #e9ecef; + padding: 1rem; + border-radius: 3px; + margin-bottom: 1rem; +} + +.form-required { + color: #cd201f; +} + +.form-required:before { + content: ' '; +} + +.state-valid { + padding-right: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.state-invalid { + padding-right: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.form-help { + display: inline-block; + width: 1rem; + height: 1rem; + text-align: center; + line-height: 1rem; + color: #9aa0ac; + background: #f8f9fa; + border-radius: 50%; + font-size: 0.75rem; + transition: .3s background-color, .3s color; + text-decoration: none; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.form-help:hover, .form-help[aria-describedby] { + background: #467fcf; + color: #fff; +} + +.sparkline { + display: inline-block; + height: 2rem; +} + +.jqstooltip { + box-sizing: content-box; + font-family: inherit !important; + background: #333 !important; + border: none !important; + border-radius: 3px; + font-size: 11px !important; + font-weight: 700 !important; + line-height: 1 !important; + padding: 6px !important; +} + +.jqstooltip .jqsfield { + font: inherit !important; +} + +.social-links li a { + background: #f8f8f8; + border-radius: 50%; + color: #9aa0ac; + display: inline-block; + height: 1.75rem; + width: 1.75rem; + line-height: 1.75rem; + text-align: center; +} + +.map, +.chart { + position: relative; + padding-top: 56.25%; +} + +.map-square, +.chart-square { + padding-top: 100%; +} + +.map-content, +.chart-content { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.map-header { + margin-top: -1.5rem; + margin-bottom: 1.5rem; + height: 15rem; + position: relative; + margin-bottom: -1.5rem; +} + +.map-header:before { + content: ''; + position: absolute; + bottom: 0; + left: 0; + right: 0; + height: 10rem; + background: linear-gradient(to bottom, rgba(245, 247, 251, 0) 5%, #f5f7fb 95%); + pointer-events: none; +} + +.map-header-layer { + height: 100%; +} + +.map-static { + height: 120px; + width: 100%; + max-width: 640px; + background-position: center center; + background-size: 640px 120px; +} + +@-webkit-keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +@keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +.status-icon { + content: ''; + width: 0.5rem; + height: 0.5rem; + display: inline-block; + background: currentColor; + border-radius: 50%; + -webkit-transform: translateY(-1px); + transform: translateY(-1px); + margin-right: .375rem; + vertical-align: middle; +} + +.status-animated { + -webkit-animation: 1s status-pulse infinite ease; + animation: 1s status-pulse infinite ease; +} + +.chart-circle { + display: block; + height: 8rem; + width: 8rem; + position: relative; +} + +.chart-circle canvas { + margin: 0 auto; + display: block; + max-width: 100%; + max-height: 100%; +} + +.chart-circle-xs { + height: 2.5rem; + width: 2.5rem; + font-size: .8rem; +} + +.chart-circle-sm { + height: 4rem; + width: 4rem; + font-size: .8rem; +} + +.chart-circle-lg { + height: 10rem; + width: 10rem; + font-size: .8rem; +} + +.chart-circle-value { + position: absolute; + top: 0; + left: 0; + right: 0; + margin-left: auto; + margin-right: auto; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + -ms-flex-align: center; + align-items: center; + -ms-flex-direction: column; + flex-direction: column; + line-height: 1; +} + +.chart-circle-value small { + display: block; + color: #9aa0ac; + font-size: 0.9375rem; +} + +.chips { + margin: 0 0 -.5rem; +} + +.chips .chip { + margin: 0 .5rem .5rem 0; +} + +.chip { + display: inline-block; + height: 2rem; + line-height: 2rem; + font-size: 0.875rem; + font-weight: 500; + color: #6e7687; + padding: 0 .75rem; + border-radius: 1rem; + background-color: #f8f9fa; + transition: .3s background; +} + +.chip .avatar { + float: left; + margin: 0 .5rem 0 -.75rem; + height: 2rem; + width: 2rem; + border-radius: 50%; +} + +a.chip:hover { + color: inherit; + text-decoration: none; + background-color: #e9ecef; +} + +.stamp { + color: #fff; + background: #868e96; + display: inline-block; + min-width: 2rem; + height: 2rem; + padding: 0 .25rem; + line-height: 2rem; + text-align: center; + border-radius: 3px; + font-weight: 600; +} + +.stamp-md { + min-width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; +} + +.chat { + outline: 0; + margin: 0; + padding: 0; + list-style-type: none; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: end; + justify-content: flex-end; + min-height: 100%; +} + +.chat-line { + padding: 0; + text-align: right; + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: row-reverse; + flex-direction: row-reverse; +} + +.chat-line + .chat-line { + padding-top: 1rem; +} + +.chat-message { + position: relative; + display: inline-block; + background-color: #467fcf; + color: #fff; + font-size: 0.875rem; + padding: .375rem .5rem; + border-radius: 3px; + white-space: normal; + text-align: left; + margin: 0 .5rem 0 2.5rem; + line-height: 1.4; +} + +.chat-message > :last-child { + margin-bottom: 0 !important; +} + +.chat-message:after { + content: ""; + position: absolute; + right: -5px; + top: 7px; + border-bottom: 6px solid transparent; + border-left: 6px solid #467fcf; + border-top: 6px solid transparent; +} + +.chat-message img { + max-width: 100%; +} + +.chat-message p { + margin-bottom: 1em; +} + +.chat-line-friend { + -ms-flex-direction: row; + flex-direction: row; +} + +.chat-line-friend + .chat-line-friend { + margin-top: -.5rem; +} + +.chat-line-friend + .chat-line-friend .chat-author { + visibility: hidden; +} + +.chat-line-friend + .chat-line-friend .chat-message:after { + display: none; +} + +.chat-line-friend .chat-message { + background-color: #f3f3f3; + color: #495057; + margin-left: .5rem; + margin-right: 2.5rem; +} + +.chat-line-friend .chat-message:after { + right: auto; + left: -5px; + border-left-width: 0; + border-right: 5px solid #f3f3f3; +} + +.example { + padding: 1.5rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px 3px 0 0; + font-size: 0.9375rem; +} + +.example-bg { + background: #f5f7fb; +} + +.example + .highlight { + border-top: none; + margin-top: 0; + border-radius: 0 0 3px 3px; +} + +.highlight { + margin: 1rem 0 2rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-size: 0.9375rem; + max-height: 40rem; + overflow: auto; + background: #fcfcfc; +} + +.highlight pre { + margin-bottom: 0; + background-color: transparent; +} + +.example-column { + margin: 0 auto; +} + +.example-column > .card:last-of-type { + margin-bottom: 0; +} + +.example-column-1 { + max-width: 20rem; +} + +.example-column-2 { + max-width: 40rem; +} + +.tag { + font-size: 0.75rem; + color: #6e7687; + background-color: #e9ecef; + border-radius: 3px; + padding: 0 .5rem; + line-height: 2em; + display: -ms-inline-flexbox; + display: inline-flex; + cursor: default; + font-weight: 400; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +a.tag { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag:hover { + background-color: rgba(110, 118, 135, 0.2); + color: inherit; +} + +.tag-addon { + display: inline-block; + padding: 0 .5rem; + color: inherit; + text-decoration: none; + background: rgba(0, 0, 0, 0.06); + margin: 0 -.5rem 0 .5rem; + text-align: center; + min-width: 1.5rem; +} + +.tag-addon:last-child { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.tag-addon i { + vertical-align: middle; + margin: 0 -.25rem; +} + +a.tag-addon { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag-addon:hover { + background: rgba(0, 0, 0, 0.16); + color: inherit; +} + +.tag-avatar { + width: 1.5rem; + height: 1.5rem; + border-radius: 3px 0 0 3px; + margin: 0 .5rem 0 -.5rem; +} + +.tag-blue { + background-color: #467fcf; + color: #fff; +} + +.tag-indigo { + background-color: #6574cd; + color: #fff; +} + +.tag-purple { + background-color: #a55eea; + color: #fff; +} + +.tag-pink { + background-color: #f66d9b; + color: #fff; +} + +.tag-red { + background-color: #cd201f; + color: #fff; +} + +.tag-orange { + background-color: #fd9644; + color: #fff; +} + +.tag-yellow { + background-color: #f1c40f; + color: #fff; +} + +.tag-green { + background-color: #5eba00; + color: #fff; +} + +.tag-teal { + background-color: #2bcbba; + color: #fff; +} + +.tag-cyan { + background-color: #17a2b8; + color: #fff; +} + +.tag-white { + background-color: #fff; + color: #fff; +} + +.tag-gray { + background-color: #868e96; + color: #fff; +} + +.tag-gray-dark { + background-color: #343a40; + color: #fff; +} + +.tag-azure { + background-color: #45aaf2; + color: #fff; +} + +.tag-lime { + background-color: #7bd235; + color: #fff; +} + +.tag-primary { + background-color: #467fcf; + color: #fff; +} + +.tag-secondary { + background-color: #868e96; + color: #fff; +} + +.tag-success { + background-color: #5eba00; + color: #fff; +} + +.tag-info { + background-color: #45aaf2; + color: #fff; +} + +.tag-warning { + background-color: #f1c40f; + color: #fff; +} + +.tag-danger { + background-color: #cd201f; + color: #fff; +} + +.tag-light { + background-color: #f8f9fa; + color: #fff; +} + +.tag-dark { + background-color: #343a40; + color: #fff; +} + +.tag-rounded { + border-radius: 50px; +} + +.tag-rounded .tag-avatar { + border-radius: 50px; +} + +.tags { + margin-bottom: -.5rem; + font-size: 0; +} + +.tags > .tag { + margin-bottom: .5rem; +} + +.tags > .tag:not(:last-child) { + margin-right: .5rem; +} + +.highlight .hll { + background-color: #ffc; +} + +.highlight .c { + color: #999; +} + +.highlight .k { + color: #069; +} + +.highlight .o { + color: #555; +} + +.highlight .cm { + color: #999; +} + +.highlight .cp { + color: #099; +} + +.highlight .c1 { + color: #999; +} + +.highlight .cs { + color: #999; +} + +.highlight .gd { + background-color: #fcc; + border: 1px solid #c00; +} + +.highlight .ge { + font-style: italic; +} + +.highlight .gr { + color: #f00; +} + +.highlight .gh { + color: #030; +} + +.highlight .gi { + background-color: #cfc; + border: 1px solid #0c0; +} + +.highlight .go { + color: #aaa; +} + +.highlight .gp { + color: #009; +} + +.highlight .gu { + color: #030; +} + +.highlight .gt { + color: #9c6; +} + +.highlight .kc { + color: #069; +} + +.highlight .kd { + color: #069; +} + +.highlight .kn { + color: #069; +} + +.highlight .kp { + color: #069; +} + +.highlight .kr { + color: #069; +} + +.highlight .kt { + color: #078; +} + +.highlight .m { + color: #f60; +} + +.highlight .s { + color: #d44950; +} + +.highlight .na { + color: #4f9fcf; +} + +.highlight .nb { + color: #366; +} + +.highlight .nc { + color: #0a8; +} + +.highlight .no { + color: #360; +} + +.highlight .nd { + color: #99f; +} + +.highlight .ni { + color: #999; +} + +.highlight .ne { + color: #c00; +} + +.highlight .nf { + color: #c0f; +} + +.highlight .nl { + color: #99f; +} + +.highlight .nn { + color: #0cf; +} + +.highlight .nt { + color: #2f6f9f; +} + +.highlight .nv { + color: #033; +} + +.highlight .ow { + color: #000; +} + +.highlight .w { + color: #bbb; +} + +.highlight .mf { + color: #f60; +} + +.highlight .mh { + color: #f60; +} + +.highlight .mi { + color: #f60; +} + +.highlight .mo { + color: #f60; +} + +.highlight .sb { + color: #c30; +} + +.highlight .sc { + color: #c30; +} + +.highlight .sd { + font-style: italic; + color: #c30; +} + +.highlight .s2 { + color: #c30; +} + +.highlight .se { + color: #c30; +} + +.highlight .sh { + color: #c30; +} + +.highlight .si { + color: #a00; +} + +.highlight .sx { + color: #c30; +} + +.highlight .sr { + color: #3aa; +} + +.highlight .s1 { + color: #c30; +} + +.highlight .ss { + color: #fc3; +} + +.highlight .bp { + color: #366; +} + +.highlight .vc { + color: #033; +} + +.highlight .vg { + color: #033; +} + +.highlight .vi { + color: #033; +} + +.highlight .il { + color: #f60; +} + +.highlight .css .o, +.highlight .css .o + .nt, +.highlight .css .nt + .nt { + color: #999; +} + +.highlight .language-bash::before, +.highlight .language-sh::before { + color: #009; + content: "$ "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.highlight .language-powershell::before { + color: #009; + content: "PM> "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.carousel-item-background { + content: ''; + background: rgba(0, 0, 0, 0.5); + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.custom-range { + -ms-flex-align: center; + align-items: center; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + height: 100%; + min-height: 2.375rem; + overflow: hidden; + padding: 0; + border: 0; +} + +.custom-range:focus { + box-shadow: none; + outline: none; +} + +.custom-range:focus::-webkit-slider-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-moz-range-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-ms-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-runnable-track { + background: #467fcf; + content: ''; + height: 2px; + pointer-events: none; +} + +.custom-range::-webkit-slider-thumb { + width: 14px; + height: 14px; + -webkit-appearance: none; + appearance: none; + background: #fff; + border-radius: 50px; + box-shadow: 1px 0 0 -6px rgba(0, 50, 126, 0.12), 6px 0 0 -6px rgba(0, 50, 126, 0.12), 7px 0 0 -6px rgba(0, 50, 126, 0.12), 8px 0 0 -6px rgba(0, 50, 126, 0.12), 9px 0 0 -6px rgba(0, 50, 126, 0.12), 10px 0 0 -6px rgba(0, 50, 126, 0.12), 11px 0 0 -6px rgba(0, 50, 126, 0.12), 12px 0 0 -6px rgba(0, 50, 126, 0.12), 13px 0 0 -6px rgba(0, 50, 126, 0.12), 14px 0 0 -6px rgba(0, 50, 126, 0.12), 15px 0 0 -6px rgba(0, 50, 126, 0.12), 16px 0 0 -6px rgba(0, 50, 126, 0.12), 17px 0 0 -6px rgba(0, 50, 126, 0.12), 18px 0 0 -6px rgba(0, 50, 126, 0.12), 19px 0 0 -6px rgba(0, 50, 126, 0.12), 20px 0 0 -6px rgba(0, 50, 126, 0.12), 21px 0 0 -6px rgba(0, 50, 126, 0.12), 22px 0 0 -6px rgba(0, 50, 126, 0.12), 23px 0 0 -6px rgba(0, 50, 126, 0.12), 24px 0 0 -6px rgba(0, 50, 126, 0.12), 25px 0 0 -6px rgba(0, 50, 126, 0.12), 26px 0 0 -6px rgba(0, 50, 126, 0.12), 27px 0 0 -6px rgba(0, 50, 126, 0.12), 28px 0 0 -6px rgba(0, 50, 126, 0.12), 29px 0 0 -6px rgba(0, 50, 126, 0.12), 30px 0 0 -6px rgba(0, 50, 126, 0.12), 31px 0 0 -6px rgba(0, 50, 126, 0.12), 32px 0 0 -6px rgba(0, 50, 126, 0.12), 33px 0 0 -6px rgba(0, 50, 126, 0.12), 34px 0 0 -6px rgba(0, 50, 126, 0.12), 35px 0 0 -6px rgba(0, 50, 126, 0.12), 36px 0 0 -6px rgba(0, 50, 126, 0.12), 37px 0 0 -6px rgba(0, 50, 126, 0.12), 38px 0 0 -6px rgba(0, 50, 126, 0.12), 39px 0 0 -6px rgba(0, 50, 126, 0.12), 40px 0 0 -6px rgba(0, 50, 126, 0.12), 41px 0 0 -6px rgba(0, 50, 126, 0.12), 42px 0 0 -6px rgba(0, 50, 126, 0.12), 43px 0 0 -6px rgba(0, 50, 126, 0.12), 44px 0 0 -6px rgba(0, 50, 126, 0.12), 45px 0 0 -6px rgba(0, 50, 126, 0.12), 46px 0 0 -6px rgba(0, 50, 126, 0.12), 47px 0 0 -6px rgba(0, 50, 126, 0.12), 48px 0 0 -6px rgba(0, 50, 126, 0.12), 49px 0 0 -6px rgba(0, 50, 126, 0.12), 50px 0 0 -6px rgba(0, 50, 126, 0.12), 51px 0 0 -6px rgba(0, 50, 126, 0.12), 52px 0 0 -6px rgba(0, 50, 126, 0.12), 53px 0 0 -6px rgba(0, 50, 126, 0.12), 54px 0 0 -6px rgba(0, 50, 126, 0.12), 55px 0 0 -6px rgba(0, 50, 126, 0.12), 56px 0 0 -6px rgba(0, 50, 126, 0.12), 57px 0 0 -6px rgba(0, 50, 126, 0.12), 58px 0 0 -6px rgba(0, 50, 126, 0.12), 59px 0 0 -6px rgba(0, 50, 126, 0.12), 60px 0 0 -6px rgba(0, 50, 126, 0.12), 61px 0 0 -6px rgba(0, 50, 126, 0.12), 62px 0 0 -6px rgba(0, 50, 126, 0.12), 63px 0 0 -6px rgba(0, 50, 126, 0.12), 64px 0 0 -6px rgba(0, 50, 126, 0.12), 65px 0 0 -6px rgba(0, 50, 126, 0.12), 66px 0 0 -6px rgba(0, 50, 126, 0.12), 67px 0 0 -6px rgba(0, 50, 126, 0.12), 68px 0 0 -6px rgba(0, 50, 126, 0.12), 69px 0 0 -6px rgba(0, 50, 126, 0.12), 70px 0 0 -6px rgba(0, 50, 126, 0.12), 71px 0 0 -6px rgba(0, 50, 126, 0.12), 72px 0 0 -6px rgba(0, 50, 126, 0.12), 73px 0 0 -6px rgba(0, 50, 126, 0.12), 74px 0 0 -6px rgba(0, 50, 126, 0.12), 75px 0 0 -6px rgba(0, 50, 126, 0.12), 76px 0 0 -6px rgba(0, 50, 126, 0.12), 77px 0 0 -6px rgba(0, 50, 126, 0.12), 78px 0 0 -6px rgba(0, 50, 126, 0.12), 79px 0 0 -6px rgba(0, 50, 126, 0.12), 80px 0 0 -6px rgba(0, 50, 126, 0.12), 81px 0 0 -6px rgba(0, 50, 126, 0.12), 82px 0 0 -6px rgba(0, 50, 126, 0.12), 83px 0 0 -6px rgba(0, 50, 126, 0.12), 84px 0 0 -6px rgba(0, 50, 126, 0.12), 85px 0 0 -6px rgba(0, 50, 126, 0.12), 86px 0 0 -6px rgba(0, 50, 126, 0.12), 87px 0 0 -6px rgba(0, 50, 126, 0.12), 88px 0 0 -6px rgba(0, 50, 126, 0.12), 89px 0 0 -6px rgba(0, 50, 126, 0.12), 90px 0 0 -6px rgba(0, 50, 126, 0.12), 91px 0 0 -6px rgba(0, 50, 126, 0.12), 92px 0 0 -6px rgba(0, 50, 126, 0.12), 93px 0 0 -6px rgba(0, 50, 126, 0.12), 94px 0 0 -6px rgba(0, 50, 126, 0.12), 95px 0 0 -6px rgba(0, 50, 126, 0.12), 96px 0 0 -6px rgba(0, 50, 126, 0.12), 97px 0 0 -6px rgba(0, 50, 126, 0.12), 98px 0 0 -6px rgba(0, 50, 126, 0.12), 99px 0 0 -6px rgba(0, 50, 126, 0.12), 100px 0 0 -6px rgba(0, 50, 126, 0.12), 101px 0 0 -6px rgba(0, 50, 126, 0.12), 102px 0 0 -6px rgba(0, 50, 126, 0.12), 103px 0 0 -6px rgba(0, 50, 126, 0.12), 104px 0 0 -6px rgba(0, 50, 126, 0.12), 105px 0 0 -6px rgba(0, 50, 126, 0.12), 106px 0 0 -6px rgba(0, 50, 126, 0.12), 107px 0 0 -6px rgba(0, 50, 126, 0.12), 108px 0 0 -6px rgba(0, 50, 126, 0.12), 109px 0 0 -6px rgba(0, 50, 126, 0.12), 110px 0 0 -6px rgba(0, 50, 126, 0.12), 111px 0 0 -6px rgba(0, 50, 126, 0.12), 112px 0 0 -6px rgba(0, 50, 126, 0.12), 113px 0 0 -6px rgba(0, 50, 126, 0.12), 114px 0 0 -6px rgba(0, 50, 126, 0.12), 115px 0 0 -6px rgba(0, 50, 126, 0.12), 116px 0 0 -6px rgba(0, 50, 126, 0.12), 117px 0 0 -6px rgba(0, 50, 126, 0.12), 118px 0 0 -6px rgba(0, 50, 126, 0.12), 119px 0 0 -6px rgba(0, 50, 126, 0.12), 120px 0 0 -6px rgba(0, 50, 126, 0.12), 121px 0 0 -6px rgba(0, 50, 126, 0.12), 122px 0 0 -6px rgba(0, 50, 126, 0.12), 123px 0 0 -6px rgba(0, 50, 126, 0.12), 124px 0 0 -6px rgba(0, 50, 126, 0.12), 125px 0 0 -6px rgba(0, 50, 126, 0.12), 126px 0 0 -6px rgba(0, 50, 126, 0.12), 127px 0 0 -6px rgba(0, 50, 126, 0.12), 128px 0 0 -6px rgba(0, 50, 126, 0.12), 129px 0 0 -6px rgba(0, 50, 126, 0.12), 130px 0 0 -6px rgba(0, 50, 126, 0.12), 131px 0 0 -6px rgba(0, 50, 126, 0.12), 132px 0 0 -6px rgba(0, 50, 126, 0.12), 133px 0 0 -6px rgba(0, 50, 126, 0.12), 134px 0 0 -6px rgba(0, 50, 126, 0.12), 135px 0 0 -6px rgba(0, 50, 126, 0.12), 136px 0 0 -6px rgba(0, 50, 126, 0.12), 137px 0 0 -6px rgba(0, 50, 126, 0.12), 138px 0 0 -6px rgba(0, 50, 126, 0.12), 139px 0 0 -6px rgba(0, 50, 126, 0.12), 140px 0 0 -6px rgba(0, 50, 126, 0.12), 141px 0 0 -6px rgba(0, 50, 126, 0.12), 142px 0 0 -6px rgba(0, 50, 126, 0.12), 143px 0 0 -6px rgba(0, 50, 126, 0.12), 144px 0 0 -6px rgba(0, 50, 126, 0.12), 145px 0 0 -6px rgba(0, 50, 126, 0.12), 146px 0 0 -6px rgba(0, 50, 126, 0.12), 147px 0 0 -6px rgba(0, 50, 126, 0.12), 148px 0 0 -6px rgba(0, 50, 126, 0.12), 149px 0 0 -6px rgba(0, 50, 126, 0.12), 150px 0 0 -6px rgba(0, 50, 126, 0.12), 151px 0 0 -6px rgba(0, 50, 126, 0.12), 152px 0 0 -6px rgba(0, 50, 126, 0.12), 153px 0 0 -6px rgba(0, 50, 126, 0.12), 154px 0 0 -6px rgba(0, 50, 126, 0.12), 155px 0 0 -6px rgba(0, 50, 126, 0.12), 156px 0 0 -6px rgba(0, 50, 126, 0.12), 157px 0 0 -6px rgba(0, 50, 126, 0.12), 158px 0 0 -6px rgba(0, 50, 126, 0.12), 159px 0 0 -6px rgba(0, 50, 126, 0.12), 160px 0 0 -6px rgba(0, 50, 126, 0.12), 161px 0 0 -6px rgba(0, 50, 126, 0.12), 162px 0 0 -6px rgba(0, 50, 126, 0.12), 163px 0 0 -6px rgba(0, 50, 126, 0.12), 164px 0 0 -6px rgba(0, 50, 126, 0.12), 165px 0 0 -6px rgba(0, 50, 126, 0.12), 166px 0 0 -6px rgba(0, 50, 126, 0.12), 167px 0 0 -6px rgba(0, 50, 126, 0.12), 168px 0 0 -6px rgba(0, 50, 126, 0.12), 169px 0 0 -6px rgba(0, 50, 126, 0.12), 170px 0 0 -6px rgba(0, 50, 126, 0.12), 171px 0 0 -6px rgba(0, 50, 126, 0.12), 172px 0 0 -6px rgba(0, 50, 126, 0.12), 173px 0 0 -6px rgba(0, 50, 126, 0.12), 174px 0 0 -6px rgba(0, 50, 126, 0.12), 175px 0 0 -6px rgba(0, 50, 126, 0.12), 176px 0 0 -6px rgba(0, 50, 126, 0.12), 177px 0 0 -6px rgba(0, 50, 126, 0.12), 178px 0 0 -6px rgba(0, 50, 126, 0.12), 179px 0 0 -6px rgba(0, 50, 126, 0.12), 180px 0 0 -6px rgba(0, 50, 126, 0.12), 181px 0 0 -6px rgba(0, 50, 126, 0.12), 182px 0 0 -6px rgba(0, 50, 126, 0.12), 183px 0 0 -6px rgba(0, 50, 126, 0.12), 184px 0 0 -6px rgba(0, 50, 126, 0.12), 185px 0 0 -6px rgba(0, 50, 126, 0.12), 186px 0 0 -6px rgba(0, 50, 126, 0.12), 187px 0 0 -6px rgba(0, 50, 126, 0.12), 188px 0 0 -6px rgba(0, 50, 126, 0.12), 189px 0 0 -6px rgba(0, 50, 126, 0.12), 190px 0 0 -6px rgba(0, 50, 126, 0.12), 191px 0 0 -6px rgba(0, 50, 126, 0.12), 192px 0 0 -6px rgba(0, 50, 126, 0.12), 193px 0 0 -6px rgba(0, 50, 126, 0.12), 194px 0 0 -6px rgba(0, 50, 126, 0.12), 195px 0 0 -6px rgba(0, 50, 126, 0.12), 196px 0 0 -6px rgba(0, 50, 126, 0.12), 197px 0 0 -6px rgba(0, 50, 126, 0.12), 198px 0 0 -6px rgba(0, 50, 126, 0.12), 199px 0 0 -6px rgba(0, 50, 126, 0.12), 200px 0 0 -6px rgba(0, 50, 126, 0.12), 201px 0 0 -6px rgba(0, 50, 126, 0.12), 202px 0 0 -6px rgba(0, 50, 126, 0.12), 203px 0 0 -6px rgba(0, 50, 126, 0.12), 204px 0 0 -6px rgba(0, 50, 126, 0.12), 205px 0 0 -6px rgba(0, 50, 126, 0.12), 206px 0 0 -6px rgba(0, 50, 126, 0.12), 207px 0 0 -6px rgba(0, 50, 126, 0.12), 208px 0 0 -6px rgba(0, 50, 126, 0.12), 209px 0 0 -6px rgba(0, 50, 126, 0.12), 210px 0 0 -6px rgba(0, 50, 126, 0.12), 211px 0 0 -6px rgba(0, 50, 126, 0.12), 212px 0 0 -6px rgba(0, 50, 126, 0.12), 213px 0 0 -6px rgba(0, 50, 126, 0.12), 214px 0 0 -6px rgba(0, 50, 126, 0.12), 215px 0 0 -6px rgba(0, 50, 126, 0.12), 216px 0 0 -6px rgba(0, 50, 126, 0.12), 217px 0 0 -6px rgba(0, 50, 126, 0.12), 218px 0 0 -6px rgba(0, 50, 126, 0.12), 219px 0 0 -6px rgba(0, 50, 126, 0.12), 220px 0 0 -6px rgba(0, 50, 126, 0.12), 221px 0 0 -6px rgba(0, 50, 126, 0.12), 222px 0 0 -6px rgba(0, 50, 126, 0.12), 223px 0 0 -6px rgba(0, 50, 126, 0.12), 224px 0 0 -6px rgba(0, 50, 126, 0.12), 225px 0 0 -6px rgba(0, 50, 126, 0.12), 226px 0 0 -6px rgba(0, 50, 126, 0.12), 227px 0 0 -6px rgba(0, 50, 126, 0.12), 228px 0 0 -6px rgba(0, 50, 126, 0.12), 229px 0 0 -6px rgba(0, 50, 126, 0.12), 230px 0 0 -6px rgba(0, 50, 126, 0.12), 231px 0 0 -6px rgba(0, 50, 126, 0.12), 232px 0 0 -6px rgba(0, 50, 126, 0.12), 233px 0 0 -6px rgba(0, 50, 126, 0.12), 234px 0 0 -6px rgba(0, 50, 126, 0.12), 235px 0 0 -6px rgba(0, 50, 126, 0.12), 236px 0 0 -6px rgba(0, 50, 126, 0.12), 237px 0 0 -6px rgba(0, 50, 126, 0.12), 238px 0 0 -6px rgba(0, 50, 126, 0.12), 239px 0 0 -6px rgba(0, 50, 126, 0.12), 240px 0 0 -6px rgba(0, 50, 126, 0.12); + margin-top: -6px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-track { + width: 240px; + height: 2px; + background: rgba(0, 50, 126, 0.12); +} + +.custom-range::-moz-range-thumb { + width: 14px; + height: 14px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + position: relative; + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-progress { + height: 2px; + background: #467fcf; + border: 0; + margin-top: 0; +} + +.custom-range::-ms-track { + background: transparent; + border: 0; + border-color: transparent; + border-radius: 0; + border-width: 0; + color: transparent; + height: 2px; + margin-top: 10px; + width: 240px; +} + +.custom-range::-ms-thumb { + width: 240px; + height: 2px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-ms-fill-lower { + background: #467fcf; + border-radius: 0; +} + +.custom-range::-ms-fill-upper { + background: rgba(0, 50, 126, 0.12); + border-radius: 0; +} + +.custom-range::-ms-tooltip { + display: none; +} + +.selectgroup { + display: -ms-inline-flexbox; + display: inline-flex; +} + +.selectgroup-item { + -ms-flex-positive: 1; + flex-grow: 1; + position: relative; +} + +.selectgroup-item + .selectgroup-item { + margin-left: -1px; +} + +.selectgroup-item:not(:first-child) .selectgroup-button { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.selectgroup-item:not(:last-child) .selectgroup-button { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.selectgroup-input { + opacity: 0; + position: absolute; + z-index: -1; + top: 0; + left: 0; +} + +.selectgroup-button { + display: block; + border: 1px solid rgba(0, 40, 100, 0.12); + text-align: center; + padding: 0.375rem 1rem; + position: relative; + cursor: pointer; + border-radius: 3px; + color: #9aa0ac; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + font-size: 0.9375rem; + line-height: 1.5rem; + min-width: 2.375rem; +} + +.selectgroup-button-icon { + padding-left: .5rem; + padding-right: .5rem; + font-size: 1rem; +} + +.selectgroup-input:checked + .selectgroup-button { + border-color: #467fcf; + z-index: 1; + color: #467fcf; + background: #edf2fa; +} + +.selectgroup-input:focus + .selectgroup-button { + border-color: #467fcf; + z-index: 2; + color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectgroup-pills { + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: start; + align-items: flex-start; +} + +.selectgroup-pills .selectgroup-item { + margin-right: .5rem; + -ms-flex-positive: 0; + flex-grow: 0; +} + +.selectgroup-pills .selectgroup-button { + border-radius: 50px !important; +} + +.custom-switch { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: default; + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + margin: 0; +} + +.custom-switch-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-switches-stacked { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.custom-switches-stacked .custom-switch { + margin-bottom: .5rem; +} + +.custom-switch-indicator { + display: inline-block; + height: 1.25rem; + width: 2.25rem; + background: #e9ecef; + border-radius: 50px; + position: relative; + vertical-align: bottom; + border: 1px solid rgba(0, 40, 100, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-switch-indicator:before { + content: ''; + position: absolute; + height: calc(1.25rem - 4px); + width: calc(1.25rem - 4px); + top: 1px; + left: 1px; + background: #fff; + border-radius: 50%; + transition: .3s left; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); +} + +.custom-switch-input:checked ~ .custom-switch-indicator { + background: #467fcf; +} + +.custom-switch-input:checked ~ .custom-switch-indicator:before { + left: calc(1rem + 1px); +} + +.custom-switch-input:focus ~ .custom-switch-indicator { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); + border-color: #467fcf; +} + +.custom-switch-description { + margin-left: .5rem; + color: #6e7687; + transition: .3s color; +} + +.custom-switch-input:checked ~ .custom-switch-description { + color: #495057; +} + +.imagecheck { + margin: 0; + position: relative; + cursor: pointer; +} + +.imagecheck-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.imagecheck-figure { + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + margin: 0; + position: relative; +} + +.imagecheck-input:focus ~ .imagecheck-figure { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.imagecheck-input:checked ~ .imagecheck-figure { + border-color: rgba(0, 40, 100, 0.24); +} + +.imagecheck-figure:before { + content: ''; + position: absolute; + top: .25rem; + left: .25rem; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background: #467fcf url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; + color: #fff; + z-index: 1; + border-radius: 3px; + opacity: 0; + transition: .3s opacity; +} + +.imagecheck-input:checked ~ .imagecheck-figure:before { + opacity: 1; +} + +.imagecheck-image { + max-width: 100%; + opacity: .64; + transition: .3s opacity; +} + +.imagecheck-image:first-child { + border-top-left-radius: 2px; + border-top-right-radius: 2px; +} + +.imagecheck-image:last-child { + border-bottom-left-radius: 2px; + border-bottom-right-radius: 2px; +} + +.imagecheck:hover .imagecheck-image, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-image, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-image { + opacity: 1; +} + +.imagecheck-caption { + text-align: center; + padding: .25rem .25rem; + color: #9aa0ac; + font-size: 0.875rem; + transition: .3s color; +} + +.imagecheck:hover .imagecheck-caption, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-caption, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-caption { + color: #495057; +} + +.colorinput { + margin: 0; + position: relative; + cursor: pointer; +} + +.colorinput-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.colorinput-color { + display: inline-block; + width: 1.75rem; + height: 1.75rem; + border-radius: 3px; + border: 1px solid rgba(0, 40, 100, 0.12); + color: #fff; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); +} + +.colorinput-color:before { + content: ''; + opacity: 0; + position: absolute; + top: .25rem; + left: .25rem; + height: 1.25rem; + width: 1.25rem; + transition: .3s opacity; + background: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; +} + +.colorinput-input:checked ~ .colorinput-color:before { + opacity: 1; +} + +.colorinput-input:focus ~ .colorinput-color { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.timeline { + position: relative; + margin: 0 0 2rem; + padding: 0; + list-style: none; +} + +.timeline:before { + background-color: #e9ecef; + position: absolute; + display: block; + content: ''; + width: 1px; + height: 100%; + top: 0; + bottom: 0; + left: 4px; +} + +.timeline-item { + position: relative; + display: -ms-flexbox; + display: flex; + padding-left: 2rem; + margin: .5rem 0; +} + +.timeline-item:first-child:before, .timeline-item:last-child:before { + content: ''; + position: absolute; + background: #fff; + width: 1px; + left: .25rem; +} + +.timeline-item:first-child { + margin-top: 0; +} + +.timeline-item:first-child:before { + top: 0; + height: .5rem; +} + +.timeline-item:last-child { + margin-bottom: 0; +} + +.timeline-item:last-child:before { + top: .5rem; + bottom: 0; +} + +.timeline-badge { + position: absolute; + display: block; + width: 0.4375rem; + height: 0.4375rem; + left: 1px; + top: .5rem; + border-radius: 100%; + border: 1px solid #fff; + background: #adb5bd; +} + +.timeline-time { + white-space: nowrap; + margin-left: auto; + color: #9aa0ac; + font-size: 87.5%; +} + +.browser { + width: 1.25rem; + height: 1.25rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; +} + +.browser-android-browser { + background-image: url("../images/browsers/android-browser.svg"); +} + +.browser-aol-explorer { + background-image: url("../images/browsers/aol-explorer.svg"); +} + +.browser-blackberry { + background-image: url("../images/browsers/blackberry.svg"); +} + +.browser-camino { + background-image: url("../images/browsers/camino.svg"); +} + +.browser-chrome { + background-image: url("../images/browsers/chrome.svg"); +} + +.browser-chromium { + background-image: url("../images/browsers/chromium.svg"); +} + +.browser-dolphin { + background-image: url("../images/browsers/dolphin.svg"); +} + +.browser-edge { + background-image: url("../images/browsers/edge.svg"); +} + +.browser-firefox { + background-image: url("../images/browsers/firefox.svg"); +} + +.browser-ie { + background-image: url("../images/browsers/ie.svg"); +} + +.browser-maxthon { + background-image: url("../images/browsers/maxthon.svg"); +} + +.browser-mozilla { + background-image: url("../images/browsers/mozilla.svg"); +} + +.browser-netscape { + background-image: url("../images/browsers/netscape.svg"); +} + +.browser-opera { + background-image: url("../images/browsers/opera.svg"); +} + +.browser-safari { + background-image: url("../images/browsers/safari.svg"); +} + +.browser-sleipnir { + background-image: url("../images/browsers/sleipnir.svg"); +} + +.browser-uc-browser { + background-image: url("../images/browsers/uc-browser.svg"); +} + +.browser-vivaldi { + background-image: url("../images/browsers/vivaldi.svg"); +} + +.flag { + width: 1.6rem; + height: 1.2rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.flag-ad { + background-image: url("../images/flags/ad.svg"); +} + +.flag-ae { + background-image: url("../images/flags/ae.svg"); +} + +.flag-af { + background-image: url("../images/flags/af.svg"); +} + +.flag-ag { + background-image: url("../images/flags/ag.svg"); +} + +.flag-ai { + background-image: url("../images/flags/ai.svg"); +} + +.flag-al { + background-image: url("../images/flags/al.svg"); +} + +.flag-am { + background-image: url("../images/flags/am.svg"); +} + +.flag-ao { + background-image: url("../images/flags/ao.svg"); +} + +.flag-aq { + background-image: url("../images/flags/aq.svg"); +} + +.flag-ar { + background-image: url("../images/flags/ar.svg"); +} + +.flag-as { + background-image: url("../images/flags/as.svg"); +} + +.flag-at { + background-image: url("../images/flags/at.svg"); +} + +.flag-au { + background-image: url("../images/flags/au.svg"); +} + +.flag-aw { + background-image: url("../images/flags/aw.svg"); +} + +.flag-ax { + background-image: url("../images/flags/ax.svg"); +} + +.flag-az { + background-image: url("../images/flags/az.svg"); +} + +.flag-ba { + background-image: url("../images/flags/ba.svg"); +} + +.flag-bb { + background-image: url("../images/flags/bb.svg"); +} + +.flag-bd { + background-image: url("../images/flags/bd.svg"); +} + +.flag-be { + background-image: url("../images/flags/be.svg"); +} + +.flag-bf { + background-image: url("../images/flags/bf.svg"); +} + +.flag-bg { + background-image: url("../images/flags/bg.svg"); +} + +.flag-bh { + background-image: url("../images/flags/bh.svg"); +} + +.flag-bi { + background-image: url("../images/flags/bi.svg"); +} + +.flag-bj { + background-image: url("../images/flags/bj.svg"); +} + +.flag-bl { + background-image: url("../images/flags/bl.svg"); +} + +.flag-bm { + background-image: url("../images/flags/bm.svg"); +} + +.flag-bn { + background-image: url("../images/flags/bn.svg"); +} + +.flag-bo { + background-image: url("../images/flags/bo.svg"); +} + +.flag-bq { + background-image: url("../images/flags/bq.svg"); +} + +.flag-br { + background-image: url("../images/flags/br.svg"); +} + +.flag-bs { + background-image: url("../images/flags/bs.svg"); +} + +.flag-bt { + background-image: url("../images/flags/bt.svg"); +} + +.flag-bv { + background-image: url("../images/flags/bv.svg"); +} + +.flag-bw { + background-image: url("../images/flags/bw.svg"); +} + +.flag-by { + background-image: url("../images/flags/by.svg"); +} + +.flag-bz { + background-image: url("../images/flags/bz.svg"); +} + +.flag-ca { + background-image: url("../images/flags/ca.svg"); +} + +.flag-cc { + background-image: url("../images/flags/cc.svg"); +} + +.flag-cd { + background-image: url("../images/flags/cd.svg"); +} + +.flag-cf { + background-image: url("../images/flags/cf.svg"); +} + +.flag-cg { + background-image: url("../images/flags/cg.svg"); +} + +.flag-ch { + background-image: url("../images/flags/ch.svg"); +} + +.flag-ci { + background-image: url("../images/flags/ci.svg"); +} + +.flag-ck { + background-image: url("../images/flags/ck.svg"); +} + +.flag-cl { + background-image: url("../images/flags/cl.svg"); +} + +.flag-cm { + background-image: url("../images/flags/cm.svg"); +} + +.flag-cn { + background-image: url("../images/flags/cn.svg"); +} + +.flag-co { + background-image: url("../images/flags/co.svg"); +} + +.flag-cr { + background-image: url("../images/flags/cr.svg"); +} + +.flag-cu { + background-image: url("../images/flags/cu.svg"); +} + +.flag-cv { + background-image: url("../images/flags/cv.svg"); +} + +.flag-cw { + background-image: url("../images/flags/cw.svg"); +} + +.flag-cx { + background-image: url("../images/flags/cx.svg"); +} + +.flag-cy { + background-image: url("../images/flags/cy.svg"); +} + +.flag-cz { + background-image: url("../images/flags/cz.svg"); +} + +.flag-de { + background-image: url("../images/flags/de.svg"); +} + +.flag-dj { + background-image: url("../images/flags/dj.svg"); +} + +.flag-dk { + background-image: url("../images/flags/dk.svg"); +} + +.flag-dm { + background-image: url("../images/flags/dm.svg"); +} + +.flag-do { + background-image: url("../images/flags/do.svg"); +} + +.flag-dz { + background-image: url("../images/flags/dz.svg"); +} + +.flag-ec { + background-image: url("../images/flags/ec.svg"); +} + +.flag-ee { + background-image: url("../images/flags/ee.svg"); +} + +.flag-eg { + background-image: url("../images/flags/eg.svg"); +} + +.flag-eh { + background-image: url("../images/flags/eh.svg"); +} + +.flag-er { + background-image: url("../images/flags/er.svg"); +} + +.flag-es { + background-image: url("../images/flags/es.svg"); +} + +.flag-et { + background-image: url("../images/flags/et.svg"); +} + +.flag-eu { + background-image: url("../images/flags/eu.svg"); +} + +.flag-fi { + background-image: url("../images/flags/fi.svg"); +} + +.flag-fj { + background-image: url("../images/flags/fj.svg"); +} + +.flag-fk { + background-image: url("../images/flags/fk.svg"); +} + +.flag-fm { + background-image: url("../images/flags/fm.svg"); +} + +.flag-fo { + background-image: url("../images/flags/fo.svg"); +} + +.flag-fr { + background-image: url("../images/flags/fr.svg"); +} + +.flag-ga { + background-image: url("../images/flags/ga.svg"); +} + +.flag-gb-eng { + background-image: url("../images/flags/gb-eng.svg"); +} + +.flag-gb-nir { + background-image: url("../images/flags/gb-nir.svg"); +} + +.flag-gb-sct { + background-image: url("../images/flags/gb-sct.svg"); +} + +.flag-gb-wls { + background-image: url("../images/flags/gb-wls.svg"); +} + +.flag-gb { + background-image: url("../images/flags/gb.svg"); +} + +.flag-gd { + background-image: url("../images/flags/gd.svg"); +} + +.flag-ge { + background-image: url("../images/flags/ge.svg"); +} + +.flag-gf { + background-image: url("../images/flags/gf.svg"); +} + +.flag-gg { + background-image: url("../images/flags/gg.svg"); +} + +.flag-gh { + background-image: url("../images/flags/gh.svg"); +} + +.flag-gi { + background-image: url("../images/flags/gi.svg"); +} + +.flag-gl { + background-image: url("../images/flags/gl.svg"); +} + +.flag-gm { + background-image: url("../images/flags/gm.svg"); +} + +.flag-gn { + background-image: url("../images/flags/gn.svg"); +} + +.flag-gp { + background-image: url("../images/flags/gp.svg"); +} + +.flag-gq { + background-image: url("../images/flags/gq.svg"); +} + +.flag-gr { + background-image: url("../images/flags/gr.svg"); +} + +.flag-gs { + background-image: url("../images/flags/gs.svg"); +} + +.flag-gt { + background-image: url("../images/flags/gt.svg"); +} + +.flag-gu { + background-image: url("../images/flags/gu.svg"); +} + +.flag-gw { + background-image: url("../images/flags/gw.svg"); +} + +.flag-gy { + background-image: url("../images/flags/gy.svg"); +} + +.flag-hk { + background-image: url("../images/flags/hk.svg"); +} + +.flag-hm { + background-image: url("../images/flags/hm.svg"); +} + +.flag-hn { + background-image: url("../images/flags/hn.svg"); +} + +.flag-hr { + background-image: url("../images/flags/hr.svg"); +} + +.flag-ht { + background-image: url("../images/flags/ht.svg"); +} + +.flag-hu { + background-image: url("../images/flags/hu.svg"); +} + +.flag-id { + background-image: url("../images/flags/id.svg"); +} + +.flag-ie { + background-image: url("../images/flags/ie.svg"); +} + +.flag-il { + background-image: url("../images/flags/il.svg"); +} + +.flag-im { + background-image: url("../images/flags/im.svg"); +} + +.flag-in { + background-image: url("../images/flags/in.svg"); +} + +.flag-io { + background-image: url("../images/flags/io.svg"); +} + +.flag-iq { + background-image: url("../images/flags/iq.svg"); +} + +.flag-ir { + background-image: url("../images/flags/ir.svg"); +} + +.flag-is { + background-image: url("../images/flags/is.svg"); +} + +.flag-it { + background-image: url("../images/flags/it.svg"); +} + +.flag-je { + background-image: url("../images/flags/je.svg"); +} + +.flag-jm { + background-image: url("../images/flags/jm.svg"); +} + +.flag-jo { + background-image: url("../images/flags/jo.svg"); +} + +.flag-jp { + background-image: url("../images/flags/jp.svg"); +} + +.flag-ke { + background-image: url("../images/flags/ke.svg"); +} + +.flag-kg { + background-image: url("../images/flags/kg.svg"); +} + +.flag-kh { + background-image: url("../images/flags/kh.svg"); +} + +.flag-ki { + background-image: url("../images/flags/ki.svg"); +} + +.flag-km { + background-image: url("../images/flags/km.svg"); +} + +.flag-kn { + background-image: url("../images/flags/kn.svg"); +} + +.flag-kp { + background-image: url("../images/flags/kp.svg"); +} + +.flag-kr { + background-image: url("../images/flags/kr.svg"); +} + +.flag-kw { + background-image: url("../images/flags/kw.svg"); +} + +.flag-ky { + background-image: url("../images/flags/ky.svg"); +} + +.flag-kz { + background-image: url("../images/flags/kz.svg"); +} + +.flag-la { + background-image: url("../images/flags/la.svg"); +} + +.flag-lb { + background-image: url("../images/flags/lb.svg"); +} + +.flag-lc { + background-image: url("../images/flags/lc.svg"); +} + +.flag-li { + background-image: url("../images/flags/li.svg"); +} + +.flag-lk { + background-image: url("../images/flags/lk.svg"); +} + +.flag-lr { + background-image: url("../images/flags/lr.svg"); +} + +.flag-ls { + background-image: url("../images/flags/ls.svg"); +} + +.flag-lt { + background-image: url("../images/flags/lt.svg"); +} + +.flag-lu { + background-image: url("../images/flags/lu.svg"); +} + +.flag-lv { + background-image: url("../images/flags/lv.svg"); +} + +.flag-ly { + background-image: url("../images/flags/ly.svg"); +} + +.flag-ma { + background-image: url("../images/flags/ma.svg"); +} + +.flag-mc { + background-image: url("../images/flags/mc.svg"); +} + +.flag-md { + background-image: url("../images/flags/md.svg"); +} + +.flag-me { + background-image: url("../images/flags/me.svg"); +} + +.flag-mf { + background-image: url("../images/flags/mf.svg"); +} + +.flag-mg { + background-image: url("../images/flags/mg.svg"); +} + +.flag-mh { + background-image: url("../images/flags/mh.svg"); +} + +.flag-mk { + background-image: url("../images/flags/mk.svg"); +} + +.flag-ml { + background-image: url("../images/flags/ml.svg"); +} + +.flag-mm { + background-image: url("../images/flags/mm.svg"); +} + +.flag-mn { + background-image: url("../images/flags/mn.svg"); +} + +.flag-mo { + background-image: url("../images/flags/mo.svg"); +} + +.flag-mp { + background-image: url("../images/flags/mp.svg"); +} + +.flag-mq { + background-image: url("../images/flags/mq.svg"); +} + +.flag-mr { + background-image: url("../images/flags/mr.svg"); +} + +.flag-ms { + background-image: url("../images/flags/ms.svg"); +} + +.flag-mt { + background-image: url("../images/flags/mt.svg"); +} + +.flag-mu { + background-image: url("../images/flags/mu.svg"); +} + +.flag-mv { + background-image: url("../images/flags/mv.svg"); +} + +.flag-mw { + background-image: url("../images/flags/mw.svg"); +} + +.flag-mx { + background-image: url("../images/flags/mx.svg"); +} + +.flag-my { + background-image: url("../images/flags/my.svg"); +} + +.flag-mz { + background-image: url("../images/flags/mz.svg"); +} + +.flag-na { + background-image: url("../images/flags/na.svg"); +} + +.flag-nc { + background-image: url("../images/flags/nc.svg"); +} + +.flag-ne { + background-image: url("../images/flags/ne.svg"); +} + +.flag-nf { + background-image: url("../images/flags/nf.svg"); +} + +.flag-ng { + background-image: url("../images/flags/ng.svg"); +} + +.flag-ni { + background-image: url("../images/flags/ni.svg"); +} + +.flag-nl { + background-image: url("../images/flags/nl.svg"); +} + +.flag-no { + background-image: url("../images/flags/no.svg"); +} + +.flag-np { + background-image: url("../images/flags/np.svg"); +} + +.flag-nr { + background-image: url("../images/flags/nr.svg"); +} + +.flag-nu { + background-image: url("../images/flags/nu.svg"); +} + +.flag-nz { + background-image: url("../images/flags/nz.svg"); +} + +.flag-om { + background-image: url("../images/flags/om.svg"); +} + +.flag-pa { + background-image: url("../images/flags/pa.svg"); +} + +.flag-pe { + background-image: url("../images/flags/pe.svg"); +} + +.flag-pf { + background-image: url("../images/flags/pf.svg"); +} + +.flag-pg { + background-image: url("../images/flags/pg.svg"); +} + +.flag-ph { + background-image: url("../images/flags/ph.svg"); +} + +.flag-pk { + background-image: url("../images/flags/pk.svg"); +} + +.flag-pl { + background-image: url("../images/flags/pl.svg"); +} + +.flag-pm { + background-image: url("../images/flags/pm.svg"); +} + +.flag-pn { + background-image: url("../images/flags/pn.svg"); +} + +.flag-pr { + background-image: url("../images/flags/pr.svg"); +} + +.flag-ps { + background-image: url("../images/flags/ps.svg"); +} + +.flag-pt { + background-image: url("../images/flags/pt.svg"); +} + +.flag-pw { + background-image: url("../images/flags/pw.svg"); +} + +.flag-py { + background-image: url("../images/flags/py.svg"); +} + +.flag-qa { + background-image: url("../images/flags/qa.svg"); +} + +.flag-re { + background-image: url("../images/flags/re.svg"); +} + +.flag-ro { + background-image: url("../images/flags/ro.svg"); +} + +.flag-rs { + background-image: url("../images/flags/rs.svg"); +} + +.flag-ru { + background-image: url("../images/flags/ru.svg"); +} + +.flag-rw { + background-image: url("../images/flags/rw.svg"); +} + +.flag-sa { + background-image: url("../images/flags/sa.svg"); +} + +.flag-sb { + background-image: url("../images/flags/sb.svg"); +} + +.flag-sc { + background-image: url("../images/flags/sc.svg"); +} + +.flag-sd { + background-image: url("../images/flags/sd.svg"); +} + +.flag-se { + background-image: url("../images/flags/se.svg"); +} + +.flag-sg { + background-image: url("../images/flags/sg.svg"); +} + +.flag-sh { + background-image: url("../images/flags/sh.svg"); +} + +.flag-si { + background-image: url("../images/flags/si.svg"); +} + +.flag-sj { + background-image: url("../images/flags/sj.svg"); +} + +.flag-sk { + background-image: url("../images/flags/sk.svg"); +} + +.flag-sl { + background-image: url("../images/flags/sl.svg"); +} + +.flag-sm { + background-image: url("../images/flags/sm.svg"); +} + +.flag-sn { + background-image: url("../images/flags/sn.svg"); +} + +.flag-so { + background-image: url("../images/flags/so.svg"); +} + +.flag-sr { + background-image: url("../images/flags/sr.svg"); +} + +.flag-ss { + background-image: url("../images/flags/ss.svg"); +} + +.flag-st { + background-image: url("../images/flags/st.svg"); +} + +.flag-sv { + background-image: url("../images/flags/sv.svg"); +} + +.flag-sx { + background-image: url("../images/flags/sx.svg"); +} + +.flag-sy { + background-image: url("../images/flags/sy.svg"); +} + +.flag-sz { + background-image: url("../images/flags/sz.svg"); +} + +.flag-tc { + background-image: url("../images/flags/tc.svg"); +} + +.flag-td { + background-image: url("../images/flags/td.svg"); +} + +.flag-tf { + background-image: url("../images/flags/tf.svg"); +} + +.flag-tg { + background-image: url("../images/flags/tg.svg"); +} + +.flag-th { + background-image: url("../images/flags/th.svg"); +} + +.flag-tj { + background-image: url("../images/flags/tj.svg"); +} + +.flag-tk { + background-image: url("../images/flags/tk.svg"); +} + +.flag-tl { + background-image: url("../images/flags/tl.svg"); +} + +.flag-tm { + background-image: url("../images/flags/tm.svg"); +} + +.flag-tn { + background-image: url("../images/flags/tn.svg"); +} + +.flag-to { + background-image: url("../images/flags/to.svg"); +} + +.flag-tr { + background-image: url("../images/flags/tr.svg"); +} + +.flag-tt { + background-image: url("../images/flags/tt.svg"); +} + +.flag-tv { + background-image: url("../images/flags/tv.svg"); +} + +.flag-tw { + background-image: url("../images/flags/tw.svg"); +} + +.flag-tz { + background-image: url("../images/flags/tz.svg"); +} + +.flag-ua { + background-image: url("../images/flags/ua.svg"); +} + +.flag-ug { + background-image: url("../images/flags/ug.svg"); +} + +.flag-um { + background-image: url("../images/flags/um.svg"); +} + +.flag-un { + background-image: url("../images/flags/un.svg"); +} + +.flag-us { + background-image: url("../images/flags/us.svg"); +} + +.flag-uy { + background-image: url("../images/flags/uy.svg"); +} + +.flag-uz { + background-image: url("../images/flags/uz.svg"); +} + +.flag-va { + background-image: url("../images/flags/va.svg"); +} + +.flag-vc { + background-image: url("../images/flags/vc.svg"); +} + +.flag-ve { + background-image: url("../images/flags/ve.svg"); +} + +.flag-vg { + background-image: url("../images/flags/vg.svg"); +} + +.flag-vi { + background-image: url("../images/flags/vi.svg"); +} + +.flag-vn { + background-image: url("../images/flags/vn.svg"); +} + +.flag-vu { + background-image: url("../images/flags/vu.svg"); +} + +.flag-wf { + background-image: url("../images/flags/wf.svg"); +} + +.flag-ws { + background-image: url("../images/flags/ws.svg"); +} + +.flag-ye { + background-image: url("../images/flags/ye.svg"); +} + +.flag-yt { + background-image: url("../images/flags/yt.svg"); +} + +.flag-za { + background-image: url("../images/flags/za.svg"); +} + +.flag-zm { + background-image: url("../images/flags/zm.svg"); +} + +.flag-zw { + background-image: url("../images/flags/zw.svg"); +} + +.payment { + width: 2.5rem; + height: 1.5rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.payment-2checkout-dark { + background-image: url("../images/payments/2checkout-dark.svg"); +} + +.payment-2checkout { + background-image: url("../images/payments/2checkout.svg"); +} + +.payment-alipay-dark { + background-image: url("../images/payments/alipay-dark.svg"); +} + +.payment-alipay { + background-image: url("../images/payments/alipay.svg"); +} + +.payment-amazon-dark { + background-image: url("../images/payments/amazon-dark.svg"); +} + +.payment-amazon { + background-image: url("../images/payments/amazon.svg"); +} + +.payment-americanexpress-dark { + background-image: url("../images/payments/americanexpress-dark.svg"); +} + +.payment-americanexpress { + background-image: url("../images/payments/americanexpress.svg"); +} + +.payment-applepay-dark { + background-image: url("../images/payments/applepay-dark.svg"); +} + +.payment-applepay { + background-image: url("../images/payments/applepay.svg"); +} + +.payment-bancontact-dark { + background-image: url("../images/payments/bancontact-dark.svg"); +} + +.payment-bancontact { + background-image: url("../images/payments/bancontact.svg"); +} + +.payment-bitcoin-dark { + background-image: url("../images/payments/bitcoin-dark.svg"); +} + +.payment-bitcoin { + background-image: url("../images/payments/bitcoin.svg"); +} + +.payment-bitpay-dark { + background-image: url("../images/payments/bitpay-dark.svg"); +} + +.payment-bitpay { + background-image: url("../images/payments/bitpay.svg"); +} + +.payment-cirrus-dark { + background-image: url("../images/payments/cirrus-dark.svg"); +} + +.payment-cirrus { + background-image: url("../images/payments/cirrus.svg"); +} + +.payment-clickandbuy-dark { + background-image: url("../images/payments/clickandbuy-dark.svg"); +} + +.payment-clickandbuy { + background-image: url("../images/payments/clickandbuy.svg"); +} + +.payment-coinkite-dark { + background-image: url("../images/payments/coinkite-dark.svg"); +} + +.payment-coinkite { + background-image: url("../images/payments/coinkite.svg"); +} + +.payment-dinersclub-dark { + background-image: url("../images/payments/dinersclub-dark.svg"); +} + +.payment-dinersclub { + background-image: url("../images/payments/dinersclub.svg"); +} + +.payment-directdebit-dark { + background-image: url("../images/payments/directdebit-dark.svg"); +} + +.payment-directdebit { + background-image: url("../images/payments/directdebit.svg"); +} + +.payment-discover-dark { + background-image: url("../images/payments/discover-dark.svg"); +} + +.payment-discover { + background-image: url("../images/payments/discover.svg"); +} + +.payment-dwolla-dark { + background-image: url("../images/payments/dwolla-dark.svg"); +} + +.payment-dwolla { + background-image: url("../images/payments/dwolla.svg"); +} + +.payment-ebay-dark { + background-image: url("../images/payments/ebay-dark.svg"); +} + +.payment-ebay { + background-image: url("../images/payments/ebay.svg"); +} + +.payment-eway-dark { + background-image: url("../images/payments/eway-dark.svg"); +} + +.payment-eway { + background-image: url("../images/payments/eway.svg"); +} + +.payment-giropay-dark { + background-image: url("../images/payments/giropay-dark.svg"); +} + +.payment-giropay { + background-image: url("../images/payments/giropay.svg"); +} + +.payment-googlewallet-dark { + background-image: url("../images/payments/googlewallet-dark.svg"); +} + +.payment-googlewallet { + background-image: url("../images/payments/googlewallet.svg"); +} + +.payment-ingenico-dark { + background-image: url("../images/payments/ingenico-dark.svg"); +} + +.payment-ingenico { + background-image: url("../images/payments/ingenico.svg"); +} + +.payment-jcb-dark { + background-image: url("../images/payments/jcb-dark.svg"); +} + +.payment-jcb { + background-image: url("../images/payments/jcb.svg"); +} + +.payment-klarna-dark { + background-image: url("../images/payments/klarna-dark.svg"); +} + +.payment-klarna { + background-image: url("../images/payments/klarna.svg"); +} + +.payment-laser-dark { + background-image: url("../images/payments/laser-dark.svg"); +} + +.payment-laser { + background-image: url("../images/payments/laser.svg"); +} + +.payment-maestro-dark { + background-image: url("../images/payments/maestro-dark.svg"); +} + +.payment-maestro { + background-image: url("../images/payments/maestro.svg"); +} + +.payment-mastercard-dark { + background-image: url("../images/payments/mastercard-dark.svg"); +} + +.payment-mastercard { + background-image: url("../images/payments/mastercard.svg"); +} + +.payment-monero-dark { + background-image: url("../images/payments/monero-dark.svg"); +} + +.payment-monero { + background-image: url("../images/payments/monero.svg"); +} + +.payment-neteller-dark { + background-image: url("../images/payments/neteller-dark.svg"); +} + +.payment-neteller { + background-image: url("../images/payments/neteller.svg"); +} + +.payment-ogone-dark { + background-image: url("../images/payments/ogone-dark.svg"); +} + +.payment-ogone { + background-image: url("../images/payments/ogone.svg"); +} + +.payment-okpay-dark { + background-image: url("../images/payments/okpay-dark.svg"); +} + +.payment-okpay { + background-image: url("../images/payments/okpay.svg"); +} + +.payment-paybox-dark { + background-image: url("../images/payments/paybox-dark.svg"); +} + +.payment-paybox { + background-image: url("../images/payments/paybox.svg"); +} + +.payment-paymill-dark { + background-image: url("../images/payments/paymill-dark.svg"); +} + +.payment-paymill { + background-image: url("../images/payments/paymill.svg"); +} + +.payment-payone-dark { + background-image: url("../images/payments/payone-dark.svg"); +} + +.payment-payone { + background-image: url("../images/payments/payone.svg"); +} + +.payment-payoneer-dark { + background-image: url("../images/payments/payoneer-dark.svg"); +} + +.payment-payoneer { + background-image: url("../images/payments/payoneer.svg"); +} + +.payment-paypal-dark { + background-image: url("../images/payments/paypal-dark.svg"); +} + +.payment-paypal { + background-image: url("../images/payments/paypal.svg"); +} + +.payment-paysafecard-dark { + background-image: url("../images/payments/paysafecard-dark.svg"); +} + +.payment-paysafecard { + background-image: url("../images/payments/paysafecard.svg"); +} + +.payment-payu-dark { + background-image: url("../images/payments/payu-dark.svg"); +} + +.payment-payu { + background-image: url("../images/payments/payu.svg"); +} + +.payment-payza-dark { + background-image: url("../images/payments/payza-dark.svg"); +} + +.payment-payza { + background-image: url("../images/payments/payza.svg"); +} + +.payment-ripple-dark { + background-image: url("../images/payments/ripple-dark.svg"); +} + +.payment-ripple { + background-image: url("../images/payments/ripple.svg"); +} + +.payment-sage-dark { + background-image: url("../images/payments/sage-dark.svg"); +} + +.payment-sage { + background-image: url("../images/payments/sage.svg"); +} + +.payment-sepa-dark { + background-image: url("../images/payments/sepa-dark.svg"); +} + +.payment-sepa { + background-image: url("../images/payments/sepa.svg"); +} + +.payment-shopify-dark { + background-image: url("../images/payments/shopify-dark.svg"); +} + +.payment-shopify { + background-image: url("../images/payments/shopify.svg"); +} + +.payment-skrill-dark { + background-image: url("../images/payments/skrill-dark.svg"); +} + +.payment-skrill { + background-image: url("../images/payments/skrill.svg"); +} + +.payment-solo-dark { + background-image: url("../images/payments/solo-dark.svg"); +} + +.payment-solo { + background-image: url("../images/payments/solo.svg"); +} + +.payment-square-dark { + background-image: url("../images/payments/square-dark.svg"); +} + +.payment-square { + background-image: url("../images/payments/square.svg"); +} + +.payment-stripe-dark { + background-image: url("../images/payments/stripe-dark.svg"); +} + +.payment-stripe { + background-image: url("../images/payments/stripe.svg"); +} + +.payment-switch-dark { + background-image: url("../images/payments/switch-dark.svg"); +} + +.payment-switch { + background-image: url("../images/payments/switch.svg"); +} + +.payment-ukash-dark { + background-image: url("../images/payments/ukash-dark.svg"); +} + +.payment-ukash { + background-image: url("../images/payments/ukash.svg"); +} + +.payment-unionpay-dark { + background-image: url("../images/payments/unionpay-dark.svg"); +} + +.payment-unionpay { + background-image: url("../images/payments/unionpay.svg"); +} + +.payment-verifone-dark { + background-image: url("../images/payments/verifone-dark.svg"); +} + +.payment-verifone { + background-image: url("../images/payments/verifone.svg"); +} + +.payment-verisign-dark { + background-image: url("../images/payments/verisign-dark.svg"); +} + +.payment-verisign { + background-image: url("../images/payments/verisign.svg"); +} + +.payment-visa-dark { + background-image: url("../images/payments/visa-dark.svg"); +} + +.payment-visa { + background-image: url("../images/payments/visa.svg"); +} + +.payment-webmoney-dark { + background-image: url("../images/payments/webmoney-dark.svg"); +} + +.payment-webmoney { + background-image: url("../images/payments/webmoney.svg"); +} + +.payment-westernunion-dark { + background-image: url("../images/payments/westernunion-dark.svg"); +} + +.payment-westernunion { + background-image: url("../images/payments/westernunion.svg"); +} + +.payment-worldpay-dark { + background-image: url("../images/payments/worldpay-dark.svg"); +} + +.payment-worldpay { + background-image: url("../images/payments/worldpay.svg"); +} + +svg { + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-container { + width: 100%; + height: 100%; + position: relative; + overflow: hidden; + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-tip { + position: absolute; + display: none; + border-radius: 3px; + background: #212529; + color: white; + padding: 6px; + font-size: 11px; + line-height: 1; + font-weight: 700; +} + +.jvectormap-tip small { + font-size: inherit; + font-weight: 400; +} + +.jvectormap-zoomin, .jvectormap-zoomout, .jvectormap-goback { + position: absolute; + left: 10px; + border-radius: 3px; + background: #292929; + padding: 3px; + color: white; + cursor: pointer; + line-height: 10px; + text-align: center; + box-sizing: content-box; +} + +.jvectormap-zoomin, .jvectormap-zoomout { + width: 10px; + height: 10px; +} + +.jvectormap-zoomin { + top: 10px; +} + +.jvectormap-zoomout { + top: 30px; +} + +.jvectormap-goback { + bottom: 10px; + z-index: 1000; + padding: 6px; +} + +.jvectormap-spinner { + position: absolute; + left: 0; + top: 0; + right: 0; + bottom: 0; + background: center no-repeat url(data:image/gif;base64,R0lGODlhIAAgAPMAAP///wAAAMbGxoSEhLa2tpqamjY2NlZWVtjY2OTk5Ly8vB4eHgQEBAAAAAAAAAAAACH/C05FVFNDQVBFMi4wAwEAAAAh/hpDcmVhdGVkIHdpdGggYWpheGxvYWQuaW5mbwAh+QQJCgAAACwAAAAAIAAgAAAE5xDISWlhperN52JLhSSdRgwVo1ICQZRUsiwHpTJT4iowNS8vyW2icCF6k8HMMBkCEDskxTBDAZwuAkkqIfxIQyhBQBFvAQSDITM5VDW6XNE4KagNh6Bgwe60smQUB3d4Rz1ZBApnFASDd0hihh12BkE9kjAJVlycXIg7CQIFA6SlnJ87paqbSKiKoqusnbMdmDC2tXQlkUhziYtyWTxIfy6BE8WJt5YJvpJivxNaGmLHT0VnOgSYf0dZXS7APdpB309RnHOG5gDqXGLDaC457D1zZ/V/nmOM82XiHRLYKhKP1oZmADdEAAAh+QQJCgAAACwAAAAAIAAgAAAE6hDISWlZpOrNp1lGNRSdRpDUolIGw5RUYhhHukqFu8DsrEyqnWThGvAmhVlteBvojpTDDBUEIFwMFBRAmBkSgOrBFZogCASwBDEY/CZSg7GSE0gSCjQBMVG023xWBhklAnoEdhQEfyNqMIcKjhRsjEdnezB+A4k8gTwJhFuiW4dokXiloUepBAp5qaKpp6+Ho7aWW54wl7obvEe0kRuoplCGepwSx2jJvqHEmGt6whJpGpfJCHmOoNHKaHx61WiSR92E4lbFoq+B6QDtuetcaBPnW6+O7wDHpIiK9SaVK5GgV543tzjgGcghAgAh+QQJCgAAACwAAAAAIAAgAAAE7hDISSkxpOrN5zFHNWRdhSiVoVLHspRUMoyUakyEe8PTPCATW9A14E0UvuAKMNAZKYUZCiBMuBakSQKG8G2FzUWox2AUtAQFcBKlVQoLgQReZhQlCIJesQXI5B0CBnUMOxMCenoCfTCEWBsJColTMANldx15BGs8B5wlCZ9Po6OJkwmRpnqkqnuSrayqfKmqpLajoiW5HJq7FL1Gr2mMMcKUMIiJgIemy7xZtJsTmsM4xHiKv5KMCXqfyUCJEonXPN2rAOIAmsfB3uPoAK++G+w48edZPK+M6hLJpQg484enXIdQFSS1u6UhksENEQAAIfkECQoAAAAsAAAAACAAIAAABOcQyEmpGKLqzWcZRVUQnZYg1aBSh2GUVEIQ2aQOE+G+cD4ntpWkZQj1JIiZIogDFFyHI0UxQwFugMSOFIPJftfVAEoZLBbcLEFhlQiqGp1Vd140AUklUN3eCA51C1EWMzMCezCBBmkxVIVHBWd3HHl9JQOIJSdSnJ0TDKChCwUJjoWMPaGqDKannasMo6WnM562R5YluZRwur0wpgqZE7NKUm+FNRPIhjBJxKZteWuIBMN4zRMIVIhffcgojwCF117i4nlLnY5ztRLsnOk+aV+oJY7V7m76PdkS4trKcdg0Zc0tTcKkRAAAIfkECQoAAAAsAAAAACAAIAAABO4QyEkpKqjqzScpRaVkXZWQEximw1BSCUEIlDohrft6cpKCk5xid5MNJTaAIkekKGQkWyKHkvhKsR7ARmitkAYDYRIbUQRQjWBwJRzChi9CRlBcY1UN4g0/VNB0AlcvcAYHRyZPdEQFYV8ccwR5HWxEJ02YmRMLnJ1xCYp0Y5idpQuhopmmC2KgojKasUQDk5BNAwwMOh2RtRq5uQuPZKGIJQIGwAwGf6I0JXMpC8C7kXWDBINFMxS4DKMAWVWAGYsAdNqW5uaRxkSKJOZKaU3tPOBZ4DuK2LATgJhkPJMgTwKCdFjyPHEnKxFCDhEAACH5BAkKAAAALAAAAAAgACAAAATzEMhJaVKp6s2nIkolIJ2WkBShpkVRWqqQrhLSEu9MZJKK9y1ZrqYK9WiClmvoUaF8gIQSNeF1Er4MNFn4SRSDARWroAIETg1iVwuHjYB1kYc1mwruwXKC9gmsJXliGxc+XiUCby9ydh1sOSdMkpMTBpaXBzsfhoc5l58Gm5yToAaZhaOUqjkDgCWNHAULCwOLaTmzswadEqggQwgHuQsHIoZCHQMMQgQGubVEcxOPFAcMDAYUA85eWARmfSRQCdcMe0zeP1AAygwLlJtPNAAL19DARdPzBOWSm1brJBi45soRAWQAAkrQIykShQ9wVhHCwCQCACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiRMDjI0Fd30/iI2UA5GSS5UDj2l6NoqgOgN4gksEBgYFf0FDqKgHnyZ9OX8HrgYHdHpcHQULXAS2qKpENRg7eAMLC7kTBaixUYFkKAzWAAnLC7FLVxLWDBLKCwaKTULgEwbLA4hJtOkSBNqITT3xEgfLpBtzE/jiuL04RGEBgwWhShRgQExHBAAh+QQJCgAAACwAAAAAIAAgAAAE7xDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfZiCqGk5dTESJeaOAlClzsJsqwiJwiqnFrb2nS9kmIcgEsjQydLiIlHehhpejaIjzh9eomSjZR+ipslWIRLAgMDOR2DOqKogTB9pCUJBagDBXR6XB0EBkIIsaRsGGMMAxoDBgYHTKJiUYEGDAzHC9EACcUGkIgFzgwZ0QsSBcXHiQvOwgDdEwfFs0sDzt4S6BK4xYjkDOzn0unFeBzOBijIm1Dgmg5YFQwsCMjp1oJ8LyIAACH5BAkKAAAALAAAAAAgACAAAATwEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GGl6NoiPOH16iZKNlH6KmyWFOggHhEEvAwwMA0N9GBsEC6amhnVcEwavDAazGwIDaH1ipaYLBUTCGgQDA8NdHz0FpqgTBwsLqAbWAAnIA4FWKdMLGdYGEgraigbT0OITBcg5QwPT4xLrROZL6AuQAPUS7bxLpoWidY0JtxLHKhwwMJBTHgPKdEQAACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GAULDJCRiXo1CpGXDJOUjY+Yip9DhToJA4RBLwMLCwVDfRgbBAaqqoZ1XBMHswsHtxtFaH1iqaoGNgAIxRpbFAgfPQSqpbgGBqUD1wBXeCYp1AYZ19JJOYgH1KwA4UBvQwXUBxPqVD9L3sbp2BNk2xvvFPJd+MFCN6HAAIKgNggY0KtEBAAh+QQJCgAAACwAAAAAIAAgAAAE6BDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfYIDMaAFdTESJeaEDAIMxYFqrOUaNW4E4ObYcCXaiBVEgULe0NJaxxtYksjh2NLkZISgDgJhHthkpU4mW6blRiYmZOlh4JWkDqILwUGBnE6TYEbCgevr0N1gH4At7gHiRpFaLNrrq8HNgAJA70AWxQIH1+vsYMDAzZQPC9VCNkDWUhGkuE5PxJNwiUK4UfLzOlD4WvzAHaoG9nxPi5d+jYUqfAhhykOFwJWiAAAIfkECQoAAAAsAAAAACAAIAAABPAQyElpUqnqzaciSoVkXVUMFaFSwlpOCcMYlErAavhOMnNLNo8KsZsMZItJEIDIFSkLGQoQTNhIsFehRww2CQLKF0tYGKYSg+ygsZIuNqJksKgbfgIGepNo2cIUB3V1B3IvNiBYNQaDSTtfhhx0CwVPI0UJe0+bm4g5VgcGoqOcnjmjqDSdnhgEoamcsZuXO1aWQy8KAwOAuTYYGwi7w5h+Kr0SJ8MFihpNbx+4Erq7BYBuzsdiH1jCAzoSfl0rVirNbRXlBBlLX+BP0XJLAPGzTkAuAOqb0WT5AH7OcdCm5B8TgRwSRKIHQtaLCwg1RAAAOwAAAAAAAAAAAA==); +} + +.jvectormap-legend-title { + font-weight: bold; + font-size: 14px; + text-align: center; +} + +.jvectormap-legend-cnt { + position: absolute; +} + +.jvectormap-legend-cnt-h { + bottom: 0; + right: 0; +} + +.jvectormap-legend-cnt-v { + top: 0; + right: 0; +} + +.jvectormap-legend { + background: black; + color: white; + border-radius: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend { + float: left; + margin: 0 10px 10px 0; + padding: 3px 3px 1px 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend .jvectormap-legend-tick { + float: left; +} + +.jvectormap-legend-cnt-v .jvectormap-legend { + margin: 10px 10px 0 0; + padding: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick { + width: 40px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-sample { + height: 15px; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-sample { + height: 20px; + width: 20px; + display: inline-block; + vertical-align: middle; +} + +.jvectormap-legend-tick-text { + font-size: 12px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-text { + text-align: center; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-text { + display: inline-block; + vertical-align: middle; + line-height: 20px; + padding-left: 3px; +} + +/** + * selectize.css (v0.12.4) + * Copyright (c) 2013–2015 Brian Reavis & contributors + * + * Licensed under the Apache License, Version 2.0 (the "License"); you may not use this + * file except in compliance with the License. You may obtain a copy of the License at: + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under + * the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF + * ANY KIND, either express or implied. See the License for the specific language + * governing permissions and limitations under the License. + * + * @author Brian Reavis + */ +.selectize-control.plugin-drag_drop.multi > .selectize-input > div.ui-sortable-placeholder { + visibility: visible !important; + background: #f2f2f2 !important; + background: rgba(0, 0, 0, 0.06) !important; + border: 0 none !important; + box-shadow: inset 0 0 12px 4px #fff; +} + +.selectize-control.plugin-drag_drop .ui-sortable-placeholder::after { + content: '!'; + visibility: hidden; +} + +.selectize-control.plugin-drag_drop .ui-sortable-helper { + box-shadow: 0 2px 5px rgba(0, 0, 0, 0.2); +} + +.selectize-dropdown-header { + position: relative; + padding: 5px 8px; + border-bottom: 1px solid #d0d0d0; + background: #f8f8f8; + border-radius: 3px 3px 0 0; +} + +.selectize-dropdown-header-close { + position: absolute; + right: 8px; + top: 50%; + color: #495057; + opacity: 0.4; + margin-top: -12px; + line-height: 20px; + font-size: 20px !important; +} + +.selectize-dropdown-header-close:hover { + color: #000; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup { + border-right: 1px solid #f2f2f2; + border-top: 0 none; + float: left; + box-sizing: border-box; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:last-child { + border-right: 0 none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:before { + display: none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup-header { + border-top: 0 none; +} + +.selectize-control.plugin-remove_button [data-value] { + position: relative; + padding-right: 24px !important; +} + +.selectize-control.plugin-remove_button [data-value] .remove { + z-index: 1; + /* fixes ie bug (see #392) */ + position: absolute; + top: 0; + right: 0; + bottom: 0; + width: 17px; + text-align: center; + font-weight: bold; + font-size: 12px; + color: inherit; + text-decoration: none; + vertical-align: middle; + display: inline-block; + padding: 2px 0 0 0; + border-left: 1px solid #d0d0d0; + border-radius: 0 2px 2px 0; + box-sizing: border-box; +} + +.selectize-control.plugin-remove_button [data-value] .remove:hover { + background: rgba(0, 0, 0, 0.05); +} + +.selectize-control.plugin-remove_button [data-value].active .remove { + border-left-color: #cacaca; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove:hover { + background: none; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove { + border-left-color: #fff; +} + +.selectize-control.plugin-remove_button .remove-single { + position: absolute; + right: 28px; + top: 6px; + font-size: 23px; +} + +.selectize-control { + position: relative; + padding: 0; + border: 0; +} + +.selectize-dropdown, +.selectize-input, +.selectize-input input { + color: #495057; + font-family: inherit; + font-size: 15px; + line-height: 18px; + -webkit-font-smoothing: inherit; +} + +.selectize-input, +.selectize-control.single .selectize-input.input-active { + background: #fff; + cursor: text; + display: inline-block; +} + +.selectize-input { + border: 1px solid rgba(0, 40, 100, 0.12); + padding: 0.5625rem 0.75rem; + display: inline-block; + display: block; + width: 100%; + overflow: hidden; + position: relative; + z-index: 1; + box-sizing: border-box; + border-radius: 3px; + transition: .3s border-color, .3s box-shadow; +} + +.selectize-control.multi .selectize-input.has-items { + padding: 7px 0.75rem 4px 7px; +} + +.selectize-input.full { + background-color: #fff; +} + +.selectize-input.disabled, +.selectize-input.disabled * { + cursor: default !important; +} + +.selectize-input.focus { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectize-input.dropdown-active { + border-radius: 3px 3px 0 0; +} + +.selectize-input > * { + vertical-align: baseline; + display: -moz-inline-stack; + display: inline-block; + zoom: 1; + *display: inline; +} + +.selectize-control.multi .selectize-input > div { + cursor: pointer; + margin: 0 3px 3px 0; + padding: 2px 6px; + background: #e9ecef; + color: #495057; + font-size: 13px; + border: 0 solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-weight: 400; +} + +.selectize-control.multi .selectize-input > div.active { + background: #e8e8e8; + color: #303030; + border: 0 solid #cacaca; +} + +.selectize-control.multi .selectize-input.disabled > div, +.selectize-control.multi .selectize-input.disabled > div.active { + color: #7d7d7d; + background: #fff; + border: 0 solid #fff; +} + +.selectize-input > input { + display: inline-block !important; + padding: 0 !important; + min-height: 0 !important; + max-height: none !important; + max-width: 100% !important; + margin: 0 2px 0 0 !important; + text-indent: 0 !important; + border: 0 none !important; + background: none !important; + line-height: inherit !important; + box-shadow: none !important; +} + +.selectize-input > input::-ms-clear { + display: none; +} + +.selectize-input > input:focus { + outline: none !important; +} + +.selectize-input::after { + content: ' '; + display: block; + clear: left; +} + +.selectize-input.dropdown-active::before { + content: ' '; + display: block; + position: absolute; + background: #f0f0f0; + height: 1px; + bottom: 0; + left: 0; + right: 0; +} + +.selectize-dropdown { + position: absolute; + z-index: 10; + border: 1px solid rgba(0, 40, 100, 0.12); + background: #fff; + margin: -1px 0 0 0; + border-top: 0 none; + box-sizing: border-box; + border-radius: 0 0 3px 3px; + height: auto; + padding: 0; +} + +.selectize-dropdown [data-selectable] { + cursor: pointer; + overflow: hidden; +} + +.selectize-dropdown [data-selectable] .highlight { + background: rgba(125, 168, 208, 0.2); + border-radius: 1px; +} + +.selectize-dropdown [data-selectable], +.selectize-dropdown .optgroup-header { + padding: 6px .75rem; +} + +.selectize-dropdown .optgroup:first-child .optgroup-header { + border-top: 0 none; +} + +.selectize-dropdown .optgroup-header { + color: #495057; + background: #fff; + cursor: default; +} + +.selectize-dropdown .active { + background-color: #F1F4F8; + color: #467fcf; +} + +.selectize-dropdown .active.create { + color: #495057; +} + +.selectize-dropdown .create { + color: rgba(48, 48, 48, 0.5); +} + +.selectize-dropdown-content { + overflow-y: auto; + overflow-x: hidden; + max-height: 200px; + -webkit-overflow-scrolling: touch; +} + +.selectize-control.single .selectize-input, +.selectize-control.single .selectize-input input { + cursor: pointer; +} + +.selectize-control.single .selectize-input.input-active, +.selectize-control.single .selectize-input.input-active input { + cursor: text; +} + +.selectize-control.single .selectize-input:after { + content: ''; + display: block; + position: absolute; + top: 13px; + right: 12px; + width: 8px; + height: 10px; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat center; + background-size: 8px 10px; + transition: .3s transform; +} + +.selectize-control.single .selectize-input.dropdown-active:after { + -webkit-transform: rotate(180deg); + transform: rotate(180deg); +} + +.selectize-control .selectize-input.disabled { + opacity: 0.5; + background-color: #fafafa; +} + +.selectize-dropdown .image, +.selectize-input .image { + width: 1.25rem; + height: 1.25rem; + background-size: contain; + margin: -1px .5rem -1px -4px; + line-height: 1.25rem; + float: left; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; +} + +.selectize-dropdown .image img, +.selectize-input .image img { + max-width: 100%; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); + border-radius: 2px; +} + +.selectize-input .image { + width: 1.5rem; + height: 1.5rem; + margin: -3px .75rem -3px -5px; +} + +@font-face { + font-family: "feather"; + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106"); + /* IE9*/ + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106#iefix") format("embedded-opentype"), url("../fonts/feather/feather-webfont.woff?t=1501841394106") format("woff"), url("../fonts/feather/feather-webfont.ttf?t=1501841394106") format("truetype"), url("../fonts/feather/feather-webfont.svg?t=1501841394106#feather") format("svg"); + /* iOS 4.1- */ +} + +.fe { + font-family: 'feather' !important; + speak: none; + font-style: normal; + font-weight: normal; + font-variant: normal; + text-transform: none; + line-height: 1; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +.fe-activity:before { + content: "\e900"; +} + +.fe-airplay:before { + content: "\e901"; +} + +.fe-alert-circle:before { + content: "\e902"; +} + +.fe-alert-octagon:before { + content: "\e903"; +} + +.fe-alert-triangle:before { + content: "\e904"; +} + +.fe-align-center:before { + content: "\e905"; +} + +.fe-align-justify:before { + content: "\e906"; +} + +.fe-align-left:before { + content: "\e907"; +} + +.fe-align-right:before { + content: "\e908"; +} + +.fe-anchor:before { + content: "\e909"; +} + +.fe-aperture:before { + content: "\e90a"; +} + +.fe-arrow-down:before { + content: "\e90b"; +} + +.fe-arrow-down-circle:before { + content: "\e90c"; +} + +.fe-arrow-down-left:before { + content: "\e90d"; +} + +.fe-arrow-down-right:before { + content: "\e90e"; +} + +.fe-arrow-left:before { + content: "\e90f"; +} + +.fe-arrow-left-circle:before { + content: "\e910"; +} + +.fe-arrow-right:before { + content: "\e911"; +} + +.fe-arrow-right-circle:before { + content: "\e912"; +} + +.fe-arrow-up:before { + content: "\e913"; +} + +.fe-arrow-up-circle:before { + content: "\e914"; +} + +.fe-arrow-up-left:before { + content: "\e915"; +} + +.fe-arrow-up-right:before { + content: "\e916"; +} + +.fe-at-sign:before { + content: "\e917"; +} + +.fe-award:before { + content: "\e918"; +} + +.fe-bar-chart:before { + content: "\e919"; +} + +.fe-bar-chart-2:before { + content: "\e91a"; +} + +.fe-battery:before { + content: "\e91b"; +} + +.fe-battery-charging:before { + content: "\e91c"; +} + +.fe-bell:before { + content: "\e91d"; +} + +.fe-bell-off:before { + content: "\e91e"; +} + +.fe-bluetooth:before { + content: "\e91f"; +} + +.fe-bold:before { + content: "\e920"; +} + +.fe-book:before { + content: "\e921"; +} + +.fe-book-open:before { + content: "\e922"; +} + +.fe-bookmark:before { + content: "\e923"; +} + +.fe-box:before { + content: "\e924"; +} + +.fe-briefcase:before { + content: "\e925"; +} + +.fe-calendar:before { + content: "\e926"; +} + +.fe-camera:before { + content: "\e927"; +} + +.fe-camera-off:before { + content: "\e928"; +} + +.fe-cast:before { + content: "\e929"; +} + +.fe-check:before { + content: "\e92a"; +} + +.fe-check-circle:before { + content: "\e92b"; +} + +.fe-check-square:before { + content: "\e92c"; +} + +.fe-chevron-down:before { + content: "\e92d"; +} + +.fe-chevron-left:before { + content: "\e92e"; +} + +.fe-chevron-right:before { + content: "\e92f"; +} + +.fe-chevron-up:before { + content: "\e930"; +} + +.fe-chevrons-down:before { + content: "\e931"; +} + +.fe-chevrons-left:before { + content: "\e932"; +} + +.fe-chevrons-right:before { + content: "\e933"; +} + +.fe-chevrons-up:before { + content: "\e934"; +} + +.fe-chrome:before { + content: "\e935"; +} + +.fe-circle:before { + content: "\e936"; +} + +.fe-clipboard:before { + content: "\e937"; +} + +.fe-clock:before { + content: "\e938"; +} + +.fe-cloud:before { + content: "\e939"; +} + +.fe-cloud-drizzle:before { + content: "\e93a"; +} + +.fe-cloud-lightning:before { + content: "\e93b"; +} + +.fe-cloud-off:before { + content: "\e93c"; +} + +.fe-cloud-rain:before { + content: "\e93d"; +} + +.fe-cloud-snow:before { + content: "\e93e"; +} + +.fe-code:before { + content: "\e93f"; +} + +.fe-codepen:before { + content: "\e940"; +} + +.fe-command:before { + content: "\e941"; +} + +.fe-compass:before { + content: "\e942"; +} + +.fe-copy:before { + content: "\e943"; +} + +.fe-corner-down-left:before { + content: "\e944"; +} + +.fe-corner-down-right:before { + content: "\e945"; +} + +.fe-corner-left-down:before { + content: "\e946"; +} + +.fe-corner-left-up:before { + content: "\e947"; +} + +.fe-corner-right-down:before { + content: "\e948"; +} + +.fe-corner-right-up:before { + content: "\e949"; +} + +.fe-corner-up-left:before { + content: "\e94a"; +} + +.fe-corner-up-right:before { + content: "\e94b"; +} + +.fe-cpu:before { + content: "\e94c"; +} + +.fe-credit-card:before { + content: "\e94d"; +} + +.fe-crop:before { + content: "\e94e"; +} + +.fe-crosshair:before { + content: "\e94f"; +} + +.fe-database:before { + content: "\e950"; +} + +.fe-delete:before { + content: "\e951"; +} + +.fe-disc:before { + content: "\e952"; +} + +.fe-dollar-sign:before { + content: "\e953"; +} + +.fe-download:before { + content: "\e954"; +} + +.fe-download-cloud:before { + content: "\e955"; +} + +.fe-droplet:before { + content: "\e956"; +} + +.fe-edit:before { + content: "\e957"; +} + +.fe-edit-2:before { + content: "\e958"; +} + +.fe-edit-3:before { + content: "\e959"; +} + +.fe-external-link:before { + content: "\e95a"; +} + +.fe-eye:before { + content: "\e95b"; +} + +.fe-eye-off:before { + content: "\e95c"; +} + +.fe-facebook:before { + content: "\e95d"; +} + +.fe-fast-forward:before { + content: "\e95e"; +} + +.fe-feather:before { + content: "\e95f"; +} + +.fe-file:before { + content: "\e960"; +} + +.fe-file-minus:before { + content: "\e961"; +} + +.fe-file-plus:before { + content: "\e962"; +} + +.fe-file-text:before { + content: "\e963"; +} + +.fe-film:before { + content: "\e964"; +} + +.fe-filter:before { + content: "\e965"; +} + +.fe-flag:before { + content: "\e966"; +} + +.fe-folder:before { + content: "\e967"; +} + +.fe-folder-minus:before { + content: "\e968"; +} + +.fe-folder-plus:before { + content: "\e969"; +} + +.fe-git-branch:before { + content: "\e96a"; +} + +.fe-git-commit:before { + content: "\e96b"; +} + +.fe-git-merge:before { + content: "\e96c"; +} + +.fe-git-pull-request:before { + content: "\e96d"; +} + +.fe-github:before { + content: "\e96e"; +} + +.fe-gitlab:before { + content: "\e96f"; +} + +.fe-globe:before { + content: "\e970"; +} + +.fe-grid:before { + content: "\e971"; +} + +.fe-hard-drive:before { + content: "\e972"; +} + +.fe-hash:before { + content: "\e973"; +} + +.fe-headphones:before { + content: "\e974"; +} + +.fe-heart:before { + content: "\e975"; +} + +.fe-help-circle:before { + content: "\e976"; +} + +.fe-home:before { + content: "\e977"; +} + +.fe-image:before { + content: "\e978"; +} + +.fe-inbox:before { + content: "\e979"; +} + +.fe-info:before { + content: "\e97a"; +} + +.fe-instagram:before { + content: "\e97b"; +} + +.fe-italic:before { + content: "\e97c"; +} + +.fe-layers:before { + content: "\e97d"; +} + +.fe-layout:before { + content: "\e97e"; +} + +.fe-life-buoy:before { + content: "\e97f"; +} + +.fe-link:before { + content: "\e980"; +} + +.fe-link-2:before { + content: "\e981"; +} + +.fe-linkedin:before { + content: "\e982"; +} + +.fe-list:before { + content: "\e983"; +} + +.fe-loader:before { + content: "\e984"; +} + +.fe-lock:before { + content: "\e985"; +} + +.fe-log-in:before { + content: "\e986"; +} + +.fe-log-out:before { + content: "\e987"; +} + +.fe-mail:before { + content: "\e988"; +} + +.fe-map:before { + content: "\e989"; +} + +.fe-map-pin:before { + content: "\e98a"; +} + +.fe-maximize:before { + content: "\e98b"; +} + +.fe-maximize-2:before { + content: "\e98c"; +} + +.fe-menu:before { + content: "\e98d"; +} + +.fe-message-circle:before { + content: "\e98e"; +} + +.fe-message-square:before { + content: "\e98f"; +} + +.fe-mic:before { + content: "\e990"; +} + +.fe-mic-off:before { + content: "\e991"; +} + +.fe-minimize:before { + content: "\e992"; +} + +.fe-minimize-2:before { + content: "\e993"; +} + +.fe-minus:before { + content: "\e994"; +} + +.fe-minus-circle:before { + content: "\e995"; +} + +.fe-minus-square:before { + content: "\e996"; +} + +.fe-monitor:before { + content: "\e997"; +} + +.fe-moon:before { + content: "\e998"; +} + +.fe-more-horizontal:before { + content: "\e999"; +} + +.fe-more-vertical:before { + content: "\e99a"; +} + +.fe-move:before { + content: "\e99b"; +} + +.fe-music:before { + content: "\e99c"; +} + +.fe-navigation:before { + content: "\e99d"; +} + +.fe-navigation-2:before { + content: "\e99e"; +} + +.fe-octagon:before { + content: "\e99f"; +} + +.fe-package:before { + content: "\e9a0"; +} + +.fe-paperclip:before { + content: "\e9a1"; +} + +.fe-pause:before { + content: "\e9a2"; +} + +.fe-pause-circle:before { + content: "\e9a3"; +} + +.fe-percent:before { + content: "\e9a4"; +} + +.fe-phone:before { + content: "\e9a5"; +} + +.fe-phone-call:before { + content: "\e9a6"; +} + +.fe-phone-forwarded:before { + content: "\e9a7"; +} + +.fe-phone-incoming:before { + content: "\e9a8"; +} + +.fe-phone-missed:before { + content: "\e9a9"; +} + +.fe-phone-off:before { + content: "\e9aa"; +} + +.fe-phone-outgoing:before { + content: "\e9ab"; +} + +.fe-pie-chart:before { + content: "\e9ac"; +} + +.fe-play:before { + content: "\e9ad"; +} + +.fe-play-circle:before { + content: "\e9ae"; +} + +.fe-plus:before { + content: "\e9af"; +} + +.fe-plus-circle:before { + content: "\e9b0"; +} + +.fe-plus-square:before { + content: "\e9b1"; +} + +.fe-pocket:before { + content: "\e9b2"; +} + +.fe-power:before { + content: "\e9b3"; +} + +.fe-printer:before { + content: "\e9b4"; +} + +.fe-radio:before { + content: "\e9b5"; +} + +.fe-refresh-ccw:before { + content: "\e9b6"; +} + +.fe-refresh-cw:before { + content: "\e9b7"; +} + +.fe-repeat:before { + content: "\e9b8"; +} + +.fe-rewind:before { + content: "\e9b9"; +} + +.fe-rotate-ccw:before { + content: "\e9ba"; +} + +.fe-rotate-cw:before { + content: "\e9bb"; +} + +.fe-rss:before { + content: "\e9bc"; +} + +.fe-save:before { + content: "\e9bd"; +} + +.fe-scissors:before { + content: "\e9be"; +} + +.fe-search:before { + content: "\e9bf"; +} + +.fe-send:before { + content: "\e9c0"; +} + +.fe-server:before { + content: "\e9c1"; +} + +.fe-settings:before { + content: "\e9c2"; +} + +.fe-share:before { + content: "\e9c3"; +} + +.fe-share-2:before { + content: "\e9c4"; +} + +.fe-shield:before { + content: "\e9c5"; +} + +.fe-shield-off:before { + content: "\e9c6"; +} + +.fe-shopping-bag:before { + content: "\e9c7"; +} + +.fe-shopping-cart:before { + content: "\e9c8"; +} + +.fe-shuffle:before { + content: "\e9c9"; +} + +.fe-sidebar:before { + content: "\e9ca"; +} + +.fe-skip-back:before { + content: "\e9cb"; +} + +.fe-skip-forward:before { + content: "\e9cc"; +} + +.fe-slack:before { + content: "\e9cd"; +} + +.fe-slash:before { + content: "\e9ce"; +} + +.fe-sliders:before { + content: "\e9cf"; +} + +.fe-smartphone:before { + content: "\e9d0"; +} + +.fe-speaker:before { + content: "\e9d1"; +} + +.fe-square:before { + content: "\e9d2"; +} + +.fe-star:before { + content: "\e9d3"; +} + +.fe-stop-circle:before { + content: "\e9d4"; +} + +.fe-sun:before { + content: "\e9d5"; +} + +.fe-sunrise:before { + content: "\e9d6"; +} + +.fe-sunset:before { + content: "\e9d7"; +} + +.fe-tablet:before { + content: "\e9d8"; +} + +.fe-tag:before { + content: "\e9d9"; +} + +.fe-target:before { + content: "\e9da"; +} + +.fe-terminal:before { + content: "\e9db"; +} + +.fe-thermometer:before { + content: "\e9dc"; +} + +.fe-thumbs-down:before { + content: "\e9dd"; +} + +.fe-thumbs-up:before { + content: "\e9de"; +} + +.fe-toggle-left:before { + content: "\e9df"; +} + +.fe-toggle-right:before { + content: "\e9e0"; +} + +.fe-trash:before { + content: "\e9e1"; +} + +.fe-trash-2:before { + content: "\e9e2"; +} + +.fe-trending-down:before { + content: "\e9e3"; +} + +.fe-trending-up:before { + content: "\e9e4"; +} + +.fe-triangle:before { + content: "\e9e5"; +} + +.fe-truck:before { + content: "\e9e6"; +} + +.fe-tv:before { + content: "\e9e7"; +} + +.fe-twitter:before { + content: "\e9e8"; +} + +.fe-type:before { + content: "\e9e9"; +} + +.fe-umbrella:before { + content: "\e9ea"; +} + +.fe-underline:before { + content: "\e9eb"; +} + +.fe-unlock:before { + content: "\e9ec"; +} + +.fe-upload:before { + content: "\e9ed"; +} + +.fe-upload-cloud:before { + content: "\e9ee"; +} + +.fe-user:before { + content: "\e9ef"; +} + +.fe-user-check:before { + content: "\e9f0"; +} + +.fe-user-minus:before { + content: "\e9f1"; +} + +.fe-user-plus:before { + content: "\e9f2"; +} + +.fe-user-x:before { + content: "\e9f3"; +} + +.fe-users:before { + content: "\e9f4"; +} + +.fe-video:before { + content: "\e9f5"; +} + +.fe-video-off:before { + content: "\e9f6"; +} + +.fe-voicemail:before { + content: "\e9f7"; +} + +.fe-volume:before { + content: "\e9f8"; +} + +.fe-volume-1:before { + content: "\e9f9"; +} + +.fe-volume-2:before { + content: "\e9fa"; +} + +.fe-volume-x:before { + content: "\e9fb"; +} + +.fe-watch:before { + content: "\e9fc"; +} + +.fe-wifi:before { + content: "\e9fd"; +} + +.fe-wifi-off:before { + content: "\e9fe"; +} + +.fe-wind:before { + content: "\e9ff"; +} + +.fe-x:before { + content: "\ea00"; +} + +.fe-x-circle:before { + content: "\ea01"; +} + +.fe-x-square:before { + content: "\ea02"; +} + +.fe-zap:before { + content: "\ea03"; +} + +.fe-zap-off:before { + content: "\ea04"; +} + +.fe-zoom-in:before { + content: "\ea05"; +} + +.fe-zoom-out:before { + content: "\ea06"; +} diff --git a/public/v2/assets/css/dashboard.rtl.css b/public/v2/assets/css/dashboard.rtl.css new file mode 100755 index 0000000000..825506ec93 --- /dev/null +++ b/public/v2/assets/css/dashboard.rtl.css @@ -0,0 +1,18610 @@ +@charset "UTF-8"; +/** +Dashboard UI + */ +/*! + * Bootstrap v4.1.0 (https://getbootstrap.com/) + * Copyright 2011-2018 The Bootstrap Authors + * Copyright 2011-2018 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +:root { + --blue: #467fcf; + --indigo: #6574cd; + --purple: #a55eea; + --pink: #f66d9b; + --red: #cd201f; + --orange: #fd9644; + --yellow: #f1c40f; + --green: #5eba00; + --teal: #2bcbba; + --cyan: #17a2b8; + --white: #fff; + --gray: #868e96; + --gray-dark: #343a40; + --azure: #45aaf2; + --lime: #7bd235; + --primary: #467fcf; + --secondary: #868e96; + --success: #5eba00; + --info: #45aaf2; + --warning: #f1c40f; + --danger: #cd201f; + --light: #f8f9fa; + --dark: #343a40; + --breakpoint-xs: 0; + --breakpoint-sm: 576px; + --breakpoint-md: 768px; + --breakpoint-lg: 992px; + --breakpoint-xl: 1280px; + --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol"; + --font-family-monospace: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +*, +*::before, +*::after { + box-sizing: border-box; +} + +html { + font-family: sans-serif; + line-height: 1.15; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; + -ms-overflow-style: scrollbar; + -webkit-tap-highlight-color: transparent; +} + +@-ms-viewport { + width: device-width; +} + +article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section { + display: block; +} + +body { + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.5; + color: #495057; + text-align: right; + background-color: #f5f7fb; +} + +[tabindex="-1"]:focus { + outline: 0 !important; +} + +hr { + box-sizing: content-box; + height: 0; + overflow: visible; +} + +h1, h2, h3, h4, h5, h6 { + margin-top: 0; + margin-bottom: 0.66em; +} + +p { + margin-top: 0; + margin-bottom: 1rem; +} + +abbr[title], +abbr[data-original-title] { + text-decoration: underline; + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; + cursor: help; + border-bottom: 0; +} + +address { + margin-bottom: 1rem; + font-style: normal; + line-height: inherit; +} + +ol, +ul, +dl { + margin-top: 0; + margin-bottom: 1rem; +} + +ol ol, +ul ul, +ol ul, +ul ol { + margin-bottom: 0; +} + +dt { + font-weight: 700; +} + +dd { + margin-bottom: .5rem; + margin-right: 0; +} + +blockquote { + margin: 0 0 1rem; +} + +dfn { + font-style: italic; +} + +b, +strong { + font-weight: bolder; +} + +small { + font-size: 80%; +} + +sub, +sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} + +sub { + bottom: -.25em; +} + +sup { + top: -.5em; +} + +a { + color: #467fcf; + text-decoration: none; + background-color: transparent; + -webkit-text-decoration-skip: objects; +} + +a:hover { + color: #295a9f; + text-decoration: underline; +} + +a:not([href]):not([tabindex]) { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):focus { + outline: 0; +} + +pre, +code, +kbd, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +pre { + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + -ms-overflow-style: scrollbar; +} + +figure { + margin: 0 0 1rem; +} + +img { + vertical-align: middle; + border-style: none; +} + +svg:not(:root) { + overflow: hidden; +} + +table { + border-collapse: collapse; +} + +caption { + padding-top: 0.75rem; + padding-bottom: 0.75rem; + color: #9aa0ac; + text-align: right; + caption-side: bottom; +} + +th { + text-align: inherit; +} + +label { + display: inline-block; + margin-bottom: 0.5rem; +} + +button { + border-radius: 0; +} + +button:focus { + outline: 1px dotted; + outline: 5px auto -webkit-focus-ring-color; +} + +input, +button, +select, +optgroup, +textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height: inherit; +} + +button, +input { + overflow: visible; +} + +button, +select { + text-transform: none; +} + +button, +html [type="button"], +[type="reset"], +[type="submit"] { + -webkit-appearance: button; +} + +button::-moz-focus-inner, +[type="button"]::-moz-focus-inner, +[type="reset"]::-moz-focus-inner, +[type="submit"]::-moz-focus-inner { + padding: 0; + border-style: none; +} + +input[type="radio"], +input[type="checkbox"] { + box-sizing: border-box; + padding: 0; +} + +input[type="date"], +input[type="time"], +input[type="datetime-local"], +input[type="month"] { + -webkit-appearance: listbox; +} + +textarea { + overflow: auto; + resize: vertical; +} + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; +} + +legend { + display: block; + width: 100%; + max-width: 100%; + padding: 0; + margin-bottom: .5rem; + font-size: 1.5rem; + line-height: inherit; + color: inherit; + white-space: normal; +} + +progress { + vertical-align: baseline; +} + +[type="number"]::-webkit-inner-spin-button, +[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +[type="search"] { + outline-offset: -2px; + -webkit-appearance: none; +} + +[type="search"]::-webkit-search-cancel-button, +[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +::-webkit-file-upload-button { + font: inherit; + -webkit-appearance: button; +} + +output { + display: inline-block; +} + +summary { + display: list-item; + cursor: pointer; +} + +template { + display: none; +} + +[hidden] { + display: none !important; +} + +h1, h2, h3, h4, h5, h6, +.h1, .h2, .h3, .h4, .h5, .h6 { + margin-bottom: 0.66em; + font-family: inherit; + font-weight: 600; + line-height: 1.1; + color: inherit; +} + +h1, .h1 { + font-size: 2rem; +} + +h2, .h2 { + font-size: 1.75rem; +} + +h3, .h3 { + font-size: 1.5rem; +} + +h4, .h4 { + font-size: 1.125rem; +} + +h5, .h5 { + font-size: 1rem; +} + +h6, .h6 { + font-size: 0.875rem; +} + +.lead { + font-size: 1.171875rem; + font-weight: 300; +} + +.display-1 { + font-size: 4.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-2 { + font-size: 4rem; + font-weight: 300; + line-height: 1.1; +} + +.display-3 { + font-size: 3.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-4 { + font-size: 3rem; + font-weight: 300; + line-height: 1.1; +} + +hr { + margin-top: 1rem; + margin-bottom: 1rem; + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +small, +.small { + font-size: 87.5%; + font-weight: 400; +} + +mark, +.mark { + padding: 0.2em; + background-color: #fcf8e3; +} + +.list-unstyled { + padding-right: 0; + list-style: none; +} + +.list-inline { + padding-right: 0; + list-style: none; +} + +.list-inline-item { + display: inline-block; +} + +.list-inline-item:not(:last-child) { + margin-left: 0.5rem; +} + +.initialism { + font-size: 90%; + text-transform: uppercase; +} + +.blockquote { + margin-bottom: 1rem; + font-size: 1.171875rem; +} + +.blockquote-footer { + display: block; + font-size: 80%; + color: #868e96; +} + +.blockquote-footer::before { + content: "\2014 \00A0"; +} + +.img-fluid { + max-width: 100%; + height: auto; +} + +.img-thumbnail { + padding: 0.25rem; + background-color: #fff; + border: 1px solid #dee2e6; + border-radius: 3px; + max-width: 100%; + height: auto; +} + +.figure { + display: inline-block; +} + +.figure-img { + margin-bottom: 0.5rem; + line-height: 1; +} + +.figure-caption { + font-size: 90%; + color: #868e96; +} + +code, +kbd, +pre, +samp { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +code { + font-size: 85%; + color: inherit; + word-break: break-word; +} + +a > code { + color: inherit; +} + +kbd { + padding: 0.2rem 0.4rem; + font-size: 85%; + color: #fff; + background-color: #343a40; + border-radius: 3px; +} + +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: 700; +} + +pre { + display: block; + font-size: 85%; + color: #212529; +} + +pre code { + font-size: inherit; + color: inherit; + word-break: normal; +} + +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} + +.container { + width: 100%; + padding-left: 0.75rem; + padding-right: 0.75rem; + margin-left: auto; + margin-right: auto; +} + +@media (min-width: 576px) { + .container { + max-width: 540px; + } +} + +@media (min-width: 768px) { + .container { + max-width: 720px; + } +} + +@media (min-width: 992px) { + .container { + max-width: 960px; + } +} + +@media (min-width: 1280px) { + .container { + max-width: 1200px; + } +} + +.container-fluid { + width: 100%; + padding-left: 0.75rem; + padding-right: 0.75rem; + margin-left: auto; + margin-right: auto; +} + +.row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-left: -0.75rem; + margin-right: -0.75rem; +} + +.no-gutters { + margin-left: 0; + margin-right: 0; +} + +.no-gutters > .col, +.no-gutters > [class*="col-"] { + padding-left: 0; + padding-right: 0; +} + +.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col, +.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm, +.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md, +.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg, +.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl, +.col-xl-auto { + position: relative; + width: 100%; + min-height: 1px; + padding-left: 0.75rem; + padding-right: 0.75rem; +} + +.col { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; +} + +.col-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; +} + +.col-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; +} + +.col-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; +} + +.col-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; +} + +.col-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; +} + +.col-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; +} + +.col-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; +} + +.col-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; +} + +.col-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; +} + +.col-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; +} + +.col-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; +} + +.col-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; +} + +.col-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; +} + +.order-first { + -ms-flex-order: -1; + order: -1; +} + +.order-last { + -ms-flex-order: 13; + order: 13; +} + +.order-0 { + -ms-flex-order: 0; + order: 0; +} + +.order-1 { + -ms-flex-order: 1; + order: 1; +} + +.order-2 { + -ms-flex-order: 2; + order: 2; +} + +.order-3 { + -ms-flex-order: 3; + order: 3; +} + +.order-4 { + -ms-flex-order: 4; + order: 4; +} + +.order-5 { + -ms-flex-order: 5; + order: 5; +} + +.order-6 { + -ms-flex-order: 6; + order: 6; +} + +.order-7 { + -ms-flex-order: 7; + order: 7; +} + +.order-8 { + -ms-flex-order: 8; + order: 8; +} + +.order-9 { + -ms-flex-order: 9; + order: 9; +} + +.order-10 { + -ms-flex-order: 10; + order: 10; +} + +.order-11 { + -ms-flex-order: 11; + order: 11; +} + +.order-12 { + -ms-flex-order: 12; + order: 12; +} + +.offset-1 { + margin-right: 8.33333333%; +} + +.offset-2 { + margin-right: 16.66666667%; +} + +.offset-3 { + margin-right: 25%; +} + +.offset-4 { + margin-right: 33.33333333%; +} + +.offset-5 { + margin-right: 41.66666667%; +} + +.offset-6 { + margin-right: 50%; +} + +.offset-7 { + margin-right: 58.33333333%; +} + +.offset-8 { + margin-right: 66.66666667%; +} + +.offset-9 { + margin-right: 75%; +} + +.offset-10 { + margin-right: 83.33333333%; +} + +.offset-11 { + margin-right: 91.66666667%; +} + +@media (min-width: 576px) { + .col-sm { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-sm-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-sm-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-sm-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-sm-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-sm-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-sm-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-sm-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-sm-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-sm-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-sm-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-sm-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-sm-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-sm-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-sm-first { + -ms-flex-order: -1; + order: -1; + } + .order-sm-last { + -ms-flex-order: 13; + order: 13; + } + .order-sm-0 { + -ms-flex-order: 0; + order: 0; + } + .order-sm-1 { + -ms-flex-order: 1; + order: 1; + } + .order-sm-2 { + -ms-flex-order: 2; + order: 2; + } + .order-sm-3 { + -ms-flex-order: 3; + order: 3; + } + .order-sm-4 { + -ms-flex-order: 4; + order: 4; + } + .order-sm-5 { + -ms-flex-order: 5; + order: 5; + } + .order-sm-6 { + -ms-flex-order: 6; + order: 6; + } + .order-sm-7 { + -ms-flex-order: 7; + order: 7; + } + .order-sm-8 { + -ms-flex-order: 8; + order: 8; + } + .order-sm-9 { + -ms-flex-order: 9; + order: 9; + } + .order-sm-10 { + -ms-flex-order: 10; + order: 10; + } + .order-sm-11 { + -ms-flex-order: 11; + order: 11; + } + .order-sm-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-sm-0 { + margin-right: 0; + } + .offset-sm-1 { + margin-right: 8.33333333%; + } + .offset-sm-2 { + margin-right: 16.66666667%; + } + .offset-sm-3 { + margin-right: 25%; + } + .offset-sm-4 { + margin-right: 33.33333333%; + } + .offset-sm-5 { + margin-right: 41.66666667%; + } + .offset-sm-6 { + margin-right: 50%; + } + .offset-sm-7 { + margin-right: 58.33333333%; + } + .offset-sm-8 { + margin-right: 66.66666667%; + } + .offset-sm-9 { + margin-right: 75%; + } + .offset-sm-10 { + margin-right: 83.33333333%; + } + .offset-sm-11 { + margin-right: 91.66666667%; + } +} + +@media (min-width: 768px) { + .col-md { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-md-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-md-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-md-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-md-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-md-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-md-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-md-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-md-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-md-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-md-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-md-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-md-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-md-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-md-first { + -ms-flex-order: -1; + order: -1; + } + .order-md-last { + -ms-flex-order: 13; + order: 13; + } + .order-md-0 { + -ms-flex-order: 0; + order: 0; + } + .order-md-1 { + -ms-flex-order: 1; + order: 1; + } + .order-md-2 { + -ms-flex-order: 2; + order: 2; + } + .order-md-3 { + -ms-flex-order: 3; + order: 3; + } + .order-md-4 { + -ms-flex-order: 4; + order: 4; + } + .order-md-5 { + -ms-flex-order: 5; + order: 5; + } + .order-md-6 { + -ms-flex-order: 6; + order: 6; + } + .order-md-7 { + -ms-flex-order: 7; + order: 7; + } + .order-md-8 { + -ms-flex-order: 8; + order: 8; + } + .order-md-9 { + -ms-flex-order: 9; + order: 9; + } + .order-md-10 { + -ms-flex-order: 10; + order: 10; + } + .order-md-11 { + -ms-flex-order: 11; + order: 11; + } + .order-md-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-md-0 { + margin-right: 0; + } + .offset-md-1 { + margin-right: 8.33333333%; + } + .offset-md-2 { + margin-right: 16.66666667%; + } + .offset-md-3 { + margin-right: 25%; + } + .offset-md-4 { + margin-right: 33.33333333%; + } + .offset-md-5 { + margin-right: 41.66666667%; + } + .offset-md-6 { + margin-right: 50%; + } + .offset-md-7 { + margin-right: 58.33333333%; + } + .offset-md-8 { + margin-right: 66.66666667%; + } + .offset-md-9 { + margin-right: 75%; + } + .offset-md-10 { + margin-right: 83.33333333%; + } + .offset-md-11 { + margin-right: 91.66666667%; + } +} + +@media (min-width: 992px) { + .col-lg { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-lg-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-lg-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-lg-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-lg-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-lg-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-lg-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-lg-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-lg-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-lg-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-lg-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-lg-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-lg-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-lg-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-lg-first { + -ms-flex-order: -1; + order: -1; + } + .order-lg-last { + -ms-flex-order: 13; + order: 13; + } + .order-lg-0 { + -ms-flex-order: 0; + order: 0; + } + .order-lg-1 { + -ms-flex-order: 1; + order: 1; + } + .order-lg-2 { + -ms-flex-order: 2; + order: 2; + } + .order-lg-3 { + -ms-flex-order: 3; + order: 3; + } + .order-lg-4 { + -ms-flex-order: 4; + order: 4; + } + .order-lg-5 { + -ms-flex-order: 5; + order: 5; + } + .order-lg-6 { + -ms-flex-order: 6; + order: 6; + } + .order-lg-7 { + -ms-flex-order: 7; + order: 7; + } + .order-lg-8 { + -ms-flex-order: 8; + order: 8; + } + .order-lg-9 { + -ms-flex-order: 9; + order: 9; + } + .order-lg-10 { + -ms-flex-order: 10; + order: 10; + } + .order-lg-11 { + -ms-flex-order: 11; + order: 11; + } + .order-lg-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-lg-0 { + margin-right: 0; + } + .offset-lg-1 { + margin-right: 8.33333333%; + } + .offset-lg-2 { + margin-right: 16.66666667%; + } + .offset-lg-3 { + margin-right: 25%; + } + .offset-lg-4 { + margin-right: 33.33333333%; + } + .offset-lg-5 { + margin-right: 41.66666667%; + } + .offset-lg-6 { + margin-right: 50%; + } + .offset-lg-7 { + margin-right: 58.33333333%; + } + .offset-lg-8 { + margin-right: 66.66666667%; + } + .offset-lg-9 { + margin-right: 75%; + } + .offset-lg-10 { + margin-right: 83.33333333%; + } + .offset-lg-11 { + margin-right: 91.66666667%; + } +} + +@media (min-width: 1280px) { + .col-xl { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-xl-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-xl-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-xl-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-xl-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-xl-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-xl-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-xl-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-xl-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-xl-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-xl-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-xl-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-xl-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-xl-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-xl-first { + -ms-flex-order: -1; + order: -1; + } + .order-xl-last { + -ms-flex-order: 13; + order: 13; + } + .order-xl-0 { + -ms-flex-order: 0; + order: 0; + } + .order-xl-1 { + -ms-flex-order: 1; + order: 1; + } + .order-xl-2 { + -ms-flex-order: 2; + order: 2; + } + .order-xl-3 { + -ms-flex-order: 3; + order: 3; + } + .order-xl-4 { + -ms-flex-order: 4; + order: 4; + } + .order-xl-5 { + -ms-flex-order: 5; + order: 5; + } + .order-xl-6 { + -ms-flex-order: 6; + order: 6; + } + .order-xl-7 { + -ms-flex-order: 7; + order: 7; + } + .order-xl-8 { + -ms-flex-order: 8; + order: 8; + } + .order-xl-9 { + -ms-flex-order: 9; + order: 9; + } + .order-xl-10 { + -ms-flex-order: 10; + order: 10; + } + .order-xl-11 { + -ms-flex-order: 11; + order: 11; + } + .order-xl-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-xl-0 { + margin-right: 0; + } + .offset-xl-1 { + margin-right: 8.33333333%; + } + .offset-xl-2 { + margin-right: 16.66666667%; + } + .offset-xl-3 { + margin-right: 25%; + } + .offset-xl-4 { + margin-right: 33.33333333%; + } + .offset-xl-5 { + margin-right: 41.66666667%; + } + .offset-xl-6 { + margin-right: 50%; + } + .offset-xl-7 { + margin-right: 58.33333333%; + } + .offset-xl-8 { + margin-right: 66.66666667%; + } + .offset-xl-9 { + margin-right: 75%; + } + .offset-xl-10 { + margin-right: 83.33333333%; + } + .offset-xl-11 { + margin-right: 91.66666667%; + } +} + +.table, .text-wrap table { + width: 100%; + max-width: 100%; + margin-bottom: 1rem; + background-color: transparent; +} + +.table th, .text-wrap table th, +.table td, +.text-wrap table td { + padding: 0.75rem; + vertical-align: top; + border-top: 1px solid #dee2e6; +} + +.table thead th, .text-wrap table thead th { + vertical-align: bottom; + border-bottom: 2px solid #dee2e6; +} + +.table tbody + tbody, .text-wrap table tbody + tbody { + border-top: 2px solid #dee2e6; +} + +.table .table, .text-wrap table .table, .table .text-wrap table, .text-wrap .table table, .text-wrap table table { + background-color: #f5f7fb; +} + +.table-sm th, +.table-sm td { + padding: 0.3rem; +} + +.table-bordered, .text-wrap table { + border: 1px solid #dee2e6; +} + +.table-bordered th, .text-wrap table th, +.table-bordered td, +.text-wrap table td { + border: 1px solid #dee2e6; +} + +.table-bordered thead th, .text-wrap table thead th, +.table-bordered thead td, +.text-wrap table thead td { + border-bottom-width: 2px; +} + +.table-borderless th, +.table-borderless td, +.table-borderless thead th, +.table-borderless tbody + tbody { + border: 0; +} + +.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-hover tbody tr:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-primary, +.table-primary > th, +.table-primary > td { + background-color: #cbdbf2; +} + +.table-hover .table-primary:hover { + background-color: #b7cded; +} + +.table-hover .table-primary:hover > td, +.table-hover .table-primary:hover > th { + background-color: #b7cded; +} + +.table-secondary, +.table-secondary > th, +.table-secondary > td { + background-color: #dddfe2; +} + +.table-hover .table-secondary:hover { + background-color: #cfd2d6; +} + +.table-hover .table-secondary:hover > td, +.table-hover .table-secondary:hover > th { + background-color: #cfd2d6; +} + +.table-success, +.table-success > th, +.table-success > td { + background-color: #d2ecb8; +} + +.table-hover .table-success:hover { + background-color: #c5e7a4; +} + +.table-hover .table-success:hover > td, +.table-hover .table-success:hover > th { + background-color: #c5e7a4; +} + +.table-info, +.table-info > th, +.table-info > td { + background-color: #cbe7fb; +} + +.table-hover .table-info:hover { + background-color: #b3dcf9; +} + +.table-hover .table-info:hover > td, +.table-hover .table-info:hover > th { + background-color: #b3dcf9; +} + +.table-warning, +.table-warning > th, +.table-warning > td { + background-color: #fbeebc; +} + +.table-hover .table-warning:hover { + background-color: #fae8a4; +} + +.table-hover .table-warning:hover > td, +.table-hover .table-warning:hover > th { + background-color: #fae8a4; +} + +.table-danger, +.table-danger > th, +.table-danger > td { + background-color: #f1c1c0; +} + +.table-hover .table-danger:hover { + background-color: #ecacab; +} + +.table-hover .table-danger:hover > td, +.table-hover .table-danger:hover > th { + background-color: #ecacab; +} + +.table-light, +.table-light > th, +.table-light > td { + background-color: #fdfdfe; +} + +.table-hover .table-light:hover { + background-color: #ececf6; +} + +.table-hover .table-light:hover > td, +.table-hover .table-light:hover > th { + background-color: #ececf6; +} + +.table-dark, +.table-dark > th, +.table-dark > td { + background-color: #c6c8ca; +} + +.table-hover .table-dark:hover { + background-color: #b9bbbe; +} + +.table-hover .table-dark:hover > td, +.table-hover .table-dark:hover > th { + background-color: #b9bbbe; +} + +.table-active, +.table-active > th, +.table-active > td { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover > td, +.table-hover .table-active:hover > th { + background-color: rgba(0, 0, 0, 0.04); +} + +.table .thead-dark th, .text-wrap table .thead-dark th { + color: #f5f7fb; + background-color: #212529; + border-color: #32383e; +} + +.table .thead-light th, .text-wrap table .thead-light th { + color: #495057; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.table-dark { + color: #f5f7fb; + background-color: #212529; +} + +.table-dark th, +.table-dark td, +.table-dark thead th { + border-color: #32383e; +} + +.table-dark.table-bordered, .text-wrap table.table-dark { + border: 0; +} + +.table-dark.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(255, 255, 255, 0.05); +} + +.table-dark.table-hover tbody tr:hover { + background-color: rgba(255, 255, 255, 0.075); +} + +@media (max-width: 575.98px) { + .table-responsive-sm { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-sm > .table-bordered, .text-wrap .table-responsive-sm > table { + border: 0; + } +} + +@media (max-width: 767.98px) { + .table-responsive-md { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-md > .table-bordered, .text-wrap .table-responsive-md > table { + border: 0; + } +} + +@media (max-width: 991.98px) { + .table-responsive-lg { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-lg > .table-bordered, .text-wrap .table-responsive-lg > table { + border: 0; + } +} + +@media (max-width: 1279.98px) { + .table-responsive-xl { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-xl > .table-bordered, .text-wrap .table-responsive-xl > table { + border: 0; + } +} + +.table-responsive { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; +} + +.table-responsive > .table-bordered, .text-wrap .table-responsive > table { + border: 0; +} + +.form-control { + display: block; + width: 100%; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.6; + color: #495057; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .form-control { + transition: none; + } +} + +.form-control::-ms-expand { + background-color: transparent; + border: 0; +} + +.form-control:focus { + color: #495057; + background-color: #fff; + border-color: #1991eb; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.form-control::-webkit-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-moz-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:disabled, .form-control[readonly] { + background-color: #f8f9fa; + opacity: 1; +} + +select.form-control:not([size]):not([multiple]) { + height: 2.375rem; +} + +select.form-control:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.form-control-file, +.form-control-range { + display: block; + width: 100%; +} + +.col-form-label { + padding-top: calc(0.375rem + 1px); + padding-bottom: calc(0.375rem + 1px); + margin-bottom: 0; + font-size: inherit; + line-height: 1.6; +} + +.col-form-label-lg { + padding-top: calc(0.5rem + 1px); + padding-bottom: calc(0.5rem + 1px); + font-size: 1.125rem; + line-height: 1.44444444; +} + +.col-form-label-sm { + padding-top: calc(0.25rem + 1px); + padding-bottom: calc(0.25rem + 1px); + font-size: 0.875rem; + line-height: 1.14285714; +} + +.form-control-plaintext { + display: block; + width: 100%; + padding-top: 0.375rem; + padding-bottom: 0.375rem; + margin-bottom: 0; + line-height: 1.6; + color: #495057; + background-color: transparent; + border: solid transparent; + border-width: 1px 0; +} + +.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control, +.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-prepend > .form-control-plaintext.btn, +.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control, +.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-prepend > .form-control-plaintext.btn, +.input-group-lg > .input-group-append > .form-control-plaintext.btn { + padding-left: 0; + padding-right: 0; +} + +.form-control-sm, .input-group-sm > .form-control, +.input-group-sm > .input-group-prepend > .input-group-text, +.input-group-sm > .input-group-append > .input-group-text, +.input-group-sm > .input-group-prepend > .btn, +.input-group-sm > .input-group-append > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.14285714; + border-radius: 3px; +} + +select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(1.8125rem + 2px); +} + +.form-control-lg, .input-group-lg > .form-control, +.input-group-lg > .input-group-prepend > .input-group-text, +.input-group-lg > .input-group-append > .input-group-text, +.input-group-lg > .input-group-prepend > .btn, +.input-group-lg > .input-group-append > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.44444444; + border-radius: 3px; +} + +select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(2.6875rem + 2px); +} + +.form-group { + margin-bottom: 1rem; +} + +.form-text { + display: block; + margin-top: 0.25rem; +} + +.form-row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-left: -5px; + margin-right: -5px; +} + +.form-row > .col, +.form-row > [class*="col-"] { + padding-left: 5px; + padding-right: 5px; +} + +.form-check { + position: relative; + display: block; + padding-right: 1.25rem; +} + +.form-check-input { + position: absolute; + margin-top: 0.3rem; + margin-right: -1.25rem; +} + +.form-check-input:disabled ~ .form-check-label { + color: #9aa0ac; +} + +.form-check-label { + margin-bottom: 0; +} + +.form-check-inline { + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + padding-right: 0; + margin-left: 0.75rem; +} + +.form-check-inline .form-check-input { + position: static; + margin-top: 0; + margin-left: 0.3125rem; + margin-right: 0; +} + +.valid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #5eba00; +} + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(94, 186, 0, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:valid, .form-control.is-valid, .was-validated +.custom-select:valid, +.custom-select.is-valid { + border-color: #5eba00; +} + +.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated +.custom-select:valid:focus, +.custom-select.is-valid:focus { + border-color: #5eba00; + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .form-control:valid ~ .valid-feedback, +.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback, +.form-control.is-valid ~ .valid-tooltip, .was-validated +.custom-select:valid ~ .valid-feedback, +.was-validated +.custom-select:valid ~ .valid-tooltip, +.custom-select.is-valid ~ .valid-feedback, +.custom-select.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { + color: #5eba00; +} + +.was-validated .form-check-input:valid ~ .valid-feedback, +.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback, +.form-check-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label { + color: #5eba00; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before { + background-color: #9eff3b; +} + +.was-validated .custom-control-input:valid ~ .valid-feedback, +.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback, +.custom-control-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before { + background-color: #78ed00; +} + +.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label { + border-color: #5eba00; +} + +.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:valid ~ .valid-feedback, +.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback, +.custom-file-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.invalid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #cd201f; +} + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(205, 32, 31, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated +.custom-select:invalid, +.custom-select.is-invalid { + border-color: #cd201f; +} + +.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated +.custom-select:invalid:focus, +.custom-select.is-invalid:focus { + border-color: #cd201f; + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .form-control:invalid ~ .invalid-feedback, +.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback, +.form-control.is-invalid ~ .invalid-tooltip, .was-validated +.custom-select:invalid ~ .invalid-feedback, +.was-validated +.custom-select:invalid ~ .invalid-tooltip, +.custom-select.is-invalid ~ .invalid-feedback, +.custom-select.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { + color: #cd201f; +} + +.was-validated .form-check-input:invalid ~ .invalid-feedback, +.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback, +.form-check-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label { + color: #cd201f; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before { + background-color: #ec8080; +} + +.was-validated .custom-control-input:invalid ~ .invalid-feedback, +.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback, +.custom-control-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before { + background-color: #e23e3d; +} + +.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label { + border-color: #cd201f; +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:invalid ~ .invalid-feedback, +.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback, +.custom-file-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.form-inline { + display: -ms-flexbox; + display: flex; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; +} + +.form-inline .form-check { + width: 100%; +} + +@media (min-width: 576px) { + .form-inline label { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + margin-bottom: 0; + } + .form-inline .form-group { + display: -ms-flexbox; + display: flex; + -ms-flex: 0 0 auto; + flex: 0 0 auto; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; + margin-bottom: 0; + } + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .form-inline .form-control-plaintext { + display: inline-block; + } + .form-inline .input-group, + .form-inline .custom-select { + width: auto; + } + .form-inline .form-check { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: auto; + padding-right: 0; + } + .form-inline .form-check-input { + position: relative; + margin-top: 0; + margin-left: 0.25rem; + margin-right: 0; + } + .form-inline .custom-control { + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + } + .form-inline .custom-control-label { + margin-bottom: 0; + } +} + +.btn { + display: inline-block; + font-weight: 400; + text-align: center; + white-space: nowrap; + vertical-align: middle; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + border: 1px solid transparent; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.84615385; + border-radius: 3px; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .btn { + transition: none; + } +} + +.btn:hover, .btn:focus { + text-decoration: none; +} + +.btn:focus, .btn.focus { + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.btn.disabled, .btn:disabled { + opacity: 0.65; +} + +.btn:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active { + background-image: none; +} + +a.btn.disabled, +fieldset:disabled a.btn { + pointer-events: none; +} + +.btn-primary { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-primary:focus, .btn-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-primary.disabled, .btn-primary:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, +.show > .btn-primary.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-secondary { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-success { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-success:focus, .btn-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-success.disabled, .btn-success:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, +.show > .btn-success.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-info { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-info:focus, .btn-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-info.disabled, .btn-info:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, +.show > .btn-info.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-warning { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-warning:focus, .btn-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-warning.disabled, .btn-warning:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, +.show > .btn-warning.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-danger { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-danger:focus, .btn-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-danger.disabled, .btn-danger:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, +.show > .btn-danger.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-light { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:hover { + color: #495057; + background-color: #e2e6ea; + border-color: #dae0e5; +} + +.btn-light:focus, .btn-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-light.disabled, .btn-light:disabled { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, +.show > .btn-light.dropdown-toggle { + color: #495057; + background-color: #dae0e5; + border-color: #d3d9df; +} + +.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-dark:focus, .btn-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-dark.disabled, .btn-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, +.show > .btn-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-primary { + color: #467fcf; + background-color: transparent; + background-image: none; + border-color: #467fcf; +} + +.btn-outline-primary:hover { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:focus, .btn-outline-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-primary.disabled, .btn-outline-primary:disabled { + color: #467fcf; + background-color: transparent; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, +.show > .btn-outline-primary.dropdown-toggle { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-secondary { + color: #868e96; + background-color: transparent; + background-image: none; + border-color: #868e96; +} + +.btn-outline-secondary:hover { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:focus, .btn-outline-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-secondary.disabled, .btn-outline-secondary:disabled { + color: #868e96; + background-color: transparent; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, +.show > .btn-outline-secondary.dropdown-toggle { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-success { + color: #5eba00; + background-color: transparent; + background-image: none; + border-color: #5eba00; +} + +.btn-outline-success:hover { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:focus, .btn-outline-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-success.disabled, .btn-outline-success:disabled { + color: #5eba00; + background-color: transparent; +} + +.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, +.show > .btn-outline-success.dropdown-toggle { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-info { + color: #45aaf2; + background-color: transparent; + background-image: none; + border-color: #45aaf2; +} + +.btn-outline-info:hover { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:focus, .btn-outline-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-info.disabled, .btn-outline-info:disabled { + color: #45aaf2; + background-color: transparent; +} + +.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, +.show > .btn-outline-info.dropdown-toggle { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-warning { + color: #f1c40f; + background-color: transparent; + background-image: none; + border-color: #f1c40f; +} + +.btn-outline-warning:hover { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:focus, .btn-outline-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-warning.disabled, .btn-outline-warning:disabled { + color: #f1c40f; + background-color: transparent; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, +.show > .btn-outline-warning.dropdown-toggle { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-danger { + color: #cd201f; + background-color: transparent; + background-image: none; + border-color: #cd201f; +} + +.btn-outline-danger:hover { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:focus, .btn-outline-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-danger.disabled, .btn-outline-danger:disabled { + color: #cd201f; + background-color: transparent; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, +.show > .btn-outline-danger.dropdown-toggle { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-light { + color: #f8f9fa; + background-color: transparent; + background-image: none; + border-color: #f8f9fa; +} + +.btn-outline-light:hover { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:focus, .btn-outline-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-light.disabled, .btn-outline-light:disabled { + color: #f8f9fa; + background-color: transparent; +} + +.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, +.show > .btn-outline-light.dropdown-toggle { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-dark { + color: #343a40; + background-color: transparent; + background-image: none; + border-color: #343a40; +} + +.btn-outline-dark:hover { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:focus, .btn-outline-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-dark.disabled, .btn-outline-dark:disabled { + color: #343a40; + background-color: transparent; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, +.show > .btn-outline-dark.dropdown-toggle { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-link { + font-weight: 400; + color: #467fcf; + background-color: transparent; +} + +.btn-link:hover { + color: #295a9f; + text-decoration: underline; + background-color: transparent; + border-color: transparent; +} + +.btn-link:focus, .btn-link.focus { + text-decoration: underline; + border-color: transparent; + box-shadow: none; +} + +.btn-link:disabled, .btn-link.disabled { + color: #868e96; + pointer-events: none; +} + +.btn-lg, .btn-group-lg > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.625; + border-radius: 3px; +} + +.btn-sm, .btn-group-sm > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.33333333; + border-radius: 3px; +} + +.btn-block { + display: block; + width: 100%; +} + +.btn-block + .btn-block { + margin-top: 0.5rem; +} + +input[type="submit"].btn-block, +input[type="reset"].btn-block, +input[type="button"].btn-block { + width: 100%; +} + +.fade { + transition: opacity 0.15s linear; +} + +@media screen and (prefers-reduced-motion: reduce) { + .fade { + transition: none; + } +} + +.fade:not(.show) { + opacity: 0; +} + +.collapse:not(.show) { + display: none; +} + +.collapsing { + position: relative; + height: 0; + overflow: hidden; + transition: height 0.35s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .collapsing { + transition: none; + } +} + +.dropup, +.dropright, +.dropdown, +.dropleft { + position: relative; +} + +.dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid; + border-left: 0.3em solid transparent; + border-bottom: 0; + border-right: 0.3em solid transparent; +} + +.dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropdown-menu { + position: absolute; + top: 100%; + right: 0; + z-index: 1000; + display: none; + float: right; + min-width: 10rem; + padding: 0.5rem 0; + margin: 0.125rem 0 0; + font-size: 0.9375rem; + color: #495057; + text-align: right; + list-style: none; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.dropdown-menu-right { + left: 0; + right: auto; +} + +.dropup .dropdown-menu { + top: auto; + bottom: 100%; + margin-top: 0; + margin-bottom: 0.125rem; +} + +.dropup .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0; + border-left: 0.3em solid transparent; + border-bottom: 0.3em solid; + border-right: 0.3em solid transparent; +} + +.dropup .dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropright .dropdown-menu { + top: 0; + left: auto; + right: 100%; + margin-top: 0; + margin-right: 0.125rem; +} + +.dropright .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-left: 0; + border-bottom: 0.3em solid transparent; + border-right: 0.3em solid; +} + +.dropright .dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropright .dropdown-toggle::after { + vertical-align: 0; +} + +.dropleft .dropdown-menu { + top: 0; + left: 100%; + right: auto; + margin-top: 0; + margin-left: 0.125rem; +} + +.dropleft .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; +} + +.dropleft .dropdown-toggle::after { + display: none; +} + +.dropleft .dropdown-toggle::before { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-left: 0.3em solid; + border-bottom: 0.3em solid transparent; +} + +.dropleft .dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropleft .dropdown-toggle::before { + vertical-align: 0; +} + +.dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] { + left: auto; + bottom: auto; +} + +.dropdown-divider { + height: 0; + margin: 0.5rem 0; + overflow: hidden; + border-top: 1px solid #e9ecef; +} + +.dropdown-item { + display: block; + width: 100%; + padding: 0.25rem 1.5rem; + clear: both; + font-weight: 400; + color: #212529; + text-align: inherit; + white-space: nowrap; + background-color: transparent; + border: 0; +} + +.dropdown-item:hover, .dropdown-item:focus { + color: #16181b; + text-decoration: none; + background-color: #f8f9fa; +} + +.dropdown-item.active, .dropdown-item:active { + color: #fff; + text-decoration: none; + background-color: #467fcf; +} + +.dropdown-item.disabled, .dropdown-item:disabled { + color: #868e96; + background-color: transparent; +} + +.dropdown-menu.show { + display: block; +} + +.dropdown-header { + display: block; + padding: 0.5rem 1.5rem; + margin-bottom: 0; + font-size: 0.875rem; + color: #868e96; + white-space: nowrap; +} + +.dropdown-item-text { + display: block; + padding: 0.25rem 1.5rem; + color: #212529; +} + +.btn-group, +.btn-group-vertical { + position: relative; + display: -ms-inline-flexbox; + display: inline-flex; + vertical-align: middle; +} + +.btn-group > .btn, +.btn-group-vertical > .btn { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; +} + +.btn-group > .btn:hover, +.btn-group-vertical > .btn:hover { + z-index: 1; +} + +.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active, +.btn-group-vertical > .btn:focus, +.btn-group-vertical > .btn:active, +.btn-group-vertical > .btn.active { + z-index: 1; +} + +.btn-group .btn + .btn, +.btn-group .btn + .btn-group, +.btn-group .btn-group + .btn, +.btn-group .btn-group + .btn-group, +.btn-group-vertical .btn + .btn, +.btn-group-vertical .btn + .btn-group, +.btn-group-vertical .btn-group + .btn, +.btn-group-vertical .btn-group + .btn-group { + margin-right: -1px; +} + +.btn-toolbar { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.btn-toolbar .input-group { + width: auto; +} + +.btn-group > .btn:first-child { + margin-right: 0; +} + +.btn-group > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group > .btn-group:not(:last-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group > .btn:not(:first-child), +.btn-group > .btn-group:not(:first-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.dropdown-toggle-split { + padding-left: 0.5625rem; + padding-right: 0.5625rem; +} + +.dropdown-toggle-split::after, +.dropup .dropdown-toggle-split::after, +.dropright .dropdown-toggle-split::after { + margin-right: 0; +} + +.dropleft .dropdown-toggle-split::before { + margin-left: 0; +} + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { + padding-left: 0.375rem; + padding-right: 0.375rem; +} + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { + padding-left: 0.75rem; + padding-right: 0.75rem; +} + +.btn-group-vertical { + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: center; + justify-content: center; +} + +.btn-group-vertical .btn, +.btn-group-vertical .btn-group { + width: 100%; +} + +.btn-group-vertical > .btn + .btn, +.btn-group-vertical > .btn + .btn-group, +.btn-group-vertical > .btn-group + .btn, +.btn-group-vertical > .btn-group + .btn-group { + margin-top: -1px; + margin-right: 0; +} + +.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group-vertical > .btn-group:not(:last-child) > .btn { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +.btn-group-vertical > .btn:not(:first-child), +.btn-group-vertical > .btn-group:not(:first-child) > .btn { + border-top-right-radius: 0; + border-top-left-radius: 0; +} + +.btn-group-toggle > .btn, +.btn-group-toggle > .btn-group > .btn { + margin-bottom: 0; +} + +.btn-group-toggle > .btn input[type="radio"], +.btn-group-toggle > .btn input[type="checkbox"], +.btn-group-toggle > .btn-group > .btn input[type="radio"], +.btn-group-toggle > .btn-group > .btn input[type="checkbox"] { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; +} + +.input-group { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: stretch; + align-items: stretch; + width: 100%; +} + +.input-group > .form-control, +.input-group > .custom-select, +.input-group > .custom-file { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + width: 1%; + margin-bottom: 0; +} + +.input-group > .form-control:focus, +.input-group > .custom-select:focus, +.input-group > .custom-file:focus { + z-index: 3; +} + +.input-group > .form-control + .form-control, +.input-group > .form-control + .custom-select, +.input-group > .form-control + .custom-file, +.input-group > .custom-select + .form-control, +.input-group > .custom-select + .custom-select, +.input-group > .custom-select + .custom-file, +.input-group > .custom-file + .form-control, +.input-group > .custom-file + .custom-select, +.input-group > .custom-file + .custom-file { + margin-right: -1px; +} + +.input-group > .form-control:not(:last-child), +.input-group > .custom-select:not(:last-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .form-control:not(:first-child), +.input-group > .custom-select:not(:first-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .custom-file { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.input-group > .custom-file:not(:last-child) .custom-file-label, +.input-group > .custom-file:not(:last-child) .custom-file-label::after { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .custom-file:not(:first-child) .custom-file-label, +.input-group > .custom-file:not(:first-child) .custom-file-label::after { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group-prepend, +.input-group-append { + display: -ms-flexbox; + display: flex; +} + +.input-group-prepend .btn, +.input-group-append .btn { + position: relative; + z-index: 2; +} + +.input-group-prepend .btn + .btn, +.input-group-prepend .btn + .input-group-text, +.input-group-prepend .input-group-text + .input-group-text, +.input-group-prepend .input-group-text + .btn, +.input-group-append .btn + .btn, +.input-group-append .btn + .input-group-text, +.input-group-append .input-group-text + .input-group-text, +.input-group-append .input-group-text + .btn { + margin-right: -1px; +} + +.input-group-prepend { + margin-left: -1px; +} + +.input-group-append { + margin-right: -1px; +} + +.input-group-text { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + padding: 0.375rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.6; + color: #495057; + text-align: center; + white-space: nowrap; + background-color: #fbfbfc; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.input-group-text input[type="radio"], +.input-group-text input[type="checkbox"] { + margin-top: 0; +} + +.input-group > .input-group-prepend > .btn, +.input-group > .input-group-prepend > .input-group-text, +.input-group > .input-group-append:not(:last-child) > .btn, +.input-group > .input-group-append:not(:last-child) > .input-group-text, +.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), +.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .input-group-append > .btn, +.input-group > .input-group-append > .input-group-text, +.input-group > .input-group-prepend:not(:first-child) > .btn, +.input-group > .input-group-prepend:not(:first-child) > .input-group-text, +.input-group > .input-group-prepend:first-child > .btn:not(:first-child), +.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.custom-control { + position: relative; + display: block; + min-height: 1.5rem; + padding-right: 1.5rem; +} + +.custom-control-inline { + display: -ms-inline-flexbox; + display: inline-flex; + margin-left: 1rem; +} + +.custom-control-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-control-input:checked ~ .custom-control-label::before { + color: #fff; + background-color: #467fcf; +} + +.custom-control-input:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-control-input:active ~ .custom-control-label::before { + color: #fff; + background-color: #d4e1f4; +} + +.custom-control-input:disabled ~ .custom-control-label { + color: #868e96; +} + +.custom-control-input:disabled ~ .custom-control-label::before { + background-color: #e9ecef; +} + +.custom-control-label { + margin-bottom: 0; +} + +.custom-control-label::before { + position: absolute; + top: 0.25rem; + right: 0; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + content: ""; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background-color: #dee2e6; +} + +.custom-control-label::after { + position: absolute; + top: 0.25rem; + right: 0; + display: block; + width: 1rem; + height: 1rem; + content: ""; + background-repeat: no-repeat; + background-position: center center; + background-size: 50% 50%; +} + +.custom-checkbox .custom-control-label::before { + border-radius: 3px; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-radio .custom-control-label::before { + border-radius: 50%; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E"); +} + +.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-select { + display: inline-block; + width: 100%; + height: 2.375rem; + padding: 0.5rem 0.75rem 0.5rem 1.75rem; + line-height: 1.5; + color: #495057; + vertical-align: middle; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat left 0.75rem center; + background-size: 8px 10px; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-select:focus { + border-color: #1991eb; + outline: 0; + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(25, 145, 235, 0.5); +} + +.custom-select:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.custom-select[multiple], .custom-select[size]:not([size="1"]) { + height: auto; + padding-left: 0.75rem; + background-image: none; +} + +.custom-select:disabled { + color: #868e96; + background-color: #e9ecef; +} + +.custom-select::-ms-expand { + opacity: 0; +} + +.custom-select-sm { + height: calc(1.8125rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 75%; +} + +.custom-select-lg { + height: calc(2.6875rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 125%; +} + +.custom-file { + position: relative; + display: inline-block; + width: 100%; + height: 2.375rem; + margin-bottom: 0; +} + +.custom-file-input { + position: relative; + z-index: 2; + width: 100%; + height: 2.375rem; + margin: 0; + opacity: 0; +} + +.custom-file-input:focus ~ .custom-file-label { + border-color: #1991eb; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-file-input:focus ~ .custom-file-label::after { + border-color: #1991eb; +} + +.custom-file-input:lang(en) ~ .custom-file-label::after { + content: "Browse"; +} + +.custom-file-label { + position: absolute; + top: 0; + left: 0; + right: 0; + z-index: 1; + height: 2.375rem; + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.custom-file-label::after { + position: absolute; + top: 0; + left: 0; + bottom: 0; + z-index: 3; + display: block; + height: calc(2.375rem - 1px * 2); + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + content: "Browse"; + background-color: #fbfbfc; + border-right: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px 0 0 3px; +} + +.custom-range { + width: 100%; + padding-right: 0; + background-color: transparent; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-range:focus { + outline: none; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-thumb { + width: 1rem; + height: 1rem; + margin-top: -0.25rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -webkit-appearance: none; + appearance: none; +} + +.custom-range::-webkit-slider-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-webkit-slider-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-webkit-slider-runnable-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-moz-range-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -moz-appearance: none; + appearance: none; +} + +.custom-range::-moz-range-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-moz-range-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-moz-range-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-ms-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + appearance: none; +} + +.custom-range::-ms-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-ms-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-ms-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: transparent; + border-color: transparent; + border-width: 0.5rem; +} + +.custom-range::-ms-fill-lower { + background-color: #dee2e6; + border-radius: 1rem; +} + +.custom-range::-ms-fill-upper { + margin-left: 15px; + background-color: #dee2e6; + border-radius: 1rem; +} + +.nav { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding-right: 0; + margin-bottom: 0; + list-style: none; +} + +.nav-link { + display: block; + padding: 0.5rem 1rem; +} + +.nav-link:hover, .nav-link:focus { + text-decoration: none; +} + +.nav-link.disabled { + color: #868e96; +} + +.nav-tabs { + border-bottom: 1px solid #dee2e6; +} + +.nav-tabs .nav-item { + margin-bottom: -1px; +} + +.nav-tabs .nav-link { + border: 1px solid transparent; + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { + border-color: #e9ecef #e9ecef #dee2e6; +} + +.nav-tabs .nav-link.disabled { + color: #868e96; + background-color: transparent; + border-color: transparent; +} + +.nav-tabs .nav-link.active, +.nav-tabs .nav-item.show .nav-link { + color: #495057; + background-color: transparent; + border-color: #dee2e6 #dee2e6 transparent; +} + +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-right-radius: 0; + border-top-left-radius: 0; +} + +.nav-pills .nav-link { + border-radius: 3px; +} + +.nav-pills .nav-link.active, +.nav-pills .show > .nav-link { + color: #fff; + background-color: #467fcf; +} + +.nav-fill .nav-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + text-align: center; +} + +.nav-justified .nav-item { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + text-align: center; +} + +.tab-content > .tab-pane { + display: none; +} + +.tab-content > .active { + display: block; +} + +.navbar { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 0.5rem 1rem; +} + +.navbar > .container, +.navbar > .container-fluid { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.navbar-brand { + display: inline-block; + padding-top: 0.359375rem; + padding-bottom: 0.359375rem; + margin-left: 1rem; + font-size: 1.125rem; + line-height: inherit; + white-space: nowrap; +} + +.navbar-brand:hover, .navbar-brand:focus { + text-decoration: none; +} + +.navbar-nav { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-right: 0; + margin-bottom: 0; + list-style: none; +} + +.navbar-nav .nav-link { + padding-left: 0; + padding-right: 0; +} + +.navbar-nav .dropdown-menu { + position: static; + float: none; +} + +.navbar-text { + display: inline-block; + padding-top: 0.5rem; + padding-bottom: 0.5rem; +} + +.navbar-collapse { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; + -ms-flex-positive: 1; + flex-grow: 1; + -ms-flex-align: center; + align-items: center; +} + +.navbar-toggler { + padding: 0.25rem 0.75rem; + font-size: 1.125rem; + line-height: 1; + background-color: transparent; + border: 1px solid transparent; + border-radius: 3px; +} + +.navbar-toggler:hover, .navbar-toggler:focus { + text-decoration: none; +} + +.navbar-toggler:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + content: ""; + background: no-repeat center center; + background-size: 100% 100%; +} + +@media (max-width: 575.98px) { + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 576px) { + .navbar-expand-sm { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-sm .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-sm .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-sm .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-sm .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-sm .navbar-toggler { + display: none; + } +} + +@media (max-width: 767.98px) { + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 768px) { + .navbar-expand-md { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-md .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-md .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-md .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-md .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-md .navbar-toggler { + display: none; + } +} + +@media (max-width: 991.98px) { + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 992px) { + .navbar-expand-lg { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-lg .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-lg .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-lg .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-lg .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-lg .navbar-toggler { + display: none; + } +} + +@media (max-width: 1279.98px) { + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 1280px) { + .navbar-expand-xl { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-xl .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-xl .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-xl .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-xl .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-xl .navbar-toggler { + display: none; + } +} + +.navbar-expand { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + padding-left: 0; + padding-right: 0; +} + +.navbar-expand .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; +} + +.navbar-expand .navbar-nav .dropdown-menu { + position: absolute; +} + +.navbar-expand .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; +} + +.navbar-expand .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; +} + +.navbar-expand .navbar-toggler { + display: none; +} + +.navbar-light .navbar-brand { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-nav .nav-link { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus { + color: rgba(0, 0, 0, 0.7); +} + +.navbar-light .navbar-nav .nav-link.disabled { + color: rgba(0, 0, 0, 0.3); +} + +.navbar-light .navbar-nav .show > .nav-link, +.navbar-light .navbar-nav .active > .nav-link, +.navbar-light .navbar-nav .nav-link.show, +.navbar-light .navbar-nav .nav-link.active { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-toggler { + color: rgba(0, 0, 0, 0.5); + border-color: rgba(0, 0, 0, 0.1); +} + +.navbar-light .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-light .navbar-text { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-text a { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-dark .navbar-brand { + color: #fff; +} + +.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus { + color: #fff; +} + +.navbar-dark .navbar-nav .nav-link { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus { + color: rgba(255, 255, 255, 0.75); +} + +.navbar-dark .navbar-nav .nav-link.disabled { + color: rgba(255, 255, 255, 0.25); +} + +.navbar-dark .navbar-nav .show > .nav-link, +.navbar-dark .navbar-nav .active > .nav-link, +.navbar-dark .navbar-nav .nav-link.show, +.navbar-dark .navbar-nav .nav-link.active { + color: #fff; +} + +.navbar-dark .navbar-toggler { + color: rgba(255, 255, 255, 0.5); + border-color: rgba(255, 255, 255, 0.1); +} + +.navbar-dark .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-dark .navbar-text { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-text a { + color: #fff; +} + +.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus { + color: #fff; +} + +.card { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + min-width: 0; + word-wrap: break-word; + background-color: #fff; + background-clip: border-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.card > hr { + margin-left: 0; + margin-right: 0; +} + +.card > .list-group:first-child .list-group-item:first-child { + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.card > .list-group:last-child .list-group-item:last-child { + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1.5rem; +} + +.card-title { + margin-bottom: 1.5rem; +} + +.card-subtitle { + margin-top: -0.75rem; + margin-bottom: 0; +} + +.card-text:last-child { + margin-bottom: 0; +} + +.card-link:hover { + text-decoration: none; +} + +.card-link + .card-link { + margin-right: 1.5rem; +} + +.card-header { + padding: 1.5rem 1.5rem; + margin-bottom: 0; + background-color: rgba(0, 0, 0, 0.03); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-header:first-child { + border-radius: calc(3px - 1px) calc(3px - 1px) 0 0; +} + +.card-header + .list-group .list-group-item:first-child { + border-top: 0; +} + +.card-footer { + padding: 1.5rem 1.5rem; + background-color: rgba(0, 0, 0, 0.03); + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-footer:last-child { + border-radius: 0 0 calc(3px - 1px) calc(3px - 1px); +} + +.card-header-tabs { + margin-left: -0.75rem; + margin-bottom: -1.5rem; + margin-right: -0.75rem; + border-bottom: 0; +} + +.card-header-pills { + margin-left: -0.75rem; + margin-right: -0.75rem; +} + +.card-img-overlay { + position: absolute; + top: 0; + left: 0; + bottom: 0; + right: 0; + padding: 1.25rem; +} + +.card-img { + width: 100%; + border-radius: calc(3px - 1px); +} + +.card-img-top { + width: 100%; + border-top-right-radius: calc(3px - 1px); + border-top-left-radius: calc(3px - 1px); +} + +.card-img-bottom { + width: 100%; + border-bottom-left-radius: calc(3px - 1px); + border-bottom-right-radius: calc(3px - 1px); +} + +.card-deck { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-deck .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-deck { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + margin-left: -0.75rem; + margin-right: -0.75rem; + } + .card-deck .card { + display: -ms-flexbox; + display: flex; + -ms-flex: 1 0 0%; + flex: 1 0 0%; + -ms-flex-direction: column; + flex-direction: column; + margin-left: 0.75rem; + margin-bottom: 0; + margin-right: 0.75rem; + } +} + +.card-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-group > .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-group { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + } + .card-group > .card { + -ms-flex: 1 0 0%; + flex: 1 0 0%; + margin-bottom: 0; + } + .card-group > .card + .card { + margin-right: 0; + border-right: 0; + } + .card-group > .card:first-child { + border-top-left-radius: 0; + border-bottom-left-radius: 0; + } + .card-group > .card:first-child .card-img-top, + .card-group > .card:first-child .card-header { + border-top-left-radius: 0; + } + .card-group > .card:first-child .card-img-bottom, + .card-group > .card:first-child .card-footer { + border-bottom-left-radius: 0; + } + .card-group > .card:last-child { + border-top-right-radius: 0; + border-bottom-right-radius: 0; + } + .card-group > .card:last-child .card-img-top, + .card-group > .card:last-child .card-header { + border-top-right-radius: 0; + } + .card-group > .card:last-child .card-img-bottom, + .card-group > .card:last-child .card-footer { + border-bottom-right-radius: 0; + } + .card-group > .card:only-child { + border-radius: 3px; + } + .card-group > .card:only-child .card-img-top, + .card-group > .card:only-child .card-header { + border-top-right-radius: 3px; + border-top-left-radius: 3px; + } + .card-group > .card:only-child .card-img-bottom, + .card-group > .card:only-child .card-footer { + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) { + border-radius: 0; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer { + border-radius: 0; + } +} + +.card-columns .card { + margin-bottom: 1.5rem; +} + +@media (min-width: 576px) { + .card-columns { + -webkit-column-count: 3; + -moz-column-count: 3; + column-count: 3; + -webkit-column-gap: 1.25rem; + -moz-column-gap: 1.25rem; + column-gap: 1.25rem; + orphans: 1; + widows: 1; + } + .card-columns .card { + display: inline-block; + width: 100%; + } +} + +.accordion .card:not(:first-of-type):not(:last-of-type) { + border-bottom: 0; + border-radius: 0; +} + +.accordion .card:not(:first-of-type) .card-header:first-child { + border-radius: 0; +} + +.accordion .card:first-of-type { + border-bottom: 0; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +.accordion .card:last-of-type { + border-top-right-radius: 0; + border-top-left-radius: 0; +} + +.breadcrumb { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding: 0.75rem 1rem; + margin-bottom: 1rem; + list-style: none; + background-color: #e9ecef; + border-radius: 3px; +} + +.breadcrumb-item + .breadcrumb-item { + padding-right: 0.5rem; +} + +.breadcrumb-item + .breadcrumb-item::before { + display: inline-block; + padding-left: 0.5rem; + color: #868e96; + content: "/"; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: underline; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: none; +} + +.breadcrumb-item.active { + color: #868e96; +} + +.pagination { + display: -ms-flexbox; + display: flex; + padding-right: 0; + list-style: none; + border-radius: 3px; +} + +.page-link { + position: relative; + display: block; + padding: 0.5rem 0.75rem; + margin-right: -1px; + line-height: 1.25; + color: #495057; + background-color: #fff; + border: 1px solid #dee2e6; +} + +.page-link:hover { + z-index: 2; + color: #295a9f; + text-decoration: none; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.page-link:focus { + z-index: 2; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.page-link:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.page-item:first-child .page-link { + margin-right: 0; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.page-item:last-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.page-item.active .page-link { + z-index: 1; + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.page-item.disabled .page-link { + color: #ced4da; + pointer-events: none; + cursor: auto; + background-color: #fff; + border-color: #dee2e6; +} + +.pagination-lg .page-link { + padding: 0.75rem 1.5rem; + font-size: 1.125rem; + line-height: 1.5; +} + +.pagination-lg .page-item:first-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pagination-lg .page-item:last-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-sm .page-link { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.5; +} + +.pagination-sm .page-item:first-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pagination-sm .page-item:last-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.badge { + display: inline-block; + padding: 0.25em 0.4em; + font-size: 75%; + font-weight: 600; + line-height: 1; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: 3px; +} + +.badge:empty { + display: none; +} + +.btn .badge { + position: relative; + top: -1px; +} + +.badge-pill { + padding-left: 0.6em; + padding-right: 0.6em; + border-radius: 10rem; +} + +.badge-primary { + color: #fff; + background-color: #467fcf; +} + +.badge-primary[href]:hover, .badge-primary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #2f66b3; +} + +.badge-secondary { + color: #fff; + background-color: #868e96; +} + +.badge-secondary[href]:hover, .badge-secondary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #6c757d; +} + +.badge-success { + color: #fff; + background-color: #5eba00; +} + +.badge-success[href]:hover, .badge-success[href]:focus { + color: #fff; + text-decoration: none; + background-color: #448700; +} + +.badge-info { + color: #fff; + background-color: #45aaf2; +} + +.badge-info[href]:hover, .badge-info[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1594ef; +} + +.badge-warning { + color: #fff; + background-color: #f1c40f; +} + +.badge-warning[href]:hover, .badge-warning[href]:focus { + color: #fff; + text-decoration: none; + background-color: #c29d0b; +} + +.badge-danger { + color: #fff; + background-color: #cd201f; +} + +.badge-danger[href]:hover, .badge-danger[href]:focus { + color: #fff; + text-decoration: none; + background-color: #a11918; +} + +.badge-light { + color: #495057; + background-color: #f8f9fa; +} + +.badge-light[href]:hover, .badge-light[href]:focus { + color: #495057; + text-decoration: none; + background-color: #dae0e5; +} + +.badge-dark { + color: #fff; + background-color: #343a40; +} + +.badge-dark[href]:hover, .badge-dark[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1d2124; +} + +.jumbotron { + padding: 2rem 1rem; + margin-bottom: 2rem; + background-color: #e9ecef; + border-radius: 3px; +} + +@media (min-width: 576px) { + .jumbotron { + padding: 4rem 2rem; + } +} + +.jumbotron-fluid { + padding-left: 0; + padding-right: 0; + border-radius: 0; +} + +.alert { + position: relative; + padding: 0.75rem 1.25rem; + margin-bottom: 1rem; + border: 1px solid transparent; + border-radius: 3px; +} + +.alert-heading { + color: inherit; +} + +.alert-link { + font-weight: 600; +} + +.alert-dismissible { + padding-left: 3.90625rem; +} + +.alert-dismissible .close { + position: absolute; + top: 0; + left: 0; + padding: 0.75rem 1.25rem; + color: inherit; +} + +.alert-primary { + color: #24426c; + background-color: #dae5f5; + border-color: #cbdbf2; +} + +.alert-primary hr { + border-top-color: #b7cded; +} + +.alert-primary .alert-link { + color: #172b46; +} + +.alert-secondary { + color: #464a4e; + background-color: #e7e8ea; + border-color: #dddfe2; +} + +.alert-secondary hr { + border-top-color: #cfd2d6; +} + +.alert-secondary .alert-link { + color: #2e3133; +} + +.alert-success { + color: #316100; + background-color: #dff1cc; + border-color: #d2ecb8; +} + +.alert-success hr { + border-top-color: #c5e7a4; +} + +.alert-success .alert-link { + color: #172e00; +} + +.alert-info { + color: #24587e; + background-color: #daeefc; + border-color: #cbe7fb; +} + +.alert-info hr { + border-top-color: #b3dcf9; +} + +.alert-info .alert-link { + color: #193c56; +} + +.alert-warning { + color: #7d6608; + background-color: #fcf3cf; + border-color: #fbeebc; +} + +.alert-warning hr { + border-top-color: #fae8a4; +} + +.alert-warning .alert-link { + color: #4d3f05; +} + +.alert-danger { + color: #6b1110; + background-color: #f5d2d2; + border-color: #f1c1c0; +} + +.alert-danger hr { + border-top-color: #ecacab; +} + +.alert-danger .alert-link { + color: #3f0a09; +} + +.alert-light { + color: #818182; + background-color: #fefefe; + border-color: #fdfdfe; +} + +.alert-light hr { + border-top-color: #ececf6; +} + +.alert-light .alert-link { + color: #686868; +} + +.alert-dark { + color: #1b1e21; + background-color: #d6d8d9; + border-color: #c6c8ca; +} + +.alert-dark hr { + border-top-color: #b9bbbe; +} + +.alert-dark .alert-link { + color: #040505; +} + +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 100% 0; + } +} + +@keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 100% 0; + } +} + +.progress { + display: -ms-flexbox; + display: flex; + height: 1rem; + overflow: hidden; + font-size: 0.703125rem; + background-color: #e9ecef; + border-radius: 3px; +} + +.progress-bar { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + color: #fff; + text-align: center; + white-space: nowrap; + background-color: #467fcf; + transition: width 0.6s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .progress-bar { + transition: none; + } +} + +.progress-bar-striped { + background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: 1rem 1rem; +} + +.progress-bar-animated { + -webkit-animation: progress-bar-stripes 1s linear infinite; + animation: progress-bar-stripes 1s linear infinite; +} + +.media { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; +} + +.media-body { + -ms-flex: 1; + flex: 1; +} + +.list-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-right: 0; + margin-bottom: 0; +} + +.list-group-item-action { + width: 100%; + color: #495057; + text-align: inherit; +} + +.list-group-item-action:hover, .list-group-item-action:focus { + color: #495057; + text-decoration: none; + background-color: #f8f9fa; +} + +.list-group-item-action:active { + color: #495057; + background-color: #e9ecef; +} + +.list-group-item { + position: relative; + display: block; + padding: 0.75rem 1.25rem; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item:first-child { + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; +} + +.list-group-item:hover, .list-group-item:focus { + z-index: 1; + text-decoration: none; +} + +.list-group-item.disabled, .list-group-item:disabled { + color: #868e96; + background-color: #fff; +} + +.list-group-item.active { + z-index: 2; + color: #467fcf; + background-color: #f8fafd; + border-color: rgba(0, 40, 100, 0.12); +} + +.list-group-flush .list-group-item { + border-left: 0; + border-right: 0; + border-radius: 0; +} + +.list-group-flush:first-child .list-group-item:first-child { + border-top: 0; +} + +.list-group-flush:last-child .list-group-item:last-child { + border-bottom: 0; +} + +.list-group-item-primary { + color: #24426c; + background-color: #cbdbf2; +} + +.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { + color: #24426c; + background-color: #b7cded; +} + +.list-group-item-primary.list-group-item-action.active { + color: #fff; + background-color: #24426c; + border-color: #24426c; +} + +.list-group-item-secondary { + color: #464a4e; + background-color: #dddfe2; +} + +.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { + color: #464a4e; + background-color: #cfd2d6; +} + +.list-group-item-secondary.list-group-item-action.active { + color: #fff; + background-color: #464a4e; + border-color: #464a4e; +} + +.list-group-item-success { + color: #316100; + background-color: #d2ecb8; +} + +.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { + color: #316100; + background-color: #c5e7a4; +} + +.list-group-item-success.list-group-item-action.active { + color: #fff; + background-color: #316100; + border-color: #316100; +} + +.list-group-item-info { + color: #24587e; + background-color: #cbe7fb; +} + +.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { + color: #24587e; + background-color: #b3dcf9; +} + +.list-group-item-info.list-group-item-action.active { + color: #fff; + background-color: #24587e; + border-color: #24587e; +} + +.list-group-item-warning { + color: #7d6608; + background-color: #fbeebc; +} + +.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { + color: #7d6608; + background-color: #fae8a4; +} + +.list-group-item-warning.list-group-item-action.active { + color: #fff; + background-color: #7d6608; + border-color: #7d6608; +} + +.list-group-item-danger { + color: #6b1110; + background-color: #f1c1c0; +} + +.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { + color: #6b1110; + background-color: #ecacab; +} + +.list-group-item-danger.list-group-item-action.active { + color: #fff; + background-color: #6b1110; + border-color: #6b1110; +} + +.list-group-item-light { + color: #818182; + background-color: #fdfdfe; +} + +.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { + color: #818182; + background-color: #ececf6; +} + +.list-group-item-light.list-group-item-action.active { + color: #fff; + background-color: #818182; + border-color: #818182; +} + +.list-group-item-dark { + color: #1b1e21; + background-color: #c6c8ca; +} + +.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { + color: #1b1e21; + background-color: #b9bbbe; +} + +.list-group-item-dark.list-group-item-action.active { + color: #fff; + background-color: #1b1e21; + border-color: #1b1e21; +} + +.close { + float: left; + font-size: 1.40625rem; + font-weight: 700; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + opacity: .5; +} + +.close:hover, .close:focus { + color: #000; + text-decoration: none; + opacity: .75; +} + +.close:not(:disabled):not(.disabled) { + cursor: pointer; +} + +button.close { + padding: 0; + background-color: transparent; + border: 0; + -webkit-appearance: none; +} + +.modal-open { + overflow: hidden; +} + +.modal { + position: fixed; + top: 0; + left: 0; + bottom: 0; + right: 0; + z-index: 1050; + display: none; + overflow: hidden; + outline: 0; +} + +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} + +.modal-dialog { + position: relative; + width: auto; + margin: 0.5rem; + pointer-events: none; +} + +.modal.fade .modal-dialog { + transition: -webkit-transform 0.3s ease-out; + transition: transform 0.3s ease-out; + transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out; + -webkit-transform: translate(0, -25%); + transform: translate(0, -25%); +} + +@media screen and (prefers-reduced-motion: reduce) { + .modal.fade .modal-dialog { + transition: none; + } +} + +.modal.show .modal-dialog { + -webkit-transform: translate(0, 0); + transform: translate(0, 0); +} + +.modal-dialog-centered { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + min-height: calc(100% - (0.5rem * 2)); +} + +.modal-content { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + width: 100%; + pointer-events: auto; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 0, 0, 0.2); + border-radius: 3px; + outline: 0; +} + +.modal-backdrop { + position: fixed; + top: 0; + left: 0; + bottom: 0; + right: 0; + z-index: 1040; + background-color: #000; +} + +.modal-backdrop.fade { + opacity: 0; +} + +.modal-backdrop.show { + opacity: 0.5; +} + +.modal-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 1rem; + border-bottom: 1px solid #e9ecef; + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.modal-header .close { + padding: 1rem; + margin: -1rem auto -1rem -1rem; +} + +.modal-title { + margin-bottom: 0; + line-height: 1.5; +} + +.modal-body { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1rem; +} + +.modal-footer { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: end; + justify-content: flex-end; + padding: 1rem; + border-top: 1px solid #e9ecef; +} + +.modal-footer > :not(:first-child) { + margin-right: .25rem; +} + +.modal-footer > :not(:last-child) { + margin-left: .25rem; +} + +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} + +@media (min-width: 576px) { + .modal-dialog { + max-width: 500px; + margin: 1.75rem auto; + } + .modal-dialog-centered { + min-height: calc(100% - (1.75rem * 2)); + } + .modal-sm { + max-width: 300px; + } +} + +@media (min-width: 992px) { + .modal-lg { + max-width: 800px; + } +} + +.tooltip { + position: absolute; + z-index: 1070; + display: block; + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: right; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + opacity: 0; +} + +.tooltip.show { + opacity: 0.9; +} + +.tooltip .arrow { + position: absolute; + display: block; + width: 0.8rem; + height: 0.4rem; +} + +.tooltip .arrow::before { + position: absolute; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] { + padding: 0.4rem 0; +} + +.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow { + bottom: 0; +} + +.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before { + top: 0; + border-width: 0.4rem 0.4rem 0; + border-top-color: #000; +} + +.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] { + padding: 0 0.4rem; +} + +.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow { + right: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before { + left: 0; + border-width: 0.4rem 0 0.4rem 0.4rem; + border-left-color: #000; +} + +.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] { + padding: 0.4rem 0; +} + +.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow { + top: 0; +} + +.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before { + bottom: 0; + border-width: 0 0.4rem 0.4rem; + border-bottom-color: #000; +} + +.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] { + padding: 0 0.4rem; +} + +.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow { + left: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before { + right: 0; + border-width: 0.4rem 0.4rem 0.4rem 0; + border-right-color: #000; +} + +.tooltip-inner { + max-width: 200px; + padding: 0.25rem 0.5rem; + color: #fff; + text-align: center; + background-color: #000; + border-radius: 3px; +} + +.popover { + position: absolute; + top: 0; + right: 0; + z-index: 1060; + display: block; + max-width: 276px; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: right; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #dee3eb; + border-radius: 3px; +} + +.popover .arrow { + position: absolute; + display: block; + width: 0.5rem; + height: 0.5rem; + margin: 0 3px; +} + +.popover .arrow::before, .popover .arrow::after { + position: absolute; + display: block; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-popover-top, .bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.5rem; +} + +.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow { + bottom: calc((0.5rem + 1px) * -1); +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before, +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + border-width: 0.5rem 0.25rem 0; +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before { + bottom: 0; + border-top-color: #dee3eb; +} + + +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + bottom: 1px; + border-top-color: #fff; +} + +.bs-popover-right, .bs-popover-auto[x-placement^="right"] { + margin-right: 0.5rem; +} + +.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow { + right: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before, +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + border-width: 0.25rem 0 0.25rem 0.5rem; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before { + right: 0; + border-left-color: #dee3eb; +} + + +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + right: 1px; + border-left-color: #fff; +} + +.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] { + margin-top: 0.5rem; +} + +.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow { + top: calc((0.5rem + 1px) * -1); +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before, +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + border-width: 0 0.25rem 0.5rem 0.25rem; +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before { + top: 0; + border-bottom-color: #dee3eb; +} + + +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + top: 1px; + border-bottom-color: #fff; +} + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before { + position: absolute; + top: 0; + right: 50%; + display: block; + width: 0.5rem; + margin-right: -0.25rem; + content: ""; + border-bottom: 1px solid #f7f7f7; +} + +.bs-popover-left, .bs-popover-auto[x-placement^="left"] { + margin-left: 0.5rem; +} + +.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow { + left: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before, +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + border-width: 0.25rem 0.5rem 0.25rem 0; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before { + left: 0; + border-right-color: #dee3eb; +} + + +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + left: 1px; + border-right-color: #fff; +} + +.popover-header { + padding: 0.5rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + color: inherit; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-top-right-radius: calc(3px - 1px); + border-top-left-radius: calc(3px - 1px); +} + +.popover-header:empty { + display: none; +} + +.popover-body { + padding: 0.75rem 1rem; + color: #6e7687; +} + +.carousel { + position: relative; +} + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; +} + +.carousel-item { + position: relative; + display: none; + -ms-flex-align: center; + align-items: center; + width: 100%; + transition: -webkit-transform 0.6s ease; + transition: transform 0.6s ease; + transition: transform 0.6s ease, -webkit-transform 0.6s ease; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000px; + perspective: 1000px; +} + +@media screen and (prefers-reduced-motion: reduce) { + .carousel-item { + transition: none; + } +} + +.carousel-item.active, +.carousel-item-next, +.carousel-item-prev { + display: block; +} + +.carousel-item-next, +.carousel-item-prev { + position: absolute; + top: 0; +} + +.carousel-item-next.carousel-item-left, +.carousel-item-prev.carousel-item-right { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next.carousel-item-left, + .carousel-item-prev.carousel-item-right { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-item-next, +.active.carousel-item-right { + -webkit-transform: translateX(-100%); + transform: translateX(-100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next, + .active.carousel-item-right { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +.carousel-item-prev, +.active.carousel-item-left { + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-prev, + .active.carousel-item-left { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +.carousel-fade .carousel-item { + opacity: 0; + transition-duration: .6s; + transition-property: opacity; +} + +.carousel-fade .carousel-item.active, +.carousel-fade .carousel-item-next.carousel-item-left, +.carousel-fade .carousel-item-prev.carousel-item-right { + opacity: 1; +} + +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-right { + opacity: 0; +} + +.carousel-fade .carousel-item-next, +.carousel-fade .carousel-item-prev, +.carousel-fade .carousel-item.active, +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-prev { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-fade .carousel-item-next, + .carousel-fade .carousel-item-prev, + .carousel-fade .carousel-item.active, + .carousel-fade .active.carousel-item-left, + .carousel-fade .active.carousel-item-prev { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-control-prev, +.carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: 15%; + color: #fff; + text-align: center; + opacity: 0.5; +} + +.carousel-control-prev:hover, .carousel-control-prev:focus, +.carousel-control-next:hover, +.carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity: .9; +} + +.carousel-control-prev { + right: 0; +} + +.carousel-control-next { + left: 0; +} + +.carousel-control-prev-icon, +.carousel-control-next-icon { + display: inline-block; + width: 20px; + height: 20px; + background: transparent no-repeat center center; + background-size: 100% 100%; +} + +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E"); +} + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E"); +} + +.carousel-indicators { + position: absolute; + left: 0; + bottom: 10px; + right: 0; + z-index: 15; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + padding-right: 0; + margin-left: 15%; + margin-right: 15%; + list-style: none; +} + +.carousel-indicators li { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; + width: 30px; + height: 3px; + margin-left: 3px; + margin-right: 3px; + text-indent: -999px; + background-color: rgba(255, 255, 255, 0.5); +} + +.carousel-indicators li::before { + position: absolute; + top: -10px; + right: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators li::after { + position: absolute; + bottom: -10px; + right: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators .active { + background-color: #fff; +} + +.carousel-caption { + position: absolute; + left: 15%; + bottom: 20px; + right: 15%; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; +} + +.align-baseline { + vertical-align: baseline !important; +} + +.align-top { + vertical-align: top !important; +} + +.align-middle { + vertical-align: middle !important; +} + +.align-bottom { + vertical-align: bottom !important; +} + +.align-text-bottom { + vertical-align: text-bottom !important; +} + +.align-text-top { + vertical-align: text-top !important; +} + +.bg-primary { + background-color: #467fcf !important; +} + +a.bg-primary:hover, a.bg-primary:focus, +button.bg-primary:hover, +button.bg-primary:focus { + background-color: #2f66b3 !important; +} + +.bg-secondary { + background-color: #868e96 !important; +} + +a.bg-secondary:hover, a.bg-secondary:focus, +button.bg-secondary:hover, +button.bg-secondary:focus { + background-color: #6c757d !important; +} + +.bg-success { + background-color: #5eba00 !important; +} + +a.bg-success:hover, a.bg-success:focus, +button.bg-success:hover, +button.bg-success:focus { + background-color: #448700 !important; +} + +.bg-info { + background-color: #45aaf2 !important; +} + +a.bg-info:hover, a.bg-info:focus, +button.bg-info:hover, +button.bg-info:focus { + background-color: #1594ef !important; +} + +.bg-warning { + background-color: #f1c40f !important; +} + +a.bg-warning:hover, a.bg-warning:focus, +button.bg-warning:hover, +button.bg-warning:focus { + background-color: #c29d0b !important; +} + +.bg-danger { + background-color: #cd201f !important; +} + +a.bg-danger:hover, a.bg-danger:focus, +button.bg-danger:hover, +button.bg-danger:focus { + background-color: #a11918 !important; +} + +.bg-light { + background-color: #f8f9fa !important; +} + +a.bg-light:hover, a.bg-light:focus, +button.bg-light:hover, +button.bg-light:focus { + background-color: #dae0e5 !important; +} + +.bg-dark { + background-color: #343a40 !important; +} + +a.bg-dark:hover, a.bg-dark:focus, +button.bg-dark:hover, +button.bg-dark:focus { + background-color: #1d2124 !important; +} + +.bg-white { + background-color: #fff !important; +} + +.bg-transparent { + background-color: transparent !important; +} + +.border { + border: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-top { + border-top: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-right { + border-left: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-bottom { + border-bottom: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-left { + border-right: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-0 { + border: 0 !important; +} + +.border-top-0 { + border-top: 0 !important; +} + +.border-right-0 { + border-left: 0 !important; +} + +.border-bottom-0 { + border-bottom: 0 !important; +} + +.border-left-0 { + border-right: 0 !important; +} + +.border-primary { + border-color: #467fcf !important; +} + +.border-secondary { + border-color: #868e96 !important; +} + +.border-success { + border-color: #5eba00 !important; +} + +.border-info { + border-color: #45aaf2 !important; +} + +.border-warning { + border-color: #f1c40f !important; +} + +.border-danger { + border-color: #cd201f !important; +} + +.border-light { + border-color: #f8f9fa !important; +} + +.border-dark { + border-color: #343a40 !important; +} + +.border-white { + border-color: #fff !important; +} + +.rounded { + border-radius: 3px !important; +} + +.rounded-top { + border-top-right-radius: 3px !important; + border-top-left-radius: 3px !important; +} + +.rounded-right { + border-top-left-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-bottom { + border-bottom-left-radius: 3px !important; + border-bottom-right-radius: 3px !important; +} + +.rounded-left { + border-top-right-radius: 3px !important; + border-bottom-right-radius: 3px !important; +} + +.rounded-circle { + border-radius: 50% !important; +} + +.rounded-0 { + border-radius: 0 !important; +} + +.clearfix::after { + display: block; + clear: both; + content: ""; +} + +.d-none { + display: none !important; +} + +.d-inline { + display: inline !important; +} + +.d-inline-block { + display: inline-block !important; +} + +.d-block { + display: block !important; +} + +.d-table { + display: table !important; +} + +.d-table-row { + display: table-row !important; +} + +.d-table-cell { + display: table-cell !important; +} + +.d-flex { + display: -ms-flexbox !important; + display: flex !important; +} + +.d-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; +} + +@media (min-width: 576px) { + .d-sm-none { + display: none !important; + } + .d-sm-inline { + display: inline !important; + } + .d-sm-inline-block { + display: inline-block !important; + } + .d-sm-block { + display: block !important; + } + .d-sm-table { + display: table !important; + } + .d-sm-table-row { + display: table-row !important; + } + .d-sm-table-cell { + display: table-cell !important; + } + .d-sm-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-sm-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 768px) { + .d-md-none { + display: none !important; + } + .d-md-inline { + display: inline !important; + } + .d-md-inline-block { + display: inline-block !important; + } + .d-md-block { + display: block !important; + } + .d-md-table { + display: table !important; + } + .d-md-table-row { + display: table-row !important; + } + .d-md-table-cell { + display: table-cell !important; + } + .d-md-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-md-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 992px) { + .d-lg-none { + display: none !important; + } + .d-lg-inline { + display: inline !important; + } + .d-lg-inline-block { + display: inline-block !important; + } + .d-lg-block { + display: block !important; + } + .d-lg-table { + display: table !important; + } + .d-lg-table-row { + display: table-row !important; + } + .d-lg-table-cell { + display: table-cell !important; + } + .d-lg-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-lg-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 1280px) { + .d-xl-none { + display: none !important; + } + .d-xl-inline { + display: inline !important; + } + .d-xl-inline-block { + display: inline-block !important; + } + .d-xl-block { + display: block !important; + } + .d-xl-table { + display: table !important; + } + .d-xl-table-row { + display: table-row !important; + } + .d-xl-table-cell { + display: table-cell !important; + } + .d-xl-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-xl-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media print { + .d-print-none { + display: none !important; + } + .d-print-inline { + display: inline !important; + } + .d-print-inline-block { + display: inline-block !important; + } + .d-print-block { + display: block !important; + } + .d-print-table { + display: table !important; + } + .d-print-table-row { + display: table-row !important; + } + .d-print-table-cell { + display: table-cell !important; + } + .d-print-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-print-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +.embed-responsive { + position: relative; + display: block; + width: 100%; + padding: 0; + overflow: hidden; +} + +.embed-responsive::before { + display: block; + content: ""; +} + +.embed-responsive .embed-responsive-item, +.embed-responsive iframe, +.embed-responsive embed, +.embed-responsive object, +.embed-responsive video { + position: absolute; + top: 0; + bottom: 0; + right: 0; + width: 100%; + height: 100%; + border: 0; +} + +.embed-responsive-21by9::before { + padding-top: 42.85714286%; +} + +.embed-responsive-16by9::before { + padding-top: 56.25%; +} + +.embed-responsive-4by3::before { + padding-top: 75%; +} + +.embed-responsive-1by1::before { + padding-top: 100%; +} + +.flex-row { + -ms-flex-direction: row !important; + flex-direction: row !important; +} + +.flex-column { + -ms-flex-direction: column !important; + flex-direction: column !important; +} + +.flex-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; +} + +.flex-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; +} + +.flex-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; +} + +.flex-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; +} + +.flex-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; +} + +.flex-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; +} + +.flex-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; +} + +.flex-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; +} + +.flex-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; +} + +.flex-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; +} + +.justify-content-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; +} + +.justify-content-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; +} + +.justify-content-center { + -ms-flex-pack: center !important; + justify-content: center !important; +} + +.justify-content-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; +} + +.justify-content-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; +} + +.align-items-start { + -ms-flex-align: start !important; + align-items: flex-start !important; +} + +.align-items-end { + -ms-flex-align: end !important; + align-items: flex-end !important; +} + +.align-items-center { + -ms-flex-align: center !important; + align-items: center !important; +} + +.align-items-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; +} + +.align-items-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; +} + +.align-content-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; +} + +.align-content-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; +} + +.align-content-center { + -ms-flex-line-pack: center !important; + align-content: center !important; +} + +.align-content-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; +} + +.align-content-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; +} + +.align-content-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; +} + +.align-self-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; +} + +.align-self-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; +} + +.align-self-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; +} + +.align-self-center { + -ms-flex-item-align: center !important; + align-self: center !important; +} + +.align-self-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; +} + +.align-self-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; +} + +@media (min-width: 576px) { + .flex-sm-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-sm-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-sm-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-sm-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-sm-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-sm-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-sm-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-sm-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-sm-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-sm-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-sm-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-sm-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-sm-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-sm-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-sm-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-sm-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-sm-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-sm-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-sm-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-sm-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-sm-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-sm-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-sm-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-sm-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-sm-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-sm-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-sm-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-sm-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-sm-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-sm-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-sm-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-sm-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-sm-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-sm-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 768px) { + .flex-md-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-md-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-md-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-md-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-md-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-md-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-md-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-md-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-md-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-md-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-md-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-md-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-md-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-md-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-md-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-md-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-md-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-md-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-md-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-md-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-md-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-md-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-md-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-md-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-md-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-md-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-md-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-md-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-md-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-md-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-md-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-md-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-md-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-md-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 992px) { + .flex-lg-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-lg-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-lg-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-lg-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-lg-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-lg-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-lg-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-lg-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-lg-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-lg-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-lg-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-lg-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-lg-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-lg-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-lg-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-lg-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-lg-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-lg-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-lg-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-lg-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-lg-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-lg-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-lg-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-lg-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-lg-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-lg-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-lg-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-lg-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-lg-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-lg-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-lg-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-lg-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-lg-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-lg-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 1280px) { + .flex-xl-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-xl-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-xl-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-xl-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-xl-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-xl-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-xl-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-xl-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-xl-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-xl-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-xl-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-xl-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-xl-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-xl-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-xl-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-xl-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-xl-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-xl-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-xl-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-xl-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-xl-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-xl-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-xl-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-xl-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-xl-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-xl-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-xl-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-xl-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-xl-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-xl-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-xl-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-xl-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-xl-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-xl-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +.float-left { + float: right !important; +} + +.float-right { + float: left !important; +} + +.float-none { + float: none !important; +} + +@media (min-width: 576px) { + .float-sm-left { + float: right !important; + } + .float-sm-right { + float: left !important; + } + .float-sm-none { + float: none !important; + } +} + +@media (min-width: 768px) { + .float-md-left { + float: right !important; + } + .float-md-right { + float: left !important; + } + .float-md-none { + float: none !important; + } +} + +@media (min-width: 992px) { + .float-lg-left { + float: right !important; + } + .float-lg-right { + float: left !important; + } + .float-lg-none { + float: none !important; + } +} + +@media (min-width: 1280px) { + .float-xl-left { + float: right !important; + } + .float-xl-right { + float: left !important; + } + .float-xl-none { + float: none !important; + } +} + +.position-static { + position: static !important; +} + +.position-relative { + position: relative !important; +} + +.position-absolute { + position: absolute !important; +} + +.position-fixed { + position: fixed !important; +} + +.position-sticky { + position: -webkit-sticky !important; + position: sticky !important; +} + +.fixed-top { + position: fixed; + top: 0; + left: 0; + right: 0; + z-index: 1030; +} + +.fixed-bottom { + position: fixed; + left: 0; + bottom: 0; + right: 0; + z-index: 1030; +} + +@supports ((position: -webkit-sticky) or (position: sticky)) { + .sticky-top { + position: -webkit-sticky; + position: sticky; + top: 0; + z-index: 1020; + } +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border: 0; +} + +.sr-only-focusable:active, .sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + overflow: visible; + clip: auto; + white-space: normal; +} + +.shadow-sm { + box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; +} + +.shadow { + box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; +} + +.shadow-lg { + box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.w-25 { + width: 25% !important; +} + +.w-50 { + width: 50% !important; +} + +.w-75 { + width: 75% !important; +} + +.w-100 { + width: 100% !important; +} + +.w-auto { + width: auto !important; +} + +.w-0 { + width: 0 !important; +} + +.w-1 { + width: 0.25rem !important; +} + +.w-2 { + width: 0.5rem !important; +} + +.w-3 { + width: 0.75rem !important; +} + +.w-4 { + width: 1rem !important; +} + +.w-5 { + width: 1.5rem !important; +} + +.w-6 { + width: 2rem !important; +} + +.w-7 { + width: 3rem !important; +} + +.w-8 { + width: 4rem !important; +} + +.w-9 { + width: 6rem !important; +} + +.h-25 { + height: 25% !important; +} + +.h-50 { + height: 50% !important; +} + +.h-75 { + height: 75% !important; +} + +.h-100 { + height: 100% !important; +} + +.h-auto { + height: auto !important; +} + +.h-0 { + height: 0 !important; +} + +.h-1 { + height: 0.25rem !important; +} + +.h-2 { + height: 0.5rem !important; +} + +.h-3 { + height: 0.75rem !important; +} + +.h-4 { + height: 1rem !important; +} + +.h-5 { + height: 1.5rem !important; +} + +.h-6 { + height: 2rem !important; +} + +.h-7 { + height: 3rem !important; +} + +.h-8 { + height: 4rem !important; +} + +.h-9 { + height: 6rem !important; +} + +.mw-100 { + max-width: 100% !important; +} + +.mh-100 { + max-height: 100% !important; +} + +.m-0 { + margin: 0 !important; +} + +.mt-0, +.my-0 { + margin-top: 0 !important; +} + +.mr-0, +.mx-0 { + margin-left: 0 !important; +} + +.mb-0, +.my-0 { + margin-bottom: 0 !important; +} + +.ml-0, +.mx-0 { + margin-right: 0 !important; +} + +.m-1 { + margin: 0.25rem !important; +} + +.mt-1, +.my-1 { + margin-top: 0.25rem !important; +} + +.mr-1, +.mx-1 { + margin-left: 0.25rem !important; +} + +.mb-1, +.my-1 { + margin-bottom: 0.25rem !important; +} + +.ml-1, +.mx-1 { + margin-right: 0.25rem !important; +} + +.m-2 { + margin: 0.5rem !important; +} + +.mt-2, +.my-2 { + margin-top: 0.5rem !important; +} + +.mr-2, +.mx-2 { + margin-left: 0.5rem !important; +} + +.mb-2, +.my-2 { + margin-bottom: 0.5rem !important; +} + +.ml-2, +.mx-2 { + margin-right: 0.5rem !important; +} + +.m-3 { + margin: 0.75rem !important; +} + +.mt-3, +.my-3 { + margin-top: 0.75rem !important; +} + +.mr-3, +.mx-3 { + margin-left: 0.75rem !important; +} + +.mb-3, +.my-3 { + margin-bottom: 0.75rem !important; +} + +.ml-3, +.mx-3 { + margin-right: 0.75rem !important; +} + +.m-4 { + margin: 1rem !important; +} + +.mt-4, +.my-4 { + margin-top: 1rem !important; +} + +.mr-4, +.mx-4 { + margin-left: 1rem !important; +} + +.mb-4, +.my-4 { + margin-bottom: 1rem !important; +} + +.ml-4, +.mx-4 { + margin-right: 1rem !important; +} + +.m-5 { + margin: 1.5rem !important; +} + +.mt-5, +.my-5 { + margin-top: 1.5rem !important; +} + +.mr-5, +.mx-5 { + margin-left: 1.5rem !important; +} + +.mb-5, +.my-5 { + margin-bottom: 1.5rem !important; +} + +.ml-5, +.mx-5 { + margin-right: 1.5rem !important; +} + +.m-6 { + margin: 2rem !important; +} + +.mt-6, +.my-6 { + margin-top: 2rem !important; +} + +.mr-6, +.mx-6 { + margin-left: 2rem !important; +} + +.mb-6, +.my-6 { + margin-bottom: 2rem !important; +} + +.ml-6, +.mx-6 { + margin-right: 2rem !important; +} + +.m-7 { + margin: 3rem !important; +} + +.mt-7, +.my-7 { + margin-top: 3rem !important; +} + +.mr-7, +.mx-7 { + margin-left: 3rem !important; +} + +.mb-7, +.my-7 { + margin-bottom: 3rem !important; +} + +.ml-7, +.mx-7 { + margin-right: 3rem !important; +} + +.m-8 { + margin: 4rem !important; +} + +.mt-8, +.my-8 { + margin-top: 4rem !important; +} + +.mr-8, +.mx-8 { + margin-left: 4rem !important; +} + +.mb-8, +.my-8 { + margin-bottom: 4rem !important; +} + +.ml-8, +.mx-8 { + margin-right: 4rem !important; +} + +.m-9 { + margin: 6rem !important; +} + +.mt-9, +.my-9 { + margin-top: 6rem !important; +} + +.mr-9, +.mx-9 { + margin-left: 6rem !important; +} + +.mb-9, +.my-9 { + margin-bottom: 6rem !important; +} + +.ml-9, +.mx-9 { + margin-right: 6rem !important; +} + +.p-0 { + padding: 0 !important; +} + +.pt-0, +.py-0 { + padding-top: 0 !important; +} + +.pr-0, +.px-0 { + padding-left: 0 !important; +} + +.pb-0, +.py-0 { + padding-bottom: 0 !important; +} + +.pl-0, +.px-0 { + padding-right: 0 !important; +} + +.p-1 { + padding: 0.25rem !important; +} + +.pt-1, +.py-1 { + padding-top: 0.25rem !important; +} + +.pr-1, +.px-1 { + padding-left: 0.25rem !important; +} + +.pb-1, +.py-1 { + padding-bottom: 0.25rem !important; +} + +.pl-1, +.px-1 { + padding-right: 0.25rem !important; +} + +.p-2 { + padding: 0.5rem !important; +} + +.pt-2, +.py-2 { + padding-top: 0.5rem !important; +} + +.pr-2, +.px-2 { + padding-left: 0.5rem !important; +} + +.pb-2, +.py-2 { + padding-bottom: 0.5rem !important; +} + +.pl-2, +.px-2 { + padding-right: 0.5rem !important; +} + +.p-3 { + padding: 0.75rem !important; +} + +.pt-3, +.py-3 { + padding-top: 0.75rem !important; +} + +.pr-3, +.px-3 { + padding-left: 0.75rem !important; +} + +.pb-3, +.py-3 { + padding-bottom: 0.75rem !important; +} + +.pl-3, +.px-3 { + padding-right: 0.75rem !important; +} + +.p-4 { + padding: 1rem !important; +} + +.pt-4, +.py-4 { + padding-top: 1rem !important; +} + +.pr-4, +.px-4 { + padding-left: 1rem !important; +} + +.pb-4, +.py-4 { + padding-bottom: 1rem !important; +} + +.pl-4, +.px-4 { + padding-right: 1rem !important; +} + +.p-5 { + padding: 1.5rem !important; +} + +.pt-5, +.py-5 { + padding-top: 1.5rem !important; +} + +.pr-5, +.px-5 { + padding-left: 1.5rem !important; +} + +.pb-5, +.py-5 { + padding-bottom: 1.5rem !important; +} + +.pl-5, +.px-5 { + padding-right: 1.5rem !important; +} + +.p-6 { + padding: 2rem !important; +} + +.pt-6, +.py-6 { + padding-top: 2rem !important; +} + +.pr-6, +.px-6 { + padding-left: 2rem !important; +} + +.pb-6, +.py-6 { + padding-bottom: 2rem !important; +} + +.pl-6, +.px-6 { + padding-right: 2rem !important; +} + +.p-7 { + padding: 3rem !important; +} + +.pt-7, +.py-7 { + padding-top: 3rem !important; +} + +.pr-7, +.px-7 { + padding-left: 3rem !important; +} + +.pb-7, +.py-7 { + padding-bottom: 3rem !important; +} + +.pl-7, +.px-7 { + padding-right: 3rem !important; +} + +.p-8 { + padding: 4rem !important; +} + +.pt-8, +.py-8 { + padding-top: 4rem !important; +} + +.pr-8, +.px-8 { + padding-left: 4rem !important; +} + +.pb-8, +.py-8 { + padding-bottom: 4rem !important; +} + +.pl-8, +.px-8 { + padding-right: 4rem !important; +} + +.p-9 { + padding: 6rem !important; +} + +.pt-9, +.py-9 { + padding-top: 6rem !important; +} + +.pr-9, +.px-9 { + padding-left: 6rem !important; +} + +.pb-9, +.py-9 { + padding-bottom: 6rem !important; +} + +.pl-9, +.px-9 { + padding-right: 6rem !important; +} + +.m-auto { + margin: auto !important; +} + +.mt-auto, +.my-auto { + margin-top: auto !important; +} + +.mr-auto, +.mx-auto { + margin-left: auto !important; +} + +.mb-auto, +.my-auto { + margin-bottom: auto !important; +} + +.ml-auto, +.mx-auto { + margin-right: auto !important; +} + +@media (min-width: 576px) { + .m-sm-0 { + margin: 0 !important; + } + .mt-sm-0, + .my-sm-0 { + margin-top: 0 !important; + } + .mr-sm-0, + .mx-sm-0 { + margin-left: 0 !important; + } + .mb-sm-0, + .my-sm-0 { + margin-bottom: 0 !important; + } + .ml-sm-0, + .mx-sm-0 { + margin-right: 0 !important; + } + .m-sm-1 { + margin: 0.25rem !important; + } + .mt-sm-1, + .my-sm-1 { + margin-top: 0.25rem !important; + } + .mr-sm-1, + .mx-sm-1 { + margin-left: 0.25rem !important; + } + .mb-sm-1, + .my-sm-1 { + margin-bottom: 0.25rem !important; + } + .ml-sm-1, + .mx-sm-1 { + margin-right: 0.25rem !important; + } + .m-sm-2 { + margin: 0.5rem !important; + } + .mt-sm-2, + .my-sm-2 { + margin-top: 0.5rem !important; + } + .mr-sm-2, + .mx-sm-2 { + margin-left: 0.5rem !important; + } + .mb-sm-2, + .my-sm-2 { + margin-bottom: 0.5rem !important; + } + .ml-sm-2, + .mx-sm-2 { + margin-right: 0.5rem !important; + } + .m-sm-3 { + margin: 0.75rem !important; + } + .mt-sm-3, + .my-sm-3 { + margin-top: 0.75rem !important; + } + .mr-sm-3, + .mx-sm-3 { + margin-left: 0.75rem !important; + } + .mb-sm-3, + .my-sm-3 { + margin-bottom: 0.75rem !important; + } + .ml-sm-3, + .mx-sm-3 { + margin-right: 0.75rem !important; + } + .m-sm-4 { + margin: 1rem !important; + } + .mt-sm-4, + .my-sm-4 { + margin-top: 1rem !important; + } + .mr-sm-4, + .mx-sm-4 { + margin-left: 1rem !important; + } + .mb-sm-4, + .my-sm-4 { + margin-bottom: 1rem !important; + } + .ml-sm-4, + .mx-sm-4 { + margin-right: 1rem !important; + } + .m-sm-5 { + margin: 1.5rem !important; + } + .mt-sm-5, + .my-sm-5 { + margin-top: 1.5rem !important; + } + .mr-sm-5, + .mx-sm-5 { + margin-left: 1.5rem !important; + } + .mb-sm-5, + .my-sm-5 { + margin-bottom: 1.5rem !important; + } + .ml-sm-5, + .mx-sm-5 { + margin-right: 1.5rem !important; + } + .m-sm-6 { + margin: 2rem !important; + } + .mt-sm-6, + .my-sm-6 { + margin-top: 2rem !important; + } + .mr-sm-6, + .mx-sm-6 { + margin-left: 2rem !important; + } + .mb-sm-6, + .my-sm-6 { + margin-bottom: 2rem !important; + } + .ml-sm-6, + .mx-sm-6 { + margin-right: 2rem !important; + } + .m-sm-7 { + margin: 3rem !important; + } + .mt-sm-7, + .my-sm-7 { + margin-top: 3rem !important; + } + .mr-sm-7, + .mx-sm-7 { + margin-left: 3rem !important; + } + .mb-sm-7, + .my-sm-7 { + margin-bottom: 3rem !important; + } + .ml-sm-7, + .mx-sm-7 { + margin-right: 3rem !important; + } + .m-sm-8 { + margin: 4rem !important; + } + .mt-sm-8, + .my-sm-8 { + margin-top: 4rem !important; + } + .mr-sm-8, + .mx-sm-8 { + margin-left: 4rem !important; + } + .mb-sm-8, + .my-sm-8 { + margin-bottom: 4rem !important; + } + .ml-sm-8, + .mx-sm-8 { + margin-right: 4rem !important; + } + .m-sm-9 { + margin: 6rem !important; + } + .mt-sm-9, + .my-sm-9 { + margin-top: 6rem !important; + } + .mr-sm-9, + .mx-sm-9 { + margin-left: 6rem !important; + } + .mb-sm-9, + .my-sm-9 { + margin-bottom: 6rem !important; + } + .ml-sm-9, + .mx-sm-9 { + margin-right: 6rem !important; + } + .p-sm-0 { + padding: 0 !important; + } + .pt-sm-0, + .py-sm-0 { + padding-top: 0 !important; + } + .pr-sm-0, + .px-sm-0 { + padding-left: 0 !important; + } + .pb-sm-0, + .py-sm-0 { + padding-bottom: 0 !important; + } + .pl-sm-0, + .px-sm-0 { + padding-right: 0 !important; + } + .p-sm-1 { + padding: 0.25rem !important; + } + .pt-sm-1, + .py-sm-1 { + padding-top: 0.25rem !important; + } + .pr-sm-1, + .px-sm-1 { + padding-left: 0.25rem !important; + } + .pb-sm-1, + .py-sm-1 { + padding-bottom: 0.25rem !important; + } + .pl-sm-1, + .px-sm-1 { + padding-right: 0.25rem !important; + } + .p-sm-2 { + padding: 0.5rem !important; + } + .pt-sm-2, + .py-sm-2 { + padding-top: 0.5rem !important; + } + .pr-sm-2, + .px-sm-2 { + padding-left: 0.5rem !important; + } + .pb-sm-2, + .py-sm-2 { + padding-bottom: 0.5rem !important; + } + .pl-sm-2, + .px-sm-2 { + padding-right: 0.5rem !important; + } + .p-sm-3 { + padding: 0.75rem !important; + } + .pt-sm-3, + .py-sm-3 { + padding-top: 0.75rem !important; + } + .pr-sm-3, + .px-sm-3 { + padding-left: 0.75rem !important; + } + .pb-sm-3, + .py-sm-3 { + padding-bottom: 0.75rem !important; + } + .pl-sm-3, + .px-sm-3 { + padding-right: 0.75rem !important; + } + .p-sm-4 { + padding: 1rem !important; + } + .pt-sm-4, + .py-sm-4 { + padding-top: 1rem !important; + } + .pr-sm-4, + .px-sm-4 { + padding-left: 1rem !important; + } + .pb-sm-4, + .py-sm-4 { + padding-bottom: 1rem !important; + } + .pl-sm-4, + .px-sm-4 { + padding-right: 1rem !important; + } + .p-sm-5 { + padding: 1.5rem !important; + } + .pt-sm-5, + .py-sm-5 { + padding-top: 1.5rem !important; + } + .pr-sm-5, + .px-sm-5 { + padding-left: 1.5rem !important; + } + .pb-sm-5, + .py-sm-5 { + padding-bottom: 1.5rem !important; + } + .pl-sm-5, + .px-sm-5 { + padding-right: 1.5rem !important; + } + .p-sm-6 { + padding: 2rem !important; + } + .pt-sm-6, + .py-sm-6 { + padding-top: 2rem !important; + } + .pr-sm-6, + .px-sm-6 { + padding-left: 2rem !important; + } + .pb-sm-6, + .py-sm-6 { + padding-bottom: 2rem !important; + } + .pl-sm-6, + .px-sm-6 { + padding-right: 2rem !important; + } + .p-sm-7 { + padding: 3rem !important; + } + .pt-sm-7, + .py-sm-7 { + padding-top: 3rem !important; + } + .pr-sm-7, + .px-sm-7 { + padding-left: 3rem !important; + } + .pb-sm-7, + .py-sm-7 { + padding-bottom: 3rem !important; + } + .pl-sm-7, + .px-sm-7 { + padding-right: 3rem !important; + } + .p-sm-8 { + padding: 4rem !important; + } + .pt-sm-8, + .py-sm-8 { + padding-top: 4rem !important; + } + .pr-sm-8, + .px-sm-8 { + padding-left: 4rem !important; + } + .pb-sm-8, + .py-sm-8 { + padding-bottom: 4rem !important; + } + .pl-sm-8, + .px-sm-8 { + padding-right: 4rem !important; + } + .p-sm-9 { + padding: 6rem !important; + } + .pt-sm-9, + .py-sm-9 { + padding-top: 6rem !important; + } + .pr-sm-9, + .px-sm-9 { + padding-left: 6rem !important; + } + .pb-sm-9, + .py-sm-9 { + padding-bottom: 6rem !important; + } + .pl-sm-9, + .px-sm-9 { + padding-right: 6rem !important; + } + .m-sm-auto { + margin: auto !important; + } + .mt-sm-auto, + .my-sm-auto { + margin-top: auto !important; + } + .mr-sm-auto, + .mx-sm-auto { + margin-left: auto !important; + } + .mb-sm-auto, + .my-sm-auto { + margin-bottom: auto !important; + } + .ml-sm-auto, + .mx-sm-auto { + margin-right: auto !important; + } +} + +@media (min-width: 768px) { + .m-md-0 { + margin: 0 !important; + } + .mt-md-0, + .my-md-0 { + margin-top: 0 !important; + } + .mr-md-0, + .mx-md-0 { + margin-left: 0 !important; + } + .mb-md-0, + .my-md-0 { + margin-bottom: 0 !important; + } + .ml-md-0, + .mx-md-0 { + margin-right: 0 !important; + } + .m-md-1 { + margin: 0.25rem !important; + } + .mt-md-1, + .my-md-1 { + margin-top: 0.25rem !important; + } + .mr-md-1, + .mx-md-1 { + margin-left: 0.25rem !important; + } + .mb-md-1, + .my-md-1 { + margin-bottom: 0.25rem !important; + } + .ml-md-1, + .mx-md-1 { + margin-right: 0.25rem !important; + } + .m-md-2 { + margin: 0.5rem !important; + } + .mt-md-2, + .my-md-2 { + margin-top: 0.5rem !important; + } + .mr-md-2, + .mx-md-2 { + margin-left: 0.5rem !important; + } + .mb-md-2, + .my-md-2 { + margin-bottom: 0.5rem !important; + } + .ml-md-2, + .mx-md-2 { + margin-right: 0.5rem !important; + } + .m-md-3 { + margin: 0.75rem !important; + } + .mt-md-3, + .my-md-3 { + margin-top: 0.75rem !important; + } + .mr-md-3, + .mx-md-3 { + margin-left: 0.75rem !important; + } + .mb-md-3, + .my-md-3 { + margin-bottom: 0.75rem !important; + } + .ml-md-3, + .mx-md-3 { + margin-right: 0.75rem !important; + } + .m-md-4 { + margin: 1rem !important; + } + .mt-md-4, + .my-md-4 { + margin-top: 1rem !important; + } + .mr-md-4, + .mx-md-4 { + margin-left: 1rem !important; + } + .mb-md-4, + .my-md-4 { + margin-bottom: 1rem !important; + } + .ml-md-4, + .mx-md-4 { + margin-right: 1rem !important; + } + .m-md-5 { + margin: 1.5rem !important; + } + .mt-md-5, + .my-md-5 { + margin-top: 1.5rem !important; + } + .mr-md-5, + .mx-md-5 { + margin-left: 1.5rem !important; + } + .mb-md-5, + .my-md-5 { + margin-bottom: 1.5rem !important; + } + .ml-md-5, + .mx-md-5 { + margin-right: 1.5rem !important; + } + .m-md-6 { + margin: 2rem !important; + } + .mt-md-6, + .my-md-6 { + margin-top: 2rem !important; + } + .mr-md-6, + .mx-md-6 { + margin-left: 2rem !important; + } + .mb-md-6, + .my-md-6 { + margin-bottom: 2rem !important; + } + .ml-md-6, + .mx-md-6 { + margin-right: 2rem !important; + } + .m-md-7 { + margin: 3rem !important; + } + .mt-md-7, + .my-md-7 { + margin-top: 3rem !important; + } + .mr-md-7, + .mx-md-7 { + margin-left: 3rem !important; + } + .mb-md-7, + .my-md-7 { + margin-bottom: 3rem !important; + } + .ml-md-7, + .mx-md-7 { + margin-right: 3rem !important; + } + .m-md-8 { + margin: 4rem !important; + } + .mt-md-8, + .my-md-8 { + margin-top: 4rem !important; + } + .mr-md-8, + .mx-md-8 { + margin-left: 4rem !important; + } + .mb-md-8, + .my-md-8 { + margin-bottom: 4rem !important; + } + .ml-md-8, + .mx-md-8 { + margin-right: 4rem !important; + } + .m-md-9 { + margin: 6rem !important; + } + .mt-md-9, + .my-md-9 { + margin-top: 6rem !important; + } + .mr-md-9, + .mx-md-9 { + margin-left: 6rem !important; + } + .mb-md-9, + .my-md-9 { + margin-bottom: 6rem !important; + } + .ml-md-9, + .mx-md-9 { + margin-right: 6rem !important; + } + .p-md-0 { + padding: 0 !important; + } + .pt-md-0, + .py-md-0 { + padding-top: 0 !important; + } + .pr-md-0, + .px-md-0 { + padding-left: 0 !important; + } + .pb-md-0, + .py-md-0 { + padding-bottom: 0 !important; + } + .pl-md-0, + .px-md-0 { + padding-right: 0 !important; + } + .p-md-1 { + padding: 0.25rem !important; + } + .pt-md-1, + .py-md-1 { + padding-top: 0.25rem !important; + } + .pr-md-1, + .px-md-1 { + padding-left: 0.25rem !important; + } + .pb-md-1, + .py-md-1 { + padding-bottom: 0.25rem !important; + } + .pl-md-1, + .px-md-1 { + padding-right: 0.25rem !important; + } + .p-md-2 { + padding: 0.5rem !important; + } + .pt-md-2, + .py-md-2 { + padding-top: 0.5rem !important; + } + .pr-md-2, + .px-md-2 { + padding-left: 0.5rem !important; + } + .pb-md-2, + .py-md-2 { + padding-bottom: 0.5rem !important; + } + .pl-md-2, + .px-md-2 { + padding-right: 0.5rem !important; + } + .p-md-3 { + padding: 0.75rem !important; + } + .pt-md-3, + .py-md-3 { + padding-top: 0.75rem !important; + } + .pr-md-3, + .px-md-3 { + padding-left: 0.75rem !important; + } + .pb-md-3, + .py-md-3 { + padding-bottom: 0.75rem !important; + } + .pl-md-3, + .px-md-3 { + padding-right: 0.75rem !important; + } + .p-md-4 { + padding: 1rem !important; + } + .pt-md-4, + .py-md-4 { + padding-top: 1rem !important; + } + .pr-md-4, + .px-md-4 { + padding-left: 1rem !important; + } + .pb-md-4, + .py-md-4 { + padding-bottom: 1rem !important; + } + .pl-md-4, + .px-md-4 { + padding-right: 1rem !important; + } + .p-md-5 { + padding: 1.5rem !important; + } + .pt-md-5, + .py-md-5 { + padding-top: 1.5rem !important; + } + .pr-md-5, + .px-md-5 { + padding-left: 1.5rem !important; + } + .pb-md-5, + .py-md-5 { + padding-bottom: 1.5rem !important; + } + .pl-md-5, + .px-md-5 { + padding-right: 1.5rem !important; + } + .p-md-6 { + padding: 2rem !important; + } + .pt-md-6, + .py-md-6 { + padding-top: 2rem !important; + } + .pr-md-6, + .px-md-6 { + padding-left: 2rem !important; + } + .pb-md-6, + .py-md-6 { + padding-bottom: 2rem !important; + } + .pl-md-6, + .px-md-6 { + padding-right: 2rem !important; + } + .p-md-7 { + padding: 3rem !important; + } + .pt-md-7, + .py-md-7 { + padding-top: 3rem !important; + } + .pr-md-7, + .px-md-7 { + padding-left: 3rem !important; + } + .pb-md-7, + .py-md-7 { + padding-bottom: 3rem !important; + } + .pl-md-7, + .px-md-7 { + padding-right: 3rem !important; + } + .p-md-8 { + padding: 4rem !important; + } + .pt-md-8, + .py-md-8 { + padding-top: 4rem !important; + } + .pr-md-8, + .px-md-8 { + padding-left: 4rem !important; + } + .pb-md-8, + .py-md-8 { + padding-bottom: 4rem !important; + } + .pl-md-8, + .px-md-8 { + padding-right: 4rem !important; + } + .p-md-9 { + padding: 6rem !important; + } + .pt-md-9, + .py-md-9 { + padding-top: 6rem !important; + } + .pr-md-9, + .px-md-9 { + padding-left: 6rem !important; + } + .pb-md-9, + .py-md-9 { + padding-bottom: 6rem !important; + } + .pl-md-9, + .px-md-9 { + padding-right: 6rem !important; + } + .m-md-auto { + margin: auto !important; + } + .mt-md-auto, + .my-md-auto { + margin-top: auto !important; + } + .mr-md-auto, + .mx-md-auto { + margin-left: auto !important; + } + .mb-md-auto, + .my-md-auto { + margin-bottom: auto !important; + } + .ml-md-auto, + .mx-md-auto { + margin-right: auto !important; + } +} + +@media (min-width: 992px) { + .m-lg-0 { + margin: 0 !important; + } + .mt-lg-0, + .my-lg-0 { + margin-top: 0 !important; + } + .mr-lg-0, + .mx-lg-0 { + margin-left: 0 !important; + } + .mb-lg-0, + .my-lg-0 { + margin-bottom: 0 !important; + } + .ml-lg-0, + .mx-lg-0 { + margin-right: 0 !important; + } + .m-lg-1 { + margin: 0.25rem !important; + } + .mt-lg-1, + .my-lg-1 { + margin-top: 0.25rem !important; + } + .mr-lg-1, + .mx-lg-1 { + margin-left: 0.25rem !important; + } + .mb-lg-1, + .my-lg-1 { + margin-bottom: 0.25rem !important; + } + .ml-lg-1, + .mx-lg-1 { + margin-right: 0.25rem !important; + } + .m-lg-2 { + margin: 0.5rem !important; + } + .mt-lg-2, + .my-lg-2 { + margin-top: 0.5rem !important; + } + .mr-lg-2, + .mx-lg-2 { + margin-left: 0.5rem !important; + } + .mb-lg-2, + .my-lg-2 { + margin-bottom: 0.5rem !important; + } + .ml-lg-2, + .mx-lg-2 { + margin-right: 0.5rem !important; + } + .m-lg-3 { + margin: 0.75rem !important; + } + .mt-lg-3, + .my-lg-3 { + margin-top: 0.75rem !important; + } + .mr-lg-3, + .mx-lg-3 { + margin-left: 0.75rem !important; + } + .mb-lg-3, + .my-lg-3 { + margin-bottom: 0.75rem !important; + } + .ml-lg-3, + .mx-lg-3 { + margin-right: 0.75rem !important; + } + .m-lg-4 { + margin: 1rem !important; + } + .mt-lg-4, + .my-lg-4 { + margin-top: 1rem !important; + } + .mr-lg-4, + .mx-lg-4 { + margin-left: 1rem !important; + } + .mb-lg-4, + .my-lg-4 { + margin-bottom: 1rem !important; + } + .ml-lg-4, + .mx-lg-4 { + margin-right: 1rem !important; + } + .m-lg-5 { + margin: 1.5rem !important; + } + .mt-lg-5, + .my-lg-5 { + margin-top: 1.5rem !important; + } + .mr-lg-5, + .mx-lg-5 { + margin-left: 1.5rem !important; + } + .mb-lg-5, + .my-lg-5 { + margin-bottom: 1.5rem !important; + } + .ml-lg-5, + .mx-lg-5 { + margin-right: 1.5rem !important; + } + .m-lg-6 { + margin: 2rem !important; + } + .mt-lg-6, + .my-lg-6 { + margin-top: 2rem !important; + } + .mr-lg-6, + .mx-lg-6 { + margin-left: 2rem !important; + } + .mb-lg-6, + .my-lg-6 { + margin-bottom: 2rem !important; + } + .ml-lg-6, + .mx-lg-6 { + margin-right: 2rem !important; + } + .m-lg-7 { + margin: 3rem !important; + } + .mt-lg-7, + .my-lg-7 { + margin-top: 3rem !important; + } + .mr-lg-7, + .mx-lg-7 { + margin-left: 3rem !important; + } + .mb-lg-7, + .my-lg-7 { + margin-bottom: 3rem !important; + } + .ml-lg-7, + .mx-lg-7 { + margin-right: 3rem !important; + } + .m-lg-8 { + margin: 4rem !important; + } + .mt-lg-8, + .my-lg-8 { + margin-top: 4rem !important; + } + .mr-lg-8, + .mx-lg-8 { + margin-left: 4rem !important; + } + .mb-lg-8, + .my-lg-8 { + margin-bottom: 4rem !important; + } + .ml-lg-8, + .mx-lg-8 { + margin-right: 4rem !important; + } + .m-lg-9 { + margin: 6rem !important; + } + .mt-lg-9, + .my-lg-9 { + margin-top: 6rem !important; + } + .mr-lg-9, + .mx-lg-9 { + margin-left: 6rem !important; + } + .mb-lg-9, + .my-lg-9 { + margin-bottom: 6rem !important; + } + .ml-lg-9, + .mx-lg-9 { + margin-right: 6rem !important; + } + .p-lg-0 { + padding: 0 !important; + } + .pt-lg-0, + .py-lg-0 { + padding-top: 0 !important; + } + .pr-lg-0, + .px-lg-0 { + padding-left: 0 !important; + } + .pb-lg-0, + .py-lg-0 { + padding-bottom: 0 !important; + } + .pl-lg-0, + .px-lg-0 { + padding-right: 0 !important; + } + .p-lg-1 { + padding: 0.25rem !important; + } + .pt-lg-1, + .py-lg-1 { + padding-top: 0.25rem !important; + } + .pr-lg-1, + .px-lg-1 { + padding-left: 0.25rem !important; + } + .pb-lg-1, + .py-lg-1 { + padding-bottom: 0.25rem !important; + } + .pl-lg-1, + .px-lg-1 { + padding-right: 0.25rem !important; + } + .p-lg-2 { + padding: 0.5rem !important; + } + .pt-lg-2, + .py-lg-2 { + padding-top: 0.5rem !important; + } + .pr-lg-2, + .px-lg-2 { + padding-left: 0.5rem !important; + } + .pb-lg-2, + .py-lg-2 { + padding-bottom: 0.5rem !important; + } + .pl-lg-2, + .px-lg-2 { + padding-right: 0.5rem !important; + } + .p-lg-3 { + padding: 0.75rem !important; + } + .pt-lg-3, + .py-lg-3 { + padding-top: 0.75rem !important; + } + .pr-lg-3, + .px-lg-3 { + padding-left: 0.75rem !important; + } + .pb-lg-3, + .py-lg-3 { + padding-bottom: 0.75rem !important; + } + .pl-lg-3, + .px-lg-3 { + padding-right: 0.75rem !important; + } + .p-lg-4 { + padding: 1rem !important; + } + .pt-lg-4, + .py-lg-4 { + padding-top: 1rem !important; + } + .pr-lg-4, + .px-lg-4 { + padding-left: 1rem !important; + } + .pb-lg-4, + .py-lg-4 { + padding-bottom: 1rem !important; + } + .pl-lg-4, + .px-lg-4 { + padding-right: 1rem !important; + } + .p-lg-5 { + padding: 1.5rem !important; + } + .pt-lg-5, + .py-lg-5 { + padding-top: 1.5rem !important; + } + .pr-lg-5, + .px-lg-5 { + padding-left: 1.5rem !important; + } + .pb-lg-5, + .py-lg-5 { + padding-bottom: 1.5rem !important; + } + .pl-lg-5, + .px-lg-5 { + padding-right: 1.5rem !important; + } + .p-lg-6 { + padding: 2rem !important; + } + .pt-lg-6, + .py-lg-6 { + padding-top: 2rem !important; + } + .pr-lg-6, + .px-lg-6 { + padding-left: 2rem !important; + } + .pb-lg-6, + .py-lg-6 { + padding-bottom: 2rem !important; + } + .pl-lg-6, + .px-lg-6 { + padding-right: 2rem !important; + } + .p-lg-7 { + padding: 3rem !important; + } + .pt-lg-7, + .py-lg-7 { + padding-top: 3rem !important; + } + .pr-lg-7, + .px-lg-7 { + padding-left: 3rem !important; + } + .pb-lg-7, + .py-lg-7 { + padding-bottom: 3rem !important; + } + .pl-lg-7, + .px-lg-7 { + padding-right: 3rem !important; + } + .p-lg-8 { + padding: 4rem !important; + } + .pt-lg-8, + .py-lg-8 { + padding-top: 4rem !important; + } + .pr-lg-8, + .px-lg-8 { + padding-left: 4rem !important; + } + .pb-lg-8, + .py-lg-8 { + padding-bottom: 4rem !important; + } + .pl-lg-8, + .px-lg-8 { + padding-right: 4rem !important; + } + .p-lg-9 { + padding: 6rem !important; + } + .pt-lg-9, + .py-lg-9 { + padding-top: 6rem !important; + } + .pr-lg-9, + .px-lg-9 { + padding-left: 6rem !important; + } + .pb-lg-9, + .py-lg-9 { + padding-bottom: 6rem !important; + } + .pl-lg-9, + .px-lg-9 { + padding-right: 6rem !important; + } + .m-lg-auto { + margin: auto !important; + } + .mt-lg-auto, + .my-lg-auto { + margin-top: auto !important; + } + .mr-lg-auto, + .mx-lg-auto { + margin-left: auto !important; + } + .mb-lg-auto, + .my-lg-auto { + margin-bottom: auto !important; + } + .ml-lg-auto, + .mx-lg-auto { + margin-right: auto !important; + } +} + +@media (min-width: 1280px) { + .m-xl-0 { + margin: 0 !important; + } + .mt-xl-0, + .my-xl-0 { + margin-top: 0 !important; + } + .mr-xl-0, + .mx-xl-0 { + margin-left: 0 !important; + } + .mb-xl-0, + .my-xl-0 { + margin-bottom: 0 !important; + } + .ml-xl-0, + .mx-xl-0 { + margin-right: 0 !important; + } + .m-xl-1 { + margin: 0.25rem !important; + } + .mt-xl-1, + .my-xl-1 { + margin-top: 0.25rem !important; + } + .mr-xl-1, + .mx-xl-1 { + margin-left: 0.25rem !important; + } + .mb-xl-1, + .my-xl-1 { + margin-bottom: 0.25rem !important; + } + .ml-xl-1, + .mx-xl-1 { + margin-right: 0.25rem !important; + } + .m-xl-2 { + margin: 0.5rem !important; + } + .mt-xl-2, + .my-xl-2 { + margin-top: 0.5rem !important; + } + .mr-xl-2, + .mx-xl-2 { + margin-left: 0.5rem !important; + } + .mb-xl-2, + .my-xl-2 { + margin-bottom: 0.5rem !important; + } + .ml-xl-2, + .mx-xl-2 { + margin-right: 0.5rem !important; + } + .m-xl-3 { + margin: 0.75rem !important; + } + .mt-xl-3, + .my-xl-3 { + margin-top: 0.75rem !important; + } + .mr-xl-3, + .mx-xl-3 { + margin-left: 0.75rem !important; + } + .mb-xl-3, + .my-xl-3 { + margin-bottom: 0.75rem !important; + } + .ml-xl-3, + .mx-xl-3 { + margin-right: 0.75rem !important; + } + .m-xl-4 { + margin: 1rem !important; + } + .mt-xl-4, + .my-xl-4 { + margin-top: 1rem !important; + } + .mr-xl-4, + .mx-xl-4 { + margin-left: 1rem !important; + } + .mb-xl-4, + .my-xl-4 { + margin-bottom: 1rem !important; + } + .ml-xl-4, + .mx-xl-4 { + margin-right: 1rem !important; + } + .m-xl-5 { + margin: 1.5rem !important; + } + .mt-xl-5, + .my-xl-5 { + margin-top: 1.5rem !important; + } + .mr-xl-5, + .mx-xl-5 { + margin-left: 1.5rem !important; + } + .mb-xl-5, + .my-xl-5 { + margin-bottom: 1.5rem !important; + } + .ml-xl-5, + .mx-xl-5 { + margin-right: 1.5rem !important; + } + .m-xl-6 { + margin: 2rem !important; + } + .mt-xl-6, + .my-xl-6 { + margin-top: 2rem !important; + } + .mr-xl-6, + .mx-xl-6 { + margin-left: 2rem !important; + } + .mb-xl-6, + .my-xl-6 { + margin-bottom: 2rem !important; + } + .ml-xl-6, + .mx-xl-6 { + margin-right: 2rem !important; + } + .m-xl-7 { + margin: 3rem !important; + } + .mt-xl-7, + .my-xl-7 { + margin-top: 3rem !important; + } + .mr-xl-7, + .mx-xl-7 { + margin-left: 3rem !important; + } + .mb-xl-7, + .my-xl-7 { + margin-bottom: 3rem !important; + } + .ml-xl-7, + .mx-xl-7 { + margin-right: 3rem !important; + } + .m-xl-8 { + margin: 4rem !important; + } + .mt-xl-8, + .my-xl-8 { + margin-top: 4rem !important; + } + .mr-xl-8, + .mx-xl-8 { + margin-left: 4rem !important; + } + .mb-xl-8, + .my-xl-8 { + margin-bottom: 4rem !important; + } + .ml-xl-8, + .mx-xl-8 { + margin-right: 4rem !important; + } + .m-xl-9 { + margin: 6rem !important; + } + .mt-xl-9, + .my-xl-9 { + margin-top: 6rem !important; + } + .mr-xl-9, + .mx-xl-9 { + margin-left: 6rem !important; + } + .mb-xl-9, + .my-xl-9 { + margin-bottom: 6rem !important; + } + .ml-xl-9, + .mx-xl-9 { + margin-right: 6rem !important; + } + .p-xl-0 { + padding: 0 !important; + } + .pt-xl-0, + .py-xl-0 { + padding-top: 0 !important; + } + .pr-xl-0, + .px-xl-0 { + padding-left: 0 !important; + } + .pb-xl-0, + .py-xl-0 { + padding-bottom: 0 !important; + } + .pl-xl-0, + .px-xl-0 { + padding-right: 0 !important; + } + .p-xl-1 { + padding: 0.25rem !important; + } + .pt-xl-1, + .py-xl-1 { + padding-top: 0.25rem !important; + } + .pr-xl-1, + .px-xl-1 { + padding-left: 0.25rem !important; + } + .pb-xl-1, + .py-xl-1 { + padding-bottom: 0.25rem !important; + } + .pl-xl-1, + .px-xl-1 { + padding-right: 0.25rem !important; + } + .p-xl-2 { + padding: 0.5rem !important; + } + .pt-xl-2, + .py-xl-2 { + padding-top: 0.5rem !important; + } + .pr-xl-2, + .px-xl-2 { + padding-left: 0.5rem !important; + } + .pb-xl-2, + .py-xl-2 { + padding-bottom: 0.5rem !important; + } + .pl-xl-2, + .px-xl-2 { + padding-right: 0.5rem !important; + } + .p-xl-3 { + padding: 0.75rem !important; + } + .pt-xl-3, + .py-xl-3 { + padding-top: 0.75rem !important; + } + .pr-xl-3, + .px-xl-3 { + padding-left: 0.75rem !important; + } + .pb-xl-3, + .py-xl-3 { + padding-bottom: 0.75rem !important; + } + .pl-xl-3, + .px-xl-3 { + padding-right: 0.75rem !important; + } + .p-xl-4 { + padding: 1rem !important; + } + .pt-xl-4, + .py-xl-4 { + padding-top: 1rem !important; + } + .pr-xl-4, + .px-xl-4 { + padding-left: 1rem !important; + } + .pb-xl-4, + .py-xl-4 { + padding-bottom: 1rem !important; + } + .pl-xl-4, + .px-xl-4 { + padding-right: 1rem !important; + } + .p-xl-5 { + padding: 1.5rem !important; + } + .pt-xl-5, + .py-xl-5 { + padding-top: 1.5rem !important; + } + .pr-xl-5, + .px-xl-5 { + padding-left: 1.5rem !important; + } + .pb-xl-5, + .py-xl-5 { + padding-bottom: 1.5rem !important; + } + .pl-xl-5, + .px-xl-5 { + padding-right: 1.5rem !important; + } + .p-xl-6 { + padding: 2rem !important; + } + .pt-xl-6, + .py-xl-6 { + padding-top: 2rem !important; + } + .pr-xl-6, + .px-xl-6 { + padding-left: 2rem !important; + } + .pb-xl-6, + .py-xl-6 { + padding-bottom: 2rem !important; + } + .pl-xl-6, + .px-xl-6 { + padding-right: 2rem !important; + } + .p-xl-7 { + padding: 3rem !important; + } + .pt-xl-7, + .py-xl-7 { + padding-top: 3rem !important; + } + .pr-xl-7, + .px-xl-7 { + padding-left: 3rem !important; + } + .pb-xl-7, + .py-xl-7 { + padding-bottom: 3rem !important; + } + .pl-xl-7, + .px-xl-7 { + padding-right: 3rem !important; + } + .p-xl-8 { + padding: 4rem !important; + } + .pt-xl-8, + .py-xl-8 { + padding-top: 4rem !important; + } + .pr-xl-8, + .px-xl-8 { + padding-left: 4rem !important; + } + .pb-xl-8, + .py-xl-8 { + padding-bottom: 4rem !important; + } + .pl-xl-8, + .px-xl-8 { + padding-right: 4rem !important; + } + .p-xl-9 { + padding: 6rem !important; + } + .pt-xl-9, + .py-xl-9 { + padding-top: 6rem !important; + } + .pr-xl-9, + .px-xl-9 { + padding-left: 6rem !important; + } + .pb-xl-9, + .py-xl-9 { + padding-bottom: 6rem !important; + } + .pl-xl-9, + .px-xl-9 { + padding-right: 6rem !important; + } + .m-xl-auto { + margin: auto !important; + } + .mt-xl-auto, + .my-xl-auto { + margin-top: auto !important; + } + .mr-xl-auto, + .mx-xl-auto { + margin-left: auto !important; + } + .mb-xl-auto, + .my-xl-auto { + margin-bottom: auto !important; + } + .ml-xl-auto, + .mx-xl-auto { + margin-right: auto !important; + } +} + +.text-monospace { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +.text-justify { + text-align: justify !important; +} + +.text-nowrap { + white-space: nowrap !important; +} + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +.text-left { + text-align: right !important; +} + +.text-right { + text-align: left !important; +} + +.text-center { + text-align: center !important; +} + +@media (min-width: 576px) { + .text-sm-left { + text-align: right !important; + } + .text-sm-right { + text-align: left !important; + } + .text-sm-center { + text-align: center !important; + } +} + +@media (min-width: 768px) { + .text-md-left { + text-align: right !important; + } + .text-md-right { + text-align: left !important; + } + .text-md-center { + text-align: center !important; + } +} + +@media (min-width: 992px) { + .text-lg-left { + text-align: right !important; + } + .text-lg-right { + text-align: left !important; + } + .text-lg-center { + text-align: center !important; + } +} + +@media (min-width: 1280px) { + .text-xl-left { + text-align: right !important; + } + .text-xl-right { + text-align: left !important; + } + .text-xl-center { + text-align: center !important; + } +} + +.text-lowercase { + text-transform: lowercase !important; +} + +.text-uppercase { + text-transform: uppercase !important; +} + +.text-capitalize { + text-transform: capitalize !important; +} + +.font-weight-light { + font-weight: 300 !important; +} + +.font-weight-normal { + font-weight: 400 !important; +} + +.font-weight-bold { + font-weight: 700 !important; +} + +.font-italic { + font-style: italic !important; +} + +.text-white { + color: #fff !important; +} + +.text-primary { + color: #467fcf !important; +} + +a.text-primary:hover, a.text-primary:focus { + color: #2f66b3 !important; +} + +.text-secondary { + color: #868e96 !important; +} + +a.text-secondary:hover, a.text-secondary:focus { + color: #6c757d !important; +} + +.text-success { + color: #5eba00 !important; +} + +a.text-success:hover, a.text-success:focus { + color: #448700 !important; +} + +.text-info { + color: #45aaf2 !important; +} + +a.text-info:hover, a.text-info:focus { + color: #1594ef !important; +} + +.text-warning { + color: #f1c40f !important; +} + +a.text-warning:hover, a.text-warning:focus { + color: #c29d0b !important; +} + +.text-danger { + color: #cd201f !important; +} + +a.text-danger:hover, a.text-danger:focus { + color: #a11918 !important; +} + +.text-light { + color: #f8f9fa !important; +} + +a.text-light:hover, a.text-light:focus { + color: #dae0e5 !important; +} + +.text-dark { + color: #343a40 !important; +} + +a.text-dark:hover, a.text-dark:focus { + color: #1d2124 !important; +} + +.text-body { + color: #495057 !important; +} + +.text-muted { + color: #9aa0ac !important; +} + +.text-black-50 { + color: rgba(0, 0, 0, 0.5) !important; +} + +.text-white-50 { + color: rgba(255, 255, 255, 0.5) !important; +} + +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} + +.visible { + visibility: visible !important; +} + +.invisible { + visibility: hidden !important; +} + +@media print { + *, + *::before, + *::after { + text-shadow: none !important; + box-shadow: none !important; + } + a:not(.btn) { + text-decoration: underline; + } + abbr[title]::after { + content: " (" attr(title) ")"; + } + pre { + white-space: pre-wrap !important; + } + pre, + blockquote { + border: 1px solid #adb5bd; + page-break-inside: avoid; + } + thead { + display: table-header-group; + } + tr, + img { + page-break-inside: avoid; + } + p, + h2, + h3 { + orphans: 3; + widows: 3; + } + h2, + h3 { + page-break-after: avoid; + } + @page { + size: a3; + } + body { + min-width: 992px !important; + } + .container { + min-width: 992px !important; + } + .navbar { + display: none; + } + .badge { + border: 1px solid #000; + } + .table, .text-wrap table { + border-collapse: collapse !important; + } + + .table td, + .text-wrap table td, .table th, .text-wrap table th { + background-color: #fff !important; + } + .table-bordered th, .text-wrap table th, + .table-bordered td, + .text-wrap table td { + border: 1px solid #dee2e6 !important; + } +} + +html { + font-size: 16px; + height: 100%; + direction: rtl; +} + +body { + direction: rtl; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; + -webkit-tap-highlight-color: transparent; + -webkit-text-size-adjust: none; + -ms-touch-action: manipulation; + touch-action: manipulation; + -webkit-font-feature-settings: "liga" 0; + font-feature-settings: "liga" 0; + height: 100%; + overflow-y: scroll; + position: relative; +} + +@media print { + body { + background: none; + } +} + +body *::-webkit-scrollbar { + width: 6px; + height: 6px; + transition: .3s background; +} + +body *::-webkit-scrollbar-thumb { + background: #ced4da; +} + +body *:hover::-webkit-scrollbar-thumb { + background: #adb5bd; +} + +.lead { + line-height: 1.4; +} + +a { + -webkit-text-decoration-skip: ink; + text-decoration-skip: ink; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a, +.h1 a, .h2 a, .h3 a, .h4 a, .h5 a, .h6 a { + color: inherit; +} + +strong, +b { + font-weight: 600; +} + +p, +ul, +ol, +blockquote { + margin-bottom: 1em; +} + +blockquote { + font-style: italic; + color: #6e7687; + padding-right: 2rem; + border-right: 2px solid rgba(0, 40, 100, 0.12); +} + +blockquote p { + margin-bottom: 1rem; +} + +blockquote cite { + display: block; + text-align: left; +} + +blockquote cite:before { + content: '— '; +} + +code { + background: rgba(0, 0, 0, 0.025); + border: 1px solid rgba(0, 0, 0, 0.05); + border-radius: 3px; + padding: 3px; +} + +pre code { + padding: 0; + border-radius: 0; + border: none; + background: none; +} + +hr { + margin-top: 2rem; + margin-bottom: 2rem; +} + +pre { + color: #343a40; + padding: 1rem; + overflow: auto; + font-size: 85%; + line-height: 1.45; + background-color: #f8fafc; + border-radius: 3px; + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + text-shadow: 0 1px white; + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} + +img { + max-width: 100%; +} + +.text-wrap { + font-size: 1rem; + line-height: 1.66; +} + +.text-wrap > :first-child { + margin-top: 0; +} + +.text-wrap > :last-child { + margin-bottom: 0; +} + +.text-wrap > h1, .text-wrap > h2, .text-wrap > h3, .text-wrap > h4, .text-wrap > h5, .text-wrap > h6 { + margin-top: 1em; +} + +.section-nav { + background-color: #f8f9fa; + margin: 1rem 0; + padding: .5rem 1rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + list-style: none; +} + +.section-nav:before { + content: 'Table of contents:'; + display: block; + font-weight: 600; +} + +@media print { + .container { + max-width: none; + } +} + +.row-cards > .col, +.row-cards > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.row-deck > .col, +.row-deck > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-align: stretch; + align-items: stretch; +} + +.row-deck > .col .card, +.row-deck > [class*='col-'] .card { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.col-text { + max-width: 48rem; +} + +.col-login { + max-width: 24rem; +} + +.gutters-0 { + margin-left: 0; + margin-right: 0; +} + +.gutters-0 > .col, +.gutters-0 > [class*="col-"] { + padding-left: 0; + padding-right: 0; +} + +.gutters-0 .card { + margin-bottom: 0; +} + +.gutters-xs { + margin-left: -0.25rem; + margin-right: -0.25rem; +} + +.gutters-xs > .col, +.gutters-xs > [class*="col-"] { + padding-left: 0.25rem; + padding-right: 0.25rem; +} + +.gutters-xs .card { + margin-bottom: 0.5rem; +} + +.gutters-sm { + margin-left: -0.5rem; + margin-right: -0.5rem; +} + +.gutters-sm > .col, +.gutters-sm > [class*="col-"] { + padding-left: 0.5rem; + padding-right: 0.5rem; +} + +.gutters-sm .card { + margin-bottom: 1rem; +} + +.gutters-lg { + margin-left: -1rem; + margin-right: -1rem; +} + +.gutters-lg > .col, +.gutters-lg > [class*="col-"] { + padding-left: 1rem; + padding-right: 1rem; +} + +.gutters-lg .card { + margin-bottom: 2rem; +} + +.gutters-xl { + margin-left: -1.5rem; + margin-right: -1.5rem; +} + +.gutters-xl > .col, +.gutters-xl > [class*="col-"] { + padding-left: 1.5rem; + padding-right: 1.5rem; +} + +.gutters-xl .card { + margin-bottom: 3rem; +} + +.page { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + min-height: 100%; +} + +body.fixed-header .page { + padding-top: 4.5rem; +} + +@media (min-width: 1600px) { + body.aside-opened .page { + margin-left: 22rem; + } +} + +.page-main { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.page-content { + margin: .75rem 0; +} + +@media (min-width: 768px) { + .page-content { + margin: 1.5rem 0; + } +} + +.page-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + margin: 1.5rem 0 1.5rem; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.page-title { + margin: 0; + font-size: 1.5rem; + font-weight: 400; + line-height: 2.5rem; +} + +.page-title-icon { + color: #9aa0ac; + font-size: 1.25rem; +} + +.page-subtitle { + font-size: 0.8125rem; + color: #6e7687; + margin-right: 2rem; +} + +.page-subtitle a { + color: inherit; +} + +.page-options { + margin-right: auto; +} + +.page-breadcrumb { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; +} + +.page-description { + margin: .25rem 0 0; + color: #6e7687; +} + +.page-description a { + color: inherit; +} + +.page-single { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + padding: 1rem 0; +} + +.content-heading { + font-weight: 400; + margin: 2rem 0 1.5rem; + font-size: 1.25rem; + line-height: 1.25; +} + +.content-heading:first-child { + margin-top: 0; +} + +.aside { + position: fixed; + top: 0; + left: 0; + bottom: 0; + width: 22rem; + background: #ffffff; + border-right: 1px solid rgba(0, 40, 100, 0.12); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + z-index: 100; + visibility: hidden; + box-shadow: 0 0 5px 2px rgba(0, 0, 0, 0.05); +} + +@media (min-width: 1600px) { + body.aside-opened .aside { + visibility: visible; + } +} + +.aside-body { + padding: 1.5rem; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + overflow: auto; +} + +.aside-footer { + padding: 1rem 1.5rem; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.aside-header { + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.header { + padding-top: .75rem; + padding-bottom: .75rem; + background: #fff; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +body.fixed-header .header { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index: 1030; +} + +@media print { + .header { + display: none; + } +} + +.header .dropdown-menu { + margin-top: .75rem; +} + +.nav-unread { + position: absolute; + top: .25rem; + left: .25rem; + background: #cd201f; + width: .5rem; + height: .5rem; + border-radius: 50%; +} + +.header-brand { + color: inherit; + margin-left: 1rem; + font-size: 1.25rem; + white-space: nowrap; + font-weight: 600; + padding: 0; + transition: .3s opacity; + line-height: 2rem; +} + +.header-brand:hover { + opacity: .8; + color: inherit; + text-decoration: none; +} + +.header-brand-img { + height: 2rem; + line-height: 2rem; + vertical-align: bottom; + margin-left: .5rem; + width: auto; +} + +.header-avatar { + width: 2rem; + height: 2rem; + display: inline-block; + vertical-align: bottom; + border-radius: 50%; +} + +.header-btn { + display: inline-block; + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + font-size: 1rem; +} + +.header-btn.has-new { + position: relative; +} + +.header-btn.has-new:before { + content: ''; + width: 6px; + height: 6px; + background: #cd201f; + position: absolute; + top: 4px; + left: 4px; + border-radius: 50%; +} + +.header-toggler { + width: 2rem; + height: 2rem; + position: relative; + color: #9aa0ac; +} + +.header-toggler:hover { + color: #6e7687; +} + +.header-toggler-icon { + position: absolute; + width: 1rem; + height: 2px; + color: inherit; + background: currentColor; + border-radius: 3px; + top: 50%; + right: 50%; + margin: -2px -.5rem 0 0; + box-shadow: 0 5px currentColor, 0 -5px currentColor; +} + +.footer { + background: #fff; + border-top: 1px solid rgba(0, 40, 100, 0.12); + font-size: 0.875rem; + padding: 1.25rem 0; + color: #9aa0ac; +} + +.footer a:not(.btn) { + color: #6e7687; +} + +@media print { + .footer { + display: none; + } +} + +.bg-blue-lightest { + background-color: #edf2fa !important; +} + +a.bg-blue-lightest:hover, a.bg-blue-lightest:focus, +button.bg-blue-lightest:hover, +button.bg-blue-lightest:focus { + background-color: #c5d5ef !important; +} + +.bg-blue-lighter { + background-color: #c8d9f1 !important; +} + +a.bg-blue-lighter:hover, a.bg-blue-lighter:focus, +button.bg-blue-lighter:hover, +button.bg-blue-lighter:focus { + background-color: #9fbde7 !important; +} + +.bg-blue-light { + background-color: #7ea5dd !important; +} + +a.bg-blue-light:hover, a.bg-blue-light:focus, +button.bg-blue-light:hover, +button.bg-blue-light:focus { + background-color: #5689d2 !important; +} + +.bg-blue-dark { + background-color: #3866a6 !important; +} + +a.bg-blue-dark:hover, a.bg-blue-dark:focus, +button.bg-blue-dark:hover, +button.bg-blue-dark:focus { + background-color: #2b4f80 !important; +} + +.bg-blue-darker { + background-color: #1c3353 !important; +} + +a.bg-blue-darker:hover, a.bg-blue-darker:focus, +button.bg-blue-darker:hover, +button.bg-blue-darker:focus { + background-color: #0f1c2d !important; +} + +.bg-blue-darkest { + background-color: #0e1929 !important; +} + +a.bg-blue-darkest:hover, a.bg-blue-darkest:focus, +button.bg-blue-darkest:hover, +button.bg-blue-darkest:focus { + background-color: #010203 !important; +} + +.bg-indigo-lightest { + background-color: #f0f1fa !important; +} + +a.bg-indigo-lightest:hover, a.bg-indigo-lightest:focus, +button.bg-indigo-lightest:hover, +button.bg-indigo-lightest:focus { + background-color: #cacded !important; +} + +.bg-indigo-lighter { + background-color: #d1d5f0 !important; +} + +a.bg-indigo-lighter:hover, a.bg-indigo-lighter:focus, +button.bg-indigo-lighter:hover, +button.bg-indigo-lighter:focus { + background-color: #abb2e3 !important; +} + +.bg-indigo-light { + background-color: #939edc !important; +} + +a.bg-indigo-light:hover, a.bg-indigo-light:focus, +button.bg-indigo-light:hover, +button.bg-indigo-light:focus { + background-color: #6c7bd0 !important; +} + +.bg-indigo-dark { + background-color: #515da4 !important; +} + +a.bg-indigo-dark:hover, a.bg-indigo-dark:focus, +button.bg-indigo-dark:hover, +button.bg-indigo-dark:focus { + background-color: #404a82 !important; +} + +.bg-indigo-darker { + background-color: #282e52 !important; +} + +a.bg-indigo-darker:hover, a.bg-indigo-darker:focus, +button.bg-indigo-darker:hover, +button.bg-indigo-darker:focus { + background-color: #171b30 !important; +} + +.bg-indigo-darkest { + background-color: #141729 !important; +} + +a.bg-indigo-darkest:hover, a.bg-indigo-darkest:focus, +button.bg-indigo-darkest:hover, +button.bg-indigo-darkest:focus { + background-color: #030407 !important; +} + +.bg-purple-lightest { + background-color: #f6effd !important; +} + +a.bg-purple-lightest:hover, a.bg-purple-lightest:focus, +button.bg-purple-lightest:hover, +button.bg-purple-lightest:focus { + background-color: #ddc2f7 !important; +} + +.bg-purple-lighter { + background-color: #e4cff9 !important; +} + +a.bg-purple-lighter:hover, a.bg-purple-lighter:focus, +button.bg-purple-lighter:hover, +button.bg-purple-lighter:focus { + background-color: #cba2f3 !important; +} + +.bg-purple-light { + background-color: #c08ef0 !important; +} + +a.bg-purple-light:hover, a.bg-purple-light:focus, +button.bg-purple-light:hover, +button.bg-purple-light:focus { + background-color: #a761ea !important; +} + +.bg-purple-dark { + background-color: #844bbb !important; +} + +a.bg-purple-dark:hover, a.bg-purple-dark:focus, +button.bg-purple-dark:hover, +button.bg-purple-dark:focus { + background-color: #6a3a99 !important; +} + +.bg-purple-darker { + background-color: #42265e !important; +} + +a.bg-purple-darker:hover, a.bg-purple-darker:focus, +button.bg-purple-darker:hover, +button.bg-purple-darker:focus { + background-color: #29173a !important; +} + +.bg-purple-darkest { + background-color: #21132f !important; +} + +a.bg-purple-darkest:hover, a.bg-purple-darkest:focus, +button.bg-purple-darkest:hover, +button.bg-purple-darkest:focus { + background-color: #08040b !important; +} + +.bg-pink-lightest { + background-color: #fef0f5 !important; +} + +a.bg-pink-lightest:hover, a.bg-pink-lightest:focus, +button.bg-pink-lightest:hover, +button.bg-pink-lightest:focus { + background-color: #fbc0d5 !important; +} + +.bg-pink-lighter { + background-color: #fcd3e1 !important; +} + +a.bg-pink-lighter:hover, a.bg-pink-lighter:focus, +button.bg-pink-lighter:hover, +button.bg-pink-lighter:focus { + background-color: #f9a3c0 !important; +} + +.bg-pink-light { + background-color: #f999b9 !important; +} + +a.bg-pink-light:hover, a.bg-pink-light:focus, +button.bg-pink-light:hover, +button.bg-pink-light:focus { + background-color: #f66998 !important; +} + +.bg-pink-dark { + background-color: #c5577c !important; +} + +a.bg-pink-dark:hover, a.bg-pink-dark:focus, +button.bg-pink-dark:hover, +button.bg-pink-dark:focus { + background-color: #ad3c62 !important; +} + +.bg-pink-darker { + background-color: #622c3e !important; +} + +a.bg-pink-darker:hover, a.bg-pink-darker:focus, +button.bg-pink-darker:hover, +button.bg-pink-darker:focus { + background-color: #3f1c28 !important; +} + +.bg-pink-darkest { + background-color: #31161f !important; +} + +a.bg-pink-darkest:hover, a.bg-pink-darkest:focus, +button.bg-pink-darkest:hover, +button.bg-pink-darkest:focus { + background-color: #0e0609 !important; +} + +.bg-red-lightest { + background-color: #fae9e9 !important; +} + +a.bg-red-lightest:hover, a.bg-red-lightest:focus, +button.bg-red-lightest:hover, +button.bg-red-lightest:focus { + background-color: #f1bfbf !important; +} + +.bg-red-lighter { + background-color: #f0bcbc !important; +} + +a.bg-red-lighter:hover, a.bg-red-lighter:focus, +button.bg-red-lighter:hover, +button.bg-red-lighter:focus { + background-color: #e79292 !important; +} + +.bg-red-light { + background-color: #dc6362 !important; +} + +a.bg-red-light:hover, a.bg-red-light:focus, +button.bg-red-light:hover, +button.bg-red-light:focus { + background-color: #d33a38 !important; +} + +.bg-red-dark { + background-color: #a41a19 !important; +} + +a.bg-red-dark:hover, a.bg-red-dark:focus, +button.bg-red-dark:hover, +button.bg-red-dark:focus { + background-color: #781312 !important; +} + +.bg-red-darker { + background-color: #520d0c !important; +} + +a.bg-red-darker:hover, a.bg-red-darker:focus, +button.bg-red-darker:hover, +button.bg-red-darker:focus { + background-color: #260605 !important; +} + +.bg-red-darkest { + background-color: #290606 !important; +} + +a.bg-red-darkest:hover, a.bg-red-darkest:focus, +button.bg-red-darkest:hover, +button.bg-red-darkest:focus { + background-color: black !important; +} + +.bg-orange-lightest { + background-color: #fff5ec !important; +} + +a.bg-orange-lightest:hover, a.bg-orange-lightest:focus, +button.bg-orange-lightest:hover, +button.bg-orange-lightest:focus { + background-color: peachpuff !important; +} + +.bg-orange-lighter { + background-color: #fee0c7 !important; +} + +a.bg-orange-lighter:hover, a.bg-orange-lighter:focus, +button.bg-orange-lighter:hover, +button.bg-orange-lighter:focus { + background-color: #fdc495 !important; +} + +.bg-orange-light { + background-color: #feb67c !important; +} + +a.bg-orange-light:hover, a.bg-orange-light:focus, +button.bg-orange-light:hover, +button.bg-orange-light:focus { + background-color: #fe9a49 !important; +} + +.bg-orange-dark { + background-color: #ca7836 !important; +} + +a.bg-orange-dark:hover, a.bg-orange-dark:focus, +button.bg-orange-dark:hover, +button.bg-orange-dark:focus { + background-color: #a2602b !important; +} + +.bg-orange-darker { + background-color: #653c1b !important; +} + +a.bg-orange-darker:hover, a.bg-orange-darker:focus, +button.bg-orange-darker:hover, +button.bg-orange-darker:focus { + background-color: #3d2410 !important; +} + +.bg-orange-darkest { + background-color: #331e0e !important; +} + +a.bg-orange-darkest:hover, a.bg-orange-darkest:focus, +button.bg-orange-darkest:hover, +button.bg-orange-darkest:focus { + background-color: #0b0603 !important; +} + +.bg-yellow-lightest { + background-color: #fef9e7 !important; +} + +a.bg-yellow-lightest:hover, a.bg-yellow-lightest:focus, +button.bg-yellow-lightest:hover, +button.bg-yellow-lightest:focus { + background-color: #fcedb6 !important; +} + +.bg-yellow-lighter { + background-color: #fbedb7 !important; +} + +a.bg-yellow-lighter:hover, a.bg-yellow-lighter:focus, +button.bg-yellow-lighter:hover, +button.bg-yellow-lighter:focus { + background-color: #f8e187 !important; +} + +.bg-yellow-light { + background-color: #f5d657 !important; +} + +a.bg-yellow-light:hover, a.bg-yellow-light:focus, +button.bg-yellow-light:hover, +button.bg-yellow-light:focus { + background-color: #f2ca27 !important; +} + +.bg-yellow-dark { + background-color: #c19d0c !important; +} + +a.bg-yellow-dark:hover, a.bg-yellow-dark:focus, +button.bg-yellow-dark:hover, +button.bg-yellow-dark:focus { + background-color: #917609 !important; +} + +.bg-yellow-darker { + background-color: #604e06 !important; +} + +a.bg-yellow-darker:hover, a.bg-yellow-darker:focus, +button.bg-yellow-darker:hover, +button.bg-yellow-darker:focus { + background-color: #302703 !important; +} + +.bg-yellow-darkest { + background-color: #302703 !important; +} + +a.bg-yellow-darkest:hover, a.bg-yellow-darkest:focus, +button.bg-yellow-darkest:hover, +button.bg-yellow-darkest:focus { + background-color: black !important; +} + +.bg-green-lightest { + background-color: #eff8e6 !important; +} + +a.bg-green-lightest:hover, a.bg-green-lightest:focus, +button.bg-green-lightest:hover, +button.bg-green-lightest:focus { + background-color: #d6edbe !important; +} + +.bg-green-lighter { + background-color: #cfeab3 !important; +} + +a.bg-green-lighter:hover, a.bg-green-lighter:focus, +button.bg-green-lighter:hover, +button.bg-green-lighter:focus { + background-color: #b6df8b !important; +} + +.bg-green-light { + background-color: #8ecf4d !important; +} + +a.bg-green-light:hover, a.bg-green-light:focus, +button.bg-green-light:hover, +button.bg-green-light:focus { + background-color: #75b831 !important; +} + +.bg-green-dark { + background-color: #4b9500 !important; +} + +a.bg-green-dark:hover, a.bg-green-dark:focus, +button.bg-green-dark:hover, +button.bg-green-dark:focus { + background-color: #316200 !important; +} + +.bg-green-darker { + background-color: #264a00 !important; +} + +a.bg-green-darker:hover, a.bg-green-darker:focus, +button.bg-green-darker:hover, +button.bg-green-darker:focus { + background-color: #0c1700 !important; +} + +.bg-green-darkest { + background-color: #132500 !important; +} + +a.bg-green-darkest:hover, a.bg-green-darkest:focus, +button.bg-green-darkest:hover, +button.bg-green-darkest:focus { + background-color: black !important; +} + +.bg-teal-lightest { + background-color: #eafaf8 !important; +} + +a.bg-teal-lightest:hover, a.bg-teal-lightest:focus, +button.bg-teal-lightest:hover, +button.bg-teal-lightest:focus { + background-color: #c1f0ea !important; +} + +.bg-teal-lighter { + background-color: #bfefea !important; +} + +a.bg-teal-lighter:hover, a.bg-teal-lighter:focus, +button.bg-teal-lighter:hover, +button.bg-teal-lighter:focus { + background-color: #96e5dd !important; +} + +.bg-teal-light { + background-color: #6bdbcf !important; +} + +a.bg-teal-light:hover, a.bg-teal-light:focus, +button.bg-teal-light:hover, +button.bg-teal-light:focus { + background-color: #42d1c2 !important; +} + +.bg-teal-dark { + background-color: #22a295 !important; +} + +a.bg-teal-dark:hover, a.bg-teal-dark:focus, +button.bg-teal-dark:hover, +button.bg-teal-dark:focus { + background-color: #19786e !important; +} + +.bg-teal-darker { + background-color: #11514a !important; +} + +a.bg-teal-darker:hover, a.bg-teal-darker:focus, +button.bg-teal-darker:hover, +button.bg-teal-darker:focus { + background-color: #082723 !important; +} + +.bg-teal-darkest { + background-color: #092925 !important; +} + +a.bg-teal-darkest:hover, a.bg-teal-darkest:focus, +button.bg-teal-darkest:hover, +button.bg-teal-darkest:focus { + background-color: black !important; +} + +.bg-cyan-lightest { + background-color: #e8f6f8 !important; +} + +a.bg-cyan-lightest:hover, a.bg-cyan-lightest:focus, +button.bg-cyan-lightest:hover, +button.bg-cyan-lightest:focus { + background-color: #c1e7ec !important; +} + +.bg-cyan-lighter { + background-color: #b9e3ea !important; +} + +a.bg-cyan-lighter:hover, a.bg-cyan-lighter:focus, +button.bg-cyan-lighter:hover, +button.bg-cyan-lighter:focus { + background-color: #92d3de !important; +} + +.bg-cyan-light { + background-color: #5dbecd !important; +} + +a.bg-cyan-light:hover, a.bg-cyan-light:focus, +button.bg-cyan-light:hover, +button.bg-cyan-light:focus { + background-color: #3aabbd !important; +} + +.bg-cyan-dark { + background-color: #128293 !important; +} + +a.bg-cyan-dark:hover, a.bg-cyan-dark:focus, +button.bg-cyan-dark:hover, +button.bg-cyan-dark:focus { + background-color: #0c5a66 !important; +} + +.bg-cyan-darker { + background-color: #09414a !important; +} + +a.bg-cyan-darker:hover, a.bg-cyan-darker:focus, +button.bg-cyan-darker:hover, +button.bg-cyan-darker:focus { + background-color: #03191d !important; +} + +.bg-cyan-darkest { + background-color: #052025 !important; +} + +a.bg-cyan-darkest:hover, a.bg-cyan-darkest:focus, +button.bg-cyan-darkest:hover, +button.bg-cyan-darkest:focus { + background-color: black !important; +} + +.bg-white-lightest { + background-color: white !important; +} + +a.bg-white-lightest:hover, a.bg-white-lightest:focus, +button.bg-white-lightest:hover, +button.bg-white-lightest:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-lighter { + background-color: white !important; +} + +a.bg-white-lighter:hover, a.bg-white-lighter:focus, +button.bg-white-lighter:hover, +button.bg-white-lighter:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-light { + background-color: white !important; +} + +a.bg-white-light:hover, a.bg-white-light:focus, +button.bg-white-light:hover, +button.bg-white-light:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-dark { + background-color: #cccccc !important; +} + +a.bg-white-dark:hover, a.bg-white-dark:focus, +button.bg-white-dark:hover, +button.bg-white-dark:focus { + background-color: #b3b2b2 !important; +} + +.bg-white-darker { + background-color: #666666 !important; +} + +a.bg-white-darker:hover, a.bg-white-darker:focus, +button.bg-white-darker:hover, +button.bg-white-darker:focus { + background-color: #4d4c4c !important; +} + +.bg-white-darkest { + background-color: #333333 !important; +} + +a.bg-white-darkest:hover, a.bg-white-darkest:focus, +button.bg-white-darkest:hover, +button.bg-white-darkest:focus { + background-color: #1a1919 !important; +} + +.bg-gray-lightest { + background-color: #f3f4f5 !important; +} + +a.bg-gray-lightest:hover, a.bg-gray-lightest:focus, +button.bg-gray-lightest:hover, +button.bg-gray-lightest:focus { + background-color: #d7dbde !important; +} + +.bg-gray-lighter { + background-color: #dbdde0 !important; +} + +a.bg-gray-lighter:hover, a.bg-gray-lighter:focus, +button.bg-gray-lighter:hover, +button.bg-gray-lighter:focus { + background-color: #c0c3c8 !important; +} + +.bg-gray-light { + background-color: #aab0b6 !important; +} + +a.bg-gray-light:hover, a.bg-gray-light:focus, +button.bg-gray-light:hover, +button.bg-gray-light:focus { + background-color: #8f979e !important; +} + +.bg-gray-dark { + background-color: #6b7278 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #53585d !important; +} + +.bg-gray-darker { + background-color: #36393c !important; +} + +a.bg-gray-darker:hover, a.bg-gray-darker:focus, +button.bg-gray-darker:hover, +button.bg-gray-darker:focus { + background-color: #1e2021 !important; +} + +.bg-gray-darkest { + background-color: #1b1c1e !important; +} + +a.bg-gray-darkest:hover, a.bg-gray-darkest:focus, +button.bg-gray-darkest:hover, +button.bg-gray-darkest:focus { + background-color: #030303 !important; +} + +.bg-gray-dark-lightest { + background-color: #ebebec !important; +} + +a.bg-gray-dark-lightest:hover, a.bg-gray-dark-lightest:focus, +button.bg-gray-dark-lightest:hover, +button.bg-gray-dark-lightest:focus { + background-color: #d1d1d3 !important; +} + +.bg-gray-dark-lighter { + background-color: #c2c4c6 !important; +} + +a.bg-gray-dark-lighter:hover, a.bg-gray-dark-lighter:focus, +button.bg-gray-dark-lighter:hover, +button.bg-gray-dark-lighter:focus { + background-color: #a8abad !important; +} + +.bg-gray-dark-light { + background-color: #717579 !important; +} + +a.bg-gray-dark-light:hover, a.bg-gray-dark-light:focus, +button.bg-gray-dark-light:hover, +button.bg-gray-dark-light:focus { + background-color: #585c5f !important; +} + +.bg-gray-dark-dark { + background-color: #2a2e33 !important; +} + +a.bg-gray-dark-dark:hover, a.bg-gray-dark-dark:focus, +button.bg-gray-dark-dark:hover, +button.bg-gray-dark-dark:focus { + background-color: #131517 !important; +} + +.bg-gray-dark-darker { + background-color: #15171a !important; +} + +a.bg-gray-dark-darker:hover, a.bg-gray-dark-darker:focus, +button.bg-gray-dark-darker:hover, +button.bg-gray-dark-darker:focus { + background-color: black !important; +} + +.bg-gray-dark-darkest { + background-color: #0a0c0d !important; +} + +a.bg-gray-dark-darkest:hover, a.bg-gray-dark-darkest:focus, +button.bg-gray-dark-darkest:hover, +button.bg-gray-dark-darkest:focus { + background-color: black !important; +} + +.bg-azure-lightest { + background-color: #ecf7fe !important; +} + +a.bg-azure-lightest:hover, a.bg-azure-lightest:focus, +button.bg-azure-lightest:hover, +button.bg-azure-lightest:focus { + background-color: #bce3fb !important; +} + +.bg-azure-lighter { + background-color: #c7e6fb !important; +} + +a.bg-azure-lighter:hover, a.bg-azure-lighter:focus, +button.bg-azure-lighter:hover, +button.bg-azure-lighter:focus { + background-color: #97d1f8 !important; +} + +.bg-azure-light { + background-color: #7dc4f6 !important; +} + +a.bg-azure-light:hover, a.bg-azure-light:focus, +button.bg-azure-light:hover, +button.bg-azure-light:focus { + background-color: #4daef3 !important; +} + +.bg-azure-dark { + background-color: #3788c2 !important; +} + +a.bg-azure-dark:hover, a.bg-azure-dark:focus, +button.bg-azure-dark:hover, +button.bg-azure-dark:focus { + background-color: #2c6c9a !important; +} + +.bg-azure-darker { + background-color: #1c4461 !important; +} + +a.bg-azure-darker:hover, a.bg-azure-darker:focus, +button.bg-azure-darker:hover, +button.bg-azure-darker:focus { + background-color: #112839 !important; +} + +.bg-azure-darkest { + background-color: #0e2230 !important; +} + +a.bg-azure-darkest:hover, a.bg-azure-darkest:focus, +button.bg-azure-darkest:hover, +button.bg-azure-darkest:focus { + background-color: #020609 !important; +} + +.bg-lime-lightest { + background-color: #f2fbeb !important; +} + +a.bg-lime-lightest:hover, a.bg-lime-lightest:focus, +button.bg-lime-lightest:hover, +button.bg-lime-lightest:focus { + background-color: #d6f3c1 !important; +} + +.bg-lime-lighter { + background-color: #d7f2c2 !important; +} + +a.bg-lime-lighter:hover, a.bg-lime-lighter:focus, +button.bg-lime-lighter:hover, +button.bg-lime-lighter:focus { + background-color: #bbe998 !important; +} + +.bg-lime-light { + background-color: #a3e072 !important; +} + +a.bg-lime-light:hover, a.bg-lime-light:focus, +button.bg-lime-light:hover, +button.bg-lime-light:focus { + background-color: #88d748 !important; +} + +.bg-lime-dark { + background-color: #62a82a !important; +} + +a.bg-lime-dark:hover, a.bg-lime-dark:focus, +button.bg-lime-dark:hover, +button.bg-lime-dark:focus { + background-color: #4a7f20 !important; +} + +.bg-lime-darker { + background-color: #315415 !important; +} + +a.bg-lime-darker:hover, a.bg-lime-darker:focus, +button.bg-lime-darker:hover, +button.bg-lime-darker:focus { + background-color: #192b0b !important; +} + +.bg-lime-darkest { + background-color: #192a0b !important; +} + +a.bg-lime-darkest:hover, a.bg-lime-darkest:focus, +button.bg-lime-darkest:hover, +button.bg-lime-darkest:focus { + background-color: #010200 !important; +} + +.display-1 i, +.display-2 i, +.display-3 i, +.display-4 i { + vertical-align: baseline; + font-size: 0.815em; +} + +.text-inherit { + color: inherit !important; +} + +.text-default { + color: #495057 !important; +} + +.text-muted-dark { + color: #6e7687 !important; +} + +.tracking-tight { + letter-spacing: -0.05em !important; +} + +.tracking-normal { + letter-spacing: 0 !important; +} + +.tracking-wide { + letter-spacing: 0.05em !important; +} + +.leading-none { + line-height: 1 !important; +} + +.leading-tight { + line-height: 1.25 !important; +} + +.leading-normal { + line-height: 1.5 !important; +} + +.leading-loose { + line-height: 2 !important; +} + +.bg-blue { + background-color: #467fcf !important; +} + +a.bg-blue:hover, a.bg-blue:focus, +button.bg-blue:hover, +button.bg-blue:focus { + background-color: #2f66b3 !important; +} + +.text-blue { + color: #467fcf !important; +} + +.bg-indigo { + background-color: #6574cd !important; +} + +a.bg-indigo:hover, a.bg-indigo:focus, +button.bg-indigo:hover, +button.bg-indigo:focus { + background-color: #3f51c1 !important; +} + +.text-indigo { + color: #6574cd !important; +} + +.bg-purple { + background-color: #a55eea !important; +} + +a.bg-purple:hover, a.bg-purple:focus, +button.bg-purple:hover, +button.bg-purple:focus { + background-color: #8c31e4 !important; +} + +.text-purple { + color: #a55eea !important; +} + +.bg-pink { + background-color: #f66d9b !important; +} + +a.bg-pink:hover, a.bg-pink:focus, +button.bg-pink:hover, +button.bg-pink:focus { + background-color: #f33d7a !important; +} + +.text-pink { + color: #f66d9b !important; +} + +.bg-red { + background-color: #cd201f !important; +} + +a.bg-red:hover, a.bg-red:focus, +button.bg-red:hover, +button.bg-red:focus { + background-color: #a11918 !important; +} + +.text-red { + color: #cd201f !important; +} + +.bg-orange { + background-color: #fd9644 !important; +} + +a.bg-orange:hover, a.bg-orange:focus, +button.bg-orange:hover, +button.bg-orange:focus { + background-color: #fc7a12 !important; +} + +.text-orange { + color: #fd9644 !important; +} + +.bg-yellow { + background-color: #f1c40f !important; +} + +a.bg-yellow:hover, a.bg-yellow:focus, +button.bg-yellow:hover, +button.bg-yellow:focus { + background-color: #c29d0b !important; +} + +.text-yellow { + color: #f1c40f !important; +} + +.bg-green { + background-color: #5eba00 !important; +} + +a.bg-green:hover, a.bg-green:focus, +button.bg-green:hover, +button.bg-green:focus { + background-color: #448700 !important; +} + +.text-green { + color: #5eba00 !important; +} + +.bg-teal { + background-color: #2bcbba !important; +} + +a.bg-teal:hover, a.bg-teal:focus, +button.bg-teal:hover, +button.bg-teal:focus { + background-color: #22a193 !important; +} + +.text-teal { + color: #2bcbba !important; +} + +.bg-cyan { + background-color: #17a2b8 !important; +} + +a.bg-cyan:hover, a.bg-cyan:focus, +button.bg-cyan:hover, +button.bg-cyan:focus { + background-color: #117a8b !important; +} + +.text-cyan { + color: #17a2b8 !important; +} + +.bg-white { + background-color: #fff !important; +} + +a.bg-white:hover, a.bg-white:focus, +button.bg-white:hover, +button.bg-white:focus { + background-color: #e6e5e5 !important; +} + +.text-white { + color: #fff !important; +} + +.bg-gray { + background-color: #868e96 !important; +} + +a.bg-gray:hover, a.bg-gray:focus, +button.bg-gray:hover, +button.bg-gray:focus { + background-color: #6c757d !important; +} + +.text-gray { + color: #868e96 !important; +} + +.bg-gray-dark { + background-color: #343a40 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #1d2124 !important; +} + +.text-gray-dark { + color: #343a40 !important; +} + +.bg-azure { + background-color: #45aaf2 !important; +} + +a.bg-azure:hover, a.bg-azure:focus, +button.bg-azure:hover, +button.bg-azure:focus { + background-color: #1594ef !important; +} + +.text-azure { + color: #45aaf2 !important; +} + +.bg-lime { + background-color: #7bd235 !important; +} + +a.bg-lime:hover, a.bg-lime:focus, +button.bg-lime:hover, +button.bg-lime:focus { + background-color: #63ad27 !important; +} + +.text-lime { + color: #7bd235 !important; +} + +.icon { + color: #9aa0ac !important; +} + +.icon i { + vertical-align: -1px; +} + +a.icon { + text-decoration: none; + cursor: pointer; +} + +a.icon:hover { + color: #495057 !important; +} + +.o-auto { + overflow: auto !important; +} + +.o-hidden { + overflow: hidden !important; +} + +.shadow { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.nav-link, +.nav-item { + padding: 0 .75rem; + min-width: 2rem; + transition: .3s color; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.nav-link .badge, +.nav-item .badge { + position: absolute; + top: 0; + left: 0; + padding: .2rem .25rem; + min-width: 1rem; +} + +.nav-tabs { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + color: #9aa0ac; + margin: 0 -.75rem; +} + +.nav-tabs .nav-link { + border: 0; + color: inherit; + border-bottom: 1px solid transparent; + margin-bottom: -1px; + transition: .3s border-color; + font-weight: 400; + padding: 1rem 0; +} + +.nav-tabs .nav-link:hover:not(.disabled) { + border-color: #6e7687; + color: #6e7687; +} + +.nav-tabs .nav-link.active { + border-color: #467fcf; + color: #467fcf; + background: transparent; +} + +.nav-tabs .nav-link.disabled { + opacity: .4; + cursor: default; + pointer-events: none; +} + +.nav-tabs .nav-item { + margin-bottom: 0; + position: relative; +} + +.nav-tabs .nav-item i { + margin-left: .25rem; + line-height: 1; + font-size: 0.875rem; + width: 0.875rem; + vertical-align: baseline; + display: inline-block; +} + +.nav-tabs .nav-item:hover .nav-submenu { + display: block; +} + +.nav-tabs .nav-submenu { + display: none; + position: absolute; + background: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-top: none; + z-index: 10; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 10rem; + border-radius: 0 0 3px 3px; +} + +.nav-tabs .nav-submenu .nav-item { + display: block; + padding: .5rem 1rem; + color: #9aa0ac; + margin: 0 !important; + cursor: pointer; + transition: .3s background; +} + +.nav-tabs .nav-submenu .nav-item.active { + color: #467fcf; +} + +.nav-tabs .nav-submenu .nav-item:hover { + color: #6e7687; + text-decoration: none; + background: rgba(0, 0, 0, 0.024); +} + +.btn { + cursor: pointer; + font-weight: 600; + letter-spacing: .03em; + font-size: 0.8125rem; + min-width: 2.375rem; +} + +.btn i { + font-size: 1rem; + vertical-align: -2px; +} + +.btn-icon { + padding-right: .5rem; + padding-left: .5rem; + text-align: center; +} + +.btn-secondary { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); + box-shadow: 0 1px 1px 0 rgba(0, 0, 0, 0.05); +} + +.btn-secondary:hover { + color: #495057; + background-color: #f6f6f6; + border-color: rgba(0, 20, 49, 0.12); +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: rgba(0, 15, 36, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-pill { + border-radius: 10rem; + padding-right: 1.5em; + padding-left: 1.5em; +} + +.btn-square { + border-radius: 0; +} + +.btn-facebook { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:hover { + color: #fff; + background-color: #30497c; + border-color: #2d4373; +} + +.btn-facebook:focus, .btn-facebook.focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-facebook.disabled, .btn-facebook:disabled { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:not(:disabled):not(.disabled):active, .btn-facebook:not(:disabled):not(.disabled).active, +.show > .btn-facebook.dropdown-toggle { + color: #fff; + background-color: #2d4373; + border-color: #293e6a; +} + +.btn-facebook:not(:disabled):not(.disabled):active:focus, .btn-facebook:not(:disabled):not(.disabled).active:focus, +.show > .btn-facebook.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-twitter { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:hover { + color: #fff; + background-color: #0d8ddc; + border-color: #0c85d0; +} + +.btn-twitter:focus, .btn-twitter.focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-twitter.disabled, .btn-twitter:disabled { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:not(:disabled):not(.disabled):active, .btn-twitter:not(:disabled):not(.disabled).active, +.show > .btn-twitter.dropdown-toggle { + color: #fff; + background-color: #0c85d0; + border-color: #0b7ec4; +} + +.btn-twitter:not(:disabled):not(.disabled):active:focus, .btn-twitter:not(:disabled):not(.disabled).active:focus, +.show > .btn-twitter.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-google { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:hover { + color: #fff; + background-color: #d03526; + border-color: #c63224; +} + +.btn-google:focus, .btn-google.focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-google.disabled, .btn-google:disabled { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:not(:disabled):not(.disabled):active, .btn-google:not(:disabled):not(.disabled).active, +.show > .btn-google.dropdown-toggle { + color: #fff; + background-color: #c63224; + border-color: #bb2f22; +} + +.btn-google:not(:disabled):not(.disabled):active:focus, .btn-google:not(:disabled):not(.disabled).active:focus, +.show > .btn-google.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-youtube { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:hover { + color: #fff; + background-color: #d90000; + border-color: #cc0000; +} + +.btn-youtube:focus, .btn-youtube.focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-youtube.disabled, .btn-youtube:disabled { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:not(:disabled):not(.disabled):active, .btn-youtube:not(:disabled):not(.disabled).active, +.show > .btn-youtube.dropdown-toggle { + color: #fff; + background-color: #cc0000; + border-color: #bf0000; +} + +.btn-youtube:not(:disabled):not(.disabled):active:focus, .btn-youtube:not(:disabled):not(.disabled).active:focus, +.show > .btn-youtube.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-vimeo { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:hover { + color: #fff; + background-color: #139ecb; + border-color: #1295bf; +} + +.btn-vimeo:focus, .btn-vimeo.focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-vimeo.disabled, .btn-vimeo:disabled { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:not(:disabled):not(.disabled):active, .btn-vimeo:not(:disabled):not(.disabled).active, +.show > .btn-vimeo.dropdown-toggle { + color: #fff; + background-color: #1295bf; + border-color: #108cb4; +} + +.btn-vimeo:not(:disabled):not(.disabled):active:focus, .btn-vimeo:not(:disabled):not(.disabled).active:focus, +.show > .btn-vimeo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-dribbble { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:hover { + color: #fff; + background-color: #e62a72; + border-color: #e51e6b; +} + +.btn-dribbble:focus, .btn-dribbble.focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-dribbble.disabled, .btn-dribbble:disabled { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:not(:disabled):not(.disabled):active, .btn-dribbble:not(:disabled):not(.disabled).active, +.show > .btn-dribbble.dropdown-toggle { + color: #fff; + background-color: #e51e6b; + border-color: #dc1a65; +} + +.btn-dribbble:not(:disabled):not(.disabled):active:focus, .btn-dribbble:not(:disabled):not(.disabled).active:focus, +.show > .btn-dribbble.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-github { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:hover { + color: #fff; + background-color: #040404; + border-color: black; +} + +.btn-github:focus, .btn-github.focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-github.disabled, .btn-github:disabled { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:not(:disabled):not(.disabled):active, .btn-github:not(:disabled):not(.disabled).active, +.show > .btn-github.dropdown-toggle { + color: #fff; + background-color: black; + border-color: black; +} + +.btn-github:not(:disabled):not(.disabled):active:focus, .btn-github:not(:disabled):not(.disabled).active:focus, +.show > .btn-github.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-instagram { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:hover { + color: #fff; + background-color: #de1f44; + border-color: #d31e40; +} + +.btn-instagram:focus, .btn-instagram.focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-instagram.disabled, .btn-instagram:disabled { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:not(:disabled):not(.disabled):active, .btn-instagram:not(:disabled):not(.disabled).active, +.show > .btn-instagram.dropdown-toggle { + color: #fff; + background-color: #d31e40; + border-color: #c81c3d; +} + +.btn-instagram:not(:disabled):not(.disabled):active:focus, .btn-instagram:not(:disabled):not(.disabled).active:focus, +.show > .btn-instagram.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-pinterest { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:hover { + color: #fff; + background-color: #980617; + border-color: #8c0615; +} + +.btn-pinterest:focus, .btn-pinterest.focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-pinterest.disabled, .btn-pinterest:disabled { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:not(:disabled):not(.disabled):active, .btn-pinterest:not(:disabled):not(.disabled).active, +.show > .btn-pinterest.dropdown-toggle { + color: #fff; + background-color: #8c0615; + border-color: #800513; +} + +.btn-pinterest:not(:disabled):not(.disabled):active:focus, .btn-pinterest:not(:disabled):not(.disabled).active:focus, +.show > .btn-pinterest.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-vk { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:hover { + color: #fff; + background-color: #527093; + border-color: #4d6a8b; +} + +.btn-vk:focus, .btn-vk.focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-vk.disabled, .btn-vk:disabled { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:not(:disabled):not(.disabled):active, .btn-vk:not(:disabled):not(.disabled).active, +.show > .btn-vk.dropdown-toggle { + color: #fff; + background-color: #4d6a8b; + border-color: #496482; +} + +.btn-vk:not(:disabled):not(.disabled):active:focus, .btn-vk:not(:disabled):not(.disabled).active:focus, +.show > .btn-vk.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-rss { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:hover { + color: #fff; + background-color: #d98c00; + border-color: #cc8400; +} + +.btn-rss:focus, .btn-rss.focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-rss.disabled, .btn-rss:disabled { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:not(:disabled):not(.disabled):active, .btn-rss:not(:disabled):not(.disabled).active, +.show > .btn-rss.dropdown-toggle { + color: #fff; + background-color: #cc8400; + border-color: #bf7c00; +} + +.btn-rss:not(:disabled):not(.disabled):active:focus, .btn-rss:not(:disabled):not(.disabled).active:focus, +.show > .btn-rss.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-flickr { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:hover { + color: #fff; + background-color: #0052b6; + border-color: #004ca9; +} + +.btn-flickr:focus, .btn-flickr.focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-flickr.disabled, .btn-flickr:disabled { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:not(:disabled):not(.disabled):active, .btn-flickr:not(:disabled):not(.disabled).active, +.show > .btn-flickr.dropdown-toggle { + color: #fff; + background-color: #004ca9; + border-color: #00469c; +} + +.btn-flickr:not(:disabled):not(.disabled):active:focus, .btn-flickr:not(:disabled):not(.disabled).active:focus, +.show > .btn-flickr.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-bitbucket { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:hover { + color: #fff; + background-color: #0043a6; + border-color: #003e99; +} + +.btn-bitbucket:focus, .btn-bitbucket.focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-bitbucket.disabled, .btn-bitbucket:disabled { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active, .btn-bitbucket:not(:disabled):not(.disabled).active, +.show > .btn-bitbucket.dropdown-toggle { + color: #fff; + background-color: #003e99; + border-color: #00388c; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active:focus, .btn-bitbucket:not(:disabled):not(.disabled).active:focus, +.show > .btn-bitbucket.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-blue { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-blue:focus, .btn-blue.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-blue.disabled, .btn-blue:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:not(:disabled):not(.disabled):active, .btn-blue:not(:disabled):not(.disabled).active, +.show > .btn-blue.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-blue:not(:disabled):not(.disabled):active:focus, .btn-blue:not(:disabled):not(.disabled).active:focus, +.show > .btn-blue.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-indigo { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:hover { + color: #fff; + background-color: #485ac4; + border-color: #3f51c1; +} + +.btn-indigo:focus, .btn-indigo.focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-indigo.disabled, .btn-indigo:disabled { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:not(:disabled):not(.disabled):active, .btn-indigo:not(:disabled):not(.disabled).active, +.show > .btn-indigo.dropdown-toggle { + color: #fff; + background-color: #3f51c1; + border-color: #3b4db7; +} + +.btn-indigo:not(:disabled):not(.disabled):active:focus, .btn-indigo:not(:disabled):not(.disabled).active:focus, +.show > .btn-indigo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-purple { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:hover { + color: #fff; + background-color: #923ce6; + border-color: #8c31e4; +} + +.btn-purple:focus, .btn-purple.focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-purple.disabled, .btn-purple:disabled { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:not(:disabled):not(.disabled):active, .btn-purple:not(:disabled):not(.disabled).active, +.show > .btn-purple.dropdown-toggle { + color: #fff; + background-color: #8c31e4; + border-color: #8526e3; +} + +.btn-purple:not(:disabled):not(.disabled):active:focus, .btn-purple:not(:disabled):not(.disabled).active:focus, +.show > .btn-purple.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-pink { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:hover { + color: #fff; + background-color: #f44982; + border-color: #f33d7a; +} + +.btn-pink:focus, .btn-pink.focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-pink.disabled, .btn-pink:disabled { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:not(:disabled):not(.disabled):active, .btn-pink:not(:disabled):not(.disabled).active, +.show > .btn-pink.dropdown-toggle { + color: #fff; + background-color: #f33d7a; + border-color: #f23172; +} + +.btn-pink:not(:disabled):not(.disabled):active:focus, .btn-pink:not(:disabled):not(.disabled).active:focus, +.show > .btn-pink.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-red { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-red:focus, .btn-red.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-red.disabled, .btn-red:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:not(:disabled):not(.disabled):active, .btn-red:not(:disabled):not(.disabled).active, +.show > .btn-red.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-red:not(:disabled):not(.disabled):active:focus, .btn-red:not(:disabled):not(.disabled).active:focus, +.show > .btn-red.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-orange { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:hover { + color: #fff; + background-color: #fd811e; + border-color: #fc7a12; +} + +.btn-orange:focus, .btn-orange.focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-orange.disabled, .btn-orange:disabled { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:not(:disabled):not(.disabled):active, .btn-orange:not(:disabled):not(.disabled).active, +.show > .btn-orange.dropdown-toggle { + color: #fff; + background-color: #fc7a12; + border-color: #fc7305; +} + +.btn-orange:not(:disabled):not(.disabled):active:focus, .btn-orange:not(:disabled):not(.disabled).active:focus, +.show > .btn-orange.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-yellow { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-yellow:focus, .btn-yellow.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-yellow.disabled, .btn-yellow:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:not(:disabled):not(.disabled):active, .btn-yellow:not(:disabled):not(.disabled).active, +.show > .btn-yellow.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-yellow:not(:disabled):not(.disabled):active:focus, .btn-yellow:not(:disabled):not(.disabled).active:focus, +.show > .btn-yellow.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-green { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-green:focus, .btn-green.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-green.disabled, .btn-green:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:not(:disabled):not(.disabled):active, .btn-green:not(:disabled):not(.disabled).active, +.show > .btn-green.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-green:not(:disabled):not(.disabled):active:focus, .btn-green:not(:disabled):not(.disabled).active:focus, +.show > .btn-green.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-teal { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:hover { + color: #fff; + background-color: #24ab9d; + border-color: #22a193; +} + +.btn-teal:focus, .btn-teal.focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-teal.disabled, .btn-teal:disabled { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:not(:disabled):not(.disabled):active, .btn-teal:not(:disabled):not(.disabled).active, +.show > .btn-teal.dropdown-toggle { + color: #fff; + background-color: #22a193; + border-color: #20968a; +} + +.btn-teal:not(:disabled):not(.disabled):active:focus, .btn-teal:not(:disabled):not(.disabled).active:focus, +.show > .btn-teal.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-cyan { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:hover { + color: #fff; + background-color: #138496; + border-color: #117a8b; +} + +.btn-cyan:focus, .btn-cyan.focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-cyan.disabled, .btn-cyan:disabled { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:not(:disabled):not(.disabled):active, .btn-cyan:not(:disabled):not(.disabled).active, +.show > .btn-cyan.dropdown-toggle { + color: #fff; + background-color: #117a8b; + border-color: #10707f; +} + +.btn-cyan:not(:disabled):not(.disabled):active:focus, .btn-cyan:not(:disabled):not(.disabled).active:focus, +.show > .btn-cyan.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-white { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:hover { + color: #495057; + background-color: #ececec; + border-color: #e6e5e5; +} + +.btn-white:focus, .btn-white.focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-white.disabled, .btn-white:disabled { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:not(:disabled):not(.disabled):active, .btn-white:not(:disabled):not(.disabled).active, +.show > .btn-white.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: #dfdfdf; +} + +.btn-white:not(:disabled):not(.disabled):active:focus, .btn-white:not(:disabled):not(.disabled).active:focus, +.show > .btn-white.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-gray { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-gray:focus, .btn-gray.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray.disabled, .btn-gray:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:not(:disabled):not(.disabled):active, .btn-gray:not(:disabled):not(.disabled).active, +.show > .btn-gray.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-gray:not(:disabled):not(.disabled):active:focus, .btn-gray:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-gray-dark:focus, .btn-gray-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-gray-dark.disabled, .btn-gray-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active, .btn-gray-dark:not(:disabled):not(.disabled).active, +.show > .btn-gray-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active:focus, .btn-gray-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-azure { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-azure:focus, .btn-azure.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-azure.disabled, .btn-azure:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:not(:disabled):not(.disabled):active, .btn-azure:not(:disabled):not(.disabled).active, +.show > .btn-azure.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-azure:not(:disabled):not(.disabled):active:focus, .btn-azure:not(:disabled):not(.disabled).active:focus, +.show > .btn-azure.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-lime { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:hover { + color: #fff; + background-color: #69b829; + border-color: #63ad27; +} + +.btn-lime:focus, .btn-lime.focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-lime.disabled, .btn-lime:disabled { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:not(:disabled):not(.disabled):active, .btn-lime:not(:disabled):not(.disabled).active, +.show > .btn-lime.dropdown-toggle { + color: #fff; + background-color: #63ad27; + border-color: #5da324; +} + +.btn-lime:not(:disabled):not(.disabled):active:focus, .btn-lime:not(:disabled):not(.disabled).active:focus, +.show > .btn-lime.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-option { + background: transparent; + color: #9aa0ac; +} + +.btn-option:hover { + color: #6e7687; +} + +.btn-option:focus { + box-shadow: none; + color: #6e7687; +} + +.btn-sm, .btn-group-sm > .btn { + font-size: 0.75rem; + min-width: 1.625rem; +} + +.btn-lg, .btn-group-lg > .btn { + font-size: 1rem; + min-width: 2.75rem; + font-weight: 400; +} + +.btn-list { + margin-bottom: -.5rem; + font-size: 0; +} + +.btn-list > .btn, +.btn-list > .dropdown { + margin-bottom: .5rem; +} + +.btn-list > .btn:not(:last-child), +.btn-list > .dropdown:not(:last-child) { + margin-left: .5rem; +} + +.btn-loading { + color: transparent !important; + pointer-events: none; + position: relative; +} + +.btn-loading:after { + content: ''; + -webkit-animation: loader 500ms infinite linear; + animation: loader 500ms infinite linear; + border: 2px solid #fff; + border-radius: 50%; + border-left-color: transparent !important; + border-top-color: transparent !important; + display: block; + height: 1.4em; + width: 1.4em; + position: absolute; + right: calc(50% - (1.4em / 2)); + top: calc(50% - (1.4em / 2)); + -webkit-transform-origin: center; + transform-origin: center; + position: absolute !important; +} + +.btn-loading.btn-sm:after, .btn-group-sm > .btn-loading.btn:after { + height: 1em; + width: 1em; + right: calc(50% - (1em / 2)); + top: calc(50% - (1em / 2)); +} + +.btn-loading.btn-secondary:after { + border-color: #495057; +} + +.alert { + font-size: 0.9375rem; +} + +.alert-icon { + padding-right: 3rem; +} + +.alert-icon > i { + color: inherit !important; + font-size: 1rem; + position: absolute; + top: 1rem; + right: 1rem; +} + +.alert-avatar { + padding-right: 3.75rem; +} + +.alert-avatar .avatar { + position: absolute; + top: .5rem; + right: .75rem; +} + +.close { + font-size: 1rem; + line-height: 1.5; + transition: .3s color; +} + +.close:before { + content: '\ea00'; + font-family: "feather"; +} + +.badge { + color: #fff; +} + +.badge-default { + background: #e9ecef; + color: #868e96; +} + +.table thead th, .text-wrap table thead th { + border-top: 0; + border-bottom-width: 1px; + padding-top: .5rem; + padding-bottom: .5rem; +} + +.table th, .text-wrap table th { + color: #9aa0ac; + text-transform: uppercase; + font-size: 0.875rem; + font-weight: 400; +} + +.table-md th, +.table-md td { + padding: .5rem; +} + +.table-vcenter td, +.table-vcenter th { + vertical-align: middle; +} + +.table-center td, +.table-center th { + text-align: center; +} + +.table-striped tbody tr:nth-of-type(odd) { + background: transparent; +} + +.table-striped tbody tr:nth-of-type(even) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-calendar { + margin: 0 0 .75rem; +} + +.table-calendar td, +.table-calendar th { + border: 0; + text-align: center; + padding: 0 !important; + width: 14.28571429%; + line-height: 2.5rem; +} + +.table-calendar td { + border-top: 0; +} + +.table-calendar-link { + line-height: 2rem; + min-width: calc(2rem + 2px); + display: inline-block; + border-radius: 3px; + background: #f8f9fa; + color: #495057; + font-weight: 600; + transition: .3s background, .3s color; + position: relative; +} + +.table-calendar-link:before { + content: ''; + width: 4px; + height: 4px; + position: absolute; + right: .25rem; + top: .25rem; + border-radius: 50px; + background: #467fcf; +} + +.table-calendar-link:hover { + color: #fff; + text-decoration: none; + background: #467fcf; + transition: .3s background; +} + +.table-calendar-link:hover:before { + background: #fff; +} + +.table-header { + cursor: pointer; + transition: .3s color; +} + +.table-header:hover { + color: #495057 !important; +} + +.table-header:after { + content: '\f0dc'; + font-family: FontAwesome; + display: inline-block; + margin-right: .5rem; + font-size: .75rem; +} + +.table-header-asc { + color: #495057 !important; +} + +.table-header-asc:after { + content: '\f0de'; +} + +.table-header-desc { + color: #495057 !important; +} + +.table-header-desc:after { + content: '\f0dd'; +} + +.page-breadcrumb { + background: none; + padding: 0; + margin: 1rem 0 0; + font-size: 0.875rem; +} + +@media (min-width: 768px) { + .page-breadcrumb { + margin: -.5rem 0 0; + } +} + +.page-breadcrumb .breadcrumb-item { + color: #9aa0ac; +} + +.page-breadcrumb .breadcrumb-item.active { + color: #6e7687; +} + +.pagination-simple .page-item .page-link { + background: none; + border: none; +} + +.pagination-simple .page-item.active .page-link { + color: #495057; + font-weight: 700; +} + +.pagination-pager .page-prev { + margin-left: auto; +} + +.pagination-pager .page-next { + margin-right: auto; +} + +.page-total-text { + margin-left: 1rem; + -ms-flex-item-align: center; + align-self: center; + color: #6e7687; +} + +.card { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + position: relative; + margin-bottom: 1.5rem; + width: 100%; +} + +.card .card { + box-shadow: none; +} + +@media print { + .card { + box-shadow: none; + border: none; + } +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + margin: 0; + padding: 1.5rem 1.5rem; + position: relative; +} + +.card-body + .card-body { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-body > :last-child { + margin-bottom: 0; +} + +@media print { + .card-body { + padding: 0; + } +} + +.card-body-scrollable { + overflow: auto; +} + +.card-footer, +.card-bottom { + padding: 1rem 1.5rem; + background: none; +} + +.card-footer { + border-top: 1px solid rgba(0, 40, 100, 0.12); + color: #6e7687; +} + +.card-header { + background: none; + padding: 0.5rem 1.5rem; + display: -ms-flexbox; + display: flex; + min-height: 3.5rem; + -ms-flex-align: center; + align-items: center; +} + +.card-header .card-title { + margin-bottom: 0; +} + +.card-header.border-0 + .card-body { + padding-top: 0; +} + +@media print { + .card-header { + display: none; + } +} + +.card-img-top { + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.card-img-overlay { + background-color: rgba(0, 0, 0, 0.4); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-title { + font-size: 1.125rem; + line-height: 1.2; + font-weight: 400; + margin-bottom: 1.5rem; +} + +.card-title a { + color: inherit; +} + +.card-title:only-child { + margin-bottom: 0; +} + +.card-title small, +.card-subtitle { + color: #9aa0ac; + font-size: 0.875rem; + display: block; + margin: -.75rem 0 1rem; + line-height: 1.1; + font-weight: 400; +} + +.card-table { + margin-bottom: 0; +} + +.card-table tr:first-child td, +.card-table tr:first-child th { + border-top: 0; +} + +.card-table tr td:first-child, +.card-table tr th:first-child { + padding-right: 1.5rem; +} + +.card-table tr td:last-child, +.card-table tr th:last-child { + padding-left: 1.5rem; +} + +.card-body + .card-table { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-profile .card-header { + height: 9rem; + background-size: cover; +} + +.card-profile-img { + max-width: 6rem; + margin-top: -5rem; + margin-bottom: 1rem; + border: 3px solid #fff; + border-radius: 100%; + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.1); +} + +.card-link + .card-link { + margin-right: 1rem; +} + +.card-body + .card-list-group { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-list-group .list-group-item { + border-left: 0; + border-right: 0; + border-radius: 0; + padding-right: 1.5rem; + padding-left: 1.5rem; +} + +.card-list-group .list-group-item:last-child { + border-bottom: 0; +} + +.card-list-group .list-group-item:first-child { + border-top: 0; +} + +.card-header-tabs { + margin: -1.25rem 0; + border-bottom: 0; + line-height: 2rem; +} + +.card-header-tabs .nav-item { + margin-bottom: 1px; +} + +.card-header-pills { + margin: -.75rem 0; +} + +.card-aside { + -ms-flex-direction: row; + flex-direction: row; +} + +.card-aside-column { + min-width: 5rem; + width: 30%; + -ms-flex: 0 0 30%; + flex: 0 0 30%; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; + background: no-repeat center/cover; +} + +.card-value { + font-size: 2.5rem; + line-height: 3.4rem; + height: 3.4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + font-weight: 400; +} + +.card-value i { + vertical-align: middle; +} + +.card-chart-bg { + height: 4rem; + margin-top: -1rem; + position: relative; + z-index: 1; + overflow: hidden; +} + +.card-options { + margin-right: auto; + display: -ms-flexbox; + display: flex; + -ms-flex-order: 100; + order: 100; + margin-left: -.5rem; + color: #9aa0ac; + -ms-flex-item-align: center; + align-self: center; +} + +.card-options a:not(.btn) { + margin-right: .5rem; + color: #9aa0ac; + display: inline-block; + min-width: 1rem; +} + +.card-options a:not(.btn):hover { + text-decoration: none; + color: #6e7687; +} + +.card-options a:not(.btn) i { + font-size: 1rem; + vertical-align: middle; +} + +.card-options .dropdown-toggle:after { + display: none; +} + +/* +Card options + */ +.card-collapsed > :not(.card-header):not(.card-status) { + display: none; +} + +.card-collapsed .card-options-collapse i:before { + content: '\e92d'; +} + +.card-fullscreen .card-options-fullscreen i:before { + content: '\e992'; +} + +.card-fullscreen .card-options-remove { + display: none; +} + +/* +Card maps + */ +.card-map { + height: 15rem; + background: #e9ecef; +} + +.card-map-placeholder { + background: no-repeat center; +} + +/** +Card tabs + */ +.card-tabs { + display: -ms-flexbox; + display: flex; +} + +.card-tabs-bottom .card-tabs-item { + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-tabs-bottom .card-tabs-item.active { + border-top-color: #fff; +} + +.card-tabs-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: block; + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); + color: inherit; + overflow: hidden; +} + +a.card-tabs-item { + background: #fafbfc; +} + +a.card-tabs-item:hover { + text-decoration: none; + color: inherit; +} + +a.card-tabs-item:focus { + z-index: 1; +} + +a.card-tabs-item.active { + background: #fff; + border-bottom-color: #fff; +} + +.card-tabs-item + .card-tabs-item { + border-right: 1px solid rgba(0, 40, 100, 0.12); +} + +/** +Card status + */ +.card-status { + position: absolute; + top: -1px; + right: -1px; + left: -1px; + height: 3px; + border-radius: 3px 3px 0 0; + background: rgba(0, 40, 100, 0.12); +} + +.card-status-left { + left: auto; + bottom: 0; + height: auto; + width: 3px; + border-radius: 0 3px 3px 0; +} + +/** +Card icon + */ +.card-icon { + width: 3rem; + font-size: 2.5rem; + line-height: 3rem; + text-align: center; +} + +/** +Card fullscreen + */ +.card-fullscreen { + position: fixed; + top: 0; + right: 0; + left: 0; + bottom: 0; + z-index: 1; + margin: 0; +} + +/** +Card alert + */ +.card-alert { + border-radius: 0; + margin: -1px -1px 0; +} + +.card-category { + font-size: 0.875rem; + text-transform: uppercase; + text-align: center; + font-weight: 600; + letter-spacing: .05em; + margin: 0 0 .5rem; +} + +.popover { + -webkit-filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); + filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); +} + +.popover.bs-popover-top, .popover.bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.625rem; +} + +.popover .arrow { + margin-right: calc(.25rem + 2px); +} + +.dropdown { + display: inline-block; +} + +.dropdown-menu { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 12rem; +} + +.dropdown-item { + color: #6e7687; +} + +.dropdown-menu-arrow:before { + position: absolute; + top: -6px; + right: 12px; + display: inline-block; + border-left: 5px solid transparent; + border-bottom: 5px solid rgba(0, 40, 100, 0.12); + border-right: 5px solid transparent; + border-bottom-color: rgba(0, 0, 0, 0.2); + content: ''; +} + +.dropdown-menu-arrow:after { + position: absolute; + top: -5px; + right: 12px; + display: inline-block; + border-left: 5px solid transparent; + border-bottom: 5px solid #fff; + border-right: 5px solid transparent; + content: ''; +} + +.dropdown-menu-arrow.dropdown-menu-right:before, .dropdown-menu-arrow.dropdown-menu-right:after { + right: auto; + left: 12px; +} + +.dropdown-toggle { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; +} + +.dropdown-toggle:after { + vertical-align: 0.155em; +} + +.dropdown-toggle:empty:after { + margin-right: 0; +} + +.dropdown-icon { + color: #9aa0ac; + margin-left: .5rem; + margin-right: -.5rem; + width: 1em; + display: inline-block; + text-align: center; + vertical-align: -1px; +} + +.list-inline-dots .list-inline-item + .list-inline-item:before { + content: '· '; + margin-right: -2px; + margin-left: 3px; +} + +.list-separated-item { + padding: 1rem 0; +} + +.list-separated-item:first-child { + padding-top: 0; +} + +.list-separated-item:last-child { + padding-bottom: 0; +} + +.list-separated-item + .list-separated-item { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item.active .icon { + color: inherit !important; +} + +.list-group-transparent .list-group-item { + background: none; + border: 0; + padding: .5rem 1rem; + border-radius: 3px; +} + +.list-group-transparent .list-group-item.active { + background: rgba(70, 127, 207, 0.06); + font-weight: 600; +} + +.avatar { + width: 2rem; + height: 2rem; + line-height: 2rem; + border-radius: 50%; + display: inline-block; + background: #ced4da no-repeat center/cover; + position: relative; + text-align: center; + color: #868e96; + font-weight: 600; + vertical-align: bottom; + font-size: .875rem; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.avatar i { + font-size: 125%; + vertical-align: sub; +} + +.avatar-status { + position: absolute; + left: -2px; + bottom: -2px; + width: .75rem; + height: .75rem; + border: 2px solid #fff; + background: #868e96; + border-radius: 50%; +} + +.avatar-sm { + width: 1.5rem; + height: 1.5rem; + line-height: 1.5rem; + font-size: .75rem; +} + +.avatar-md { + width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; + font-size: 1rem; +} + +.avatar-lg { + width: 3rem; + height: 3rem; + line-height: 3rem; + font-size: 1.25rem; +} + +.avatar-xl { + width: 4rem; + height: 4rem; + line-height: 4rem; + font-size: 1.75rem; +} + +.avatar-xxl { + width: 5rem; + height: 5rem; + line-height: 5rem; + font-size: 2rem; +} + +.avatar-placeholder { + background: #ced4da url('data:image/svg+xml;charset=utf8,') no-repeat center/80%; +} + +.avatar-list { + margin: 0 0 -.5rem; + padding: 0; + font-size: 0; +} + +.avatar-list .avatar { + margin-bottom: .5rem; +} + +.avatar-list .avatar:not(:last-child) { + margin-left: .5rem; +} + +.avatar-list-stacked .avatar { + margin-left: -.8em !important; +} + +.avatar-list-stacked .avatar { + box-shadow: 0 0 0 2px #fff; +} + +.avatar-blue { + background-color: #c8d9f1; + color: #467fcf; +} + +.avatar-indigo { + background-color: #d1d5f0; + color: #6574cd; +} + +.avatar-purple { + background-color: #e4cff9; + color: #a55eea; +} + +.avatar-pink { + background-color: #fcd3e1; + color: #f66d9b; +} + +.avatar-red { + background-color: #f0bcbc; + color: #cd201f; +} + +.avatar-orange { + background-color: #fee0c7; + color: #fd9644; +} + +.avatar-yellow { + background-color: #fbedb7; + color: #f1c40f; +} + +.avatar-green { + background-color: #cfeab3; + color: #5eba00; +} + +.avatar-teal { + background-color: #bfefea; + color: #2bcbba; +} + +.avatar-cyan { + background-color: #b9e3ea; + color: #17a2b8; +} + +.avatar-white { + background-color: white; + color: #fff; +} + +.avatar-gray { + background-color: #dbdde0; + color: #868e96; +} + +.avatar-gray-dark { + background-color: #c2c4c6; + color: #343a40; +} + +.avatar-azure { + background-color: #c7e6fb; + color: #45aaf2; +} + +.avatar-lime { + background-color: #d7f2c2; + color: #7bd235; +} + +.product-price { + font-size: 1rem; +} + +.product-price strong { + font-size: 1.5rem; +} + +@-webkit-keyframes indeterminate { + 0% { + right: -35%; + left: 100%; + } + 100%, 60% { + right: 100%; + left: -90%; + } +} + +@keyframes indeterminate { + 0% { + right: -35%; + left: 100%; + } + 100%, 60% { + right: 100%; + left: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + right: -200%; + left: 100%; + } + 100%, 60% { + right: 107%; + left: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + right: -200%; + left: 100%; + } + 100%, 60% { + right: 107%; + left: -8%; + } +} + +.progress { + position: relative; +} + +.progress-xs, +.progress-xs .progress-bar { + height: .25rem; +} + +.progress-sm, +.progress-sm .progress-bar { + height: .5rem; +} + +.progress-bar-indeterminate:after, .progress-bar-indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + right: 0; + will-change: left, right; + top: 0; + bottom: 0; +} + +.progress-bar-indeterminate:before { + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress-bar-indeterminate:after { + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(-360deg); + transform: rotate(-360deg); + } +} + +@keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(-360deg); + transform: rotate(-360deg); + } +} + +/** +Dimmer +*/ +.dimmer { + position: relative; +} + +.dimmer .loader { + display: none; + margin: 0 auto; + position: absolute; + top: 50%; + right: 0; + left: 0; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); +} + +.dimmer.active .loader { + display: block; +} + +.dimmer.active .dimmer-content { + opacity: .04; + pointer-events: none; +} + +/** +Loader +*/ +.loader { + display: block; + position: relative; + height: 2.5rem; + width: 2.5rem; + color: #467fcf; +} + +.loader:before, .loader:after { + width: 2.5rem; + height: 2.5rem; + margin: -1.25rem -1.25rem 0 0; + position: absolute; + content: ''; + top: 50%; + right: 50%; +} + +.loader:before { + border-radius: 50%; + border: 3px solid currentColor; + opacity: .15; +} + +.loader:after { + -webkit-animation: loader .6s linear; + animation: loader .6s linear; + -webkit-animation-iteration-count: infinite; + animation-iteration-count: infinite; + border-radius: 50%; + border: 3px solid; + border-color: transparent; + border-top-color: currentColor; + box-shadow: 0 0 0 1px transparent; +} + +.icons-list { + list-style: none; + margin: 0 0 -1px -1px; + padding: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.icons-list > li { + -ms-flex: 1 0 4rem; + flex: 1 0 4rem; +} + +.icons-list-wrap { + overflow: hidden; +} + +.icons-list-item { + text-align: center; + height: 4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + border-left: 1px solid rgba(0, 40, 100, 0.12); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.icons-list-item i { + font-size: 1.25rem; +} + +.img-gallery { + margin-left: -.25rem; + margin-right: -.25rem; + margin-bottom: -.5rem; +} + +.img-gallery > .col, +.img-gallery > [class*="col-"] { + padding-right: .25rem; + padding-left: .25rem; + padding-bottom: .5rem; +} + +.link-overlay { + position: relative; +} + +.link-overlay:hover .link-overlay-bg { + opacity: 1; +} + +.link-overlay-bg { + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; + background: rgba(70, 127, 207, 0.8); + display: -ms-flexbox; + display: flex; + color: #fff; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + font-size: 1.25rem; + opacity: 0; + transition: .3s opacity; +} + +.media-icon { + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + border-radius: 100%; +} + +.media-list { + margin: 0; + padding: 0; + list-style: none; +} + +textarea[cols] { + height: auto; +} + +.form-group { + display: block; +} + +.form-label { + display: block; + margin-bottom: .375rem; + font-weight: 600; + font-size: 0.875rem; +} + +.form-label-small { + float: left; + font-weight: 400; + font-size: 87.5%; +} + +.form-footer { + margin-top: 2rem; +} + +.custom-control { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.custom-controls-stacked .custom-control { + margin-bottom: .25rem; +} + +.custom-control-label { + vertical-align: middle; +} + +.custom-control-label:before { + border: 1px solid rgba(0, 40, 100, 0.12); + background-color: #fff; + background-size: .5rem; +} + +.custom-control-description { + line-height: 1.5rem; +} + +.input-group-prepend, +.input-group-append, +.input-group-btn { + font-size: 0.9375rem; +} + +.input-group-prepend > .btn, +.input-group-append > .btn, +.input-group-btn > .btn { + height: 100%; + border-color: rgba(0, 40, 100, 0.12); +} + +.input-group-prepend > .input-group-text { + border-left: 0; +} + +.input-group-append > .input-group-text { + border-right: 0; +} + +/** +Icon input + */ +.input-icon { + position: relative; +} + +.input-icon .form-control:not(:last-child) { + padding-left: 2.5rem; +} + +.input-icon .form-control:not(:first-child) { + padding-right: 2.5rem; +} + +.input-icon-addon { + position: absolute; + top: 0; + bottom: 0; + right: 0; + color: #9aa0ac; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + min-width: 2.5rem; + pointer-events: none; +} + +.input-icon-addon:last-child { + right: auto; + left: 0; +} + +.form-fieldset { + background: #f8f9fa; + border: 1px solid #e9ecef; + padding: 1rem; + border-radius: 3px; + margin-bottom: 1rem; +} + +.form-required { + color: #cd201f; +} + +.form-required:before { + content: ' '; +} + +.state-valid { + padding-left: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.state-invalid { + padding-left: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.form-help { + display: inline-block; + width: 1rem; + height: 1rem; + text-align: center; + line-height: 1rem; + color: #9aa0ac; + background: #f8f9fa; + border-radius: 50%; + font-size: 0.75rem; + transition: .3s background-color, .3s color; + text-decoration: none; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.form-help:hover, .form-help[aria-describedby] { + background: #467fcf; + color: #fff; +} + +.sparkline { + display: inline-block; + height: 2rem; +} + +.jqstooltip { + box-sizing: content-box; + font-family: inherit !important; + background: #333 !important; + border: none !important; + border-radius: 3px; + font-size: 11px !important; + font-weight: 700 !important; + line-height: 1 !important; + padding: 6px !important; +} + +.jqstooltip .jqsfield { + font: inherit !important; +} + +.social-links li a { + background: #f8f8f8; + border-radius: 50%; + color: #9aa0ac; + display: inline-block; + height: 1.75rem; + width: 1.75rem; + line-height: 1.75rem; + text-align: center; +} + +.map, +.chart { + position: relative; + padding-top: 56.25%; +} + +.map-square, +.chart-square { + padding-top: 100%; +} + +.map-content, +.chart-content { + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; +} + +.map-header { + margin-top: -1.5rem; + margin-bottom: 1.5rem; + height: 15rem; + position: relative; + margin-bottom: -1.5rem; +} + +.map-header:before { + content: ''; + position: absolute; + bottom: 0; + right: 0; + left: 0; + height: 10rem; + background: linear-gradient(to bottom, rgba(245, 247, 251, 0) 5%, #f5f7fb 95%); + pointer-events: none; +} + +.map-header-layer { + height: 100%; +} + +.map-static { + height: 120px; + width: 100%; + max-width: 640px; + background-position: center center; + background-size: 640px 120px; +} + +@-webkit-keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +@keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +.status-icon { + content: ''; + width: 0.5rem; + height: 0.5rem; + display: inline-block; + background: currentColor; + border-radius: 50%; + -webkit-transform: translateY(-1px); + transform: translateY(-1px); + margin-left: .375rem; + vertical-align: middle; +} + +.status-animated { + -webkit-animation: 1s status-pulse infinite ease; + animation: 1s status-pulse infinite ease; +} + +.chart-circle { + display: block; + height: 8rem; + width: 8rem; + position: relative; +} + +.chart-circle canvas { + margin: 0 auto; + display: block; + max-width: 100%; + max-height: 100%; +} + +.chart-circle-xs { + height: 2.5rem; + width: 2.5rem; + font-size: .8rem; +} + +.chart-circle-sm { + height: 4rem; + width: 4rem; + font-size: .8rem; +} + +.chart-circle-lg { + height: 10rem; + width: 10rem; + font-size: .8rem; +} + +.chart-circle-value { + position: absolute; + top: 0; + right: 0; + left: 0; + margin-right: auto; + margin-left: auto; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + -ms-flex-align: center; + align-items: center; + -ms-flex-direction: column; + flex-direction: column; + line-height: 1; +} + +.chart-circle-value small { + display: block; + color: #9aa0ac; + font-size: 0.9375rem; +} + +.chips { + margin: 0 0 -.5rem; +} + +.chips .chip { + margin: 0 0 .5rem .5rem; +} + +.chip { + display: inline-block; + height: 2rem; + line-height: 2rem; + font-size: 0.875rem; + font-weight: 500; + color: #6e7687; + padding: 0 .75rem; + border-radius: 1rem; + background-color: #f8f9fa; + transition: .3s background; +} + +.chip .avatar { + float: right; + margin: 0 -.75rem 0 .5rem; + height: 2rem; + width: 2rem; + border-radius: 50%; +} + +a.chip:hover { + color: inherit; + text-decoration: none; + background-color: #e9ecef; +} + +.stamp { + color: #fff; + background: #868e96; + display: inline-block; + min-width: 2rem; + height: 2rem; + padding: 0 .25rem; + line-height: 2rem; + text-align: center; + border-radius: 3px; + font-weight: 600; +} + +.stamp-md { + min-width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; +} + +.chat { + outline: 0; + margin: 0; + padding: 0; + list-style-type: none; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: end; + justify-content: flex-end; + min-height: 100%; +} + +.chat-line { + padding: 0; + text-align: left; + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: row-reverse; + flex-direction: row-reverse; +} + +.chat-line + .chat-line { + padding-top: 1rem; +} + +.chat-message { + position: relative; + display: inline-block; + background-color: #467fcf; + color: #fff; + font-size: 0.875rem; + padding: .375rem .5rem; + border-radius: 3px; + white-space: normal; + text-align: right; + margin: 0 2.5rem 0 .5rem; + line-height: 1.4; +} + +.chat-message > :last-child { + margin-bottom: 0 !important; +} + +.chat-message:after { + content: ""; + position: absolute; + left: -5px; + top: 7px; + border-bottom: 6px solid transparent; + border-right: 6px solid #467fcf; + border-top: 6px solid transparent; +} + +.chat-message img { + max-width: 100%; +} + +.chat-message p { + margin-bottom: 1em; +} + +.chat-line-friend { + -ms-flex-direction: row; + flex-direction: row; +} + +.chat-line-friend + .chat-line-friend { + margin-top: -.5rem; +} + +.chat-line-friend + .chat-line-friend .chat-author { + visibility: hidden; +} + +.chat-line-friend + .chat-line-friend .chat-message:after { + display: none; +} + +.chat-line-friend .chat-message { + background-color: #f3f3f3; + color: #495057; + margin-right: .5rem; + margin-left: 2.5rem; +} + +.chat-line-friend .chat-message:after { + left: auto; + right: -5px; + border-right-width: 0; + border-left: 5px solid #f3f3f3; +} + +.example { + padding: 1.5rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px 3px 0 0; + font-size: 0.9375rem; +} + +.example-bg { + background: #f5f7fb; +} + +.example + .highlight { + border-top: none; + margin-top: 0; + border-radius: 0 0 3px 3px; +} + +.highlight { + margin: 1rem 0 2rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-size: 0.9375rem; + max-height: 40rem; + overflow: auto; + background: #fcfcfc; +} + +.highlight pre { + margin-bottom: 0; + background-color: transparent; +} + +.example-column { + margin: 0 auto; +} + +.example-column > .card:last-of-type { + margin-bottom: 0; +} + +.example-column-1 { + max-width: 20rem; +} + +.example-column-2 { + max-width: 40rem; +} + +.tag { + font-size: 0.75rem; + color: #6e7687; + background-color: #e9ecef; + border-radius: 3px; + padding: 0 .5rem; + line-height: 2em; + display: -ms-inline-flexbox; + display: inline-flex; + cursor: default; + font-weight: 400; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +a.tag { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag:hover { + background-color: rgba(110, 118, 135, 0.2); + color: inherit; +} + +.tag-addon { + display: inline-block; + padding: 0 .5rem; + color: inherit; + text-decoration: none; + background: rgba(0, 0, 0, 0.06); + margin: 0 .5rem 0 -.5rem; + text-align: center; + min-width: 1.5rem; +} + +.tag-addon:last-child { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.tag-addon i { + vertical-align: middle; + margin: 0 -.25rem; +} + +a.tag-addon { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag-addon:hover { + background: rgba(0, 0, 0, 0.16); + color: inherit; +} + +.tag-avatar { + width: 1.5rem; + height: 1.5rem; + border-radius: 0 3px 3px 0; + margin: 0 -.5rem 0 .5rem; +} + +.tag-blue { + background-color: #467fcf; + color: #fff; +} + +.tag-indigo { + background-color: #6574cd; + color: #fff; +} + +.tag-purple { + background-color: #a55eea; + color: #fff; +} + +.tag-pink { + background-color: #f66d9b; + color: #fff; +} + +.tag-red { + background-color: #cd201f; + color: #fff; +} + +.tag-orange { + background-color: #fd9644; + color: #fff; +} + +.tag-yellow { + background-color: #f1c40f; + color: #fff; +} + +.tag-green { + background-color: #5eba00; + color: #fff; +} + +.tag-teal { + background-color: #2bcbba; + color: #fff; +} + +.tag-cyan { + background-color: #17a2b8; + color: #fff; +} + +.tag-white { + background-color: #fff; + color: #fff; +} + +.tag-gray { + background-color: #868e96; + color: #fff; +} + +.tag-gray-dark { + background-color: #343a40; + color: #fff; +} + +.tag-azure { + background-color: #45aaf2; + color: #fff; +} + +.tag-lime { + background-color: #7bd235; + color: #fff; +} + +.tag-primary { + background-color: #467fcf; + color: #fff; +} + +.tag-secondary { + background-color: #868e96; + color: #fff; +} + +.tag-success { + background-color: #5eba00; + color: #fff; +} + +.tag-info { + background-color: #45aaf2; + color: #fff; +} + +.tag-warning { + background-color: #f1c40f; + color: #fff; +} + +.tag-danger { + background-color: #cd201f; + color: #fff; +} + +.tag-light { + background-color: #f8f9fa; + color: #fff; +} + +.tag-dark { + background-color: #343a40; + color: #fff; +} + +.tag-rounded { + border-radius: 50px; +} + +.tag-rounded .tag-avatar { + border-radius: 50px; +} + +.tags { + margin-bottom: -.5rem; + font-size: 0; +} + +.tags > .tag { + margin-bottom: .5rem; +} + +.tags > .tag:not(:last-child) { + margin-left: .5rem; +} + +.highlight .hll { + background-color: #ffc; +} + +.highlight .c { + color: #999; +} + +.highlight .k { + color: #069; +} + +.highlight .o { + color: #555; +} + +.highlight .cm { + color: #999; +} + +.highlight .cp { + color: #099; +} + +.highlight .c1 { + color: #999; +} + +.highlight .cs { + color: #999; +} + +.highlight .gd { + background-color: #fcc; + border: 1px solid #c00; +} + +.highlight .ge { + font-style: italic; +} + +.highlight .gr { + color: #f00; +} + +.highlight .gh { + color: #030; +} + +.highlight .gi { + background-color: #cfc; + border: 1px solid #0c0; +} + +.highlight .go { + color: #aaa; +} + +.highlight .gp { + color: #009; +} + +.highlight .gu { + color: #030; +} + +.highlight .gt { + color: #9c6; +} + +.highlight .kc { + color: #069; +} + +.highlight .kd { + color: #069; +} + +.highlight .kn { + color: #069; +} + +.highlight .kp { + color: #069; +} + +.highlight .kr { + color: #069; +} + +.highlight .kt { + color: #078; +} + +.highlight .m { + color: #f60; +} + +.highlight .s { + color: #d44950; +} + +.highlight .na { + color: #4f9fcf; +} + +.highlight .nb { + color: #366; +} + +.highlight .nc { + color: #0a8; +} + +.highlight .no { + color: #360; +} + +.highlight .nd { + color: #99f; +} + +.highlight .ni { + color: #999; +} + +.highlight .ne { + color: #c00; +} + +.highlight .nf { + color: #c0f; +} + +.highlight .nl { + color: #99f; +} + +.highlight .nn { + color: #0cf; +} + +.highlight .nt { + color: #2f6f9f; +} + +.highlight .nv { + color: #033; +} + +.highlight .ow { + color: #000; +} + +.highlight .w { + color: #bbb; +} + +.highlight .mf { + color: #f60; +} + +.highlight .mh { + color: #f60; +} + +.highlight .mi { + color: #f60; +} + +.highlight .mo { + color: #f60; +} + +.highlight .sb { + color: #c30; +} + +.highlight .sc { + color: #c30; +} + +.highlight .sd { + font-style: italic; + color: #c30; +} + +.highlight .s2 { + color: #c30; +} + +.highlight .se { + color: #c30; +} + +.highlight .sh { + color: #c30; +} + +.highlight .si { + color: #a00; +} + +.highlight .sx { + color: #c30; +} + +.highlight .sr { + color: #3aa; +} + +.highlight .s1 { + color: #c30; +} + +.highlight .ss { + color: #fc3; +} + +.highlight .bp { + color: #366; +} + +.highlight .vc { + color: #033; +} + +.highlight .vg { + color: #033; +} + +.highlight .vi { + color: #033; +} + +.highlight .il { + color: #f60; +} + +.highlight .css .o, +.highlight .css .o + .nt, +.highlight .css .nt + .nt { + color: #999; +} + +.highlight .language-bash::before, +.highlight .language-sh::before { + color: #009; + content: "$ "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.highlight .language-powershell::before { + color: #009; + content: "PM> "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.carousel-item-background { + content: ''; + background: rgba(0, 0, 0, 0.5); + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; +} + +.custom-range { + -ms-flex-align: center; + align-items: center; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + height: 100%; + min-height: 2.375rem; + overflow: hidden; + padding: 0; + border: 0; +} + +.custom-range:focus { + box-shadow: none; + outline: none; +} + +.custom-range:focus::-webkit-slider-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-moz-range-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-ms-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-runnable-track { + background: #467fcf; + content: ''; + height: 2px; + pointer-events: none; +} + +.custom-range::-webkit-slider-thumb { + width: 14px; + height: 14px; + -webkit-appearance: none; + appearance: none; + background: #fff; + border-radius: 50px; + box-shadow: -1px 0 0 -6px rgba(0, 50, 126, 0.12), -6px 0 0 -6px rgba(0, 50, 126, 0.12), -7px 0 0 -6px rgba(0, 50, 126, 0.12), -8px 0 0 -6px rgba(0, 50, 126, 0.12), -9px 0 0 -6px rgba(0, 50, 126, 0.12), -10px 0 0 -6px rgba(0, 50, 126, 0.12), -11px 0 0 -6px rgba(0, 50, 126, 0.12), -12px 0 0 -6px rgba(0, 50, 126, 0.12), -13px 0 0 -6px rgba(0, 50, 126, 0.12), -14px 0 0 -6px rgba(0, 50, 126, 0.12), -15px 0 0 -6px rgba(0, 50, 126, 0.12), -16px 0 0 -6px rgba(0, 50, 126, 0.12), -17px 0 0 -6px rgba(0, 50, 126, 0.12), -18px 0 0 -6px rgba(0, 50, 126, 0.12), -19px 0 0 -6px rgba(0, 50, 126, 0.12), -20px 0 0 -6px rgba(0, 50, 126, 0.12), -21px 0 0 -6px rgba(0, 50, 126, 0.12), -22px 0 0 -6px rgba(0, 50, 126, 0.12), -23px 0 0 -6px rgba(0, 50, 126, 0.12), -24px 0 0 -6px rgba(0, 50, 126, 0.12), -25px 0 0 -6px rgba(0, 50, 126, 0.12), -26px 0 0 -6px rgba(0, 50, 126, 0.12), -27px 0 0 -6px rgba(0, 50, 126, 0.12), -28px 0 0 -6px rgba(0, 50, 126, 0.12), -29px 0 0 -6px rgba(0, 50, 126, 0.12), -30px 0 0 -6px rgba(0, 50, 126, 0.12), -31px 0 0 -6px rgba(0, 50, 126, 0.12), -32px 0 0 -6px rgba(0, 50, 126, 0.12), -33px 0 0 -6px rgba(0, 50, 126, 0.12), -34px 0 0 -6px rgba(0, 50, 126, 0.12), -35px 0 0 -6px rgba(0, 50, 126, 0.12), -36px 0 0 -6px rgba(0, 50, 126, 0.12), -37px 0 0 -6px rgba(0, 50, 126, 0.12), -38px 0 0 -6px rgba(0, 50, 126, 0.12), -39px 0 0 -6px rgba(0, 50, 126, 0.12), -40px 0 0 -6px rgba(0, 50, 126, 0.12), -41px 0 0 -6px rgba(0, 50, 126, 0.12), -42px 0 0 -6px rgba(0, 50, 126, 0.12), -43px 0 0 -6px rgba(0, 50, 126, 0.12), -44px 0 0 -6px rgba(0, 50, 126, 0.12), -45px 0 0 -6px rgba(0, 50, 126, 0.12), -46px 0 0 -6px rgba(0, 50, 126, 0.12), -47px 0 0 -6px rgba(0, 50, 126, 0.12), -48px 0 0 -6px rgba(0, 50, 126, 0.12), -49px 0 0 -6px rgba(0, 50, 126, 0.12), -50px 0 0 -6px rgba(0, 50, 126, 0.12), -51px 0 0 -6px rgba(0, 50, 126, 0.12), -52px 0 0 -6px rgba(0, 50, 126, 0.12), -53px 0 0 -6px rgba(0, 50, 126, 0.12), -54px 0 0 -6px rgba(0, 50, 126, 0.12), -55px 0 0 -6px rgba(0, 50, 126, 0.12), -56px 0 0 -6px rgba(0, 50, 126, 0.12), -57px 0 0 -6px rgba(0, 50, 126, 0.12), -58px 0 0 -6px rgba(0, 50, 126, 0.12), -59px 0 0 -6px rgba(0, 50, 126, 0.12), -60px 0 0 -6px rgba(0, 50, 126, 0.12), -61px 0 0 -6px rgba(0, 50, 126, 0.12), -62px 0 0 -6px rgba(0, 50, 126, 0.12), -63px 0 0 -6px rgba(0, 50, 126, 0.12), -64px 0 0 -6px rgba(0, 50, 126, 0.12), -65px 0 0 -6px rgba(0, 50, 126, 0.12), -66px 0 0 -6px rgba(0, 50, 126, 0.12), -67px 0 0 -6px rgba(0, 50, 126, 0.12), -68px 0 0 -6px rgba(0, 50, 126, 0.12), -69px 0 0 -6px rgba(0, 50, 126, 0.12), -70px 0 0 -6px rgba(0, 50, 126, 0.12), -71px 0 0 -6px rgba(0, 50, 126, 0.12), -72px 0 0 -6px rgba(0, 50, 126, 0.12), -73px 0 0 -6px rgba(0, 50, 126, 0.12), -74px 0 0 -6px rgba(0, 50, 126, 0.12), -75px 0 0 -6px rgba(0, 50, 126, 0.12), -76px 0 0 -6px rgba(0, 50, 126, 0.12), -77px 0 0 -6px rgba(0, 50, 126, 0.12), -78px 0 0 -6px rgba(0, 50, 126, 0.12), -79px 0 0 -6px rgba(0, 50, 126, 0.12), -80px 0 0 -6px rgba(0, 50, 126, 0.12), -81px 0 0 -6px rgba(0, 50, 126, 0.12), -82px 0 0 -6px rgba(0, 50, 126, 0.12), -83px 0 0 -6px rgba(0, 50, 126, 0.12), -84px 0 0 -6px rgba(0, 50, 126, 0.12), -85px 0 0 -6px rgba(0, 50, 126, 0.12), -86px 0 0 -6px rgba(0, 50, 126, 0.12), -87px 0 0 -6px rgba(0, 50, 126, 0.12), -88px 0 0 -6px rgba(0, 50, 126, 0.12), -89px 0 0 -6px rgba(0, 50, 126, 0.12), -90px 0 0 -6px rgba(0, 50, 126, 0.12), -91px 0 0 -6px rgba(0, 50, 126, 0.12), -92px 0 0 -6px rgba(0, 50, 126, 0.12), -93px 0 0 -6px rgba(0, 50, 126, 0.12), -94px 0 0 -6px rgba(0, 50, 126, 0.12), -95px 0 0 -6px rgba(0, 50, 126, 0.12), -96px 0 0 -6px rgba(0, 50, 126, 0.12), -97px 0 0 -6px rgba(0, 50, 126, 0.12), -98px 0 0 -6px rgba(0, 50, 126, 0.12), -99px 0 0 -6px rgba(0, 50, 126, 0.12), -100px 0 0 -6px rgba(0, 50, 126, 0.12), -101px 0 0 -6px rgba(0, 50, 126, 0.12), -102px 0 0 -6px rgba(0, 50, 126, 0.12), -103px 0 0 -6px rgba(0, 50, 126, 0.12), -104px 0 0 -6px rgba(0, 50, 126, 0.12), -105px 0 0 -6px rgba(0, 50, 126, 0.12), -106px 0 0 -6px rgba(0, 50, 126, 0.12), -107px 0 0 -6px rgba(0, 50, 126, 0.12), -108px 0 0 -6px rgba(0, 50, 126, 0.12), -109px 0 0 -6px rgba(0, 50, 126, 0.12), -110px 0 0 -6px rgba(0, 50, 126, 0.12), -111px 0 0 -6px rgba(0, 50, 126, 0.12), -112px 0 0 -6px rgba(0, 50, 126, 0.12), -113px 0 0 -6px rgba(0, 50, 126, 0.12), -114px 0 0 -6px rgba(0, 50, 126, 0.12), -115px 0 0 -6px rgba(0, 50, 126, 0.12), -116px 0 0 -6px rgba(0, 50, 126, 0.12), -117px 0 0 -6px rgba(0, 50, 126, 0.12), -118px 0 0 -6px rgba(0, 50, 126, 0.12), -119px 0 0 -6px rgba(0, 50, 126, 0.12), -120px 0 0 -6px rgba(0, 50, 126, 0.12), -121px 0 0 -6px rgba(0, 50, 126, 0.12), -122px 0 0 -6px rgba(0, 50, 126, 0.12), -123px 0 0 -6px rgba(0, 50, 126, 0.12), -124px 0 0 -6px rgba(0, 50, 126, 0.12), -125px 0 0 -6px rgba(0, 50, 126, 0.12), -126px 0 0 -6px rgba(0, 50, 126, 0.12), -127px 0 0 -6px rgba(0, 50, 126, 0.12), -128px 0 0 -6px rgba(0, 50, 126, 0.12), -129px 0 0 -6px rgba(0, 50, 126, 0.12), -130px 0 0 -6px rgba(0, 50, 126, 0.12), -131px 0 0 -6px rgba(0, 50, 126, 0.12), -132px 0 0 -6px rgba(0, 50, 126, 0.12), -133px 0 0 -6px rgba(0, 50, 126, 0.12), -134px 0 0 -6px rgba(0, 50, 126, 0.12), -135px 0 0 -6px rgba(0, 50, 126, 0.12), -136px 0 0 -6px rgba(0, 50, 126, 0.12), -137px 0 0 -6px rgba(0, 50, 126, 0.12), -138px 0 0 -6px rgba(0, 50, 126, 0.12), -139px 0 0 -6px rgba(0, 50, 126, 0.12), -140px 0 0 -6px rgba(0, 50, 126, 0.12), -141px 0 0 -6px rgba(0, 50, 126, 0.12), -142px 0 0 -6px rgba(0, 50, 126, 0.12), -143px 0 0 -6px rgba(0, 50, 126, 0.12), -144px 0 0 -6px rgba(0, 50, 126, 0.12), -145px 0 0 -6px rgba(0, 50, 126, 0.12), -146px 0 0 -6px rgba(0, 50, 126, 0.12), -147px 0 0 -6px rgba(0, 50, 126, 0.12), -148px 0 0 -6px rgba(0, 50, 126, 0.12), -149px 0 0 -6px rgba(0, 50, 126, 0.12), -150px 0 0 -6px rgba(0, 50, 126, 0.12), -151px 0 0 -6px rgba(0, 50, 126, 0.12), -152px 0 0 -6px rgba(0, 50, 126, 0.12), -153px 0 0 -6px rgba(0, 50, 126, 0.12), -154px 0 0 -6px rgba(0, 50, 126, 0.12), -155px 0 0 -6px rgba(0, 50, 126, 0.12), -156px 0 0 -6px rgba(0, 50, 126, 0.12), -157px 0 0 -6px rgba(0, 50, 126, 0.12), -158px 0 0 -6px rgba(0, 50, 126, 0.12), -159px 0 0 -6px rgba(0, 50, 126, 0.12), -160px 0 0 -6px rgba(0, 50, 126, 0.12), -161px 0 0 -6px rgba(0, 50, 126, 0.12), -162px 0 0 -6px rgba(0, 50, 126, 0.12), -163px 0 0 -6px rgba(0, 50, 126, 0.12), -164px 0 0 -6px rgba(0, 50, 126, 0.12), -165px 0 0 -6px rgba(0, 50, 126, 0.12), -166px 0 0 -6px rgba(0, 50, 126, 0.12), -167px 0 0 -6px rgba(0, 50, 126, 0.12), -168px 0 0 -6px rgba(0, 50, 126, 0.12), -169px 0 0 -6px rgba(0, 50, 126, 0.12), -170px 0 0 -6px rgba(0, 50, 126, 0.12), -171px 0 0 -6px rgba(0, 50, 126, 0.12), -172px 0 0 -6px rgba(0, 50, 126, 0.12), -173px 0 0 -6px rgba(0, 50, 126, 0.12), -174px 0 0 -6px rgba(0, 50, 126, 0.12), -175px 0 0 -6px rgba(0, 50, 126, 0.12), -176px 0 0 -6px rgba(0, 50, 126, 0.12), -177px 0 0 -6px rgba(0, 50, 126, 0.12), -178px 0 0 -6px rgba(0, 50, 126, 0.12), -179px 0 0 -6px rgba(0, 50, 126, 0.12), -180px 0 0 -6px rgba(0, 50, 126, 0.12), -181px 0 0 -6px rgba(0, 50, 126, 0.12), -182px 0 0 -6px rgba(0, 50, 126, 0.12), -183px 0 0 -6px rgba(0, 50, 126, 0.12), -184px 0 0 -6px rgba(0, 50, 126, 0.12), -185px 0 0 -6px rgba(0, 50, 126, 0.12), -186px 0 0 -6px rgba(0, 50, 126, 0.12), -187px 0 0 -6px rgba(0, 50, 126, 0.12), -188px 0 0 -6px rgba(0, 50, 126, 0.12), -189px 0 0 -6px rgba(0, 50, 126, 0.12), -190px 0 0 -6px rgba(0, 50, 126, 0.12), -191px 0 0 -6px rgba(0, 50, 126, 0.12), -192px 0 0 -6px rgba(0, 50, 126, 0.12), -193px 0 0 -6px rgba(0, 50, 126, 0.12), -194px 0 0 -6px rgba(0, 50, 126, 0.12), -195px 0 0 -6px rgba(0, 50, 126, 0.12), -196px 0 0 -6px rgba(0, 50, 126, 0.12), -197px 0 0 -6px rgba(0, 50, 126, 0.12), -198px 0 0 -6px rgba(0, 50, 126, 0.12), -199px 0 0 -6px rgba(0, 50, 126, 0.12), -200px 0 0 -6px rgba(0, 50, 126, 0.12), -201px 0 0 -6px rgba(0, 50, 126, 0.12), -202px 0 0 -6px rgba(0, 50, 126, 0.12), -203px 0 0 -6px rgba(0, 50, 126, 0.12), -204px 0 0 -6px rgba(0, 50, 126, 0.12), -205px 0 0 -6px rgba(0, 50, 126, 0.12), -206px 0 0 -6px rgba(0, 50, 126, 0.12), -207px 0 0 -6px rgba(0, 50, 126, 0.12), -208px 0 0 -6px rgba(0, 50, 126, 0.12), -209px 0 0 -6px rgba(0, 50, 126, 0.12), -210px 0 0 -6px rgba(0, 50, 126, 0.12), -211px 0 0 -6px rgba(0, 50, 126, 0.12), -212px 0 0 -6px rgba(0, 50, 126, 0.12), -213px 0 0 -6px rgba(0, 50, 126, 0.12), -214px 0 0 -6px rgba(0, 50, 126, 0.12), -215px 0 0 -6px rgba(0, 50, 126, 0.12), -216px 0 0 -6px rgba(0, 50, 126, 0.12), -217px 0 0 -6px rgba(0, 50, 126, 0.12), -218px 0 0 -6px rgba(0, 50, 126, 0.12), -219px 0 0 -6px rgba(0, 50, 126, 0.12), -220px 0 0 -6px rgba(0, 50, 126, 0.12), -221px 0 0 -6px rgba(0, 50, 126, 0.12), -222px 0 0 -6px rgba(0, 50, 126, 0.12), -223px 0 0 -6px rgba(0, 50, 126, 0.12), -224px 0 0 -6px rgba(0, 50, 126, 0.12), -225px 0 0 -6px rgba(0, 50, 126, 0.12), -226px 0 0 -6px rgba(0, 50, 126, 0.12), -227px 0 0 -6px rgba(0, 50, 126, 0.12), -228px 0 0 -6px rgba(0, 50, 126, 0.12), -229px 0 0 -6px rgba(0, 50, 126, 0.12), -230px 0 0 -6px rgba(0, 50, 126, 0.12), -231px 0 0 -6px rgba(0, 50, 126, 0.12), -232px 0 0 -6px rgba(0, 50, 126, 0.12), -233px 0 0 -6px rgba(0, 50, 126, 0.12), -234px 0 0 -6px rgba(0, 50, 126, 0.12), -235px 0 0 -6px rgba(0, 50, 126, 0.12), -236px 0 0 -6px rgba(0, 50, 126, 0.12), -237px 0 0 -6px rgba(0, 50, 126, 0.12), -238px 0 0 -6px rgba(0, 50, 126, 0.12), -239px 0 0 -6px rgba(0, 50, 126, 0.12), -240px 0 0 -6px rgba(0, 50, 126, 0.12); + margin-top: -6px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-track { + width: 240px; + height: 2px; + background: rgba(0, 50, 126, 0.12); +} + +.custom-range::-moz-range-thumb { + width: 14px; + height: 14px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + position: relative; + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-progress { + height: 2px; + background: #467fcf; + border: 0; + margin-top: 0; +} + +.custom-range::-ms-track { + background: transparent; + border: 0; + border-color: transparent; + border-radius: 0; + border-width: 0; + color: transparent; + height: 2px; + margin-top: 10px; + width: 240px; +} + +.custom-range::-ms-thumb { + width: 240px; + height: 2px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-ms-fill-lower { + background: #467fcf; + border-radius: 0; +} + +.custom-range::-ms-fill-upper { + background: rgba(0, 50, 126, 0.12); + border-radius: 0; +} + +.custom-range::-ms-tooltip { + display: none; +} + +.selectgroup { + display: -ms-inline-flexbox; + display: inline-flex; +} + +.selectgroup-item { + -ms-flex-positive: 1; + flex-grow: 1; + position: relative; +} + +.selectgroup-item + .selectgroup-item { + margin-right: -1px; +} + +.selectgroup-item:not(:first-child) .selectgroup-button { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.selectgroup-item:not(:last-child) .selectgroup-button { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.selectgroup-input { + opacity: 0; + position: absolute; + z-index: -1; + top: 0; + right: 0; +} + +.selectgroup-button { + display: block; + border: 1px solid rgba(0, 40, 100, 0.12); + text-align: center; + padding: 0.375rem 1rem; + position: relative; + cursor: pointer; + border-radius: 3px; + color: #9aa0ac; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + font-size: 0.9375rem; + line-height: 1.5rem; + min-width: 2.375rem; +} + +.selectgroup-button-icon { + padding-right: .5rem; + padding-left: .5rem; + font-size: 1rem; +} + +.selectgroup-input:checked + .selectgroup-button { + border-color: #467fcf; + z-index: 1; + color: #467fcf; + background: #edf2fa; +} + +.selectgroup-input:focus + .selectgroup-button { + border-color: #467fcf; + z-index: 2; + color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectgroup-pills { + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: start; + align-items: flex-start; +} + +.selectgroup-pills .selectgroup-item { + margin-left: .5rem; + -ms-flex-positive: 0; + flex-grow: 0; +} + +.selectgroup-pills .selectgroup-button { + border-radius: 50px !important; +} + +.custom-switch { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: default; + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + margin: 0; +} + +.custom-switch-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-switches-stacked { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.custom-switches-stacked .custom-switch { + margin-bottom: .5rem; +} + +.custom-switch-indicator { + display: inline-block; + height: 1.25rem; + width: 2.25rem; + background: #e9ecef; + border-radius: 50px; + position: relative; + vertical-align: bottom; + border: 1px solid rgba(0, 40, 100, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-switch-indicator:before { + content: ''; + position: absolute; + height: calc(1.25rem - 4px); + width: calc(1.25rem - 4px); + top: 1px; + right: 1px; + background: #fff; + border-radius: 50%; + transition: .3s right; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); +} + +.custom-switch-input:checked ~ .custom-switch-indicator { + background: #467fcf; +} + +.custom-switch-input:checked ~ .custom-switch-indicator:before { + right: calc(1rem + 1px); +} + +.custom-switch-input:focus ~ .custom-switch-indicator { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); + border-color: #467fcf; +} + +.custom-switch-description { + margin-right: .5rem; + color: #6e7687; + transition: .3s color; +} + +.custom-switch-input:checked ~ .custom-switch-description { + color: #495057; +} + +.imagecheck { + margin: 0; + position: relative; + cursor: pointer; +} + +.imagecheck-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.imagecheck-figure { + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + margin: 0; + position: relative; +} + +.imagecheck-input:focus ~ .imagecheck-figure { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.imagecheck-input:checked ~ .imagecheck-figure { + border-color: rgba(0, 40, 100, 0.24); +} + +.imagecheck-figure:before { + content: ''; + position: absolute; + top: .25rem; + right: .25rem; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background: #467fcf url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; + color: #fff; + z-index: 1; + border-radius: 3px; + opacity: 0; + transition: .3s opacity; +} + +.imagecheck-input:checked ~ .imagecheck-figure:before { + opacity: 1; +} + +.imagecheck-image { + max-width: 100%; + opacity: .64; + transition: .3s opacity; +} + +.imagecheck-image:first-child { + border-top-right-radius: 2px; + border-top-left-radius: 2px; +} + +.imagecheck-image:last-child { + border-bottom-right-radius: 2px; + border-bottom-left-radius: 2px; +} + +.imagecheck:hover .imagecheck-image, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-image, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-image { + opacity: 1; +} + +.imagecheck-caption { + text-align: center; + padding: .25rem .25rem; + color: #9aa0ac; + font-size: 0.875rem; + transition: .3s color; +} + +.imagecheck:hover .imagecheck-caption, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-caption, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-caption { + color: #495057; +} + +.colorinput { + margin: 0; + position: relative; + cursor: pointer; +} + +.colorinput-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.colorinput-color { + display: inline-block; + width: 1.75rem; + height: 1.75rem; + border-radius: 3px; + border: 1px solid rgba(0, 40, 100, 0.12); + color: #fff; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); +} + +.colorinput-color:before { + content: ''; + opacity: 0; + position: absolute; + top: .25rem; + right: .25rem; + height: 1.25rem; + width: 1.25rem; + transition: .3s opacity; + background: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; +} + +.colorinput-input:checked ~ .colorinput-color:before { + opacity: 1; +} + +.colorinput-input:focus ~ .colorinput-color { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.timeline { + position: relative; + margin: 0 0 2rem; + padding: 0; + list-style: none; +} + +.timeline:before { + background-color: #e9ecef; + position: absolute; + display: block; + content: ''; + width: 1px; + height: 100%; + top: 0; + bottom: 0; + right: 4px; +} + +.timeline-item { + position: relative; + display: -ms-flexbox; + display: flex; + padding-right: 2rem; + margin: .5rem 0; +} + +.timeline-item:first-child:before, .timeline-item:last-child:before { + content: ''; + position: absolute; + background: #fff; + width: 1px; + right: .25rem; +} + +.timeline-item:first-child { + margin-top: 0; +} + +.timeline-item:first-child:before { + top: 0; + height: .5rem; +} + +.timeline-item:last-child { + margin-bottom: 0; +} + +.timeline-item:last-child:before { + top: .5rem; + bottom: 0; +} + +.timeline-badge { + position: absolute; + display: block; + width: 0.4375rem; + height: 0.4375rem; + right: 1px; + top: .5rem; + border-radius: 100%; + border: 1px solid #fff; + background: #adb5bd; +} + +.timeline-time { + white-space: nowrap; + margin-right: auto; + color: #9aa0ac; + font-size: 87.5%; +} + +.browser { + width: 1.25rem; + height: 1.25rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; +} + +.browser-android-browser { + background-image: url("../images/browsers/android-browser.svg"); +} + +.browser-aol-explorer { + background-image: url("../images/browsers/aol-explorer.svg"); +} + +.browser-blackberry { + background-image: url("../images/browsers/blackberry.svg"); +} + +.browser-camino { + background-image: url("../images/browsers/camino.svg"); +} + +.browser-chrome { + background-image: url("../images/browsers/chrome.svg"); +} + +.browser-chromium { + background-image: url("../images/browsers/chromium.svg"); +} + +.browser-dolphin { + background-image: url("../images/browsers/dolphin.svg"); +} + +.browser-edge { + background-image: url("../images/browsers/edge.svg"); +} + +.browser-firefox { + background-image: url("../images/browsers/firefox.svg"); +} + +.browser-ie { + background-image: url("../images/browsers/ie.svg"); +} + +.browser-maxthon { + background-image: url("../images/browsers/maxthon.svg"); +} + +.browser-mozilla { + background-image: url("../images/browsers/mozilla.svg"); +} + +.browser-netscape { + background-image: url("../images/browsers/netscape.svg"); +} + +.browser-opera { + background-image: url("../images/browsers/opera.svg"); +} + +.browser-safari { + background-image: url("../images/browsers/safari.svg"); +} + +.browser-sleipnir { + background-image: url("../images/browsers/sleipnir.svg"); +} + +.browser-uc-browser { + background-image: url("../images/browsers/uc-browser.svg"); +} + +.browser-vivaldi { + background-image: url("../images/browsers/vivaldi.svg"); +} + +.flag { + width: 1.6rem; + height: 1.2rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.flag-ad { + background-image: url("../images/flags/ad.svg"); +} + +.flag-ae { + background-image: url("../images/flags/ae.svg"); +} + +.flag-af { + background-image: url("../images/flags/af.svg"); +} + +.flag-ag { + background-image: url("../images/flags/ag.svg"); +} + +.flag-ai { + background-image: url("../images/flags/ai.svg"); +} + +.flag-al { + background-image: url("../images/flags/al.svg"); +} + +.flag-am { + background-image: url("../images/flags/am.svg"); +} + +.flag-ao { + background-image: url("../images/flags/ao.svg"); +} + +.flag-aq { + background-image: url("../images/flags/aq.svg"); +} + +.flag-ar { + background-image: url("../images/flags/ar.svg"); +} + +.flag-as { + background-image: url("../images/flags/as.svg"); +} + +.flag-at { + background-image: url("../images/flags/at.svg"); +} + +.flag-au { + background-image: url("../images/flags/au.svg"); +} + +.flag-aw { + background-image: url("../images/flags/aw.svg"); +} + +.flag-ax { + background-image: url("../images/flags/ax.svg"); +} + +.flag-az { + background-image: url("../images/flags/az.svg"); +} + +.flag-ba { + background-image: url("../images/flags/ba.svg"); +} + +.flag-bb { + background-image: url("../images/flags/bb.svg"); +} + +.flag-bd { + background-image: url("../images/flags/bd.svg"); +} + +.flag-be { + background-image: url("../images/flags/be.svg"); +} + +.flag-bf { + background-image: url("../images/flags/bf.svg"); +} + +.flag-bg { + background-image: url("../images/flags/bg.svg"); +} + +.flag-bh { + background-image: url("../images/flags/bh.svg"); +} + +.flag-bi { + background-image: url("../images/flags/bi.svg"); +} + +.flag-bj { + background-image: url("../images/flags/bj.svg"); +} + +.flag-bl { + background-image: url("../images/flags/bl.svg"); +} + +.flag-bm { + background-image: url("../images/flags/bm.svg"); +} + +.flag-bn { + background-image: url("../images/flags/bn.svg"); +} + +.flag-bo { + background-image: url("../images/flags/bo.svg"); +} + +.flag-bq { + background-image: url("../images/flags/bq.svg"); +} + +.flag-br { + background-image: url("../images/flags/br.svg"); +} + +.flag-bs { + background-image: url("../images/flags/bs.svg"); +} + +.flag-bt { + background-image: url("../images/flags/bt.svg"); +} + +.flag-bv { + background-image: url("../images/flags/bv.svg"); +} + +.flag-bw { + background-image: url("../images/flags/bw.svg"); +} + +.flag-by { + background-image: url("../images/flags/by.svg"); +} + +.flag-bz { + background-image: url("../images/flags/bz.svg"); +} + +.flag-ca { + background-image: url("../images/flags/ca.svg"); +} + +.flag-cc { + background-image: url("../images/flags/cc.svg"); +} + +.flag-cd { + background-image: url("../images/flags/cd.svg"); +} + +.flag-cf { + background-image: url("../images/flags/cf.svg"); +} + +.flag-cg { + background-image: url("../images/flags/cg.svg"); +} + +.flag-ch { + background-image: url("../images/flags/ch.svg"); +} + +.flag-ci { + background-image: url("../images/flags/ci.svg"); +} + +.flag-ck { + background-image: url("../images/flags/ck.svg"); +} + +.flag-cl { + background-image: url("../images/flags/cl.svg"); +} + +.flag-cm { + background-image: url("../images/flags/cm.svg"); +} + +.flag-cn { + background-image: url("../images/flags/cn.svg"); +} + +.flag-co { + background-image: url("../images/flags/co.svg"); +} + +.flag-cr { + background-image: url("../images/flags/cr.svg"); +} + +.flag-cu { + background-image: url("../images/flags/cu.svg"); +} + +.flag-cv { + background-image: url("../images/flags/cv.svg"); +} + +.flag-cw { + background-image: url("../images/flags/cw.svg"); +} + +.flag-cx { + background-image: url("../images/flags/cx.svg"); +} + +.flag-cy { + background-image: url("../images/flags/cy.svg"); +} + +.flag-cz { + background-image: url("../images/flags/cz.svg"); +} + +.flag-de { + background-image: url("../images/flags/de.svg"); +} + +.flag-dj { + background-image: url("../images/flags/dj.svg"); +} + +.flag-dk { + background-image: url("../images/flags/dk.svg"); +} + +.flag-dm { + background-image: url("../images/flags/dm.svg"); +} + +.flag-do { + background-image: url("../images/flags/do.svg"); +} + +.flag-dz { + background-image: url("../images/flags/dz.svg"); +} + +.flag-ec { + background-image: url("../images/flags/ec.svg"); +} + +.flag-ee { + background-image: url("../images/flags/ee.svg"); +} + +.flag-eg { + background-image: url("../images/flags/eg.svg"); +} + +.flag-eh { + background-image: url("../images/flags/eh.svg"); +} + +.flag-er { + background-image: url("../images/flags/er.svg"); +} + +.flag-es { + background-image: url("../images/flags/es.svg"); +} + +.flag-et { + background-image: url("../images/flags/et.svg"); +} + +.flag-eu { + background-image: url("../images/flags/eu.svg"); +} + +.flag-fi { + background-image: url("../images/flags/fi.svg"); +} + +.flag-fj { + background-image: url("../images/flags/fj.svg"); +} + +.flag-fk { + background-image: url("../images/flags/fk.svg"); +} + +.flag-fm { + background-image: url("../images/flags/fm.svg"); +} + +.flag-fo { + background-image: url("../images/flags/fo.svg"); +} + +.flag-fr { + background-image: url("../images/flags/fr.svg"); +} + +.flag-ga { + background-image: url("../images/flags/ga.svg"); +} + +.flag-gb-eng { + background-image: url("../images/flags/gb-eng.svg"); +} + +.flag-gb-nir { + background-image: url("../images/flags/gb-nir.svg"); +} + +.flag-gb-sct { + background-image: url("../images/flags/gb-sct.svg"); +} + +.flag-gb-wls { + background-image: url("../images/flags/gb-wls.svg"); +} + +.flag-gb { + background-image: url("../images/flags/gb.svg"); +} + +.flag-gd { + background-image: url("../images/flags/gd.svg"); +} + +.flag-ge { + background-image: url("../images/flags/ge.svg"); +} + +.flag-gf { + background-image: url("../images/flags/gf.svg"); +} + +.flag-gg { + background-image: url("../images/flags/gg.svg"); +} + +.flag-gh { + background-image: url("../images/flags/gh.svg"); +} + +.flag-gi { + background-image: url("../images/flags/gi.svg"); +} + +.flag-gl { + background-image: url("../images/flags/gl.svg"); +} + +.flag-gm { + background-image: url("../images/flags/gm.svg"); +} + +.flag-gn { + background-image: url("../images/flags/gn.svg"); +} + +.flag-gp { + background-image: url("../images/flags/gp.svg"); +} + +.flag-gq { + background-image: url("../images/flags/gq.svg"); +} + +.flag-gr { + background-image: url("../images/flags/gr.svg"); +} + +.flag-gs { + background-image: url("../images/flags/gs.svg"); +} + +.flag-gt { + background-image: url("../images/flags/gt.svg"); +} + +.flag-gu { + background-image: url("../images/flags/gu.svg"); +} + +.flag-gw { + background-image: url("../images/flags/gw.svg"); +} + +.flag-gy { + background-image: url("../images/flags/gy.svg"); +} + +.flag-hk { + background-image: url("../images/flags/hk.svg"); +} + +.flag-hm { + background-image: url("../images/flags/hm.svg"); +} + +.flag-hn { + background-image: url("../images/flags/hn.svg"); +} + +.flag-hr { + background-image: url("../images/flags/hr.svg"); +} + +.flag-ht { + background-image: url("../images/flags/ht.svg"); +} + +.flag-hu { + background-image: url("../images/flags/hu.svg"); +} + +.flag-id { + background-image: url("../images/flags/id.svg"); +} + +.flag-ie { + background-image: url("../images/flags/ie.svg"); +} + +.flag-il { + background-image: url("../images/flags/il.svg"); +} + +.flag-im { + background-image: url("../images/flags/im.svg"); +} + +.flag-in { + background-image: url("../images/flags/in.svg"); +} + +.flag-io { + background-image: url("../images/flags/io.svg"); +} + +.flag-iq { + background-image: url("../images/flags/iq.svg"); +} + +.flag-ir { + background-image: url("../images/flags/ir.svg"); +} + +.flag-is { + background-image: url("../images/flags/is.svg"); +} + +.flag-it { + background-image: url("../images/flags/it.svg"); +} + +.flag-je { + background-image: url("../images/flags/je.svg"); +} + +.flag-jm { + background-image: url("../images/flags/jm.svg"); +} + +.flag-jo { + background-image: url("../images/flags/jo.svg"); +} + +.flag-jp { + background-image: url("../images/flags/jp.svg"); +} + +.flag-ke { + background-image: url("../images/flags/ke.svg"); +} + +.flag-kg { + background-image: url("../images/flags/kg.svg"); +} + +.flag-kh { + background-image: url("../images/flags/kh.svg"); +} + +.flag-ki { + background-image: url("../images/flags/ki.svg"); +} + +.flag-km { + background-image: url("../images/flags/km.svg"); +} + +.flag-kn { + background-image: url("../images/flags/kn.svg"); +} + +.flag-kp { + background-image: url("../images/flags/kp.svg"); +} + +.flag-kr { + background-image: url("../images/flags/kr.svg"); +} + +.flag-kw { + background-image: url("../images/flags/kw.svg"); +} + +.flag-ky { + background-image: url("../images/flags/ky.svg"); +} + +.flag-kz { + background-image: url("../images/flags/kz.svg"); +} + +.flag-la { + background-image: url("../images/flags/la.svg"); +} + +.flag-lb { + background-image: url("../images/flags/lb.svg"); +} + +.flag-lc { + background-image: url("../images/flags/lc.svg"); +} + +.flag-li { + background-image: url("../images/flags/li.svg"); +} + +.flag-lk { + background-image: url("../images/flags/lk.svg"); +} + +.flag-lr { + background-image: url("../images/flags/lr.svg"); +} + +.flag-ls { + background-image: url("../images/flags/ls.svg"); +} + +.flag-lt { + background-image: url("../images/flags/lt.svg"); +} + +.flag-lu { + background-image: url("../images/flags/lu.svg"); +} + +.flag-lv { + background-image: url("../images/flags/lv.svg"); +} + +.flag-ly { + background-image: url("../images/flags/ly.svg"); +} + +.flag-ma { + background-image: url("../images/flags/ma.svg"); +} + +.flag-mc { + background-image: url("../images/flags/mc.svg"); +} + +.flag-md { + background-image: url("../images/flags/md.svg"); +} + +.flag-me { + background-image: url("../images/flags/me.svg"); +} + +.flag-mf { + background-image: url("../images/flags/mf.svg"); +} + +.flag-mg { + background-image: url("../images/flags/mg.svg"); +} + +.flag-mh { + background-image: url("../images/flags/mh.svg"); +} + +.flag-mk { + background-image: url("../images/flags/mk.svg"); +} + +.flag-ml { + background-image: url("../images/flags/ml.svg"); +} + +.flag-mm { + background-image: url("../images/flags/mm.svg"); +} + +.flag-mn { + background-image: url("../images/flags/mn.svg"); +} + +.flag-mo { + background-image: url("../images/flags/mo.svg"); +} + +.flag-mp { + background-image: url("../images/flags/mp.svg"); +} + +.flag-mq { + background-image: url("../images/flags/mq.svg"); +} + +.flag-mr { + background-image: url("../images/flags/mr.svg"); +} + +.flag-ms { + background-image: url("../images/flags/ms.svg"); +} + +.flag-mt { + background-image: url("../images/flags/mt.svg"); +} + +.flag-mu { + background-image: url("../images/flags/mu.svg"); +} + +.flag-mv { + background-image: url("../images/flags/mv.svg"); +} + +.flag-mw { + background-image: url("../images/flags/mw.svg"); +} + +.flag-mx { + background-image: url("../images/flags/mx.svg"); +} + +.flag-my { + background-image: url("../images/flags/my.svg"); +} + +.flag-mz { + background-image: url("../images/flags/mz.svg"); +} + +.flag-na { + background-image: url("../images/flags/na.svg"); +} + +.flag-nc { + background-image: url("../images/flags/nc.svg"); +} + +.flag-ne { + background-image: url("../images/flags/ne.svg"); +} + +.flag-nf { + background-image: url("../images/flags/nf.svg"); +} + +.flag-ng { + background-image: url("../images/flags/ng.svg"); +} + +.flag-ni { + background-image: url("../images/flags/ni.svg"); +} + +.flag-nl { + background-image: url("../images/flags/nl.svg"); +} + +.flag-no { + background-image: url("../images/flags/no.svg"); +} + +.flag-np { + background-image: url("../images/flags/np.svg"); +} + +.flag-nr { + background-image: url("../images/flags/nr.svg"); +} + +.flag-nu { + background-image: url("../images/flags/nu.svg"); +} + +.flag-nz { + background-image: url("../images/flags/nz.svg"); +} + +.flag-om { + background-image: url("../images/flags/om.svg"); +} + +.flag-pa { + background-image: url("../images/flags/pa.svg"); +} + +.flag-pe { + background-image: url("../images/flags/pe.svg"); +} + +.flag-pf { + background-image: url("../images/flags/pf.svg"); +} + +.flag-pg { + background-image: url("../images/flags/pg.svg"); +} + +.flag-ph { + background-image: url("../images/flags/ph.svg"); +} + +.flag-pk { + background-image: url("../images/flags/pk.svg"); +} + +.flag-pl { + background-image: url("../images/flags/pl.svg"); +} + +.flag-pm { + background-image: url("../images/flags/pm.svg"); +} + +.flag-pn { + background-image: url("../images/flags/pn.svg"); +} + +.flag-pr { + background-image: url("../images/flags/pr.svg"); +} + +.flag-ps { + background-image: url("../images/flags/ps.svg"); +} + +.flag-pt { + background-image: url("../images/flags/pt.svg"); +} + +.flag-pw { + background-image: url("../images/flags/pw.svg"); +} + +.flag-py { + background-image: url("../images/flags/py.svg"); +} + +.flag-qa { + background-image: url("../images/flags/qa.svg"); +} + +.flag-re { + background-image: url("../images/flags/re.svg"); +} + +.flag-ro { + background-image: url("../images/flags/ro.svg"); +} + +.flag-rs { + background-image: url("../images/flags/rs.svg"); +} + +.flag-ru { + background-image: url("../images/flags/ru.svg"); +} + +.flag-rw { + background-image: url("../images/flags/rw.svg"); +} + +.flag-sa { + background-image: url("../images/flags/sa.svg"); +} + +.flag-sb { + background-image: url("../images/flags/sb.svg"); +} + +.flag-sc { + background-image: url("../images/flags/sc.svg"); +} + +.flag-sd { + background-image: url("../images/flags/sd.svg"); +} + +.flag-se { + background-image: url("../images/flags/se.svg"); +} + +.flag-sg { + background-image: url("../images/flags/sg.svg"); +} + +.flag-sh { + background-image: url("../images/flags/sh.svg"); +} + +.flag-si { + background-image: url("../images/flags/si.svg"); +} + +.flag-sj { + background-image: url("../images/flags/sj.svg"); +} + +.flag-sk { + background-image: url("../images/flags/sk.svg"); +} + +.flag-sl { + background-image: url("../images/flags/sl.svg"); +} + +.flag-sm { + background-image: url("../images/flags/sm.svg"); +} + +.flag-sn { + background-image: url("../images/flags/sn.svg"); +} + +.flag-so { + background-image: url("../images/flags/so.svg"); +} + +.flag-sr { + background-image: url("../images/flags/sr.svg"); +} + +.flag-ss { + background-image: url("../images/flags/ss.svg"); +} + +.flag-st { + background-image: url("../images/flags/st.svg"); +} + +.flag-sv { + background-image: url("../images/flags/sv.svg"); +} + +.flag-sx { + background-image: url("../images/flags/sx.svg"); +} + +.flag-sy { + background-image: url("../images/flags/sy.svg"); +} + +.flag-sz { + background-image: url("../images/flags/sz.svg"); +} + +.flag-tc { + background-image: url("../images/flags/tc.svg"); +} + +.flag-td { + background-image: url("../images/flags/td.svg"); +} + +.flag-tf { + background-image: url("../images/flags/tf.svg"); +} + +.flag-tg { + background-image: url("../images/flags/tg.svg"); +} + +.flag-th { + background-image: url("../images/flags/th.svg"); +} + +.flag-tj { + background-image: url("../images/flags/tj.svg"); +} + +.flag-tk { + background-image: url("../images/flags/tk.svg"); +} + +.flag-tl { + background-image: url("../images/flags/tl.svg"); +} + +.flag-tm { + background-image: url("../images/flags/tm.svg"); +} + +.flag-tn { + background-image: url("../images/flags/tn.svg"); +} + +.flag-to { + background-image: url("../images/flags/to.svg"); +} + +.flag-tr { + background-image: url("../images/flags/tr.svg"); +} + +.flag-tt { + background-image: url("../images/flags/tt.svg"); +} + +.flag-tv { + background-image: url("../images/flags/tv.svg"); +} + +.flag-tw { + background-image: url("../images/flags/tw.svg"); +} + +.flag-tz { + background-image: url("../images/flags/tz.svg"); +} + +.flag-ua { + background-image: url("../images/flags/ua.svg"); +} + +.flag-ug { + background-image: url("../images/flags/ug.svg"); +} + +.flag-um { + background-image: url("../images/flags/um.svg"); +} + +.flag-un { + background-image: url("../images/flags/un.svg"); +} + +.flag-us { + background-image: url("../images/flags/us.svg"); +} + +.flag-uy { + background-image: url("../images/flags/uy.svg"); +} + +.flag-uz { + background-image: url("../images/flags/uz.svg"); +} + +.flag-va { + background-image: url("../images/flags/va.svg"); +} + +.flag-vc { + background-image: url("../images/flags/vc.svg"); +} + +.flag-ve { + background-image: url("../images/flags/ve.svg"); +} + +.flag-vg { + background-image: url("../images/flags/vg.svg"); +} + +.flag-vi { + background-image: url("../images/flags/vi.svg"); +} + +.flag-vn { + background-image: url("../images/flags/vn.svg"); +} + +.flag-vu { + background-image: url("../images/flags/vu.svg"); +} + +.flag-wf { + background-image: url("../images/flags/wf.svg"); +} + +.flag-ws { + background-image: url("../images/flags/ws.svg"); +} + +.flag-ye { + background-image: url("../images/flags/ye.svg"); +} + +.flag-yt { + background-image: url("../images/flags/yt.svg"); +} + +.flag-za { + background-image: url("../images/flags/za.svg"); +} + +.flag-zm { + background-image: url("../images/flags/zm.svg"); +} + +.flag-zw { + background-image: url("../images/flags/zw.svg"); +} + +.payment { + width: 2.5rem; + height: 1.5rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.payment-2checkout-dark { + background-image: url("../images/payments/2checkout-dark.svg"); +} + +.payment-2checkout { + background-image: url("../images/payments/2checkout.svg"); +} + +.payment-alipay-dark { + background-image: url("../images/payments/alipay-dark.svg"); +} + +.payment-alipay { + background-image: url("../images/payments/alipay.svg"); +} + +.payment-amazon-dark { + background-image: url("../images/payments/amazon-dark.svg"); +} + +.payment-amazon { + background-image: url("../images/payments/amazon.svg"); +} + +.payment-americanexpress-dark { + background-image: url("../images/payments/americanexpress-dark.svg"); +} + +.payment-americanexpress { + background-image: url("../images/payments/americanexpress.svg"); +} + +.payment-applepay-dark { + background-image: url("../images/payments/applepay-dark.svg"); +} + +.payment-applepay { + background-image: url("../images/payments/applepay.svg"); +} + +.payment-bancontact-dark { + background-image: url("../images/payments/bancontact-dark.svg"); +} + +.payment-bancontact { + background-image: url("../images/payments/bancontact.svg"); +} + +.payment-bitcoin-dark { + background-image: url("../images/payments/bitcoin-dark.svg"); +} + +.payment-bitcoin { + background-image: url("../images/payments/bitcoin.svg"); +} + +.payment-bitpay-dark { + background-image: url("../images/payments/bitpay-dark.svg"); +} + +.payment-bitpay { + background-image: url("../images/payments/bitpay.svg"); +} + +.payment-cirrus-dark { + background-image: url("../images/payments/cirrus-dark.svg"); +} + +.payment-cirrus { + background-image: url("../images/payments/cirrus.svg"); +} + +.payment-clickandbuy-dark { + background-image: url("../images/payments/clickandbuy-dark.svg"); +} + +.payment-clickandbuy { + background-image: url("../images/payments/clickandbuy.svg"); +} + +.payment-coinkite-dark { + background-image: url("../images/payments/coinkite-dark.svg"); +} + +.payment-coinkite { + background-image: url("../images/payments/coinkite.svg"); +} + +.payment-dinersclub-dark { + background-image: url("../images/payments/dinersclub-dark.svg"); +} + +.payment-dinersclub { + background-image: url("../images/payments/dinersclub.svg"); +} + +.payment-directdebit-dark { + background-image: url("../images/payments/directdebit-dark.svg"); +} + +.payment-directdebit { + background-image: url("../images/payments/directdebit.svg"); +} + +.payment-discover-dark { + background-image: url("../images/payments/discover-dark.svg"); +} + +.payment-discover { + background-image: url("../images/payments/discover.svg"); +} + +.payment-dwolla-dark { + background-image: url("../images/payments/dwolla-dark.svg"); +} + +.payment-dwolla { + background-image: url("../images/payments/dwolla.svg"); +} + +.payment-ebay-dark { + background-image: url("../images/payments/ebay-dark.svg"); +} + +.payment-ebay { + background-image: url("../images/payments/ebay.svg"); +} + +.payment-eway-dark { + background-image: url("../images/payments/eway-dark.svg"); +} + +.payment-eway { + background-image: url("../images/payments/eway.svg"); +} + +.payment-giropay-dark { + background-image: url("../images/payments/giropay-dark.svg"); +} + +.payment-giropay { + background-image: url("../images/payments/giropay.svg"); +} + +.payment-googlewallet-dark { + background-image: url("../images/payments/googlewallet-dark.svg"); +} + +.payment-googlewallet { + background-image: url("../images/payments/googlewallet.svg"); +} + +.payment-ingenico-dark { + background-image: url("../images/payments/ingenico-dark.svg"); +} + +.payment-ingenico { + background-image: url("../images/payments/ingenico.svg"); +} + +.payment-jcb-dark { + background-image: url("../images/payments/jcb-dark.svg"); +} + +.payment-jcb { + background-image: url("../images/payments/jcb.svg"); +} + +.payment-klarna-dark { + background-image: url("../images/payments/klarna-dark.svg"); +} + +.payment-klarna { + background-image: url("../images/payments/klarna.svg"); +} + +.payment-laser-dark { + background-image: url("../images/payments/laser-dark.svg"); +} + +.payment-laser { + background-image: url("../images/payments/laser.svg"); +} + +.payment-maestro-dark { + background-image: url("../images/payments/maestro-dark.svg"); +} + +.payment-maestro { + background-image: url("../images/payments/maestro.svg"); +} + +.payment-mastercard-dark { + background-image: url("../images/payments/mastercard-dark.svg"); +} + +.payment-mastercard { + background-image: url("../images/payments/mastercard.svg"); +} + +.payment-monero-dark { + background-image: url("../images/payments/monero-dark.svg"); +} + +.payment-monero { + background-image: url("../images/payments/monero.svg"); +} + +.payment-neteller-dark { + background-image: url("../images/payments/neteller-dark.svg"); +} + +.payment-neteller { + background-image: url("../images/payments/neteller.svg"); +} + +.payment-ogone-dark { + background-image: url("../images/payments/ogone-dark.svg"); +} + +.payment-ogone { + background-image: url("../images/payments/ogone.svg"); +} + +.payment-okpay-dark { + background-image: url("../images/payments/okpay-dark.svg"); +} + +.payment-okpay { + background-image: url("../images/payments/okpay.svg"); +} + +.payment-paybox-dark { + background-image: url("../images/payments/paybox-dark.svg"); +} + +.payment-paybox { + background-image: url("../images/payments/paybox.svg"); +} + +.payment-paymill-dark { + background-image: url("../images/payments/paymill-dark.svg"); +} + +.payment-paymill { + background-image: url("../images/payments/paymill.svg"); +} + +.payment-payone-dark { + background-image: url("../images/payments/payone-dark.svg"); +} + +.payment-payone { + background-image: url("../images/payments/payone.svg"); +} + +.payment-payoneer-dark { + background-image: url("../images/payments/payoneer-dark.svg"); +} + +.payment-payoneer { + background-image: url("../images/payments/payoneer.svg"); +} + +.payment-paypal-dark { + background-image: url("../images/payments/paypal-dark.svg"); +} + +.payment-paypal { + background-image: url("../images/payments/paypal.svg"); +} + +.payment-paysafecard-dark { + background-image: url("../images/payments/paysafecard-dark.svg"); +} + +.payment-paysafecard { + background-image: url("../images/payments/paysafecard.svg"); +} + +.payment-payu-dark { + background-image: url("../images/payments/payu-dark.svg"); +} + +.payment-payu { + background-image: url("../images/payments/payu.svg"); +} + +.payment-payza-dark { + background-image: url("../images/payments/payza-dark.svg"); +} + +.payment-payza { + background-image: url("../images/payments/payza.svg"); +} + +.payment-ripple-dark { + background-image: url("../images/payments/ripple-dark.svg"); +} + +.payment-ripple { + background-image: url("../images/payments/ripple.svg"); +} + +.payment-sage-dark { + background-image: url("../images/payments/sage-dark.svg"); +} + +.payment-sage { + background-image: url("../images/payments/sage.svg"); +} + +.payment-sepa-dark { + background-image: url("../images/payments/sepa-dark.svg"); +} + +.payment-sepa { + background-image: url("../images/payments/sepa.svg"); +} + +.payment-shopify-dark { + background-image: url("../images/payments/shopify-dark.svg"); +} + +.payment-shopify { + background-image: url("../images/payments/shopify.svg"); +} + +.payment-skrill-dark { + background-image: url("../images/payments/skrill-dark.svg"); +} + +.payment-skrill { + background-image: url("../images/payments/skrill.svg"); +} + +.payment-solo-dark { + background-image: url("../images/payments/solo-dark.svg"); +} + +.payment-solo { + background-image: url("../images/payments/solo.svg"); +} + +.payment-square-dark { + background-image: url("../images/payments/square-dark.svg"); +} + +.payment-square { + background-image: url("../images/payments/square.svg"); +} + +.payment-stripe-dark { + background-image: url("../images/payments/stripe-dark.svg"); +} + +.payment-stripe { + background-image: url("../images/payments/stripe.svg"); +} + +.payment-switch-dark { + background-image: url("../images/payments/switch-dark.svg"); +} + +.payment-switch { + background-image: url("../images/payments/switch.svg"); +} + +.payment-ukash-dark { + background-image: url("../images/payments/ukash-dark.svg"); +} + +.payment-ukash { + background-image: url("../images/payments/ukash.svg"); +} + +.payment-unionpay-dark { + background-image: url("../images/payments/unionpay-dark.svg"); +} + +.payment-unionpay { + background-image: url("../images/payments/unionpay.svg"); +} + +.payment-verifone-dark { + background-image: url("../images/payments/verifone-dark.svg"); +} + +.payment-verifone { + background-image: url("../images/payments/verifone.svg"); +} + +.payment-verisign-dark { + background-image: url("../images/payments/verisign-dark.svg"); +} + +.payment-verisign { + background-image: url("../images/payments/verisign.svg"); +} + +.payment-visa-dark { + background-image: url("../images/payments/visa-dark.svg"); +} + +.payment-visa { + background-image: url("../images/payments/visa.svg"); +} + +.payment-webmoney-dark { + background-image: url("../images/payments/webmoney-dark.svg"); +} + +.payment-webmoney { + background-image: url("../images/payments/webmoney.svg"); +} + +.payment-westernunion-dark { + background-image: url("../images/payments/westernunion-dark.svg"); +} + +.payment-westernunion { + background-image: url("../images/payments/westernunion.svg"); +} + +.payment-worldpay-dark { + background-image: url("../images/payments/worldpay-dark.svg"); +} + +.payment-worldpay { + background-image: url("../images/payments/worldpay.svg"); +} + +svg { + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-container { + width: 100%; + height: 100%; + position: relative; + overflow: hidden; + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-tip { + position: absolute; + display: none; + border-radius: 3px; + background: #212529; + color: white; + padding: 6px; + font-size: 11px; + line-height: 1; + font-weight: 700; +} + +.jvectormap-tip small { + font-size: inherit; + font-weight: 400; +} + +.jvectormap-zoomin, .jvectormap-zoomout, .jvectormap-goback { + position: absolute; + right: 10px; + border-radius: 3px; + background: #292929; + padding: 3px; + color: white; + cursor: pointer; + line-height: 10px; + text-align: center; + box-sizing: content-box; +} + +.jvectormap-zoomin, .jvectormap-zoomout { + width: 10px; + height: 10px; +} + +.jvectormap-zoomin { + top: 10px; +} + +.jvectormap-zoomout { + top: 30px; +} + +.jvectormap-goback { + bottom: 10px; + z-index: 1000; + padding: 6px; +} + +.jvectormap-spinner { + position: absolute; + right: 0; + top: 0; + left: 0; + bottom: 0; + background: center no-repeat url(data:image/gif;base64,R0lGODlhIAAgAPMAAP///wAAAMbGxoSEhLa2tpqamjY2NlZWVtjY2OTk5Ly8vB4eHgQEBAAAAAAAAAAAACH/C05FVFNDQVBFMi4wAwEAAAAh/hpDcmVhdGVkIHdpdGggYWpheGxvYWQuaW5mbwAh+QQJCgAAACwAAAAAIAAgAAAE5xDISWlhperN52JLhSSdRgwVo1ICQZRUsiwHpTJT4iowNS8vyW2icCF6k8HMMBkCEDskxTBDAZwuAkkqIfxIQyhBQBFvAQSDITM5VDW6XNE4KagNh6Bgwe60smQUB3d4Rz1ZBApnFASDd0hihh12BkE9kjAJVlycXIg7CQIFA6SlnJ87paqbSKiKoqusnbMdmDC2tXQlkUhziYtyWTxIfy6BE8WJt5YJvpJivxNaGmLHT0VnOgSYf0dZXS7APdpB309RnHOG5gDqXGLDaC457D1zZ/V/nmOM82XiHRLYKhKP1oZmADdEAAAh+QQJCgAAACwAAAAAIAAgAAAE6hDISWlZpOrNp1lGNRSdRpDUolIGw5RUYhhHukqFu8DsrEyqnWThGvAmhVlteBvojpTDDBUEIFwMFBRAmBkSgOrBFZogCASwBDEY/CZSg7GSE0gSCjQBMVG023xWBhklAnoEdhQEfyNqMIcKjhRsjEdnezB+A4k8gTwJhFuiW4dokXiloUepBAp5qaKpp6+Ho7aWW54wl7obvEe0kRuoplCGepwSx2jJvqHEmGt6whJpGpfJCHmOoNHKaHx61WiSR92E4lbFoq+B6QDtuetcaBPnW6+O7wDHpIiK9SaVK5GgV543tzjgGcghAgAh+QQJCgAAACwAAAAAIAAgAAAE7hDISSkxpOrN5zFHNWRdhSiVoVLHspRUMoyUakyEe8PTPCATW9A14E0UvuAKMNAZKYUZCiBMuBakSQKG8G2FzUWox2AUtAQFcBKlVQoLgQReZhQlCIJesQXI5B0CBnUMOxMCenoCfTCEWBsJColTMANldx15BGs8B5wlCZ9Po6OJkwmRpnqkqnuSrayqfKmqpLajoiW5HJq7FL1Gr2mMMcKUMIiJgIemy7xZtJsTmsM4xHiKv5KMCXqfyUCJEonXPN2rAOIAmsfB3uPoAK++G+w48edZPK+M6hLJpQg484enXIdQFSS1u6UhksENEQAAIfkECQoAAAAsAAAAACAAIAAABOcQyEmpGKLqzWcZRVUQnZYg1aBSh2GUVEIQ2aQOE+G+cD4ntpWkZQj1JIiZIogDFFyHI0UxQwFugMSOFIPJftfVAEoZLBbcLEFhlQiqGp1Vd140AUklUN3eCA51C1EWMzMCezCBBmkxVIVHBWd3HHl9JQOIJSdSnJ0TDKChCwUJjoWMPaGqDKannasMo6WnM562R5YluZRwur0wpgqZE7NKUm+FNRPIhjBJxKZteWuIBMN4zRMIVIhffcgojwCF117i4nlLnY5ztRLsnOk+aV+oJY7V7m76PdkS4trKcdg0Zc0tTcKkRAAAIfkECQoAAAAsAAAAACAAIAAABO4QyEkpKqjqzScpRaVkXZWQEximw1BSCUEIlDohrft6cpKCk5xid5MNJTaAIkekKGQkWyKHkvhKsR7ARmitkAYDYRIbUQRQjWBwJRzChi9CRlBcY1UN4g0/VNB0AlcvcAYHRyZPdEQFYV8ccwR5HWxEJ02YmRMLnJ1xCYp0Y5idpQuhopmmC2KgojKasUQDk5BNAwwMOh2RtRq5uQuPZKGIJQIGwAwGf6I0JXMpC8C7kXWDBINFMxS4DKMAWVWAGYsAdNqW5uaRxkSKJOZKaU3tPOBZ4DuK2LATgJhkPJMgTwKCdFjyPHEnKxFCDhEAACH5BAkKAAAALAAAAAAgACAAAATzEMhJaVKp6s2nIkolIJ2WkBShpkVRWqqQrhLSEu9MZJKK9y1ZrqYK9WiClmvoUaF8gIQSNeF1Er4MNFn4SRSDARWroAIETg1iVwuHjYB1kYc1mwruwXKC9gmsJXliGxc+XiUCby9ydh1sOSdMkpMTBpaXBzsfhoc5l58Gm5yToAaZhaOUqjkDgCWNHAULCwOLaTmzswadEqggQwgHuQsHIoZCHQMMQgQGubVEcxOPFAcMDAYUA85eWARmfSRQCdcMe0zeP1AAygwLlJtPNAAL19DARdPzBOWSm1brJBi45soRAWQAAkrQIykShQ9wVhHCwCQCACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiRMDjI0Fd30/iI2UA5GSS5UDj2l6NoqgOgN4gksEBgYFf0FDqKgHnyZ9OX8HrgYHdHpcHQULXAS2qKpENRg7eAMLC7kTBaixUYFkKAzWAAnLC7FLVxLWDBLKCwaKTULgEwbLA4hJtOkSBNqITT3xEgfLpBtzE/jiuL04RGEBgwWhShRgQExHBAAh+QQJCgAAACwAAAAAIAAgAAAE7xDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfZiCqGk5dTESJeaOAlClzsJsqwiJwiqnFrb2nS9kmIcgEsjQydLiIlHehhpejaIjzh9eomSjZR+ipslWIRLAgMDOR2DOqKogTB9pCUJBagDBXR6XB0EBkIIsaRsGGMMAxoDBgYHTKJiUYEGDAzHC9EACcUGkIgFzgwZ0QsSBcXHiQvOwgDdEwfFs0sDzt4S6BK4xYjkDOzn0unFeBzOBijIm1Dgmg5YFQwsCMjp1oJ8LyIAACH5BAkKAAAALAAAAAAgACAAAATwEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GGl6NoiPOH16iZKNlH6KmyWFOggHhEEvAwwMA0N9GBsEC6amhnVcEwavDAazGwIDaH1ipaYLBUTCGgQDA8NdHz0FpqgTBwsLqAbWAAnIA4FWKdMLGdYGEgraigbT0OITBcg5QwPT4xLrROZL6AuQAPUS7bxLpoWidY0JtxLHKhwwMJBTHgPKdEQAACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GAULDJCRiXo1CpGXDJOUjY+Yip9DhToJA4RBLwMLCwVDfRgbBAaqqoZ1XBMHswsHtxtFaH1iqaoGNgAIxRpbFAgfPQSqpbgGBqUD1wBXeCYp1AYZ19JJOYgH1KwA4UBvQwXUBxPqVD9L3sbp2BNk2xvvFPJd+MFCN6HAAIKgNggY0KtEBAAh+QQJCgAAACwAAAAAIAAgAAAE6BDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfYIDMaAFdTESJeaEDAIMxYFqrOUaNW4E4ObYcCXaiBVEgULe0NJaxxtYksjh2NLkZISgDgJhHthkpU4mW6blRiYmZOlh4JWkDqILwUGBnE6TYEbCgevr0N1gH4At7gHiRpFaLNrrq8HNgAJA70AWxQIH1+vsYMDAzZQPC9VCNkDWUhGkuE5PxJNwiUK4UfLzOlD4WvzAHaoG9nxPi5d+jYUqfAhhykOFwJWiAAAIfkECQoAAAAsAAAAACAAIAAABPAQyElpUqnqzaciSoVkXVUMFaFSwlpOCcMYlErAavhOMnNLNo8KsZsMZItJEIDIFSkLGQoQTNhIsFehRww2CQLKF0tYGKYSg+ygsZIuNqJksKgbfgIGepNo2cIUB3V1B3IvNiBYNQaDSTtfhhx0CwVPI0UJe0+bm4g5VgcGoqOcnjmjqDSdnhgEoamcsZuXO1aWQy8KAwOAuTYYGwi7w5h+Kr0SJ8MFihpNbx+4Erq7BYBuzsdiH1jCAzoSfl0rVirNbRXlBBlLX+BP0XJLAPGzTkAuAOqb0WT5AH7OcdCm5B8TgRwSRKIHQtaLCwg1RAAAOwAAAAAAAAAAAA==); +} + +.jvectormap-legend-title { + font-weight: bold; + font-size: 14px; + text-align: center; +} + +.jvectormap-legend-cnt { + position: absolute; +} + +.jvectormap-legend-cnt-h { + bottom: 0; + left: 0; +} + +.jvectormap-legend-cnt-v { + top: 0; + left: 0; +} + +.jvectormap-legend { + background: black; + color: white; + border-radius: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend { + float: right; + margin: 0 0 10px 10px; + padding: 3px 3px 1px 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend .jvectormap-legend-tick { + float: right; +} + +.jvectormap-legend-cnt-v .jvectormap-legend { + margin: 10px 0 0 10px; + padding: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick { + width: 40px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-sample { + height: 15px; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-sample { + height: 20px; + width: 20px; + display: inline-block; + vertical-align: middle; +} + +.jvectormap-legend-tick-text { + font-size: 12px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-text { + text-align: center; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-text { + display: inline-block; + vertical-align: middle; + line-height: 20px; + padding-right: 3px; +} + +/** + * selectize.css (v0.12.4) + * Copyright (c) 2013–2015 Brian Reavis & contributors + * + * Licensed under the Apache License, Version 2.0 (the "License"); you may not use this + * file except in compliance with the License. You may obtain a copy of the License at: + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under + * the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF + * ANY KIND, either express or implied. See the License for the specific language + * governing permissions and limitations under the License. + * + * @author Brian Reavis + */ +.selectize-control.plugin-drag_drop.multi > .selectize-input > div.ui-sortable-placeholder { + visibility: visible !important; + background: #f2f2f2 !important; + background: rgba(0, 0, 0, 0.06) !important; + border: 0 none !important; + box-shadow: inset 0 0 12px 4px #fff; +} + +.selectize-control.plugin-drag_drop .ui-sortable-placeholder::after { + content: '!'; + visibility: hidden; +} + +.selectize-control.plugin-drag_drop .ui-sortable-helper { + box-shadow: 0 2px 5px rgba(0, 0, 0, 0.2); +} + +.selectize-dropdown-header { + position: relative; + padding: 5px 8px; + border-bottom: 1px solid #d0d0d0; + background: #f8f8f8; + border-radius: 3px 3px 0 0; +} + +.selectize-dropdown-header-close { + position: absolute; + left: 8px; + top: 50%; + color: #495057; + opacity: 0.4; + margin-top: -12px; + line-height: 20px; + font-size: 20px !important; +} + +.selectize-dropdown-header-close:hover { + color: #000; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup { + border-left: 1px solid #f2f2f2; + border-top: 0 none; + float: right; + box-sizing: border-box; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:last-child { + border-left: 0 none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:before { + display: none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup-header { + border-top: 0 none; +} + +.selectize-control.plugin-remove_button [data-value] { + position: relative; + padding-left: 24px !important; +} + +.selectize-control.plugin-remove_button [data-value] .remove { + z-index: 1; + /* fixes ie bug (see #392) */ + position: absolute; + top: 0; + left: 0; + bottom: 0; + width: 17px; + text-align: center; + font-weight: bold; + font-size: 12px; + color: inherit; + text-decoration: none; + vertical-align: middle; + display: inline-block; + padding: 2px 0 0 0; + border-right: 1px solid #d0d0d0; + border-radius: 2px 0 0 2px; + box-sizing: border-box; +} + +.selectize-control.plugin-remove_button [data-value] .remove:hover { + background: rgba(0, 0, 0, 0.05); +} + +.selectize-control.plugin-remove_button [data-value].active .remove { + border-right-color: #cacaca; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove:hover { + background: none; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove { + border-right-color: #fff; +} + +.selectize-control.plugin-remove_button .remove-single { + position: absolute; + left: 28px; + top: 6px; + font-size: 23px; +} + +.selectize-control { + position: relative; + padding: 0; + border: 0; +} + +.selectize-dropdown, +.selectize-input, +.selectize-input input { + color: #495057; + font-family: inherit; + font-size: 15px; + line-height: 18px; + -webkit-font-smoothing: inherit; +} + +.selectize-input, +.selectize-control.single .selectize-input.input-active { + background: #fff; + cursor: text; + display: inline-block; +} + +.selectize-input { + border: 1px solid rgba(0, 40, 100, 0.12); + padding: 0.5625rem 0.75rem; + display: inline-block; + display: block; + width: 100%; + overflow: hidden; + position: relative; + z-index: 1; + box-sizing: border-box; + border-radius: 3px; + transition: .3s border-color, .3s box-shadow; +} + +.selectize-control.multi .selectize-input.has-items { + padding: 7px 7px 4px 0.75rem; +} + +.selectize-input.full { + background-color: #fff; +} + +.selectize-input.disabled, +.selectize-input.disabled * { + cursor: default !important; +} + +.selectize-input.focus { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectize-input.dropdown-active { + border-radius: 3px 3px 0 0; +} + +.selectize-input > * { + vertical-align: baseline; + display: -moz-inline-stack; + display: inline-block; + zoom: 1; + *display: inline; +} + +.selectize-control.multi .selectize-input > div { + cursor: pointer; + margin: 0 0 3px 3px; + padding: 2px 6px; + background: #e9ecef; + color: #495057; + font-size: 13px; + border: 0 solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-weight: 400; +} + +.selectize-control.multi .selectize-input > div.active { + background: #e8e8e8; + color: #303030; + border: 0 solid #cacaca; +} + +.selectize-control.multi .selectize-input.disabled > div, +.selectize-control.multi .selectize-input.disabled > div.active { + color: #7d7d7d; + background: #fff; + border: 0 solid #fff; +} + +.selectize-input > input { + display: inline-block !important; + padding: 0 !important; + min-height: 0 !important; + max-height: none !important; + max-width: 100% !important; + margin: 0 0 0 2px !important; + text-indent: 0 !important; + border: 0 none !important; + background: none !important; + line-height: inherit !important; + box-shadow: none !important; +} + +.selectize-input > input::-ms-clear { + display: none; +} + +.selectize-input > input:focus { + outline: none !important; +} + +.selectize-input::after { + content: ' '; + display: block; + clear: right; +} + +.selectize-input.dropdown-active::before { + content: ' '; + display: block; + position: absolute; + background: #f0f0f0; + height: 1px; + bottom: 0; + right: 0; + left: 0; +} + +.selectize-dropdown { + position: absolute; + z-index: 10; + border: 1px solid rgba(0, 40, 100, 0.12); + background: #fff; + margin: -1px 0 0 0; + border-top: 0 none; + box-sizing: border-box; + border-radius: 0 0 3px 3px; + height: auto; + padding: 0; +} + +.selectize-dropdown [data-selectable] { + cursor: pointer; + overflow: hidden; +} + +.selectize-dropdown [data-selectable] .highlight { + background: rgba(125, 168, 208, 0.2); + border-radius: 1px; +} + +.selectize-dropdown [data-selectable], +.selectize-dropdown .optgroup-header { + padding: 6px .75rem; +} + +.selectize-dropdown .optgroup:first-child .optgroup-header { + border-top: 0 none; +} + +.selectize-dropdown .optgroup-header { + color: #495057; + background: #fff; + cursor: default; +} + +.selectize-dropdown .active { + background-color: #F1F4F8; + color: #467fcf; +} + +.selectize-dropdown .active.create { + color: #495057; +} + +.selectize-dropdown .create { + color: rgba(48, 48, 48, 0.5); +} + +.selectize-dropdown-content { + overflow-y: auto; + overflow-x: hidden; + max-height: 200px; + -webkit-overflow-scrolling: touch; +} + +.selectize-control.single .selectize-input, +.selectize-control.single .selectize-input input { + cursor: pointer; +} + +.selectize-control.single .selectize-input.input-active, +.selectize-control.single .selectize-input.input-active input { + cursor: text; +} + +.selectize-control.single .selectize-input:after { + content: ''; + display: block; + position: absolute; + top: 13px; + left: 12px; + width: 8px; + height: 10px; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat center; + background-size: 8px 10px; + transition: .3s transform; +} + +.selectize-control.single .selectize-input.dropdown-active:after { + -webkit-transform: rotate(-180deg); + transform: rotate(-180deg); +} + +.selectize-control .selectize-input.disabled { + opacity: 0.5; + background-color: #fafafa; +} + +.selectize-dropdown .image, +.selectize-input .image { + width: 1.25rem; + height: 1.25rem; + background-size: contain; + margin: -1px -4px -1px .5rem; + line-height: 1.25rem; + float: right; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; +} + +.selectize-dropdown .image img, +.selectize-input .image img { + max-width: 100%; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); + border-radius: 2px; +} + +.selectize-input .image { + width: 1.5rem; + height: 1.5rem; + margin: -3px -5px -3px .75rem; +} + +@font-face { + font-family: "feather"; + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106"); + /* IE9*/ + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106#iefix") format("embedded-opentype"), url("../fonts/feather/feather-webfont.woff?t=1501841394106") format("woff"), url("../fonts/feather/feather-webfont.ttf?t=1501841394106") format("truetype"), url("../fonts/feather/feather-webfont.svg?t=1501841394106#feather") format("svg"); + /* iOS 4.1- */ +} + +.fe { + font-family: 'feather' !important; + speak: none; + font-style: normal; + font-weight: normal; + font-variant: normal; + text-transform: none; + line-height: 1; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +.fe-activity:before { + content: "\e900"; +} + +.fe-airplay:before { + content: "\e901"; +} + +.fe-alert-circle:before { + content: "\e902"; +} + +.fe-alert-octagon:before { + content: "\e903"; +} + +.fe-alert-triangle:before { + content: "\e904"; +} + +.fe-align-center:before { + content: "\e905"; +} + +.fe-align-justify:before { + content: "\e906"; +} + +.fe-align-left:before { + content: "\e907"; +} + +.fe-align-right:before { + content: "\e908"; +} + +.fe-anchor:before { + content: "\e909"; +} + +.fe-aperture:before { + content: "\e90a"; +} + +.fe-arrow-down:before { + content: "\e90b"; +} + +.fe-arrow-down-circle:before { + content: "\e90c"; +} + +.fe-arrow-down-left:before { + content: "\e90d"; +} + +.fe-arrow-down-right:before { + content: "\e90e"; +} + +.fe-arrow-left:before { + content: "\e90f"; +} + +.fe-arrow-left-circle:before { + content: "\e910"; +} + +.fe-arrow-right:before { + content: "\e911"; +} + +.fe-arrow-right-circle:before { + content: "\e912"; +} + +.fe-arrow-up:before { + content: "\e913"; +} + +.fe-arrow-up-circle:before { + content: "\e914"; +} + +.fe-arrow-up-left:before { + content: "\e915"; +} + +.fe-arrow-up-right:before { + content: "\e916"; +} + +.fe-at-sign:before { + content: "\e917"; +} + +.fe-award:before { + content: "\e918"; +} + +.fe-bar-chart:before { + content: "\e919"; +} + +.fe-bar-chart-2:before { + content: "\e91a"; +} + +.fe-battery:before { + content: "\e91b"; +} + +.fe-battery-charging:before { + content: "\e91c"; +} + +.fe-bell:before { + content: "\e91d"; +} + +.fe-bell-off:before { + content: "\e91e"; +} + +.fe-bluetooth:before { + content: "\e91f"; +} + +.fe-bold:before { + content: "\e920"; +} + +.fe-book:before { + content: "\e921"; +} + +.fe-book-open:before { + content: "\e922"; +} + +.fe-bookmark:before { + content: "\e923"; +} + +.fe-box:before { + content: "\e924"; +} + +.fe-briefcase:before { + content: "\e925"; +} + +.fe-calendar:before { + content: "\e926"; +} + +.fe-camera:before { + content: "\e927"; +} + +.fe-camera-off:before { + content: "\e928"; +} + +.fe-cast:before { + content: "\e929"; +} + +.fe-check:before { + content: "\e92a"; +} + +.fe-check-circle:before { + content: "\e92b"; +} + +.fe-check-square:before { + content: "\e92c"; +} + +.fe-chevron-down:before { + content: "\e92d"; +} + +.fe-chevron-left:before { + content: "\e92e"; +} + +.fe-chevron-right:before { + content: "\e92f"; +} + +.fe-chevron-up:before { + content: "\e930"; +} + +.fe-chevrons-down:before { + content: "\e931"; +} + +.fe-chevrons-left:before { + content: "\e932"; +} + +.fe-chevrons-right:before { + content: "\e933"; +} + +.fe-chevrons-up:before { + content: "\e934"; +} + +.fe-chrome:before { + content: "\e935"; +} + +.fe-circle:before { + content: "\e936"; +} + +.fe-clipboard:before { + content: "\e937"; +} + +.fe-clock:before { + content: "\e938"; +} + +.fe-cloud:before { + content: "\e939"; +} + +.fe-cloud-drizzle:before { + content: "\e93a"; +} + +.fe-cloud-lightning:before { + content: "\e93b"; +} + +.fe-cloud-off:before { + content: "\e93c"; +} + +.fe-cloud-rain:before { + content: "\e93d"; +} + +.fe-cloud-snow:before { + content: "\e93e"; +} + +.fe-code:before { + content: "\e93f"; +} + +.fe-codepen:before { + content: "\e940"; +} + +.fe-command:before { + content: "\e941"; +} + +.fe-compass:before { + content: "\e942"; +} + +.fe-copy:before { + content: "\e943"; +} + +.fe-corner-down-left:before { + content: "\e944"; +} + +.fe-corner-down-right:before { + content: "\e945"; +} + +.fe-corner-left-down:before { + content: "\e946"; +} + +.fe-corner-left-up:before { + content: "\e947"; +} + +.fe-corner-right-down:before { + content: "\e948"; +} + +.fe-corner-right-up:before { + content: "\e949"; +} + +.fe-corner-up-left:before { + content: "\e94a"; +} + +.fe-corner-up-right:before { + content: "\e94b"; +} + +.fe-cpu:before { + content: "\e94c"; +} + +.fe-credit-card:before { + content: "\e94d"; +} + +.fe-crop:before { + content: "\e94e"; +} + +.fe-crosshair:before { + content: "\e94f"; +} + +.fe-database:before { + content: "\e950"; +} + +.fe-delete:before { + content: "\e951"; +} + +.fe-disc:before { + content: "\e952"; +} + +.fe-dollar-sign:before { + content: "\e953"; +} + +.fe-download:before { + content: "\e954"; +} + +.fe-download-cloud:before { + content: "\e955"; +} + +.fe-droplet:before { + content: "\e956"; +} + +.fe-edit:before { + content: "\e957"; +} + +.fe-edit-2:before { + content: "\e958"; +} + +.fe-edit-3:before { + content: "\e959"; +} + +.fe-external-link:before { + content: "\e95a"; +} + +.fe-eye:before { + content: "\e95b"; +} + +.fe-eye-off:before { + content: "\e95c"; +} + +.fe-facebook:before { + content: "\e95d"; +} + +.fe-fast-forward:before { + content: "\e95e"; +} + +.fe-feather:before { + content: "\e95f"; +} + +.fe-file:before { + content: "\e960"; +} + +.fe-file-minus:before { + content: "\e961"; +} + +.fe-file-plus:before { + content: "\e962"; +} + +.fe-file-text:before { + content: "\e963"; +} + +.fe-film:before { + content: "\e964"; +} + +.fe-filter:before { + content: "\e965"; +} + +.fe-flag:before { + content: "\e966"; +} + +.fe-folder:before { + content: "\e967"; +} + +.fe-folder-minus:before { + content: "\e968"; +} + +.fe-folder-plus:before { + content: "\e969"; +} + +.fe-git-branch:before { + content: "\e96a"; +} + +.fe-git-commit:before { + content: "\e96b"; +} + +.fe-git-merge:before { + content: "\e96c"; +} + +.fe-git-pull-request:before { + content: "\e96d"; +} + +.fe-github:before { + content: "\e96e"; +} + +.fe-gitlab:before { + content: "\e96f"; +} + +.fe-globe:before { + content: "\e970"; +} + +.fe-grid:before { + content: "\e971"; +} + +.fe-hard-drive:before { + content: "\e972"; +} + +.fe-hash:before { + content: "\e973"; +} + +.fe-headphones:before { + content: "\e974"; +} + +.fe-heart:before { + content: "\e975"; +} + +.fe-help-circle:before { + content: "\e976"; +} + +.fe-home:before { + content: "\e977"; +} + +.fe-image:before { + content: "\e978"; +} + +.fe-inbox:before { + content: "\e979"; +} + +.fe-info:before { + content: "\e97a"; +} + +.fe-instagram:before { + content: "\e97b"; +} + +.fe-italic:before { + content: "\e97c"; +} + +.fe-layers:before { + content: "\e97d"; +} + +.fe-layout:before { + content: "\e97e"; +} + +.fe-life-buoy:before { + content: "\e97f"; +} + +.fe-link:before { + content: "\e980"; +} + +.fe-link-2:before { + content: "\e981"; +} + +.fe-linkedin:before { + content: "\e982"; +} + +.fe-list:before { + content: "\e983"; +} + +.fe-loader:before { + content: "\e984"; +} + +.fe-lock:before { + content: "\e985"; +} + +.fe-log-in:before { + content: "\e986"; +} + +.fe-log-out:before { + content: "\e987"; +} + +.fe-mail:before { + content: "\e988"; +} + +.fe-map:before { + content: "\e989"; +} + +.fe-map-pin:before { + content: "\e98a"; +} + +.fe-maximize:before { + content: "\e98b"; +} + +.fe-maximize-2:before { + content: "\e98c"; +} + +.fe-menu:before { + content: "\e98d"; +} + +.fe-message-circle:before { + content: "\e98e"; +} + +.fe-message-square:before { + content: "\e98f"; +} + +.fe-mic:before { + content: "\e990"; +} + +.fe-mic-off:before { + content: "\e991"; +} + +.fe-minimize:before { + content: "\e992"; +} + +.fe-minimize-2:before { + content: "\e993"; +} + +.fe-minus:before { + content: "\e994"; +} + +.fe-minus-circle:before { + content: "\e995"; +} + +.fe-minus-square:before { + content: "\e996"; +} + +.fe-monitor:before { + content: "\e997"; +} + +.fe-moon:before { + content: "\e998"; +} + +.fe-more-horizontal:before { + content: "\e999"; +} + +.fe-more-vertical:before { + content: "\e99a"; +} + +.fe-move:before { + content: "\e99b"; +} + +.fe-music:before { + content: "\e99c"; +} + +.fe-navigation:before { + content: "\e99d"; +} + +.fe-navigation-2:before { + content: "\e99e"; +} + +.fe-octagon:before { + content: "\e99f"; +} + +.fe-package:before { + content: "\e9a0"; +} + +.fe-paperclip:before { + content: "\e9a1"; +} + +.fe-pause:before { + content: "\e9a2"; +} + +.fe-pause-circle:before { + content: "\e9a3"; +} + +.fe-percent:before { + content: "\e9a4"; +} + +.fe-phone:before { + content: "\e9a5"; +} + +.fe-phone-call:before { + content: "\e9a6"; +} + +.fe-phone-forwarded:before { + content: "\e9a7"; +} + +.fe-phone-incoming:before { + content: "\e9a8"; +} + +.fe-phone-missed:before { + content: "\e9a9"; +} + +.fe-phone-off:before { + content: "\e9aa"; +} + +.fe-phone-outgoing:before { + content: "\e9ab"; +} + +.fe-pie-chart:before { + content: "\e9ac"; +} + +.fe-play:before { + content: "\e9ad"; +} + +.fe-play-circle:before { + content: "\e9ae"; +} + +.fe-plus:before { + content: "\e9af"; +} + +.fe-plus-circle:before { + content: "\e9b0"; +} + +.fe-plus-square:before { + content: "\e9b1"; +} + +.fe-pocket:before { + content: "\e9b2"; +} + +.fe-power:before { + content: "\e9b3"; +} + +.fe-printer:before { + content: "\e9b4"; +} + +.fe-radio:before { + content: "\e9b5"; +} + +.fe-refresh-ccw:before { + content: "\e9b6"; +} + +.fe-refresh-cw:before { + content: "\e9b7"; +} + +.fe-repeat:before { + content: "\e9b8"; +} + +.fe-rewind:before { + content: "\e9b9"; +} + +.fe-rotate-ccw:before { + content: "\e9ba"; +} + +.fe-rotate-cw:before { + content: "\e9bb"; +} + +.fe-rss:before { + content: "\e9bc"; +} + +.fe-save:before { + content: "\e9bd"; +} + +.fe-scissors:before { + content: "\e9be"; +} + +.fe-search:before { + content: "\e9bf"; +} + +.fe-send:before { + content: "\e9c0"; +} + +.fe-server:before { + content: "\e9c1"; +} + +.fe-settings:before { + content: "\e9c2"; +} + +.fe-share:before { + content: "\e9c3"; +} + +.fe-share-2:before { + content: "\e9c4"; +} + +.fe-shield:before { + content: "\e9c5"; +} + +.fe-shield-off:before { + content: "\e9c6"; +} + +.fe-shopping-bag:before { + content: "\e9c7"; +} + +.fe-shopping-cart:before { + content: "\e9c8"; +} + +.fe-shuffle:before { + content: "\e9c9"; +} + +.fe-sidebar:before { + content: "\e9ca"; +} + +.fe-skip-back:before { + content: "\e9cb"; +} + +.fe-skip-forward:before { + content: "\e9cc"; +} + +.fe-slack:before { + content: "\e9cd"; +} + +.fe-slash:before { + content: "\e9ce"; +} + +.fe-sliders:before { + content: "\e9cf"; +} + +.fe-smartphone:before { + content: "\e9d0"; +} + +.fe-speaker:before { + content: "\e9d1"; +} + +.fe-square:before { + content: "\e9d2"; +} + +.fe-star:before { + content: "\e9d3"; +} + +.fe-stop-circle:before { + content: "\e9d4"; +} + +.fe-sun:before { + content: "\e9d5"; +} + +.fe-sunrise:before { + content: "\e9d6"; +} + +.fe-sunset:before { + content: "\e9d7"; +} + +.fe-tablet:before { + content: "\e9d8"; +} + +.fe-tag:before { + content: "\e9d9"; +} + +.fe-target:before { + content: "\e9da"; +} + +.fe-terminal:before { + content: "\e9db"; +} + +.fe-thermometer:before { + content: "\e9dc"; +} + +.fe-thumbs-down:before { + content: "\e9dd"; +} + +.fe-thumbs-up:before { + content: "\e9de"; +} + +.fe-toggle-left:before { + content: "\e9df"; +} + +.fe-toggle-right:before { + content: "\e9e0"; +} + +.fe-trash:before { + content: "\e9e1"; +} + +.fe-trash-2:before { + content: "\e9e2"; +} + +.fe-trending-down:before { + content: "\e9e3"; +} + +.fe-trending-up:before { + content: "\e9e4"; +} + +.fe-triangle:before { + content: "\e9e5"; +} + +.fe-truck:before { + content: "\e9e6"; +} + +.fe-tv:before { + content: "\e9e7"; +} + +.fe-twitter:before { + content: "\e9e8"; +} + +.fe-type:before { + content: "\e9e9"; +} + +.fe-umbrella:before { + content: "\e9ea"; +} + +.fe-underline:before { + content: "\e9eb"; +} + +.fe-unlock:before { + content: "\e9ec"; +} + +.fe-upload:before { + content: "\e9ed"; +} + +.fe-upload-cloud:before { + content: "\e9ee"; +} + +.fe-user:before { + content: "\e9ef"; +} + +.fe-user-check:before { + content: "\e9f0"; +} + +.fe-user-minus:before { + content: "\e9f1"; +} + +.fe-user-plus:before { + content: "\e9f2"; +} + +.fe-user-x:before { + content: "\e9f3"; +} + +.fe-users:before { + content: "\e9f4"; +} + +.fe-video:before { + content: "\e9f5"; +} + +.fe-video-off:before { + content: "\e9f6"; +} + +.fe-voicemail:before { + content: "\e9f7"; +} + +.fe-volume:before { + content: "\e9f8"; +} + +.fe-volume-1:before { + content: "\e9f9"; +} + +.fe-volume-2:before { + content: "\e9fa"; +} + +.fe-volume-x:before { + content: "\e9fb"; +} + +.fe-watch:before { + content: "\e9fc"; +} + +.fe-wifi:before { + content: "\e9fd"; +} + +.fe-wifi-off:before { + content: "\e9fe"; +} + +.fe-wind:before { + content: "\e9ff"; +} + +.fe-x:before { + content: "\ea00"; +} + +.fe-x-circle:before { + content: "\ea01"; +} + +.fe-x-square:before { + content: "\ea02"; +} + +.fe-zap:before { + content: "\ea03"; +} + +.fe-zap-off:before { + content: "\ea04"; +} + +.fe-zoom-in:before { + content: "\ea05"; +} + +.fe-zoom-out:before { + content: "\ea06"; +} diff --git a/public/v2/assets/css/gf-source.css b/public/v2/assets/css/gf-source.css new file mode 100644 index 0000000000..1f95488861 --- /dev/null +++ b/public/v2/assets/css/gf-source.css @@ -0,0 +1,523 @@ +/* + * google-fonts.css + * Copyright (c) 2017 thegrumpydictator@gmail.com + * + * This file is part of Firefly III. + * + * Firefly III is free software: you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Firefly III is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with Firefly III. If not, see . + */ + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 300; + src: local('Source Sans Pro Light Italic'), local('SourceSansPro-LightItalic'), url('../fonts/SourceSansPro-LightItalic-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-LightItalic-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 300; + src: local('Source Sans Pro Light Italic'), local('SourceSansPro-LightItalic'), url('../fonts/SourceSansPro-LightItalic-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-LightItalic-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 300; + src: local('Source Sans Pro Light Italic'), local('SourceSansPro-LightItalic'), url('../fonts/SourceSansPro-LightItalic-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-LightItalic-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 300; + src: local('Source Sans Pro Light Italic'), local('SourceSansPro-LightItalic'), url('../fonts/SourceSansPro-LightItalic-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-LightItalic-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 300; + src: local('Source Sans Pro Light Italic'), local('SourceSansPro-LightItalic'), url('../fonts/SourceSansPro-LightItalic-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-LightItalic-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 300; + src: local('Source Sans Pro Light Italic'), local('SourceSansPro-LightItalic'), url('../fonts/SourceSansPro-LightItalic-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-LightItalic-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 300; + src: local('Source Sans Pro Light Italic'), local('SourceSansPro-LightItalic'), url('../fonts/SourceSansPro-LightItalic-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-LightItalic-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 400; + src: local('Source Sans Pro Italic'), local('SourceSansPro-Italic'), url('../fonts/SourceSansPro-Italic-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Italic-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 400; + src: local('Source Sans Pro Italic'), local('SourceSansPro-Italic'), url('../fonts/SourceSansPro-Italic-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-Italic-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 400; + src: local('Source Sans Pro Italic'), local('SourceSansPro-Italic'), url('../fonts/SourceSansPro-Italic-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Italic-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 400; + src: local('Source Sans Pro Italic'), local('SourceSansPro-Italic'), url('../fonts/SourceSansPro-Italic-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-Italic-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 400; + src: local('Source Sans Pro Italic'), local('SourceSansPro-Italic'), url('../fonts/SourceSansPro-Italic-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-Italic-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 400; + src: local('Source Sans Pro Italic'), local('SourceSansPro-Italic'), url('../fonts/SourceSansPro-Italic-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Italic-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 400; + src: local('Source Sans Pro Italic'), local('SourceSansPro-Italic'), url('../fonts/SourceSansPro-Italic-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-Italic-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 600; + src: local('Source Sans Pro SemiBold Italic'), local('SourceSansPro-SemiBoldItalic'), url('../fonts/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 600; + src: local('Source Sans Pro SemiBold Italic'), local('SourceSansPro-SemiBoldItalic'), url('../fonts/SourceSansPro-SemiBoldItalic-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBoldItalic-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 600; + src: local('Source Sans Pro SemiBold Italic'), local('SourceSansPro-SemiBoldItalic'), url('../fonts/SourceSansPro-SemiBoldItalic-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBoldItalic-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 600; + src: local('Source Sans Pro SemiBold Italic'), local('SourceSansPro-SemiBoldItalic'), url('../fonts/SourceSansPro-SemiBoldItalic-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBoldItalic-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 600; + src: local('Source Sans Pro SemiBold Italic'), local('SourceSansPro-SemiBoldItalic'), url('../fonts/SourceSansPro-SemiBoldItalic-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBoldItalic-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 600; + src: local('Source Sans Pro SemiBold Italic'), local('SourceSansPro-SemiBoldItalic'), url('../fonts/SourceSansPro-SemiBoldItalic-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBoldItalic-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: italic; + font-weight: 600; + src: local('Source Sans Pro SemiBold Italic'), local('SourceSansPro-SemiBoldItalic'), url('../fonts/SourceSansPro-SemiBoldItalic-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBoldItalic-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold Italic'), local('SourceSansPro-BoldItalic'), url('../fonts/SourceSansPro-BoldItalic-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-BoldItalic-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold Italic'), local('SourceSansPro-BoldItalic'), url('../fonts/SourceSansPro-BoldItalic-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-BoldItalic-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold Italic'), local('SourceSansPro-BoldItalic'), url('../fonts/SourceSansPro-BoldItalic-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-BoldItalic-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold Italic'), local('SourceSansPro-BoldItalic'), url('../fonts/SourceSansPro-BoldItalic-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-BoldItalic-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold Italic'), local('SourceSansPro-BoldItalic'), url('../fonts/SourceSansPro-BoldItalic-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-BoldItalic-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold Italic'), local('SourceSansPro-BoldItalic'), url('../fonts/SourceSansPro-BoldItalic-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-BoldItalic-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold Italic'), local('SourceSansPro-BoldItalic'), url('../fonts/SourceSansPro-BoldItalic-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-BoldItalic-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 300; + src: local('Source Sans Pro Light'), local('SourceSansPro-Light'), url('../fonts/SourceSansPro-Light-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Light-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 300; + src: local('Source Sans Pro Light'), local('SourceSansPro-Light'), url('../fonts/SourceSansPro-Light-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-Light-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 300; + src: local('Source Sans Pro Light'), local('SourceSansPro-Light'), url('../fonts/SourceSansPro-Light-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Light-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 300; + src: local('Source Sans Pro Light'), local('SourceSansPro-Light'), url('../fonts/SourceSansPro-Light-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-Light-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 300; + src: local('Source Sans Pro Light'), local('SourceSansPro-Light'), url('../fonts/SourceSansPro-Light-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-Light-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 300; + src: local('Source Sans Pro Light'), local('SourceSansPro-Light'), url('../fonts/SourceSansPro-Light-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Light-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 300; + src: local('Source Sans Pro Light'), local('SourceSansPro-Light'), url('../fonts/SourceSansPro-Light-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-Light-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 400; + src: local('Source Sans Pro Regular'), local('SourceSansPro-Regular'), url('../fonts/SourceSansPro-Regular-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Regular-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 400; + src: local('Source Sans Pro Regular'), local('SourceSansPro-Regular'), url('../fonts/SourceSansPro-Regular-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-Regular-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 400; + src: local('Source Sans Pro Regular'), local('SourceSansPro-Regular'), url('../fonts/SourceSansPro-Regular-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Regular-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 400; + src: local('Source Sans Pro Regular'), local('SourceSansPro-Regular'), url('../fonts/SourceSansPro-Regular-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-Regular-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 400; + src: local('Source Sans Pro Regular'), local('SourceSansPro-Regular'), url('../fonts/SourceSansPro-Regular-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-Regular-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 400; + src: local('Source Sans Pro Regular'), local('SourceSansPro-Regular'), url('../fonts/SourceSansPro-Regular-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Regular-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 400; + src: local('Source Sans Pro Regular'), local('SourceSansPro-Regular'), url('../fonts/SourceSansPro-Regular-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-Regular-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 600; + src: local('Source Sans Pro SemiBold'), local('SourceSansPro-SemiBold'), url('../fonts/SourceSansPro-SemiBold-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBold-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 600; + src: local('Source Sans Pro SemiBold'), local('SourceSansPro-SemiBold'), url('../fonts/SourceSansPro-SemiBold-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBold-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 600; + src: local('Source Sans Pro SemiBold'), local('SourceSansPro-SemiBold'), url('../fonts/SourceSansPro-SemiBold-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBold-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 600; + src: local('Source Sans Pro SemiBold'), local('SourceSansPro-SemiBold'), url('../fonts/SourceSansPro-SemiBold-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBold-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 600; + src: local('Source Sans Pro SemiBold'), local('SourceSansPro-SemiBold'), url('../fonts/SourceSansPro-SemiBold-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBold-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 600; + src: local('Source Sans Pro SemiBold'), local('SourceSansPro-SemiBold'), url('../fonts/SourceSansPro-SemiBold-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBold-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 600; + src: local('Source Sans Pro SemiBold'), local('SourceSansPro-SemiBold'), url('../fonts/SourceSansPro-SemiBold-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-SemiBold-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} + +/* cyrillic-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold'), local('SourceSansPro-Bold'), url('../fonts/SourceSansPro-Bold-cyrillic-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Bold-cyrillic-ext.woff') format('woff'); + unicode-range: U+0460-052F, U+20B4, U+2DE0-2DFF, U+A640-A69F; +} + +/* cyrillic */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold'), local('SourceSansPro-Bold'), url('../fonts/SourceSansPro-Bold-cyrillic.woff2') format('woff2'), url('../fonts/SourceSansPro-Bold-cyrillic.woff') format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} + +/* greek-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold'), local('SourceSansPro-Bold'), url('../fonts/SourceSansPro-Bold-greek-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Bold-greek-ext.woff') format('woff'); + unicode-range: U+1F00-1FFF; +} + +/* greek */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold'), local('SourceSansPro-Bold'), url('../fonts/SourceSansPro-Bold-greek.woff2') format('woff2'), url('../fonts/SourceSansPro-Bold-greek.woff') format('woff'); + unicode-range: U+0370-03FF; +} + +/* vietnamese */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold'), local('SourceSansPro-Bold'), url('../fonts/SourceSansPro-Bold-vietnamese.woff2') format('woff2'), url('../fonts/SourceSansPro-Bold-vietnamese.woff') format('woff'); + unicode-range: U+0102-0103, U+1EA0-1EF9, U+20AB; +} + +/* latin-ext */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold'), local('SourceSansPro-Bold'), url('../fonts/SourceSansPro-Bold-latin-ext.woff2') format('woff2'), url('../fonts/SourceSansPro-Bold-latin-ext.woff') format('woff'); + unicode-range: U+0100-024F, U+1E00-1EFF, U+20A0-20AB, U+20AD-20CF, U+2C60-2C7F, U+A720-A7FF; +} + +/* latin */ +@font-face { + font-family: 'Source Sans Pro'; + font-style: normal; + font-weight: 700; + src: local('Source Sans Pro Bold'), local('SourceSansPro-Bold'), url('../fonts/SourceSansPro-Bold-latin.woff2') format('woff2'), url('../fonts/SourceSansPro-Bold-latin.woff') format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2212, U+2215; +} diff --git a/public/v2/assets/css/tabler.css b/public/v2/assets/css/tabler.css new file mode 100755 index 0000000000..1010475819 --- /dev/null +++ b/public/v2/assets/css/tabler.css @@ -0,0 +1,18610 @@ +@charset "UTF-8"; +/** +Dashboard UI + */ +/*! + * Bootstrap v4.1.0 (https://getbootstrap.com/) + * Copyright 2011-2018 The Bootstrap Authors + * Copyright 2011-2018 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +:root { + --blue: #467fcf; + --indigo: #6574cd; + --purple: #a55eea; + --pink: #f66d9b; + --red: #cd201f; + --orange: #fd9644; + --yellow: #f1c40f; + --green: #5eba00; + --teal: #2bcbba; + --cyan: #17a2b8; + --white: #fff; + --gray: #868e96; + --gray-dark: #343a40; + --azure: #45aaf2; + --lime: #7bd235; + --primary: #467fcf; + --secondary: #868e96; + --success: #5eba00; + --info: #45aaf2; + --warning: #f1c40f; + --danger: #cd201f; + --light: #f8f9fa; + --dark: #343a40; + --breakpoint-xs: 0; + --breakpoint-sm: 576px; + --breakpoint-md: 768px; + --breakpoint-lg: 992px; + --breakpoint-xl: 1280px; + --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol"; + --font-family-monospace: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +*, +*::before, +*::after { + box-sizing: border-box; +} + +html { + font-family: sans-serif; + line-height: 1.15; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; + -ms-overflow-style: scrollbar; + -webkit-tap-highlight-color: transparent; +} + +@-ms-viewport { + width: device-width; +} + +article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section { + display: block; +} + +body { + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.5; + color: #495057; + text-align: left; + background-color: #f5f7fb; +} + +[tabindex="-1"]:focus { + outline: 0 !important; +} + +hr { + box-sizing: content-box; + height: 0; + overflow: visible; +} + +h1, h2, h3, h4, h5, h6 { + margin-top: 0; + margin-bottom: 0.66em; +} + +p { + margin-top: 0; + margin-bottom: 1rem; +} + +abbr[title], +abbr[data-original-title] { + text-decoration: underline; + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; + cursor: help; + border-bottom: 0; +} + +address { + margin-bottom: 1rem; + font-style: normal; + line-height: inherit; +} + +ol, +ul, +dl { + margin-top: 0; + margin-bottom: 1rem; +} + +ol ol, +ul ul, +ol ul, +ul ol { + margin-bottom: 0; +} + +dt { + font-weight: 700; +} + +dd { + margin-bottom: .5rem; + margin-left: 0; +} + +blockquote { + margin: 0 0 1rem; +} + +dfn { + font-style: italic; +} + +b, +strong { + font-weight: bolder; +} + +small { + font-size: 80%; +} + +sub, +sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} + +sub { + bottom: -.25em; +} + +sup { + top: -.5em; +} + +a { + color: #467fcf; + text-decoration: none; + background-color: transparent; + -webkit-text-decoration-skip: objects; +} + +a:hover { + color: #295a9f; + text-decoration: underline; +} + +a:not([href]):not([tabindex]) { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):focus { + outline: 0; +} + +pre, +code, +kbd, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +pre { + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + -ms-overflow-style: scrollbar; +} + +figure { + margin: 0 0 1rem; +} + +img { + vertical-align: middle; + border-style: none; +} + +svg:not(:root) { + overflow: hidden; +} + +table { + border-collapse: collapse; +} + +caption { + padding-top: 0.75rem; + padding-bottom: 0.75rem; + color: #9aa0ac; + text-align: left; + caption-side: bottom; +} + +th { + text-align: inherit; +} + +label { + display: inline-block; + margin-bottom: 0.5rem; +} + +button { + border-radius: 0; +} + +button:focus { + outline: 1px dotted; + outline: 5px auto -webkit-focus-ring-color; +} + +input, +button, +select, +optgroup, +textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height: inherit; +} + +button, +input { + overflow: visible; +} + +button, +select { + text-transform: none; +} + +button, +html [type="button"], +[type="reset"], +[type="submit"] { + -webkit-appearance: button; +} + +button::-moz-focus-inner, +[type="button"]::-moz-focus-inner, +[type="reset"]::-moz-focus-inner, +[type="submit"]::-moz-focus-inner { + padding: 0; + border-style: none; +} + +input[type="radio"], +input[type="checkbox"] { + box-sizing: border-box; + padding: 0; +} + +input[type="date"], +input[type="time"], +input[type="datetime-local"], +input[type="month"] { + -webkit-appearance: listbox; +} + +textarea { + overflow: auto; + resize: vertical; +} + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; +} + +legend { + display: block; + width: 100%; + max-width: 100%; + padding: 0; + margin-bottom: .5rem; + font-size: 1.5rem; + line-height: inherit; + color: inherit; + white-space: normal; +} + +progress { + vertical-align: baseline; +} + +[type="number"]::-webkit-inner-spin-button, +[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +[type="search"] { + outline-offset: -2px; + -webkit-appearance: none; +} + +[type="search"]::-webkit-search-cancel-button, +[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +::-webkit-file-upload-button { + font: inherit; + -webkit-appearance: button; +} + +output { + display: inline-block; +} + +summary { + display: list-item; + cursor: pointer; +} + +template { + display: none; +} + +[hidden] { + display: none !important; +} + +h1, h2, h3, h4, h5, h6, +.h1, .h2, .h3, .h4, .h5, .h6 { + margin-bottom: 0.66em; + font-family: inherit; + font-weight: 600; + line-height: 1.1; + color: inherit; +} + +h1, .h1 { + font-size: 2rem; +} + +h2, .h2 { + font-size: 1.75rem; +} + +h3, .h3 { + font-size: 1.5rem; +} + +h4, .h4 { + font-size: 1.125rem; +} + +h5, .h5 { + font-size: 1rem; +} + +h6, .h6 { + font-size: 0.875rem; +} + +.lead { + font-size: 1.171875rem; + font-weight: 300; +} + +.display-1 { + font-size: 4.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-2 { + font-size: 4rem; + font-weight: 300; + line-height: 1.1; +} + +.display-3 { + font-size: 3.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-4 { + font-size: 3rem; + font-weight: 300; + line-height: 1.1; +} + +hr { + margin-top: 1rem; + margin-bottom: 1rem; + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +small, +.small { + font-size: 87.5%; + font-weight: 400; +} + +mark, +.mark { + padding: 0.2em; + background-color: #fcf8e3; +} + +.list-unstyled { + padding-left: 0; + list-style: none; +} + +.list-inline { + padding-left: 0; + list-style: none; +} + +.list-inline-item { + display: inline-block; +} + +.list-inline-item:not(:last-child) { + margin-right: 0.5rem; +} + +.initialism { + font-size: 90%; + text-transform: uppercase; +} + +.blockquote { + margin-bottom: 1rem; + font-size: 1.171875rem; +} + +.blockquote-footer { + display: block; + font-size: 80%; + color: #868e96; +} + +.blockquote-footer::before { + content: "\2014 \00A0"; +} + +.img-fluid { + max-width: 100%; + height: auto; +} + +.img-thumbnail { + padding: 0.25rem; + background-color: #fff; + border: 1px solid #dee2e6; + border-radius: 3px; + max-width: 100%; + height: auto; +} + +.figure { + display: inline-block; +} + +.figure-img { + margin-bottom: 0.5rem; + line-height: 1; +} + +.figure-caption { + font-size: 90%; + color: #868e96; +} + +code, +kbd, +pre, +samp { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +code { + font-size: 85%; + color: inherit; + word-break: break-word; +} + +a > code { + color: inherit; +} + +kbd { + padding: 0.2rem 0.4rem; + font-size: 85%; + color: #fff; + background-color: #343a40; + border-radius: 3px; +} + +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: 700; +} + +pre { + display: block; + font-size: 85%; + color: #212529; +} + +pre code { + font-size: inherit; + color: inherit; + word-break: normal; +} + +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} + +.container { + width: 100%; + padding-right: 0.75rem; + padding-left: 0.75rem; + margin-right: auto; + margin-left: auto; +} + +@media (min-width: 576px) { + .container { + max-width: 540px; + } +} + +@media (min-width: 768px) { + .container { + max-width: 720px; + } +} + +@media (min-width: 992px) { + .container { + max-width: 960px; + } +} + +@media (min-width: 1280px) { + .container { + max-width: 1200px; + } +} + +.container-fluid { + width: 100%; + padding-right: 0.75rem; + padding-left: 0.75rem; + margin-right: auto; + margin-left: auto; +} + +.row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-right: -0.75rem; + margin-left: -0.75rem; +} + +.no-gutters { + margin-right: 0; + margin-left: 0; +} + +.no-gutters > .col, +.no-gutters > [class*="col-"] { + padding-right: 0; + padding-left: 0; +} + +.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col, +.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm, +.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md, +.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg, +.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl, +.col-xl-auto { + position: relative; + width: 100%; + min-height: 1px; + padding-right: 0.75rem; + padding-left: 0.75rem; +} + +.col { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; +} + +.col-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; +} + +.col-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; +} + +.col-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; +} + +.col-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; +} + +.col-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; +} + +.col-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; +} + +.col-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; +} + +.col-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; +} + +.col-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; +} + +.col-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; +} + +.col-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; +} + +.col-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; +} + +.col-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; +} + +.order-first { + -ms-flex-order: -1; + order: -1; +} + +.order-last { + -ms-flex-order: 13; + order: 13; +} + +.order-0 { + -ms-flex-order: 0; + order: 0; +} + +.order-1 { + -ms-flex-order: 1; + order: 1; +} + +.order-2 { + -ms-flex-order: 2; + order: 2; +} + +.order-3 { + -ms-flex-order: 3; + order: 3; +} + +.order-4 { + -ms-flex-order: 4; + order: 4; +} + +.order-5 { + -ms-flex-order: 5; + order: 5; +} + +.order-6 { + -ms-flex-order: 6; + order: 6; +} + +.order-7 { + -ms-flex-order: 7; + order: 7; +} + +.order-8 { + -ms-flex-order: 8; + order: 8; +} + +.order-9 { + -ms-flex-order: 9; + order: 9; +} + +.order-10 { + -ms-flex-order: 10; + order: 10; +} + +.order-11 { + -ms-flex-order: 11; + order: 11; +} + +.order-12 { + -ms-flex-order: 12; + order: 12; +} + +.offset-1 { + margin-left: 8.33333333%; +} + +.offset-2 { + margin-left: 16.66666667%; +} + +.offset-3 { + margin-left: 25%; +} + +.offset-4 { + margin-left: 33.33333333%; +} + +.offset-5 { + margin-left: 41.66666667%; +} + +.offset-6 { + margin-left: 50%; +} + +.offset-7 { + margin-left: 58.33333333%; +} + +.offset-8 { + margin-left: 66.66666667%; +} + +.offset-9 { + margin-left: 75%; +} + +.offset-10 { + margin-left: 83.33333333%; +} + +.offset-11 { + margin-left: 91.66666667%; +} + +@media (min-width: 576px) { + .col-sm { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-sm-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-sm-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-sm-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-sm-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-sm-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-sm-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-sm-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-sm-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-sm-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-sm-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-sm-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-sm-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-sm-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-sm-first { + -ms-flex-order: -1; + order: -1; + } + .order-sm-last { + -ms-flex-order: 13; + order: 13; + } + .order-sm-0 { + -ms-flex-order: 0; + order: 0; + } + .order-sm-1 { + -ms-flex-order: 1; + order: 1; + } + .order-sm-2 { + -ms-flex-order: 2; + order: 2; + } + .order-sm-3 { + -ms-flex-order: 3; + order: 3; + } + .order-sm-4 { + -ms-flex-order: 4; + order: 4; + } + .order-sm-5 { + -ms-flex-order: 5; + order: 5; + } + .order-sm-6 { + -ms-flex-order: 6; + order: 6; + } + .order-sm-7 { + -ms-flex-order: 7; + order: 7; + } + .order-sm-8 { + -ms-flex-order: 8; + order: 8; + } + .order-sm-9 { + -ms-flex-order: 9; + order: 9; + } + .order-sm-10 { + -ms-flex-order: 10; + order: 10; + } + .order-sm-11 { + -ms-flex-order: 11; + order: 11; + } + .order-sm-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-sm-0 { + margin-left: 0; + } + .offset-sm-1 { + margin-left: 8.33333333%; + } + .offset-sm-2 { + margin-left: 16.66666667%; + } + .offset-sm-3 { + margin-left: 25%; + } + .offset-sm-4 { + margin-left: 33.33333333%; + } + .offset-sm-5 { + margin-left: 41.66666667%; + } + .offset-sm-6 { + margin-left: 50%; + } + .offset-sm-7 { + margin-left: 58.33333333%; + } + .offset-sm-8 { + margin-left: 66.66666667%; + } + .offset-sm-9 { + margin-left: 75%; + } + .offset-sm-10 { + margin-left: 83.33333333%; + } + .offset-sm-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 768px) { + .col-md { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-md-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-md-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-md-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-md-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-md-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-md-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-md-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-md-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-md-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-md-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-md-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-md-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-md-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-md-first { + -ms-flex-order: -1; + order: -1; + } + .order-md-last { + -ms-flex-order: 13; + order: 13; + } + .order-md-0 { + -ms-flex-order: 0; + order: 0; + } + .order-md-1 { + -ms-flex-order: 1; + order: 1; + } + .order-md-2 { + -ms-flex-order: 2; + order: 2; + } + .order-md-3 { + -ms-flex-order: 3; + order: 3; + } + .order-md-4 { + -ms-flex-order: 4; + order: 4; + } + .order-md-5 { + -ms-flex-order: 5; + order: 5; + } + .order-md-6 { + -ms-flex-order: 6; + order: 6; + } + .order-md-7 { + -ms-flex-order: 7; + order: 7; + } + .order-md-8 { + -ms-flex-order: 8; + order: 8; + } + .order-md-9 { + -ms-flex-order: 9; + order: 9; + } + .order-md-10 { + -ms-flex-order: 10; + order: 10; + } + .order-md-11 { + -ms-flex-order: 11; + order: 11; + } + .order-md-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-md-0 { + margin-left: 0; + } + .offset-md-1 { + margin-left: 8.33333333%; + } + .offset-md-2 { + margin-left: 16.66666667%; + } + .offset-md-3 { + margin-left: 25%; + } + .offset-md-4 { + margin-left: 33.33333333%; + } + .offset-md-5 { + margin-left: 41.66666667%; + } + .offset-md-6 { + margin-left: 50%; + } + .offset-md-7 { + margin-left: 58.33333333%; + } + .offset-md-8 { + margin-left: 66.66666667%; + } + .offset-md-9 { + margin-left: 75%; + } + .offset-md-10 { + margin-left: 83.33333333%; + } + .offset-md-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 992px) { + .col-lg { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-lg-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-lg-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-lg-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-lg-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-lg-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-lg-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-lg-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-lg-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-lg-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-lg-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-lg-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-lg-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-lg-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-lg-first { + -ms-flex-order: -1; + order: -1; + } + .order-lg-last { + -ms-flex-order: 13; + order: 13; + } + .order-lg-0 { + -ms-flex-order: 0; + order: 0; + } + .order-lg-1 { + -ms-flex-order: 1; + order: 1; + } + .order-lg-2 { + -ms-flex-order: 2; + order: 2; + } + .order-lg-3 { + -ms-flex-order: 3; + order: 3; + } + .order-lg-4 { + -ms-flex-order: 4; + order: 4; + } + .order-lg-5 { + -ms-flex-order: 5; + order: 5; + } + .order-lg-6 { + -ms-flex-order: 6; + order: 6; + } + .order-lg-7 { + -ms-flex-order: 7; + order: 7; + } + .order-lg-8 { + -ms-flex-order: 8; + order: 8; + } + .order-lg-9 { + -ms-flex-order: 9; + order: 9; + } + .order-lg-10 { + -ms-flex-order: 10; + order: 10; + } + .order-lg-11 { + -ms-flex-order: 11; + order: 11; + } + .order-lg-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-lg-0 { + margin-left: 0; + } + .offset-lg-1 { + margin-left: 8.33333333%; + } + .offset-lg-2 { + margin-left: 16.66666667%; + } + .offset-lg-3 { + margin-left: 25%; + } + .offset-lg-4 { + margin-left: 33.33333333%; + } + .offset-lg-5 { + margin-left: 41.66666667%; + } + .offset-lg-6 { + margin-left: 50%; + } + .offset-lg-7 { + margin-left: 58.33333333%; + } + .offset-lg-8 { + margin-left: 66.66666667%; + } + .offset-lg-9 { + margin-left: 75%; + } + .offset-lg-10 { + margin-left: 83.33333333%; + } + .offset-lg-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 1280px) { + .col-xl { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-xl-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-xl-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-xl-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-xl-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-xl-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-xl-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-xl-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-xl-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-xl-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-xl-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-xl-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-xl-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-xl-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-xl-first { + -ms-flex-order: -1; + order: -1; + } + .order-xl-last { + -ms-flex-order: 13; + order: 13; + } + .order-xl-0 { + -ms-flex-order: 0; + order: 0; + } + .order-xl-1 { + -ms-flex-order: 1; + order: 1; + } + .order-xl-2 { + -ms-flex-order: 2; + order: 2; + } + .order-xl-3 { + -ms-flex-order: 3; + order: 3; + } + .order-xl-4 { + -ms-flex-order: 4; + order: 4; + } + .order-xl-5 { + -ms-flex-order: 5; + order: 5; + } + .order-xl-6 { + -ms-flex-order: 6; + order: 6; + } + .order-xl-7 { + -ms-flex-order: 7; + order: 7; + } + .order-xl-8 { + -ms-flex-order: 8; + order: 8; + } + .order-xl-9 { + -ms-flex-order: 9; + order: 9; + } + .order-xl-10 { + -ms-flex-order: 10; + order: 10; + } + .order-xl-11 { + -ms-flex-order: 11; + order: 11; + } + .order-xl-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-xl-0 { + margin-left: 0; + } + .offset-xl-1 { + margin-left: 8.33333333%; + } + .offset-xl-2 { + margin-left: 16.66666667%; + } + .offset-xl-3 { + margin-left: 25%; + } + .offset-xl-4 { + margin-left: 33.33333333%; + } + .offset-xl-5 { + margin-left: 41.66666667%; + } + .offset-xl-6 { + margin-left: 50%; + } + .offset-xl-7 { + margin-left: 58.33333333%; + } + .offset-xl-8 { + margin-left: 66.66666667%; + } + .offset-xl-9 { + margin-left: 75%; + } + .offset-xl-10 { + margin-left: 83.33333333%; + } + .offset-xl-11 { + margin-left: 91.66666667%; + } +} + +.table, .text-wrap table { + width: 100%; + max-width: 100%; + margin-bottom: 1rem; + background-color: transparent; +} + +.table th, .text-wrap table th, +.table td, +.text-wrap table td { + padding: 0.75rem; + vertical-align: top; + border-top: 1px solid #dee2e6; +} + +.table thead th, .text-wrap table thead th { + vertical-align: bottom; + border-bottom: 2px solid #dee2e6; +} + +.table tbody + tbody, .text-wrap table tbody + tbody { + border-top: 2px solid #dee2e6; +} + +.table .table, .text-wrap table .table, .table .text-wrap table, .text-wrap .table table, .text-wrap table table { + background-color: #f5f7fb; +} + +.table-sm th, +.table-sm td { + padding: 0.3rem; +} + +.table-bordered, .text-wrap table { + border: 1px solid #dee2e6; +} + +.table-bordered th, .text-wrap table th, +.table-bordered td, +.text-wrap table td { + border: 1px solid #dee2e6; +} + +.table-bordered thead th, .text-wrap table thead th, +.table-bordered thead td, +.text-wrap table thead td { + border-bottom-width: 2px; +} + +.table-borderless th, +.table-borderless td, +.table-borderless thead th, +.table-borderless tbody + tbody { + border: 0; +} + +.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-hover tbody tr:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-primary, +.table-primary > th, +.table-primary > td { + background-color: #cbdbf2; +} + +.table-hover .table-primary:hover { + background-color: #b7cded; +} + +.table-hover .table-primary:hover > td, +.table-hover .table-primary:hover > th { + background-color: #b7cded; +} + +.table-secondary, +.table-secondary > th, +.table-secondary > td { + background-color: #dddfe2; +} + +.table-hover .table-secondary:hover { + background-color: #cfd2d6; +} + +.table-hover .table-secondary:hover > td, +.table-hover .table-secondary:hover > th { + background-color: #cfd2d6; +} + +.table-success, +.table-success > th, +.table-success > td { + background-color: #d2ecb8; +} + +.table-hover .table-success:hover { + background-color: #c5e7a4; +} + +.table-hover .table-success:hover > td, +.table-hover .table-success:hover > th { + background-color: #c5e7a4; +} + +.table-info, +.table-info > th, +.table-info > td { + background-color: #cbe7fb; +} + +.table-hover .table-info:hover { + background-color: #b3dcf9; +} + +.table-hover .table-info:hover > td, +.table-hover .table-info:hover > th { + background-color: #b3dcf9; +} + +.table-warning, +.table-warning > th, +.table-warning > td { + background-color: #fbeebc; +} + +.table-hover .table-warning:hover { + background-color: #fae8a4; +} + +.table-hover .table-warning:hover > td, +.table-hover .table-warning:hover > th { + background-color: #fae8a4; +} + +.table-danger, +.table-danger > th, +.table-danger > td { + background-color: #f1c1c0; +} + +.table-hover .table-danger:hover { + background-color: #ecacab; +} + +.table-hover .table-danger:hover > td, +.table-hover .table-danger:hover > th { + background-color: #ecacab; +} + +.table-light, +.table-light > th, +.table-light > td { + background-color: #fdfdfe; +} + +.table-hover .table-light:hover { + background-color: #ececf6; +} + +.table-hover .table-light:hover > td, +.table-hover .table-light:hover > th { + background-color: #ececf6; +} + +.table-dark, +.table-dark > th, +.table-dark > td { + background-color: #c6c8ca; +} + +.table-hover .table-dark:hover { + background-color: #b9bbbe; +} + +.table-hover .table-dark:hover > td, +.table-hover .table-dark:hover > th { + background-color: #b9bbbe; +} + +.table-active, +.table-active > th, +.table-active > td { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover > td, +.table-hover .table-active:hover > th { + background-color: rgba(0, 0, 0, 0.04); +} + +.table .thead-dark th, .text-wrap table .thead-dark th { + color: #f5f7fb; + background-color: #212529; + border-color: #32383e; +} + +.table .thead-light th, .text-wrap table .thead-light th { + color: #495057; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.table-dark { + color: #f5f7fb; + background-color: #212529; +} + +.table-dark th, +.table-dark td, +.table-dark thead th { + border-color: #32383e; +} + +.table-dark.table-bordered, .text-wrap table.table-dark { + border: 0; +} + +.table-dark.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(255, 255, 255, 0.05); +} + +.table-dark.table-hover tbody tr:hover { + background-color: rgba(255, 255, 255, 0.075); +} + +@media (max-width: 575.98px) { + .table-responsive-sm { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-sm > .table-bordered, .text-wrap .table-responsive-sm > table { + border: 0; + } +} + +@media (max-width: 767.98px) { + .table-responsive-md { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-md > .table-bordered, .text-wrap .table-responsive-md > table { + border: 0; + } +} + +@media (max-width: 991.98px) { + .table-responsive-lg { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-lg > .table-bordered, .text-wrap .table-responsive-lg > table { + border: 0; + } +} + +@media (max-width: 1279.98px) { + .table-responsive-xl { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-xl > .table-bordered, .text-wrap .table-responsive-xl > table { + border: 0; + } +} + +.table-responsive { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; +} + +.table-responsive > .table-bordered, .text-wrap .table-responsive > table { + border: 0; +} + +.form-control { + display: block; + width: 100%; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.6; + color: #495057; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .form-control { + transition: none; + } +} + +.form-control::-ms-expand { + background-color: transparent; + border: 0; +} + +.form-control:focus { + color: #495057; + background-color: #fff; + border-color: #1991eb; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.form-control::-webkit-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-moz-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:disabled, .form-control[readonly] { + background-color: #f8f9fa; + opacity: 1; +} + +select.form-control:not([size]):not([multiple]) { + height: 2.375rem; +} + +select.form-control:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.form-control-file, +.form-control-range { + display: block; + width: 100%; +} + +.col-form-label { + padding-top: calc(0.375rem + 1px); + padding-bottom: calc(0.375rem + 1px); + margin-bottom: 0; + font-size: inherit; + line-height: 1.6; +} + +.col-form-label-lg { + padding-top: calc(0.5rem + 1px); + padding-bottom: calc(0.5rem + 1px); + font-size: 1.125rem; + line-height: 1.44444444; +} + +.col-form-label-sm { + padding-top: calc(0.25rem + 1px); + padding-bottom: calc(0.25rem + 1px); + font-size: 0.875rem; + line-height: 1.14285714; +} + +.form-control-plaintext { + display: block; + width: 100%; + padding-top: 0.375rem; + padding-bottom: 0.375rem; + margin-bottom: 0; + line-height: 1.6; + color: #495057; + background-color: transparent; + border: solid transparent; + border-width: 1px 0; +} + +.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control, +.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-prepend > .form-control-plaintext.btn, +.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control, +.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-prepend > .form-control-plaintext.btn, +.input-group-lg > .input-group-append > .form-control-plaintext.btn { + padding-right: 0; + padding-left: 0; +} + +.form-control-sm, .input-group-sm > .form-control, +.input-group-sm > .input-group-prepend > .input-group-text, +.input-group-sm > .input-group-append > .input-group-text, +.input-group-sm > .input-group-prepend > .btn, +.input-group-sm > .input-group-append > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.14285714; + border-radius: 3px; +} + +select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(1.8125rem + 2px); +} + +.form-control-lg, .input-group-lg > .form-control, +.input-group-lg > .input-group-prepend > .input-group-text, +.input-group-lg > .input-group-append > .input-group-text, +.input-group-lg > .input-group-prepend > .btn, +.input-group-lg > .input-group-append > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.44444444; + border-radius: 3px; +} + +select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(2.6875rem + 2px); +} + +.form-group { + margin-bottom: 1rem; +} + +.form-text { + display: block; + margin-top: 0.25rem; +} + +.form-row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-right: -5px; + margin-left: -5px; +} + +.form-row > .col, +.form-row > [class*="col-"] { + padding-right: 5px; + padding-left: 5px; +} + +.form-check { + position: relative; + display: block; + padding-left: 1.25rem; +} + +.form-check-input { + position: absolute; + margin-top: 0.3rem; + margin-left: -1.25rem; +} + +.form-check-input:disabled ~ .form-check-label { + color: #9aa0ac; +} + +.form-check-label { + margin-bottom: 0; +} + +.form-check-inline { + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + padding-left: 0; + margin-right: 0.75rem; +} + +.form-check-inline .form-check-input { + position: static; + margin-top: 0; + margin-right: 0.3125rem; + margin-left: 0; +} + +.valid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #5eba00; +} + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(94, 186, 0, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:valid, .form-control.is-valid, .was-validated +.custom-select:valid, +.custom-select.is-valid { + border-color: #5eba00; +} + +.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated +.custom-select:valid:focus, +.custom-select.is-valid:focus { + border-color: #5eba00; + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .form-control:valid ~ .valid-feedback, +.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback, +.form-control.is-valid ~ .valid-tooltip, .was-validated +.custom-select:valid ~ .valid-feedback, +.was-validated +.custom-select:valid ~ .valid-tooltip, +.custom-select.is-valid ~ .valid-feedback, +.custom-select.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { + color: #5eba00; +} + +.was-validated .form-check-input:valid ~ .valid-feedback, +.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback, +.form-check-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label { + color: #5eba00; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before { + background-color: #9eff3b; +} + +.was-validated .custom-control-input:valid ~ .valid-feedback, +.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback, +.custom-control-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before { + background-color: #78ed00; +} + +.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label { + border-color: #5eba00; +} + +.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:valid ~ .valid-feedback, +.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback, +.custom-file-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.invalid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #cd201f; +} + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(205, 32, 31, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated +.custom-select:invalid, +.custom-select.is-invalid { + border-color: #cd201f; +} + +.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated +.custom-select:invalid:focus, +.custom-select.is-invalid:focus { + border-color: #cd201f; + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .form-control:invalid ~ .invalid-feedback, +.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback, +.form-control.is-invalid ~ .invalid-tooltip, .was-validated +.custom-select:invalid ~ .invalid-feedback, +.was-validated +.custom-select:invalid ~ .invalid-tooltip, +.custom-select.is-invalid ~ .invalid-feedback, +.custom-select.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { + color: #cd201f; +} + +.was-validated .form-check-input:invalid ~ .invalid-feedback, +.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback, +.form-check-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label { + color: #cd201f; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before { + background-color: #ec8080; +} + +.was-validated .custom-control-input:invalid ~ .invalid-feedback, +.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback, +.custom-control-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before { + background-color: #e23e3d; +} + +.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label { + border-color: #cd201f; +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:invalid ~ .invalid-feedback, +.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback, +.custom-file-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.form-inline { + display: -ms-flexbox; + display: flex; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; +} + +.form-inline .form-check { + width: 100%; +} + +@media (min-width: 576px) { + .form-inline label { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + margin-bottom: 0; + } + .form-inline .form-group { + display: -ms-flexbox; + display: flex; + -ms-flex: 0 0 auto; + flex: 0 0 auto; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; + margin-bottom: 0; + } + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .form-inline .form-control-plaintext { + display: inline-block; + } + .form-inline .input-group, + .form-inline .custom-select { + width: auto; + } + .form-inline .form-check { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: auto; + padding-left: 0; + } + .form-inline .form-check-input { + position: relative; + margin-top: 0; + margin-right: 0.25rem; + margin-left: 0; + } + .form-inline .custom-control { + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + } + .form-inline .custom-control-label { + margin-bottom: 0; + } +} + +.btn { + display: inline-block; + font-weight: 400; + text-align: center; + white-space: nowrap; + vertical-align: middle; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + border: 1px solid transparent; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.84615385; + border-radius: 3px; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .btn { + transition: none; + } +} + +.btn:hover, .btn:focus { + text-decoration: none; +} + +.btn:focus, .btn.focus { + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.btn.disabled, .btn:disabled { + opacity: 0.65; +} + +.btn:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active { + background-image: none; +} + +a.btn.disabled, +fieldset:disabled a.btn { + pointer-events: none; +} + +.btn-primary { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-primary:focus, .btn-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-primary.disabled, .btn-primary:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, +.show > .btn-primary.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-secondary { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-success { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-success:focus, .btn-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-success.disabled, .btn-success:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, +.show > .btn-success.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-info { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-info:focus, .btn-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-info.disabled, .btn-info:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, +.show > .btn-info.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-warning { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-warning:focus, .btn-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-warning.disabled, .btn-warning:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, +.show > .btn-warning.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-danger { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-danger:focus, .btn-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-danger.disabled, .btn-danger:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, +.show > .btn-danger.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-light { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:hover { + color: #495057; + background-color: #e2e6ea; + border-color: #dae0e5; +} + +.btn-light:focus, .btn-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-light.disabled, .btn-light:disabled { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, +.show > .btn-light.dropdown-toggle { + color: #495057; + background-color: #dae0e5; + border-color: #d3d9df; +} + +.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-dark:focus, .btn-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-dark.disabled, .btn-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, +.show > .btn-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-primary { + color: #467fcf; + background-color: transparent; + background-image: none; + border-color: #467fcf; +} + +.btn-outline-primary:hover { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:focus, .btn-outline-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-primary.disabled, .btn-outline-primary:disabled { + color: #467fcf; + background-color: transparent; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, +.show > .btn-outline-primary.dropdown-toggle { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-secondary { + color: #868e96; + background-color: transparent; + background-image: none; + border-color: #868e96; +} + +.btn-outline-secondary:hover { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:focus, .btn-outline-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-secondary.disabled, .btn-outline-secondary:disabled { + color: #868e96; + background-color: transparent; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, +.show > .btn-outline-secondary.dropdown-toggle { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-success { + color: #5eba00; + background-color: transparent; + background-image: none; + border-color: #5eba00; +} + +.btn-outline-success:hover { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:focus, .btn-outline-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-success.disabled, .btn-outline-success:disabled { + color: #5eba00; + background-color: transparent; +} + +.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, +.show > .btn-outline-success.dropdown-toggle { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-info { + color: #45aaf2; + background-color: transparent; + background-image: none; + border-color: #45aaf2; +} + +.btn-outline-info:hover { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:focus, .btn-outline-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-info.disabled, .btn-outline-info:disabled { + color: #45aaf2; + background-color: transparent; +} + +.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, +.show > .btn-outline-info.dropdown-toggle { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-warning { + color: #f1c40f; + background-color: transparent; + background-image: none; + border-color: #f1c40f; +} + +.btn-outline-warning:hover { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:focus, .btn-outline-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-warning.disabled, .btn-outline-warning:disabled { + color: #f1c40f; + background-color: transparent; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, +.show > .btn-outline-warning.dropdown-toggle { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-danger { + color: #cd201f; + background-color: transparent; + background-image: none; + border-color: #cd201f; +} + +.btn-outline-danger:hover { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:focus, .btn-outline-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-danger.disabled, .btn-outline-danger:disabled { + color: #cd201f; + background-color: transparent; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, +.show > .btn-outline-danger.dropdown-toggle { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-light { + color: #f8f9fa; + background-color: transparent; + background-image: none; + border-color: #f8f9fa; +} + +.btn-outline-light:hover { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:focus, .btn-outline-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-light.disabled, .btn-outline-light:disabled { + color: #f8f9fa; + background-color: transparent; +} + +.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, +.show > .btn-outline-light.dropdown-toggle { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-dark { + color: #343a40; + background-color: transparent; + background-image: none; + border-color: #343a40; +} + +.btn-outline-dark:hover { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:focus, .btn-outline-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-dark.disabled, .btn-outline-dark:disabled { + color: #343a40; + background-color: transparent; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, +.show > .btn-outline-dark.dropdown-toggle { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-link { + font-weight: 400; + color: #467fcf; + background-color: transparent; +} + +.btn-link:hover { + color: #295a9f; + text-decoration: underline; + background-color: transparent; + border-color: transparent; +} + +.btn-link:focus, .btn-link.focus { + text-decoration: underline; + border-color: transparent; + box-shadow: none; +} + +.btn-link:disabled, .btn-link.disabled { + color: #868e96; + pointer-events: none; +} + +.btn-lg, .btn-group-lg > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.625; + border-radius: 3px; +} + +.btn-sm, .btn-group-sm > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.33333333; + border-radius: 3px; +} + +.btn-block { + display: block; + width: 100%; +} + +.btn-block + .btn-block { + margin-top: 0.5rem; +} + +input[type="submit"].btn-block, +input[type="reset"].btn-block, +input[type="button"].btn-block { + width: 100%; +} + +.fade { + transition: opacity 0.15s linear; +} + +@media screen and (prefers-reduced-motion: reduce) { + .fade { + transition: none; + } +} + +.fade:not(.show) { + opacity: 0; +} + +.collapse:not(.show) { + display: none; +} + +.collapsing { + position: relative; + height: 0; + overflow: hidden; + transition: height 0.35s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .collapsing { + transition: none; + } +} + +.dropup, +.dropright, +.dropdown, +.dropleft { + position: relative; +} + +.dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid; + border-right: 0.3em solid transparent; + border-bottom: 0; + border-left: 0.3em solid transparent; +} + +.dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropdown-menu { + position: absolute; + top: 100%; + left: 0; + z-index: 1000; + display: none; + float: left; + min-width: 10rem; + padding: 0.5rem 0; + margin: 0.125rem 0 0; + font-size: 0.9375rem; + color: #495057; + text-align: left; + list-style: none; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.dropdown-menu-right { + right: 0; + left: auto; +} + +.dropup .dropdown-menu { + top: auto; + bottom: 100%; + margin-top: 0; + margin-bottom: 0.125rem; +} + +.dropup .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0; + border-right: 0.3em solid transparent; + border-bottom: 0.3em solid; + border-left: 0.3em solid transparent; +} + +.dropup .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropright .dropdown-menu { + top: 0; + right: auto; + left: 100%; + margin-top: 0; + margin-left: 0.125rem; +} + +.dropright .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0; + border-bottom: 0.3em solid transparent; + border-left: 0.3em solid; +} + +.dropright .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropright .dropdown-toggle::after { + vertical-align: 0; +} + +.dropleft .dropdown-menu { + top: 0; + right: 100%; + left: auto; + margin-top: 0; + margin-right: 0.125rem; +} + +.dropleft .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; +} + +.dropleft .dropdown-toggle::after { + display: none; +} + +.dropleft .dropdown-toggle::before { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0.3em solid; + border-bottom: 0.3em solid transparent; +} + +.dropleft .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropleft .dropdown-toggle::before { + vertical-align: 0; +} + +.dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] { + right: auto; + bottom: auto; +} + +.dropdown-divider { + height: 0; + margin: 0.5rem 0; + overflow: hidden; + border-top: 1px solid #e9ecef; +} + +.dropdown-item { + display: block; + width: 100%; + padding: 0.25rem 1.5rem; + clear: both; + font-weight: 400; + color: #212529; + text-align: inherit; + white-space: nowrap; + background-color: transparent; + border: 0; +} + +.dropdown-item:hover, .dropdown-item:focus { + color: #16181b; + text-decoration: none; + background-color: #f8f9fa; +} + +.dropdown-item.active, .dropdown-item:active { + color: #fff; + text-decoration: none; + background-color: #467fcf; +} + +.dropdown-item.disabled, .dropdown-item:disabled { + color: #868e96; + background-color: transparent; +} + +.dropdown-menu.show { + display: block; +} + +.dropdown-header { + display: block; + padding: 0.5rem 1.5rem; + margin-bottom: 0; + font-size: 0.875rem; + color: #868e96; + white-space: nowrap; +} + +.dropdown-item-text { + display: block; + padding: 0.25rem 1.5rem; + color: #212529; +} + +.btn-group, +.btn-group-vertical { + position: relative; + display: -ms-inline-flexbox; + display: inline-flex; + vertical-align: middle; +} + +.btn-group > .btn, +.btn-group-vertical > .btn { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; +} + +.btn-group > .btn:hover, +.btn-group-vertical > .btn:hover { + z-index: 1; +} + +.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active, +.btn-group-vertical > .btn:focus, +.btn-group-vertical > .btn:active, +.btn-group-vertical > .btn.active { + z-index: 1; +} + +.btn-group .btn + .btn, +.btn-group .btn + .btn-group, +.btn-group .btn-group + .btn, +.btn-group .btn-group + .btn-group, +.btn-group-vertical .btn + .btn, +.btn-group-vertical .btn + .btn-group, +.btn-group-vertical .btn-group + .btn, +.btn-group-vertical .btn-group + .btn-group { + margin-left: -1px; +} + +.btn-toolbar { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.btn-toolbar .input-group { + width: auto; +} + +.btn-group > .btn:first-child { + margin-left: 0; +} + +.btn-group > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group > .btn-group:not(:last-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.btn-group > .btn:not(:first-child), +.btn-group > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.dropdown-toggle-split { + padding-right: 0.5625rem; + padding-left: 0.5625rem; +} + +.dropdown-toggle-split::after, +.dropup .dropdown-toggle-split::after, +.dropright .dropdown-toggle-split::after { + margin-left: 0; +} + +.dropleft .dropdown-toggle-split::before { + margin-right: 0; +} + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { + padding-right: 0.375rem; + padding-left: 0.375rem; +} + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { + padding-right: 0.75rem; + padding-left: 0.75rem; +} + +.btn-group-vertical { + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: center; + justify-content: center; +} + +.btn-group-vertical .btn, +.btn-group-vertical .btn-group { + width: 100%; +} + +.btn-group-vertical > .btn + .btn, +.btn-group-vertical > .btn + .btn-group, +.btn-group-vertical > .btn-group + .btn, +.btn-group-vertical > .btn-group + .btn-group { + margin-top: -1px; + margin-left: 0; +} + +.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group-vertical > .btn-group:not(:last-child) > .btn { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group-vertical > .btn:not(:first-child), +.btn-group-vertical > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.btn-group-toggle > .btn, +.btn-group-toggle > .btn-group > .btn { + margin-bottom: 0; +} + +.btn-group-toggle > .btn input[type="radio"], +.btn-group-toggle > .btn input[type="checkbox"], +.btn-group-toggle > .btn-group > .btn input[type="radio"], +.btn-group-toggle > .btn-group > .btn input[type="checkbox"] { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; +} + +.input-group { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: stretch; + align-items: stretch; + width: 100%; +} + +.input-group > .form-control, +.input-group > .custom-select, +.input-group > .custom-file { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + width: 1%; + margin-bottom: 0; +} + +.input-group > .form-control:focus, +.input-group > .custom-select:focus, +.input-group > .custom-file:focus { + z-index: 3; +} + +.input-group > .form-control + .form-control, +.input-group > .form-control + .custom-select, +.input-group > .form-control + .custom-file, +.input-group > .custom-select + .form-control, +.input-group > .custom-select + .custom-select, +.input-group > .custom-select + .custom-file, +.input-group > .custom-file + .form-control, +.input-group > .custom-file + .custom-select, +.input-group > .custom-file + .custom-file { + margin-left: -1px; +} + +.input-group > .form-control:not(:last-child), +.input-group > .custom-select:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .form-control:not(:first-child), +.input-group > .custom-select:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .custom-file { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.input-group > .custom-file:not(:last-child) .custom-file-label, +.input-group > .custom-file:not(:last-child) .custom-file-label::after { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .custom-file:not(:first-child) .custom-file-label, +.input-group > .custom-file:not(:first-child) .custom-file-label::after { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group-prepend, +.input-group-append { + display: -ms-flexbox; + display: flex; +} + +.input-group-prepend .btn, +.input-group-append .btn { + position: relative; + z-index: 2; +} + +.input-group-prepend .btn + .btn, +.input-group-prepend .btn + .input-group-text, +.input-group-prepend .input-group-text + .input-group-text, +.input-group-prepend .input-group-text + .btn, +.input-group-append .btn + .btn, +.input-group-append .btn + .input-group-text, +.input-group-append .input-group-text + .input-group-text, +.input-group-append .input-group-text + .btn { + margin-left: -1px; +} + +.input-group-prepend { + margin-right: -1px; +} + +.input-group-append { + margin-left: -1px; +} + +.input-group-text { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + padding: 0.375rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.6; + color: #495057; + text-align: center; + white-space: nowrap; + background-color: #fbfbfc; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.input-group-text input[type="radio"], +.input-group-text input[type="checkbox"] { + margin-top: 0; +} + +.input-group > .input-group-prepend > .btn, +.input-group > .input-group-prepend > .input-group-text, +.input-group > .input-group-append:not(:last-child) > .btn, +.input-group > .input-group-append:not(:last-child) > .input-group-text, +.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), +.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .input-group-append > .btn, +.input-group > .input-group-append > .input-group-text, +.input-group > .input-group-prepend:not(:first-child) > .btn, +.input-group > .input-group-prepend:not(:first-child) > .input-group-text, +.input-group > .input-group-prepend:first-child > .btn:not(:first-child), +.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.custom-control { + position: relative; + display: block; + min-height: 1.5rem; + padding-left: 1.5rem; +} + +.custom-control-inline { + display: -ms-inline-flexbox; + display: inline-flex; + margin-right: 1rem; +} + +.custom-control-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-control-input:checked ~ .custom-control-label::before { + color: #fff; + background-color: #467fcf; +} + +.custom-control-input:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-control-input:active ~ .custom-control-label::before { + color: #fff; + background-color: #d4e1f4; +} + +.custom-control-input:disabled ~ .custom-control-label { + color: #868e96; +} + +.custom-control-input:disabled ~ .custom-control-label::before { + background-color: #e9ecef; +} + +.custom-control-label { + margin-bottom: 0; +} + +.custom-control-label::before { + position: absolute; + top: 0.25rem; + left: 0; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + content: ""; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background-color: #dee2e6; +} + +.custom-control-label::after { + position: absolute; + top: 0.25rem; + left: 0; + display: block; + width: 1rem; + height: 1rem; + content: ""; + background-repeat: no-repeat; + background-position: center center; + background-size: 50% 50%; +} + +.custom-checkbox .custom-control-label::before { + border-radius: 3px; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-radio .custom-control-label::before { + border-radius: 50%; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E"); +} + +.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-select { + display: inline-block; + width: 100%; + height: 2.375rem; + padding: 0.5rem 1.75rem 0.5rem 0.75rem; + line-height: 1.5; + color: #495057; + vertical-align: middle; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat right 0.75rem center; + background-size: 8px 10px; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-select:focus { + border-color: #1991eb; + outline: 0; + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(25, 145, 235, 0.5); +} + +.custom-select:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.custom-select[multiple], .custom-select[size]:not([size="1"]) { + height: auto; + padding-right: 0.75rem; + background-image: none; +} + +.custom-select:disabled { + color: #868e96; + background-color: #e9ecef; +} + +.custom-select::-ms-expand { + opacity: 0; +} + +.custom-select-sm { + height: calc(1.8125rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 75%; +} + +.custom-select-lg { + height: calc(2.6875rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 125%; +} + +.custom-file { + position: relative; + display: inline-block; + width: 100%; + height: 2.375rem; + margin-bottom: 0; +} + +.custom-file-input { + position: relative; + z-index: 2; + width: 100%; + height: 2.375rem; + margin: 0; + opacity: 0; +} + +.custom-file-input:focus ~ .custom-file-label { + border-color: #1991eb; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-file-input:focus ~ .custom-file-label::after { + border-color: #1991eb; +} + +.custom-file-input:lang(en) ~ .custom-file-label::after { + content: "Browse"; +} + +.custom-file-label { + position: absolute; + top: 0; + right: 0; + left: 0; + z-index: 1; + height: 2.375rem; + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.custom-file-label::after { + position: absolute; + top: 0; + right: 0; + bottom: 0; + z-index: 3; + display: block; + height: calc(2.375rem - 1px * 2); + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + content: "Browse"; + background-color: #fbfbfc; + border-left: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 0 3px 3px 0; +} + +.custom-range { + width: 100%; + padding-left: 0; + background-color: transparent; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-range:focus { + outline: none; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-thumb { + width: 1rem; + height: 1rem; + margin-top: -0.25rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -webkit-appearance: none; + appearance: none; +} + +.custom-range::-webkit-slider-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-webkit-slider-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-webkit-slider-runnable-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-moz-range-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -moz-appearance: none; + appearance: none; +} + +.custom-range::-moz-range-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-moz-range-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-moz-range-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-ms-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + appearance: none; +} + +.custom-range::-ms-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-ms-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-ms-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: transparent; + border-color: transparent; + border-width: 0.5rem; +} + +.custom-range::-ms-fill-lower { + background-color: #dee2e6; + border-radius: 1rem; +} + +.custom-range::-ms-fill-upper { + margin-right: 15px; + background-color: #dee2e6; + border-radius: 1rem; +} + +.nav { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding-left: 0; + margin-bottom: 0; + list-style: none; +} + +.nav-link { + display: block; + padding: 0.5rem 1rem; +} + +.nav-link:hover, .nav-link:focus { + text-decoration: none; +} + +.nav-link.disabled { + color: #868e96; +} + +.nav-tabs { + border-bottom: 1px solid #dee2e6; +} + +.nav-tabs .nav-item { + margin-bottom: -1px; +} + +.nav-tabs .nav-link { + border: 1px solid transparent; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { + border-color: #e9ecef #e9ecef #dee2e6; +} + +.nav-tabs .nav-link.disabled { + color: #868e96; + background-color: transparent; + border-color: transparent; +} + +.nav-tabs .nav-link.active, +.nav-tabs .nav-item.show .nav-link { + color: #495057; + background-color: transparent; + border-color: #dee2e6 #dee2e6 transparent; +} + +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.nav-pills .nav-link { + border-radius: 3px; +} + +.nav-pills .nav-link.active, +.nav-pills .show > .nav-link { + color: #fff; + background-color: #467fcf; +} + +.nav-fill .nav-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + text-align: center; +} + +.nav-justified .nav-item { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + text-align: center; +} + +.tab-content > .tab-pane { + display: none; +} + +.tab-content > .active { + display: block; +} + +.navbar { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 0.5rem 1rem; +} + +.navbar > .container, +.navbar > .container-fluid { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.navbar-brand { + display: inline-block; + padding-top: 0.359375rem; + padding-bottom: 0.359375rem; + margin-right: 1rem; + font-size: 1.125rem; + line-height: inherit; + white-space: nowrap; +} + +.navbar-brand:hover, .navbar-brand:focus { + text-decoration: none; +} + +.navbar-nav { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + list-style: none; +} + +.navbar-nav .nav-link { + padding-right: 0; + padding-left: 0; +} + +.navbar-nav .dropdown-menu { + position: static; + float: none; +} + +.navbar-text { + display: inline-block; + padding-top: 0.5rem; + padding-bottom: 0.5rem; +} + +.navbar-collapse { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; + -ms-flex-positive: 1; + flex-grow: 1; + -ms-flex-align: center; + align-items: center; +} + +.navbar-toggler { + padding: 0.25rem 0.75rem; + font-size: 1.125rem; + line-height: 1; + background-color: transparent; + border: 1px solid transparent; + border-radius: 3px; +} + +.navbar-toggler:hover, .navbar-toggler:focus { + text-decoration: none; +} + +.navbar-toggler:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + content: ""; + background: no-repeat center center; + background-size: 100% 100%; +} + +@media (max-width: 575.98px) { + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 576px) { + .navbar-expand-sm { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-sm .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-sm .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-sm .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-sm .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-sm .navbar-toggler { + display: none; + } +} + +@media (max-width: 767.98px) { + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 768px) { + .navbar-expand-md { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-md .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-md .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-md .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-md .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-md .navbar-toggler { + display: none; + } +} + +@media (max-width: 991.98px) { + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 992px) { + .navbar-expand-lg { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-lg .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-lg .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-lg .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-lg .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-lg .navbar-toggler { + display: none; + } +} + +@media (max-width: 1279.98px) { + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 1280px) { + .navbar-expand-xl { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-xl .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-xl .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-xl .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-xl .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-xl .navbar-toggler { + display: none; + } +} + +.navbar-expand { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + padding-right: 0; + padding-left: 0; +} + +.navbar-expand .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; +} + +.navbar-expand .navbar-nav .dropdown-menu { + position: absolute; +} + +.navbar-expand .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; +} + +.navbar-expand .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; +} + +.navbar-expand .navbar-toggler { + display: none; +} + +.navbar-light .navbar-brand { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-nav .nav-link { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus { + color: rgba(0, 0, 0, 0.7); +} + +.navbar-light .navbar-nav .nav-link.disabled { + color: rgba(0, 0, 0, 0.3); +} + +.navbar-light .navbar-nav .show > .nav-link, +.navbar-light .navbar-nav .active > .nav-link, +.navbar-light .navbar-nav .nav-link.show, +.navbar-light .navbar-nav .nav-link.active { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-toggler { + color: rgba(0, 0, 0, 0.5); + border-color: rgba(0, 0, 0, 0.1); +} + +.navbar-light .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-light .navbar-text { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-text a { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-dark .navbar-brand { + color: #fff; +} + +.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus { + color: #fff; +} + +.navbar-dark .navbar-nav .nav-link { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus { + color: rgba(255, 255, 255, 0.75); +} + +.navbar-dark .navbar-nav .nav-link.disabled { + color: rgba(255, 255, 255, 0.25); +} + +.navbar-dark .navbar-nav .show > .nav-link, +.navbar-dark .navbar-nav .active > .nav-link, +.navbar-dark .navbar-nav .nav-link.show, +.navbar-dark .navbar-nav .nav-link.active { + color: #fff; +} + +.navbar-dark .navbar-toggler { + color: rgba(255, 255, 255, 0.5); + border-color: rgba(255, 255, 255, 0.1); +} + +.navbar-dark .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-dark .navbar-text { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-text a { + color: #fff; +} + +.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus { + color: #fff; +} + +.card { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + min-width: 0; + word-wrap: break-word; + background-color: #fff; + background-clip: border-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.card > hr { + margin-right: 0; + margin-left: 0; +} + +.card > .list-group:first-child .list-group-item:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.card > .list-group:last-child .list-group-item:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1.5rem; +} + +.card-title { + margin-bottom: 1.5rem; +} + +.card-subtitle { + margin-top: -0.75rem; + margin-bottom: 0; +} + +.card-text:last-child { + margin-bottom: 0; +} + +.card-link:hover { + text-decoration: none; +} + +.card-link + .card-link { + margin-left: 1.5rem; +} + +.card-header { + padding: 1.5rem 1.5rem; + margin-bottom: 0; + background-color: rgba(0, 0, 0, 0.03); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-header:first-child { + border-radius: calc(3px - 1px) calc(3px - 1px) 0 0; +} + +.card-header + .list-group .list-group-item:first-child { + border-top: 0; +} + +.card-footer { + padding: 1.5rem 1.5rem; + background-color: rgba(0, 0, 0, 0.03); + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-footer:last-child { + border-radius: 0 0 calc(3px - 1px) calc(3px - 1px); +} + +.card-header-tabs { + margin-right: -0.75rem; + margin-bottom: -1.5rem; + margin-left: -0.75rem; + border-bottom: 0; +} + +.card-header-pills { + margin-right: -0.75rem; + margin-left: -0.75rem; +} + +.card-img-overlay { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + padding: 1.25rem; +} + +.card-img { + width: 100%; + border-radius: calc(3px - 1px); +} + +.card-img-top { + width: 100%; + border-top-left-radius: calc(3px - 1px); + border-top-right-radius: calc(3px - 1px); +} + +.card-img-bottom { + width: 100%; + border-bottom-right-radius: calc(3px - 1px); + border-bottom-left-radius: calc(3px - 1px); +} + +.card-deck { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-deck .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-deck { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + margin-right: -0.75rem; + margin-left: -0.75rem; + } + .card-deck .card { + display: -ms-flexbox; + display: flex; + -ms-flex: 1 0 0%; + flex: 1 0 0%; + -ms-flex-direction: column; + flex-direction: column; + margin-right: 0.75rem; + margin-bottom: 0; + margin-left: 0.75rem; + } +} + +.card-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-group > .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-group { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + } + .card-group > .card { + -ms-flex: 1 0 0%; + flex: 1 0 0%; + margin-bottom: 0; + } + .card-group > .card + .card { + margin-left: 0; + border-left: 0; + } + .card-group > .card:first-child { + border-top-right-radius: 0; + border-bottom-right-radius: 0; + } + .card-group > .card:first-child .card-img-top, + .card-group > .card:first-child .card-header { + border-top-right-radius: 0; + } + .card-group > .card:first-child .card-img-bottom, + .card-group > .card:first-child .card-footer { + border-bottom-right-radius: 0; + } + .card-group > .card:last-child { + border-top-left-radius: 0; + border-bottom-left-radius: 0; + } + .card-group > .card:last-child .card-img-top, + .card-group > .card:last-child .card-header { + border-top-left-radius: 0; + } + .card-group > .card:last-child .card-img-bottom, + .card-group > .card:last-child .card-footer { + border-bottom-left-radius: 0; + } + .card-group > .card:only-child { + border-radius: 3px; + } + .card-group > .card:only-child .card-img-top, + .card-group > .card:only-child .card-header { + border-top-left-radius: 3px; + border-top-right-radius: 3px; + } + .card-group > .card:only-child .card-img-bottom, + .card-group > .card:only-child .card-footer { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) { + border-radius: 0; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer { + border-radius: 0; + } +} + +.card-columns .card { + margin-bottom: 1.5rem; +} + +@media (min-width: 576px) { + .card-columns { + -webkit-column-count: 3; + -moz-column-count: 3; + column-count: 3; + -webkit-column-gap: 1.25rem; + -moz-column-gap: 1.25rem; + column-gap: 1.25rem; + orphans: 1; + widows: 1; + } + .card-columns .card { + display: inline-block; + width: 100%; + } +} + +.accordion .card:not(:first-of-type):not(:last-of-type) { + border-bottom: 0; + border-radius: 0; +} + +.accordion .card:not(:first-of-type) .card-header:first-child { + border-radius: 0; +} + +.accordion .card:first-of-type { + border-bottom: 0; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.accordion .card:last-of-type { + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.breadcrumb { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding: 0.75rem 1rem; + margin-bottom: 1rem; + list-style: none; + background-color: #e9ecef; + border-radius: 3px; +} + +.breadcrumb-item + .breadcrumb-item { + padding-left: 0.5rem; +} + +.breadcrumb-item + .breadcrumb-item::before { + display: inline-block; + padding-right: 0.5rem; + color: #868e96; + content: "/"; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: underline; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: none; +} + +.breadcrumb-item.active { + color: #868e96; +} + +.pagination { + display: -ms-flexbox; + display: flex; + padding-left: 0; + list-style: none; + border-radius: 3px; +} + +.page-link { + position: relative; + display: block; + padding: 0.5rem 0.75rem; + margin-left: -1px; + line-height: 1.25; + color: #495057; + background-color: #fff; + border: 1px solid #dee2e6; +} + +.page-link:hover { + z-index: 2; + color: #295a9f; + text-decoration: none; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.page-link:focus { + z-index: 2; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.page-link:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.page-item:first-child .page-link { + margin-left: 0; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.page-item.active .page-link { + z-index: 1; + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.page-item.disabled .page-link { + color: #ced4da; + pointer-events: none; + cursor: auto; + background-color: #fff; + border-color: #dee2e6; +} + +.pagination-lg .page-link { + padding: 0.75rem 1.5rem; + font-size: 1.125rem; + line-height: 1.5; +} + +.pagination-lg .page-item:first-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-lg .page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pagination-sm .page-link { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.5; +} + +.pagination-sm .page-item:first-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-sm .page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.badge { + display: inline-block; + padding: 0.25em 0.4em; + font-size: 75%; + font-weight: 600; + line-height: 1; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: 3px; +} + +.badge:empty { + display: none; +} + +.btn .badge { + position: relative; + top: -1px; +} + +.badge-pill { + padding-right: 0.6em; + padding-left: 0.6em; + border-radius: 10rem; +} + +.badge-primary { + color: #fff; + background-color: #467fcf; +} + +.badge-primary[href]:hover, .badge-primary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #2f66b3; +} + +.badge-secondary { + color: #fff; + background-color: #868e96; +} + +.badge-secondary[href]:hover, .badge-secondary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #6c757d; +} + +.badge-success { + color: #fff; + background-color: #5eba00; +} + +.badge-success[href]:hover, .badge-success[href]:focus { + color: #fff; + text-decoration: none; + background-color: #448700; +} + +.badge-info { + color: #fff; + background-color: #45aaf2; +} + +.badge-info[href]:hover, .badge-info[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1594ef; +} + +.badge-warning { + color: #fff; + background-color: #f1c40f; +} + +.badge-warning[href]:hover, .badge-warning[href]:focus { + color: #fff; + text-decoration: none; + background-color: #c29d0b; +} + +.badge-danger { + color: #fff; + background-color: #cd201f; +} + +.badge-danger[href]:hover, .badge-danger[href]:focus { + color: #fff; + text-decoration: none; + background-color: #a11918; +} + +.badge-light { + color: #495057; + background-color: #f8f9fa; +} + +.badge-light[href]:hover, .badge-light[href]:focus { + color: #495057; + text-decoration: none; + background-color: #dae0e5; +} + +.badge-dark { + color: #fff; + background-color: #343a40; +} + +.badge-dark[href]:hover, .badge-dark[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1d2124; +} + +.jumbotron { + padding: 2rem 1rem; + margin-bottom: 2rem; + background-color: #e9ecef; + border-radius: 3px; +} + +@media (min-width: 576px) { + .jumbotron { + padding: 4rem 2rem; + } +} + +.jumbotron-fluid { + padding-right: 0; + padding-left: 0; + border-radius: 0; +} + +.alert { + position: relative; + padding: 0.75rem 1.25rem; + margin-bottom: 1rem; + border: 1px solid transparent; + border-radius: 3px; +} + +.alert-heading { + color: inherit; +} + +.alert-link { + font-weight: 600; +} + +.alert-dismissible { + padding-right: 3.90625rem; +} + +.alert-dismissible .close { + position: absolute; + top: 0; + right: 0; + padding: 0.75rem 1.25rem; + color: inherit; +} + +.alert-primary { + color: #24426c; + background-color: #dae5f5; + border-color: #cbdbf2; +} + +.alert-primary hr { + border-top-color: #b7cded; +} + +.alert-primary .alert-link { + color: #172b46; +} + +.alert-secondary { + color: #464a4e; + background-color: #e7e8ea; + border-color: #dddfe2; +} + +.alert-secondary hr { + border-top-color: #cfd2d6; +} + +.alert-secondary .alert-link { + color: #2e3133; +} + +.alert-success { + color: #316100; + background-color: #dff1cc; + border-color: #d2ecb8; +} + +.alert-success hr { + border-top-color: #c5e7a4; +} + +.alert-success .alert-link { + color: #172e00; +} + +.alert-info { + color: #24587e; + background-color: #daeefc; + border-color: #cbe7fb; +} + +.alert-info hr { + border-top-color: #b3dcf9; +} + +.alert-info .alert-link { + color: #193c56; +} + +.alert-warning { + color: #7d6608; + background-color: #fcf3cf; + border-color: #fbeebc; +} + +.alert-warning hr { + border-top-color: #fae8a4; +} + +.alert-warning .alert-link { + color: #4d3f05; +} + +.alert-danger { + color: #6b1110; + background-color: #f5d2d2; + border-color: #f1c1c0; +} + +.alert-danger hr { + border-top-color: #ecacab; +} + +.alert-danger .alert-link { + color: #3f0a09; +} + +.alert-light { + color: #818182; + background-color: #fefefe; + border-color: #fdfdfe; +} + +.alert-light hr { + border-top-color: #ececf6; +} + +.alert-light .alert-link { + color: #686868; +} + +.alert-dark { + color: #1b1e21; + background-color: #d6d8d9; + border-color: #c6c8ca; +} + +.alert-dark hr { + border-top-color: #b9bbbe; +} + +.alert-dark .alert-link { + color: #040505; +} + +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 0 0; + } +} + +@keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 0 0; + } +} + +.progress { + display: -ms-flexbox; + display: flex; + height: 1rem; + overflow: hidden; + font-size: 0.703125rem; + background-color: #e9ecef; + border-radius: 3px; +} + +.progress-bar { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + color: #fff; + text-align: center; + white-space: nowrap; + background-color: #467fcf; + transition: width 0.6s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .progress-bar { + transition: none; + } +} + +.progress-bar-striped { + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: 1rem 1rem; +} + +.progress-bar-animated { + -webkit-animation: progress-bar-stripes 1s linear infinite; + animation: progress-bar-stripes 1s linear infinite; +} + +.media { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; +} + +.media-body { + -ms-flex: 1; + flex: 1; +} + +.list-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; +} + +.list-group-item-action { + width: 100%; + color: #495057; + text-align: inherit; +} + +.list-group-item-action:hover, .list-group-item-action:focus { + color: #495057; + text-decoration: none; + background-color: #f8f9fa; +} + +.list-group-item-action:active { + color: #495057; + background-color: #e9ecef; +} + +.list-group-item { + position: relative; + display: block; + padding: 0.75rem 1.25rem; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.list-group-item:hover, .list-group-item:focus { + z-index: 1; + text-decoration: none; +} + +.list-group-item.disabled, .list-group-item:disabled { + color: #868e96; + background-color: #fff; +} + +.list-group-item.active { + z-index: 2; + color: #467fcf; + background-color: #f8fafd; + border-color: rgba(0, 40, 100, 0.12); +} + +.list-group-flush .list-group-item { + border-right: 0; + border-left: 0; + border-radius: 0; +} + +.list-group-flush:first-child .list-group-item:first-child { + border-top: 0; +} + +.list-group-flush:last-child .list-group-item:last-child { + border-bottom: 0; +} + +.list-group-item-primary { + color: #24426c; + background-color: #cbdbf2; +} + +.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { + color: #24426c; + background-color: #b7cded; +} + +.list-group-item-primary.list-group-item-action.active { + color: #fff; + background-color: #24426c; + border-color: #24426c; +} + +.list-group-item-secondary { + color: #464a4e; + background-color: #dddfe2; +} + +.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { + color: #464a4e; + background-color: #cfd2d6; +} + +.list-group-item-secondary.list-group-item-action.active { + color: #fff; + background-color: #464a4e; + border-color: #464a4e; +} + +.list-group-item-success { + color: #316100; + background-color: #d2ecb8; +} + +.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { + color: #316100; + background-color: #c5e7a4; +} + +.list-group-item-success.list-group-item-action.active { + color: #fff; + background-color: #316100; + border-color: #316100; +} + +.list-group-item-info { + color: #24587e; + background-color: #cbe7fb; +} + +.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { + color: #24587e; + background-color: #b3dcf9; +} + +.list-group-item-info.list-group-item-action.active { + color: #fff; + background-color: #24587e; + border-color: #24587e; +} + +.list-group-item-warning { + color: #7d6608; + background-color: #fbeebc; +} + +.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { + color: #7d6608; + background-color: #fae8a4; +} + +.list-group-item-warning.list-group-item-action.active { + color: #fff; + background-color: #7d6608; + border-color: #7d6608; +} + +.list-group-item-danger { + color: #6b1110; + background-color: #f1c1c0; +} + +.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { + color: #6b1110; + background-color: #ecacab; +} + +.list-group-item-danger.list-group-item-action.active { + color: #fff; + background-color: #6b1110; + border-color: #6b1110; +} + +.list-group-item-light { + color: #818182; + background-color: #fdfdfe; +} + +.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { + color: #818182; + background-color: #ececf6; +} + +.list-group-item-light.list-group-item-action.active { + color: #fff; + background-color: #818182; + border-color: #818182; +} + +.list-group-item-dark { + color: #1b1e21; + background-color: #c6c8ca; +} + +.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { + color: #1b1e21; + background-color: #b9bbbe; +} + +.list-group-item-dark.list-group-item-action.active { + color: #fff; + background-color: #1b1e21; + border-color: #1b1e21; +} + +.close { + float: right; + font-size: 1.40625rem; + font-weight: 700; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + opacity: .5; +} + +.close:hover, .close:focus { + color: #000; + text-decoration: none; + opacity: .75; +} + +.close:not(:disabled):not(.disabled) { + cursor: pointer; +} + +button.close { + padding: 0; + background-color: transparent; + border: 0; + -webkit-appearance: none; +} + +.modal-open { + overflow: hidden; +} + +.modal { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1050; + display: none; + overflow: hidden; + outline: 0; +} + +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} + +.modal-dialog { + position: relative; + width: auto; + margin: 0.5rem; + pointer-events: none; +} + +.modal.fade .modal-dialog { + transition: -webkit-transform 0.3s ease-out; + transition: transform 0.3s ease-out; + transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out; + -webkit-transform: translate(0, -25%); + transform: translate(0, -25%); +} + +@media screen and (prefers-reduced-motion: reduce) { + .modal.fade .modal-dialog { + transition: none; + } +} + +.modal.show .modal-dialog { + -webkit-transform: translate(0, 0); + transform: translate(0, 0); +} + +.modal-dialog-centered { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + min-height: calc(100% - (0.5rem * 2)); +} + +.modal-content { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + width: 100%; + pointer-events: auto; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 0, 0, 0.2); + border-radius: 3px; + outline: 0; +} + +.modal-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1040; + background-color: #000; +} + +.modal-backdrop.fade { + opacity: 0; +} + +.modal-backdrop.show { + opacity: 0.5; +} + +.modal-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 1rem; + border-bottom: 1px solid #e9ecef; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.modal-header .close { + padding: 1rem; + margin: -1rem -1rem -1rem auto; +} + +.modal-title { + margin-bottom: 0; + line-height: 1.5; +} + +.modal-body { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1rem; +} + +.modal-footer { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: end; + justify-content: flex-end; + padding: 1rem; + border-top: 1px solid #e9ecef; +} + +.modal-footer > :not(:first-child) { + margin-left: .25rem; +} + +.modal-footer > :not(:last-child) { + margin-right: .25rem; +} + +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} + +@media (min-width: 576px) { + .modal-dialog { + max-width: 500px; + margin: 1.75rem auto; + } + .modal-dialog-centered { + min-height: calc(100% - (1.75rem * 2)); + } + .modal-sm { + max-width: 300px; + } +} + +@media (min-width: 992px) { + .modal-lg { + max-width: 800px; + } +} + +.tooltip { + position: absolute; + z-index: 1070; + display: block; + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + opacity: 0; +} + +.tooltip.show { + opacity: 0.9; +} + +.tooltip .arrow { + position: absolute; + display: block; + width: 0.8rem; + height: 0.4rem; +} + +.tooltip .arrow::before { + position: absolute; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] { + padding: 0.4rem 0; +} + +.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow { + bottom: 0; +} + +.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before { + top: 0; + border-width: 0.4rem 0.4rem 0; + border-top-color: #000; +} + +.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] { + padding: 0 0.4rem; +} + +.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow { + left: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before { + right: 0; + border-width: 0.4rem 0.4rem 0.4rem 0; + border-right-color: #000; +} + +.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] { + padding: 0.4rem 0; +} + +.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow { + top: 0; +} + +.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before { + bottom: 0; + border-width: 0 0.4rem 0.4rem; + border-bottom-color: #000; +} + +.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] { + padding: 0 0.4rem; +} + +.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow { + right: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before { + left: 0; + border-width: 0.4rem 0 0.4rem 0.4rem; + border-left-color: #000; +} + +.tooltip-inner { + max-width: 200px; + padding: 0.25rem 0.5rem; + color: #fff; + text-align: center; + background-color: #000; + border-radius: 3px; +} + +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1060; + display: block; + max-width: 276px; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #dee3eb; + border-radius: 3px; +} + +.popover .arrow { + position: absolute; + display: block; + width: 0.5rem; + height: 0.5rem; + margin: 0 3px; +} + +.popover .arrow::before, .popover .arrow::after { + position: absolute; + display: block; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-popover-top, .bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.5rem; +} + +.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow { + bottom: calc((0.5rem + 1px) * -1); +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before, +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + border-width: 0.5rem 0.25rem 0; +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before { + bottom: 0; + border-top-color: #dee3eb; +} + + +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + bottom: 1px; + border-top-color: #fff; +} + +.bs-popover-right, .bs-popover-auto[x-placement^="right"] { + margin-left: 0.5rem; +} + +.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow { + left: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before, +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + border-width: 0.25rem 0.5rem 0.25rem 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before { + left: 0; + border-right-color: #dee3eb; +} + + +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + left: 1px; + border-right-color: #fff; +} + +.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] { + margin-top: 0.5rem; +} + +.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow { + top: calc((0.5rem + 1px) * -1); +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before, +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + border-width: 0 0.25rem 0.5rem 0.25rem; +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before { + top: 0; + border-bottom-color: #dee3eb; +} + + +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + top: 1px; + border-bottom-color: #fff; +} + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before { + position: absolute; + top: 0; + left: 50%; + display: block; + width: 0.5rem; + margin-left: -0.25rem; + content: ""; + border-bottom: 1px solid #f7f7f7; +} + +.bs-popover-left, .bs-popover-auto[x-placement^="left"] { + margin-right: 0.5rem; +} + +.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow { + right: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before, +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + border-width: 0.25rem 0 0.25rem 0.5rem; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before { + right: 0; + border-left-color: #dee3eb; +} + + +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + right: 1px; + border-left-color: #fff; +} + +.popover-header { + padding: 0.5rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + color: inherit; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-top-left-radius: calc(3px - 1px); + border-top-right-radius: calc(3px - 1px); +} + +.popover-header:empty { + display: none; +} + +.popover-body { + padding: 0.75rem 1rem; + color: #6e7687; +} + +.carousel { + position: relative; +} + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; +} + +.carousel-item { + position: relative; + display: none; + -ms-flex-align: center; + align-items: center; + width: 100%; + transition: -webkit-transform 0.6s ease; + transition: transform 0.6s ease; + transition: transform 0.6s ease, -webkit-transform 0.6s ease; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000px; + perspective: 1000px; +} + +@media screen and (prefers-reduced-motion: reduce) { + .carousel-item { + transition: none; + } +} + +.carousel-item.active, +.carousel-item-next, +.carousel-item-prev { + display: block; +} + +.carousel-item-next, +.carousel-item-prev { + position: absolute; + top: 0; +} + +.carousel-item-next.carousel-item-left, +.carousel-item-prev.carousel-item-right { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next.carousel-item-left, + .carousel-item-prev.carousel-item-right { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-item-next, +.active.carousel-item-right { + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next, + .active.carousel-item-right { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +.carousel-item-prev, +.active.carousel-item-left { + -webkit-transform: translateX(-100%); + transform: translateX(-100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-prev, + .active.carousel-item-left { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +.carousel-fade .carousel-item { + opacity: 0; + transition-duration: .6s; + transition-property: opacity; +} + +.carousel-fade .carousel-item.active, +.carousel-fade .carousel-item-next.carousel-item-left, +.carousel-fade .carousel-item-prev.carousel-item-right { + opacity: 1; +} + +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-right { + opacity: 0; +} + +.carousel-fade .carousel-item-next, +.carousel-fade .carousel-item-prev, +.carousel-fade .carousel-item.active, +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-prev { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-fade .carousel-item-next, + .carousel-fade .carousel-item-prev, + .carousel-fade .carousel-item.active, + .carousel-fade .active.carousel-item-left, + .carousel-fade .active.carousel-item-prev { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-control-prev, +.carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: 15%; + color: #fff; + text-align: center; + opacity: 0.5; +} + +.carousel-control-prev:hover, .carousel-control-prev:focus, +.carousel-control-next:hover, +.carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity: .9; +} + +.carousel-control-prev { + left: 0; +} + +.carousel-control-next { + right: 0; +} + +.carousel-control-prev-icon, +.carousel-control-next-icon { + display: inline-block; + width: 20px; + height: 20px; + background: transparent no-repeat center center; + background-size: 100% 100%; +} + +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E"); +} + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E"); +} + +.carousel-indicators { + position: absolute; + right: 0; + bottom: 10px; + left: 0; + z-index: 15; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + padding-left: 0; + margin-right: 15%; + margin-left: 15%; + list-style: none; +} + +.carousel-indicators li { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; + width: 30px; + height: 3px; + margin-right: 3px; + margin-left: 3px; + text-indent: -999px; + background-color: rgba(255, 255, 255, 0.5); +} + +.carousel-indicators li::before { + position: absolute; + top: -10px; + left: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators li::after { + position: absolute; + bottom: -10px; + left: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators .active { + background-color: #fff; +} + +.carousel-caption { + position: absolute; + right: 15%; + bottom: 20px; + left: 15%; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; +} + +.align-baseline { + vertical-align: baseline !important; +} + +.align-top { + vertical-align: top !important; +} + +.align-middle { + vertical-align: middle !important; +} + +.align-bottom { + vertical-align: bottom !important; +} + +.align-text-bottom { + vertical-align: text-bottom !important; +} + +.align-text-top { + vertical-align: text-top !important; +} + +.bg-primary { + background-color: #467fcf !important; +} + +a.bg-primary:hover, a.bg-primary:focus, +button.bg-primary:hover, +button.bg-primary:focus { + background-color: #2f66b3 !important; +} + +.bg-secondary { + background-color: #868e96 !important; +} + +a.bg-secondary:hover, a.bg-secondary:focus, +button.bg-secondary:hover, +button.bg-secondary:focus { + background-color: #6c757d !important; +} + +.bg-success { + background-color: #5eba00 !important; +} + +a.bg-success:hover, a.bg-success:focus, +button.bg-success:hover, +button.bg-success:focus { + background-color: #448700 !important; +} + +.bg-info { + background-color: #45aaf2 !important; +} + +a.bg-info:hover, a.bg-info:focus, +button.bg-info:hover, +button.bg-info:focus { + background-color: #1594ef !important; +} + +.bg-warning { + background-color: #f1c40f !important; +} + +a.bg-warning:hover, a.bg-warning:focus, +button.bg-warning:hover, +button.bg-warning:focus { + background-color: #c29d0b !important; +} + +.bg-danger { + background-color: #cd201f !important; +} + +a.bg-danger:hover, a.bg-danger:focus, +button.bg-danger:hover, +button.bg-danger:focus { + background-color: #a11918 !important; +} + +.bg-light { + background-color: #f8f9fa !important; +} + +a.bg-light:hover, a.bg-light:focus, +button.bg-light:hover, +button.bg-light:focus { + background-color: #dae0e5 !important; +} + +.bg-dark { + background-color: #343a40 !important; +} + +a.bg-dark:hover, a.bg-dark:focus, +button.bg-dark:hover, +button.bg-dark:focus { + background-color: #1d2124 !important; +} + +.bg-white { + background-color: #fff !important; +} + +.bg-transparent { + background-color: transparent !important; +} + +.border { + border: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-top { + border-top: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-right { + border-right: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-bottom { + border-bottom: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-left { + border-left: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-0 { + border: 0 !important; +} + +.border-top-0 { + border-top: 0 !important; +} + +.border-right-0 { + border-right: 0 !important; +} + +.border-bottom-0 { + border-bottom: 0 !important; +} + +.border-left-0 { + border-left: 0 !important; +} + +.border-primary { + border-color: #467fcf !important; +} + +.border-secondary { + border-color: #868e96 !important; +} + +.border-success { + border-color: #5eba00 !important; +} + +.border-info { + border-color: #45aaf2 !important; +} + +.border-warning { + border-color: #f1c40f !important; +} + +.border-danger { + border-color: #cd201f !important; +} + +.border-light { + border-color: #f8f9fa !important; +} + +.border-dark { + border-color: #343a40 !important; +} + +.border-white { + border-color: #fff !important; +} + +.rounded { + border-radius: 3px !important; +} + +.rounded-top { + border-top-left-radius: 3px !important; + border-top-right-radius: 3px !important; +} + +.rounded-right { + border-top-right-radius: 3px !important; + border-bottom-right-radius: 3px !important; +} + +.rounded-bottom { + border-bottom-right-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-left { + border-top-left-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-circle { + border-radius: 50% !important; +} + +.rounded-0 { + border-radius: 0 !important; +} + +.clearfix::after { + display: block; + clear: both; + content: ""; +} + +.d-none { + display: none !important; +} + +.d-inline { + display: inline !important; +} + +.d-inline-block { + display: inline-block !important; +} + +.d-block { + display: block !important; +} + +.d-table { + display: table !important; +} + +.d-table-row { + display: table-row !important; +} + +.d-table-cell { + display: table-cell !important; +} + +.d-flex { + display: -ms-flexbox !important; + display: flex !important; +} + +.d-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; +} + +@media (min-width: 576px) { + .d-sm-none { + display: none !important; + } + .d-sm-inline { + display: inline !important; + } + .d-sm-inline-block { + display: inline-block !important; + } + .d-sm-block { + display: block !important; + } + .d-sm-table { + display: table !important; + } + .d-sm-table-row { + display: table-row !important; + } + .d-sm-table-cell { + display: table-cell !important; + } + .d-sm-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-sm-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 768px) { + .d-md-none { + display: none !important; + } + .d-md-inline { + display: inline !important; + } + .d-md-inline-block { + display: inline-block !important; + } + .d-md-block { + display: block !important; + } + .d-md-table { + display: table !important; + } + .d-md-table-row { + display: table-row !important; + } + .d-md-table-cell { + display: table-cell !important; + } + .d-md-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-md-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 992px) { + .d-lg-none { + display: none !important; + } + .d-lg-inline { + display: inline !important; + } + .d-lg-inline-block { + display: inline-block !important; + } + .d-lg-block { + display: block !important; + } + .d-lg-table { + display: table !important; + } + .d-lg-table-row { + display: table-row !important; + } + .d-lg-table-cell { + display: table-cell !important; + } + .d-lg-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-lg-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 1280px) { + .d-xl-none { + display: none !important; + } + .d-xl-inline { + display: inline !important; + } + .d-xl-inline-block { + display: inline-block !important; + } + .d-xl-block { + display: block !important; + } + .d-xl-table { + display: table !important; + } + .d-xl-table-row { + display: table-row !important; + } + .d-xl-table-cell { + display: table-cell !important; + } + .d-xl-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-xl-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media print { + .d-print-none { + display: none !important; + } + .d-print-inline { + display: inline !important; + } + .d-print-inline-block { + display: inline-block !important; + } + .d-print-block { + display: block !important; + } + .d-print-table { + display: table !important; + } + .d-print-table-row { + display: table-row !important; + } + .d-print-table-cell { + display: table-cell !important; + } + .d-print-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-print-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +.embed-responsive { + position: relative; + display: block; + width: 100%; + padding: 0; + overflow: hidden; +} + +.embed-responsive::before { + display: block; + content: ""; +} + +.embed-responsive .embed-responsive-item, +.embed-responsive iframe, +.embed-responsive embed, +.embed-responsive object, +.embed-responsive video { + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 100%; + height: 100%; + border: 0; +} + +.embed-responsive-21by9::before { + padding-top: 42.85714286%; +} + +.embed-responsive-16by9::before { + padding-top: 56.25%; +} + +.embed-responsive-4by3::before { + padding-top: 75%; +} + +.embed-responsive-1by1::before { + padding-top: 100%; +} + +.flex-row { + -ms-flex-direction: row !important; + flex-direction: row !important; +} + +.flex-column { + -ms-flex-direction: column !important; + flex-direction: column !important; +} + +.flex-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; +} + +.flex-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; +} + +.flex-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; +} + +.flex-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; +} + +.flex-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; +} + +.flex-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; +} + +.flex-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; +} + +.flex-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; +} + +.flex-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; +} + +.flex-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; +} + +.justify-content-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; +} + +.justify-content-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; +} + +.justify-content-center { + -ms-flex-pack: center !important; + justify-content: center !important; +} + +.justify-content-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; +} + +.justify-content-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; +} + +.align-items-start { + -ms-flex-align: start !important; + align-items: flex-start !important; +} + +.align-items-end { + -ms-flex-align: end !important; + align-items: flex-end !important; +} + +.align-items-center { + -ms-flex-align: center !important; + align-items: center !important; +} + +.align-items-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; +} + +.align-items-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; +} + +.align-content-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; +} + +.align-content-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; +} + +.align-content-center { + -ms-flex-line-pack: center !important; + align-content: center !important; +} + +.align-content-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; +} + +.align-content-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; +} + +.align-content-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; +} + +.align-self-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; +} + +.align-self-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; +} + +.align-self-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; +} + +.align-self-center { + -ms-flex-item-align: center !important; + align-self: center !important; +} + +.align-self-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; +} + +.align-self-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; +} + +@media (min-width: 576px) { + .flex-sm-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-sm-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-sm-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-sm-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-sm-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-sm-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-sm-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-sm-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-sm-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-sm-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-sm-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-sm-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-sm-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-sm-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-sm-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-sm-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-sm-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-sm-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-sm-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-sm-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-sm-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-sm-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-sm-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-sm-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-sm-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-sm-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-sm-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-sm-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-sm-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-sm-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-sm-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-sm-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-sm-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-sm-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 768px) { + .flex-md-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-md-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-md-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-md-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-md-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-md-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-md-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-md-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-md-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-md-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-md-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-md-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-md-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-md-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-md-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-md-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-md-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-md-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-md-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-md-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-md-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-md-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-md-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-md-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-md-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-md-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-md-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-md-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-md-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-md-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-md-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-md-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-md-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-md-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 992px) { + .flex-lg-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-lg-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-lg-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-lg-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-lg-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-lg-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-lg-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-lg-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-lg-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-lg-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-lg-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-lg-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-lg-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-lg-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-lg-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-lg-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-lg-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-lg-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-lg-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-lg-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-lg-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-lg-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-lg-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-lg-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-lg-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-lg-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-lg-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-lg-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-lg-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-lg-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-lg-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-lg-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-lg-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-lg-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 1280px) { + .flex-xl-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-xl-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-xl-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-xl-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-xl-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-xl-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-xl-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-xl-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-xl-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-xl-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-xl-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-xl-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-xl-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-xl-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-xl-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-xl-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-xl-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-xl-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-xl-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-xl-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-xl-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-xl-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-xl-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-xl-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-xl-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-xl-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-xl-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-xl-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-xl-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-xl-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-xl-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-xl-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-xl-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-xl-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +.float-left { + float: left !important; +} + +.float-right { + float: right !important; +} + +.float-none { + float: none !important; +} + +@media (min-width: 576px) { + .float-sm-left { + float: left !important; + } + .float-sm-right { + float: right !important; + } + .float-sm-none { + float: none !important; + } +} + +@media (min-width: 768px) { + .float-md-left { + float: left !important; + } + .float-md-right { + float: right !important; + } + .float-md-none { + float: none !important; + } +} + +@media (min-width: 992px) { + .float-lg-left { + float: left !important; + } + .float-lg-right { + float: right !important; + } + .float-lg-none { + float: none !important; + } +} + +@media (min-width: 1280px) { + .float-xl-left { + float: left !important; + } + .float-xl-right { + float: right !important; + } + .float-xl-none { + float: none !important; + } +} + +.position-static { + position: static !important; +} + +.position-relative { + position: relative !important; +} + +.position-absolute { + position: absolute !important; +} + +.position-fixed { + position: fixed !important; +} + +.position-sticky { + position: -webkit-sticky !important; + position: sticky !important; +} + +.fixed-top { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index: 1030; +} + +.fixed-bottom { + position: fixed; + right: 0; + bottom: 0; + left: 0; + z-index: 1030; +} + +@supports ((position: -webkit-sticky) or (position: sticky)) { + .sticky-top { + position: -webkit-sticky; + position: sticky; + top: 0; + z-index: 1020; + } +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border: 0; +} + +.sr-only-focusable:active, .sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + overflow: visible; + clip: auto; + white-space: normal; +} + +.shadow-sm { + box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; +} + +.shadow { + box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; +} + +.shadow-lg { + box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.w-25 { + width: 25% !important; +} + +.w-50 { + width: 50% !important; +} + +.w-75 { + width: 75% !important; +} + +.w-100 { + width: 100% !important; +} + +.w-auto { + width: auto !important; +} + +.w-0 { + width: 0 !important; +} + +.w-1 { + width: 0.25rem !important; +} + +.w-2 { + width: 0.5rem !important; +} + +.w-3 { + width: 0.75rem !important; +} + +.w-4 { + width: 1rem !important; +} + +.w-5 { + width: 1.5rem !important; +} + +.w-6 { + width: 2rem !important; +} + +.w-7 { + width: 3rem !important; +} + +.w-8 { + width: 4rem !important; +} + +.w-9 { + width: 6rem !important; +} + +.h-25 { + height: 25% !important; +} + +.h-50 { + height: 50% !important; +} + +.h-75 { + height: 75% !important; +} + +.h-100 { + height: 100% !important; +} + +.h-auto { + height: auto !important; +} + +.h-0 { + height: 0 !important; +} + +.h-1 { + height: 0.25rem !important; +} + +.h-2 { + height: 0.5rem !important; +} + +.h-3 { + height: 0.75rem !important; +} + +.h-4 { + height: 1rem !important; +} + +.h-5 { + height: 1.5rem !important; +} + +.h-6 { + height: 2rem !important; +} + +.h-7 { + height: 3rem !important; +} + +.h-8 { + height: 4rem !important; +} + +.h-9 { + height: 6rem !important; +} + +.mw-100 { + max-width: 100% !important; +} + +.mh-100 { + max-height: 100% !important; +} + +.m-0 { + margin: 0 !important; +} + +.mt-0, +.my-0 { + margin-top: 0 !important; +} + +.mr-0, +.mx-0 { + margin-right: 0 !important; +} + +.mb-0, +.my-0 { + margin-bottom: 0 !important; +} + +.ml-0, +.mx-0 { + margin-left: 0 !important; +} + +.m-1 { + margin: 0.25rem !important; +} + +.mt-1, +.my-1 { + margin-top: 0.25rem !important; +} + +.mr-1, +.mx-1 { + margin-right: 0.25rem !important; +} + +.mb-1, +.my-1 { + margin-bottom: 0.25rem !important; +} + +.ml-1, +.mx-1 { + margin-left: 0.25rem !important; +} + +.m-2 { + margin: 0.5rem !important; +} + +.mt-2, +.my-2 { + margin-top: 0.5rem !important; +} + +.mr-2, +.mx-2 { + margin-right: 0.5rem !important; +} + +.mb-2, +.my-2 { + margin-bottom: 0.5rem !important; +} + +.ml-2, +.mx-2 { + margin-left: 0.5rem !important; +} + +.m-3 { + margin: 0.75rem !important; +} + +.mt-3, +.my-3 { + margin-top: 0.75rem !important; +} + +.mr-3, +.mx-3 { + margin-right: 0.75rem !important; +} + +.mb-3, +.my-3 { + margin-bottom: 0.75rem !important; +} + +.ml-3, +.mx-3 { + margin-left: 0.75rem !important; +} + +.m-4 { + margin: 1rem !important; +} + +.mt-4, +.my-4 { + margin-top: 1rem !important; +} + +.mr-4, +.mx-4 { + margin-right: 1rem !important; +} + +.mb-4, +.my-4 { + margin-bottom: 1rem !important; +} + +.ml-4, +.mx-4 { + margin-left: 1rem !important; +} + +.m-5 { + margin: 1.5rem !important; +} + +.mt-5, +.my-5 { + margin-top: 1.5rem !important; +} + +.mr-5, +.mx-5 { + margin-right: 1.5rem !important; +} + +.mb-5, +.my-5 { + margin-bottom: 1.5rem !important; +} + +.ml-5, +.mx-5 { + margin-left: 1.5rem !important; +} + +.m-6 { + margin: 2rem !important; +} + +.mt-6, +.my-6 { + margin-top: 2rem !important; +} + +.mr-6, +.mx-6 { + margin-right: 2rem !important; +} + +.mb-6, +.my-6 { + margin-bottom: 2rem !important; +} + +.ml-6, +.mx-6 { + margin-left: 2rem !important; +} + +.m-7 { + margin: 3rem !important; +} + +.mt-7, +.my-7 { + margin-top: 3rem !important; +} + +.mr-7, +.mx-7 { + margin-right: 3rem !important; +} + +.mb-7, +.my-7 { + margin-bottom: 3rem !important; +} + +.ml-7, +.mx-7 { + margin-left: 3rem !important; +} + +.m-8 { + margin: 4rem !important; +} + +.mt-8, +.my-8 { + margin-top: 4rem !important; +} + +.mr-8, +.mx-8 { + margin-right: 4rem !important; +} + +.mb-8, +.my-8 { + margin-bottom: 4rem !important; +} + +.ml-8, +.mx-8 { + margin-left: 4rem !important; +} + +.m-9 { + margin: 6rem !important; +} + +.mt-9, +.my-9 { + margin-top: 6rem !important; +} + +.mr-9, +.mx-9 { + margin-right: 6rem !important; +} + +.mb-9, +.my-9 { + margin-bottom: 6rem !important; +} + +.ml-9, +.mx-9 { + margin-left: 6rem !important; +} + +.p-0 { + padding: 0 !important; +} + +.pt-0, +.py-0 { + padding-top: 0 !important; +} + +.pr-0, +.px-0 { + padding-right: 0 !important; +} + +.pb-0, +.py-0 { + padding-bottom: 0 !important; +} + +.pl-0, +.px-0 { + padding-left: 0 !important; +} + +.p-1 { + padding: 0.25rem !important; +} + +.pt-1, +.py-1 { + padding-top: 0.25rem !important; +} + +.pr-1, +.px-1 { + padding-right: 0.25rem !important; +} + +.pb-1, +.py-1 { + padding-bottom: 0.25rem !important; +} + +.pl-1, +.px-1 { + padding-left: 0.25rem !important; +} + +.p-2 { + padding: 0.5rem !important; +} + +.pt-2, +.py-2 { + padding-top: 0.5rem !important; +} + +.pr-2, +.px-2 { + padding-right: 0.5rem !important; +} + +.pb-2, +.py-2 { + padding-bottom: 0.5rem !important; +} + +.pl-2, +.px-2 { + padding-left: 0.5rem !important; +} + +.p-3 { + padding: 0.75rem !important; +} + +.pt-3, +.py-3 { + padding-top: 0.75rem !important; +} + +.pr-3, +.px-3 { + padding-right: 0.75rem !important; +} + +.pb-3, +.py-3 { + padding-bottom: 0.75rem !important; +} + +.pl-3, +.px-3 { + padding-left: 0.75rem !important; +} + +.p-4 { + padding: 1rem !important; +} + +.pt-4, +.py-4 { + padding-top: 1rem !important; +} + +.pr-4, +.px-4 { + padding-right: 1rem !important; +} + +.pb-4, +.py-4 { + padding-bottom: 1rem !important; +} + +.pl-4, +.px-4 { + padding-left: 1rem !important; +} + +.p-5 { + padding: 1.5rem !important; +} + +.pt-5, +.py-5 { + padding-top: 1.5rem !important; +} + +.pr-5, +.px-5 { + padding-right: 1.5rem !important; +} + +.pb-5, +.py-5 { + padding-bottom: 1.5rem !important; +} + +.pl-5, +.px-5 { + padding-left: 1.5rem !important; +} + +.p-6 { + padding: 2rem !important; +} + +.pt-6, +.py-6 { + padding-top: 2rem !important; +} + +.pr-6, +.px-6 { + padding-right: 2rem !important; +} + +.pb-6, +.py-6 { + padding-bottom: 2rem !important; +} + +.pl-6, +.px-6 { + padding-left: 2rem !important; +} + +.p-7 { + padding: 3rem !important; +} + +.pt-7, +.py-7 { + padding-top: 3rem !important; +} + +.pr-7, +.px-7 { + padding-right: 3rem !important; +} + +.pb-7, +.py-7 { + padding-bottom: 3rem !important; +} + +.pl-7, +.px-7 { + padding-left: 3rem !important; +} + +.p-8 { + padding: 4rem !important; +} + +.pt-8, +.py-8 { + padding-top: 4rem !important; +} + +.pr-8, +.px-8 { + padding-right: 4rem !important; +} + +.pb-8, +.py-8 { + padding-bottom: 4rem !important; +} + +.pl-8, +.px-8 { + padding-left: 4rem !important; +} + +.p-9 { + padding: 6rem !important; +} + +.pt-9, +.py-9 { + padding-top: 6rem !important; +} + +.pr-9, +.px-9 { + padding-right: 6rem !important; +} + +.pb-9, +.py-9 { + padding-bottom: 6rem !important; +} + +.pl-9, +.px-9 { + padding-left: 6rem !important; +} + +.m-auto { + margin: auto !important; +} + +.mt-auto, +.my-auto { + margin-top: auto !important; +} + +.mr-auto, +.mx-auto { + margin-right: auto !important; +} + +.mb-auto, +.my-auto { + margin-bottom: auto !important; +} + +.ml-auto, +.mx-auto { + margin-left: auto !important; +} + +@media (min-width: 576px) { + .m-sm-0 { + margin: 0 !important; + } + .mt-sm-0, + .my-sm-0 { + margin-top: 0 !important; + } + .mr-sm-0, + .mx-sm-0 { + margin-right: 0 !important; + } + .mb-sm-0, + .my-sm-0 { + margin-bottom: 0 !important; + } + .ml-sm-0, + .mx-sm-0 { + margin-left: 0 !important; + } + .m-sm-1 { + margin: 0.25rem !important; + } + .mt-sm-1, + .my-sm-1 { + margin-top: 0.25rem !important; + } + .mr-sm-1, + .mx-sm-1 { + margin-right: 0.25rem !important; + } + .mb-sm-1, + .my-sm-1 { + margin-bottom: 0.25rem !important; + } + .ml-sm-1, + .mx-sm-1 { + margin-left: 0.25rem !important; + } + .m-sm-2 { + margin: 0.5rem !important; + } + .mt-sm-2, + .my-sm-2 { + margin-top: 0.5rem !important; + } + .mr-sm-2, + .mx-sm-2 { + margin-right: 0.5rem !important; + } + .mb-sm-2, + .my-sm-2 { + margin-bottom: 0.5rem !important; + } + .ml-sm-2, + .mx-sm-2 { + margin-left: 0.5rem !important; + } + .m-sm-3 { + margin: 0.75rem !important; + } + .mt-sm-3, + .my-sm-3 { + margin-top: 0.75rem !important; + } + .mr-sm-3, + .mx-sm-3 { + margin-right: 0.75rem !important; + } + .mb-sm-3, + .my-sm-3 { + margin-bottom: 0.75rem !important; + } + .ml-sm-3, + .mx-sm-3 { + margin-left: 0.75rem !important; + } + .m-sm-4 { + margin: 1rem !important; + } + .mt-sm-4, + .my-sm-4 { + margin-top: 1rem !important; + } + .mr-sm-4, + .mx-sm-4 { + margin-right: 1rem !important; + } + .mb-sm-4, + .my-sm-4 { + margin-bottom: 1rem !important; + } + .ml-sm-4, + .mx-sm-4 { + margin-left: 1rem !important; + } + .m-sm-5 { + margin: 1.5rem !important; + } + .mt-sm-5, + .my-sm-5 { + margin-top: 1.5rem !important; + } + .mr-sm-5, + .mx-sm-5 { + margin-right: 1.5rem !important; + } + .mb-sm-5, + .my-sm-5 { + margin-bottom: 1.5rem !important; + } + .ml-sm-5, + .mx-sm-5 { + margin-left: 1.5rem !important; + } + .m-sm-6 { + margin: 2rem !important; + } + .mt-sm-6, + .my-sm-6 { + margin-top: 2rem !important; + } + .mr-sm-6, + .mx-sm-6 { + margin-right: 2rem !important; + } + .mb-sm-6, + .my-sm-6 { + margin-bottom: 2rem !important; + } + .ml-sm-6, + .mx-sm-6 { + margin-left: 2rem !important; + } + .m-sm-7 { + margin: 3rem !important; + } + .mt-sm-7, + .my-sm-7 { + margin-top: 3rem !important; + } + .mr-sm-7, + .mx-sm-7 { + margin-right: 3rem !important; + } + .mb-sm-7, + .my-sm-7 { + margin-bottom: 3rem !important; + } + .ml-sm-7, + .mx-sm-7 { + margin-left: 3rem !important; + } + .m-sm-8 { + margin: 4rem !important; + } + .mt-sm-8, + .my-sm-8 { + margin-top: 4rem !important; + } + .mr-sm-8, + .mx-sm-8 { + margin-right: 4rem !important; + } + .mb-sm-8, + .my-sm-8 { + margin-bottom: 4rem !important; + } + .ml-sm-8, + .mx-sm-8 { + margin-left: 4rem !important; + } + .m-sm-9 { + margin: 6rem !important; + } + .mt-sm-9, + .my-sm-9 { + margin-top: 6rem !important; + } + .mr-sm-9, + .mx-sm-9 { + margin-right: 6rem !important; + } + .mb-sm-9, + .my-sm-9 { + margin-bottom: 6rem !important; + } + .ml-sm-9, + .mx-sm-9 { + margin-left: 6rem !important; + } + .p-sm-0 { + padding: 0 !important; + } + .pt-sm-0, + .py-sm-0 { + padding-top: 0 !important; + } + .pr-sm-0, + .px-sm-0 { + padding-right: 0 !important; + } + .pb-sm-0, + .py-sm-0 { + padding-bottom: 0 !important; + } + .pl-sm-0, + .px-sm-0 { + padding-left: 0 !important; + } + .p-sm-1 { + padding: 0.25rem !important; + } + .pt-sm-1, + .py-sm-1 { + padding-top: 0.25rem !important; + } + .pr-sm-1, + .px-sm-1 { + padding-right: 0.25rem !important; + } + .pb-sm-1, + .py-sm-1 { + padding-bottom: 0.25rem !important; + } + .pl-sm-1, + .px-sm-1 { + padding-left: 0.25rem !important; + } + .p-sm-2 { + padding: 0.5rem !important; + } + .pt-sm-2, + .py-sm-2 { + padding-top: 0.5rem !important; + } + .pr-sm-2, + .px-sm-2 { + padding-right: 0.5rem !important; + } + .pb-sm-2, + .py-sm-2 { + padding-bottom: 0.5rem !important; + } + .pl-sm-2, + .px-sm-2 { + padding-left: 0.5rem !important; + } + .p-sm-3 { + padding: 0.75rem !important; + } + .pt-sm-3, + .py-sm-3 { + padding-top: 0.75rem !important; + } + .pr-sm-3, + .px-sm-3 { + padding-right: 0.75rem !important; + } + .pb-sm-3, + .py-sm-3 { + padding-bottom: 0.75rem !important; + } + .pl-sm-3, + .px-sm-3 { + padding-left: 0.75rem !important; + } + .p-sm-4 { + padding: 1rem !important; + } + .pt-sm-4, + .py-sm-4 { + padding-top: 1rem !important; + } + .pr-sm-4, + .px-sm-4 { + padding-right: 1rem !important; + } + .pb-sm-4, + .py-sm-4 { + padding-bottom: 1rem !important; + } + .pl-sm-4, + .px-sm-4 { + padding-left: 1rem !important; + } + .p-sm-5 { + padding: 1.5rem !important; + } + .pt-sm-5, + .py-sm-5 { + padding-top: 1.5rem !important; + } + .pr-sm-5, + .px-sm-5 { + padding-right: 1.5rem !important; + } + .pb-sm-5, + .py-sm-5 { + padding-bottom: 1.5rem !important; + } + .pl-sm-5, + .px-sm-5 { + padding-left: 1.5rem !important; + } + .p-sm-6 { + padding: 2rem !important; + } + .pt-sm-6, + .py-sm-6 { + padding-top: 2rem !important; + } + .pr-sm-6, + .px-sm-6 { + padding-right: 2rem !important; + } + .pb-sm-6, + .py-sm-6 { + padding-bottom: 2rem !important; + } + .pl-sm-6, + .px-sm-6 { + padding-left: 2rem !important; + } + .p-sm-7 { + padding: 3rem !important; + } + .pt-sm-7, + .py-sm-7 { + padding-top: 3rem !important; + } + .pr-sm-7, + .px-sm-7 { + padding-right: 3rem !important; + } + .pb-sm-7, + .py-sm-7 { + padding-bottom: 3rem !important; + } + .pl-sm-7, + .px-sm-7 { + padding-left: 3rem !important; + } + .p-sm-8 { + padding: 4rem !important; + } + .pt-sm-8, + .py-sm-8 { + padding-top: 4rem !important; + } + .pr-sm-8, + .px-sm-8 { + padding-right: 4rem !important; + } + .pb-sm-8, + .py-sm-8 { + padding-bottom: 4rem !important; + } + .pl-sm-8, + .px-sm-8 { + padding-left: 4rem !important; + } + .p-sm-9 { + padding: 6rem !important; + } + .pt-sm-9, + .py-sm-9 { + padding-top: 6rem !important; + } + .pr-sm-9, + .px-sm-9 { + padding-right: 6rem !important; + } + .pb-sm-9, + .py-sm-9 { + padding-bottom: 6rem !important; + } + .pl-sm-9, + .px-sm-9 { + padding-left: 6rem !important; + } + .m-sm-auto { + margin: auto !important; + } + .mt-sm-auto, + .my-sm-auto { + margin-top: auto !important; + } + .mr-sm-auto, + .mx-sm-auto { + margin-right: auto !important; + } + .mb-sm-auto, + .my-sm-auto { + margin-bottom: auto !important; + } + .ml-sm-auto, + .mx-sm-auto { + margin-left: auto !important; + } +} + +@media (min-width: 768px) { + .m-md-0 { + margin: 0 !important; + } + .mt-md-0, + .my-md-0 { + margin-top: 0 !important; + } + .mr-md-0, + .mx-md-0 { + margin-right: 0 !important; + } + .mb-md-0, + .my-md-0 { + margin-bottom: 0 !important; + } + .ml-md-0, + .mx-md-0 { + margin-left: 0 !important; + } + .m-md-1 { + margin: 0.25rem !important; + } + .mt-md-1, + .my-md-1 { + margin-top: 0.25rem !important; + } + .mr-md-1, + .mx-md-1 { + margin-right: 0.25rem !important; + } + .mb-md-1, + .my-md-1 { + margin-bottom: 0.25rem !important; + } + .ml-md-1, + .mx-md-1 { + margin-left: 0.25rem !important; + } + .m-md-2 { + margin: 0.5rem !important; + } + .mt-md-2, + .my-md-2 { + margin-top: 0.5rem !important; + } + .mr-md-2, + .mx-md-2 { + margin-right: 0.5rem !important; + } + .mb-md-2, + .my-md-2 { + margin-bottom: 0.5rem !important; + } + .ml-md-2, + .mx-md-2 { + margin-left: 0.5rem !important; + } + .m-md-3 { + margin: 0.75rem !important; + } + .mt-md-3, + .my-md-3 { + margin-top: 0.75rem !important; + } + .mr-md-3, + .mx-md-3 { + margin-right: 0.75rem !important; + } + .mb-md-3, + .my-md-3 { + margin-bottom: 0.75rem !important; + } + .ml-md-3, + .mx-md-3 { + margin-left: 0.75rem !important; + } + .m-md-4 { + margin: 1rem !important; + } + .mt-md-4, + .my-md-4 { + margin-top: 1rem !important; + } + .mr-md-4, + .mx-md-4 { + margin-right: 1rem !important; + } + .mb-md-4, + .my-md-4 { + margin-bottom: 1rem !important; + } + .ml-md-4, + .mx-md-4 { + margin-left: 1rem !important; + } + .m-md-5 { + margin: 1.5rem !important; + } + .mt-md-5, + .my-md-5 { + margin-top: 1.5rem !important; + } + .mr-md-5, + .mx-md-5 { + margin-right: 1.5rem !important; + } + .mb-md-5, + .my-md-5 { + margin-bottom: 1.5rem !important; + } + .ml-md-5, + .mx-md-5 { + margin-left: 1.5rem !important; + } + .m-md-6 { + margin: 2rem !important; + } + .mt-md-6, + .my-md-6 { + margin-top: 2rem !important; + } + .mr-md-6, + .mx-md-6 { + margin-right: 2rem !important; + } + .mb-md-6, + .my-md-6 { + margin-bottom: 2rem !important; + } + .ml-md-6, + .mx-md-6 { + margin-left: 2rem !important; + } + .m-md-7 { + margin: 3rem !important; + } + .mt-md-7, + .my-md-7 { + margin-top: 3rem !important; + } + .mr-md-7, + .mx-md-7 { + margin-right: 3rem !important; + } + .mb-md-7, + .my-md-7 { + margin-bottom: 3rem !important; + } + .ml-md-7, + .mx-md-7 { + margin-left: 3rem !important; + } + .m-md-8 { + margin: 4rem !important; + } + .mt-md-8, + .my-md-8 { + margin-top: 4rem !important; + } + .mr-md-8, + .mx-md-8 { + margin-right: 4rem !important; + } + .mb-md-8, + .my-md-8 { + margin-bottom: 4rem !important; + } + .ml-md-8, + .mx-md-8 { + margin-left: 4rem !important; + } + .m-md-9 { + margin: 6rem !important; + } + .mt-md-9, + .my-md-9 { + margin-top: 6rem !important; + } + .mr-md-9, + .mx-md-9 { + margin-right: 6rem !important; + } + .mb-md-9, + .my-md-9 { + margin-bottom: 6rem !important; + } + .ml-md-9, + .mx-md-9 { + margin-left: 6rem !important; + } + .p-md-0 { + padding: 0 !important; + } + .pt-md-0, + .py-md-0 { + padding-top: 0 !important; + } + .pr-md-0, + .px-md-0 { + padding-right: 0 !important; + } + .pb-md-0, + .py-md-0 { + padding-bottom: 0 !important; + } + .pl-md-0, + .px-md-0 { + padding-left: 0 !important; + } + .p-md-1 { + padding: 0.25rem !important; + } + .pt-md-1, + .py-md-1 { + padding-top: 0.25rem !important; + } + .pr-md-1, + .px-md-1 { + padding-right: 0.25rem !important; + } + .pb-md-1, + .py-md-1 { + padding-bottom: 0.25rem !important; + } + .pl-md-1, + .px-md-1 { + padding-left: 0.25rem !important; + } + .p-md-2 { + padding: 0.5rem !important; + } + .pt-md-2, + .py-md-2 { + padding-top: 0.5rem !important; + } + .pr-md-2, + .px-md-2 { + padding-right: 0.5rem !important; + } + .pb-md-2, + .py-md-2 { + padding-bottom: 0.5rem !important; + } + .pl-md-2, + .px-md-2 { + padding-left: 0.5rem !important; + } + .p-md-3 { + padding: 0.75rem !important; + } + .pt-md-3, + .py-md-3 { + padding-top: 0.75rem !important; + } + .pr-md-3, + .px-md-3 { + padding-right: 0.75rem !important; + } + .pb-md-3, + .py-md-3 { + padding-bottom: 0.75rem !important; + } + .pl-md-3, + .px-md-3 { + padding-left: 0.75rem !important; + } + .p-md-4 { + padding: 1rem !important; + } + .pt-md-4, + .py-md-4 { + padding-top: 1rem !important; + } + .pr-md-4, + .px-md-4 { + padding-right: 1rem !important; + } + .pb-md-4, + .py-md-4 { + padding-bottom: 1rem !important; + } + .pl-md-4, + .px-md-4 { + padding-left: 1rem !important; + } + .p-md-5 { + padding: 1.5rem !important; + } + .pt-md-5, + .py-md-5 { + padding-top: 1.5rem !important; + } + .pr-md-5, + .px-md-5 { + padding-right: 1.5rem !important; + } + .pb-md-5, + .py-md-5 { + padding-bottom: 1.5rem !important; + } + .pl-md-5, + .px-md-5 { + padding-left: 1.5rem !important; + } + .p-md-6 { + padding: 2rem !important; + } + .pt-md-6, + .py-md-6 { + padding-top: 2rem !important; + } + .pr-md-6, + .px-md-6 { + padding-right: 2rem !important; + } + .pb-md-6, + .py-md-6 { + padding-bottom: 2rem !important; + } + .pl-md-6, + .px-md-6 { + padding-left: 2rem !important; + } + .p-md-7 { + padding: 3rem !important; + } + .pt-md-7, + .py-md-7 { + padding-top: 3rem !important; + } + .pr-md-7, + .px-md-7 { + padding-right: 3rem !important; + } + .pb-md-7, + .py-md-7 { + padding-bottom: 3rem !important; + } + .pl-md-7, + .px-md-7 { + padding-left: 3rem !important; + } + .p-md-8 { + padding: 4rem !important; + } + .pt-md-8, + .py-md-8 { + padding-top: 4rem !important; + } + .pr-md-8, + .px-md-8 { + padding-right: 4rem !important; + } + .pb-md-8, + .py-md-8 { + padding-bottom: 4rem !important; + } + .pl-md-8, + .px-md-8 { + padding-left: 4rem !important; + } + .p-md-9 { + padding: 6rem !important; + } + .pt-md-9, + .py-md-9 { + padding-top: 6rem !important; + } + .pr-md-9, + .px-md-9 { + padding-right: 6rem !important; + } + .pb-md-9, + .py-md-9 { + padding-bottom: 6rem !important; + } + .pl-md-9, + .px-md-9 { + padding-left: 6rem !important; + } + .m-md-auto { + margin: auto !important; + } + .mt-md-auto, + .my-md-auto { + margin-top: auto !important; + } + .mr-md-auto, + .mx-md-auto { + margin-right: auto !important; + } + .mb-md-auto, + .my-md-auto { + margin-bottom: auto !important; + } + .ml-md-auto, + .mx-md-auto { + margin-left: auto !important; + } +} + +@media (min-width: 992px) { + .m-lg-0 { + margin: 0 !important; + } + .mt-lg-0, + .my-lg-0 { + margin-top: 0 !important; + } + .mr-lg-0, + .mx-lg-0 { + margin-right: 0 !important; + } + .mb-lg-0, + .my-lg-0 { + margin-bottom: 0 !important; + } + .ml-lg-0, + .mx-lg-0 { + margin-left: 0 !important; + } + .m-lg-1 { + margin: 0.25rem !important; + } + .mt-lg-1, + .my-lg-1 { + margin-top: 0.25rem !important; + } + .mr-lg-1, + .mx-lg-1 { + margin-right: 0.25rem !important; + } + .mb-lg-1, + .my-lg-1 { + margin-bottom: 0.25rem !important; + } + .ml-lg-1, + .mx-lg-1 { + margin-left: 0.25rem !important; + } + .m-lg-2 { + margin: 0.5rem !important; + } + .mt-lg-2, + .my-lg-2 { + margin-top: 0.5rem !important; + } + .mr-lg-2, + .mx-lg-2 { + margin-right: 0.5rem !important; + } + .mb-lg-2, + .my-lg-2 { + margin-bottom: 0.5rem !important; + } + .ml-lg-2, + .mx-lg-2 { + margin-left: 0.5rem !important; + } + .m-lg-3 { + margin: 0.75rem !important; + } + .mt-lg-3, + .my-lg-3 { + margin-top: 0.75rem !important; + } + .mr-lg-3, + .mx-lg-3 { + margin-right: 0.75rem !important; + } + .mb-lg-3, + .my-lg-3 { + margin-bottom: 0.75rem !important; + } + .ml-lg-3, + .mx-lg-3 { + margin-left: 0.75rem !important; + } + .m-lg-4 { + margin: 1rem !important; + } + .mt-lg-4, + .my-lg-4 { + margin-top: 1rem !important; + } + .mr-lg-4, + .mx-lg-4 { + margin-right: 1rem !important; + } + .mb-lg-4, + .my-lg-4 { + margin-bottom: 1rem !important; + } + .ml-lg-4, + .mx-lg-4 { + margin-left: 1rem !important; + } + .m-lg-5 { + margin: 1.5rem !important; + } + .mt-lg-5, + .my-lg-5 { + margin-top: 1.5rem !important; + } + .mr-lg-5, + .mx-lg-5 { + margin-right: 1.5rem !important; + } + .mb-lg-5, + .my-lg-5 { + margin-bottom: 1.5rem !important; + } + .ml-lg-5, + .mx-lg-5 { + margin-left: 1.5rem !important; + } + .m-lg-6 { + margin: 2rem !important; + } + .mt-lg-6, + .my-lg-6 { + margin-top: 2rem !important; + } + .mr-lg-6, + .mx-lg-6 { + margin-right: 2rem !important; + } + .mb-lg-6, + .my-lg-6 { + margin-bottom: 2rem !important; + } + .ml-lg-6, + .mx-lg-6 { + margin-left: 2rem !important; + } + .m-lg-7 { + margin: 3rem !important; + } + .mt-lg-7, + .my-lg-7 { + margin-top: 3rem !important; + } + .mr-lg-7, + .mx-lg-7 { + margin-right: 3rem !important; + } + .mb-lg-7, + .my-lg-7 { + margin-bottom: 3rem !important; + } + .ml-lg-7, + .mx-lg-7 { + margin-left: 3rem !important; + } + .m-lg-8 { + margin: 4rem !important; + } + .mt-lg-8, + .my-lg-8 { + margin-top: 4rem !important; + } + .mr-lg-8, + .mx-lg-8 { + margin-right: 4rem !important; + } + .mb-lg-8, + .my-lg-8 { + margin-bottom: 4rem !important; + } + .ml-lg-8, + .mx-lg-8 { + margin-left: 4rem !important; + } + .m-lg-9 { + margin: 6rem !important; + } + .mt-lg-9, + .my-lg-9 { + margin-top: 6rem !important; + } + .mr-lg-9, + .mx-lg-9 { + margin-right: 6rem !important; + } + .mb-lg-9, + .my-lg-9 { + margin-bottom: 6rem !important; + } + .ml-lg-9, + .mx-lg-9 { + margin-left: 6rem !important; + } + .p-lg-0 { + padding: 0 !important; + } + .pt-lg-0, + .py-lg-0 { + padding-top: 0 !important; + } + .pr-lg-0, + .px-lg-0 { + padding-right: 0 !important; + } + .pb-lg-0, + .py-lg-0 { + padding-bottom: 0 !important; + } + .pl-lg-0, + .px-lg-0 { + padding-left: 0 !important; + } + .p-lg-1 { + padding: 0.25rem !important; + } + .pt-lg-1, + .py-lg-1 { + padding-top: 0.25rem !important; + } + .pr-lg-1, + .px-lg-1 { + padding-right: 0.25rem !important; + } + .pb-lg-1, + .py-lg-1 { + padding-bottom: 0.25rem !important; + } + .pl-lg-1, + .px-lg-1 { + padding-left: 0.25rem !important; + } + .p-lg-2 { + padding: 0.5rem !important; + } + .pt-lg-2, + .py-lg-2 { + padding-top: 0.5rem !important; + } + .pr-lg-2, + .px-lg-2 { + padding-right: 0.5rem !important; + } + .pb-lg-2, + .py-lg-2 { + padding-bottom: 0.5rem !important; + } + .pl-lg-2, + .px-lg-2 { + padding-left: 0.5rem !important; + } + .p-lg-3 { + padding: 0.75rem !important; + } + .pt-lg-3, + .py-lg-3 { + padding-top: 0.75rem !important; + } + .pr-lg-3, + .px-lg-3 { + padding-right: 0.75rem !important; + } + .pb-lg-3, + .py-lg-3 { + padding-bottom: 0.75rem !important; + } + .pl-lg-3, + .px-lg-3 { + padding-left: 0.75rem !important; + } + .p-lg-4 { + padding: 1rem !important; + } + .pt-lg-4, + .py-lg-4 { + padding-top: 1rem !important; + } + .pr-lg-4, + .px-lg-4 { + padding-right: 1rem !important; + } + .pb-lg-4, + .py-lg-4 { + padding-bottom: 1rem !important; + } + .pl-lg-4, + .px-lg-4 { + padding-left: 1rem !important; + } + .p-lg-5 { + padding: 1.5rem !important; + } + .pt-lg-5, + .py-lg-5 { + padding-top: 1.5rem !important; + } + .pr-lg-5, + .px-lg-5 { + padding-right: 1.5rem !important; + } + .pb-lg-5, + .py-lg-5 { + padding-bottom: 1.5rem !important; + } + .pl-lg-5, + .px-lg-5 { + padding-left: 1.5rem !important; + } + .p-lg-6 { + padding: 2rem !important; + } + .pt-lg-6, + .py-lg-6 { + padding-top: 2rem !important; + } + .pr-lg-6, + .px-lg-6 { + padding-right: 2rem !important; + } + .pb-lg-6, + .py-lg-6 { + padding-bottom: 2rem !important; + } + .pl-lg-6, + .px-lg-6 { + padding-left: 2rem !important; + } + .p-lg-7 { + padding: 3rem !important; + } + .pt-lg-7, + .py-lg-7 { + padding-top: 3rem !important; + } + .pr-lg-7, + .px-lg-7 { + padding-right: 3rem !important; + } + .pb-lg-7, + .py-lg-7 { + padding-bottom: 3rem !important; + } + .pl-lg-7, + .px-lg-7 { + padding-left: 3rem !important; + } + .p-lg-8 { + padding: 4rem !important; + } + .pt-lg-8, + .py-lg-8 { + padding-top: 4rem !important; + } + .pr-lg-8, + .px-lg-8 { + padding-right: 4rem !important; + } + .pb-lg-8, + .py-lg-8 { + padding-bottom: 4rem !important; + } + .pl-lg-8, + .px-lg-8 { + padding-left: 4rem !important; + } + .p-lg-9 { + padding: 6rem !important; + } + .pt-lg-9, + .py-lg-9 { + padding-top: 6rem !important; + } + .pr-lg-9, + .px-lg-9 { + padding-right: 6rem !important; + } + .pb-lg-9, + .py-lg-9 { + padding-bottom: 6rem !important; + } + .pl-lg-9, + .px-lg-9 { + padding-left: 6rem !important; + } + .m-lg-auto { + margin: auto !important; + } + .mt-lg-auto, + .my-lg-auto { + margin-top: auto !important; + } + .mr-lg-auto, + .mx-lg-auto { + margin-right: auto !important; + } + .mb-lg-auto, + .my-lg-auto { + margin-bottom: auto !important; + } + .ml-lg-auto, + .mx-lg-auto { + margin-left: auto !important; + } +} + +@media (min-width: 1280px) { + .m-xl-0 { + margin: 0 !important; + } + .mt-xl-0, + .my-xl-0 { + margin-top: 0 !important; + } + .mr-xl-0, + .mx-xl-0 { + margin-right: 0 !important; + } + .mb-xl-0, + .my-xl-0 { + margin-bottom: 0 !important; + } + .ml-xl-0, + .mx-xl-0 { + margin-left: 0 !important; + } + .m-xl-1 { + margin: 0.25rem !important; + } + .mt-xl-1, + .my-xl-1 { + margin-top: 0.25rem !important; + } + .mr-xl-1, + .mx-xl-1 { + margin-right: 0.25rem !important; + } + .mb-xl-1, + .my-xl-1 { + margin-bottom: 0.25rem !important; + } + .ml-xl-1, + .mx-xl-1 { + margin-left: 0.25rem !important; + } + .m-xl-2 { + margin: 0.5rem !important; + } + .mt-xl-2, + .my-xl-2 { + margin-top: 0.5rem !important; + } + .mr-xl-2, + .mx-xl-2 { + margin-right: 0.5rem !important; + } + .mb-xl-2, + .my-xl-2 { + margin-bottom: 0.5rem !important; + } + .ml-xl-2, + .mx-xl-2 { + margin-left: 0.5rem !important; + } + .m-xl-3 { + margin: 0.75rem !important; + } + .mt-xl-3, + .my-xl-3 { + margin-top: 0.75rem !important; + } + .mr-xl-3, + .mx-xl-3 { + margin-right: 0.75rem !important; + } + .mb-xl-3, + .my-xl-3 { + margin-bottom: 0.75rem !important; + } + .ml-xl-3, + .mx-xl-3 { + margin-left: 0.75rem !important; + } + .m-xl-4 { + margin: 1rem !important; + } + .mt-xl-4, + .my-xl-4 { + margin-top: 1rem !important; + } + .mr-xl-4, + .mx-xl-4 { + margin-right: 1rem !important; + } + .mb-xl-4, + .my-xl-4 { + margin-bottom: 1rem !important; + } + .ml-xl-4, + .mx-xl-4 { + margin-left: 1rem !important; + } + .m-xl-5 { + margin: 1.5rem !important; + } + .mt-xl-5, + .my-xl-5 { + margin-top: 1.5rem !important; + } + .mr-xl-5, + .mx-xl-5 { + margin-right: 1.5rem !important; + } + .mb-xl-5, + .my-xl-5 { + margin-bottom: 1.5rem !important; + } + .ml-xl-5, + .mx-xl-5 { + margin-left: 1.5rem !important; + } + .m-xl-6 { + margin: 2rem !important; + } + .mt-xl-6, + .my-xl-6 { + margin-top: 2rem !important; + } + .mr-xl-6, + .mx-xl-6 { + margin-right: 2rem !important; + } + .mb-xl-6, + .my-xl-6 { + margin-bottom: 2rem !important; + } + .ml-xl-6, + .mx-xl-6 { + margin-left: 2rem !important; + } + .m-xl-7 { + margin: 3rem !important; + } + .mt-xl-7, + .my-xl-7 { + margin-top: 3rem !important; + } + .mr-xl-7, + .mx-xl-7 { + margin-right: 3rem !important; + } + .mb-xl-7, + .my-xl-7 { + margin-bottom: 3rem !important; + } + .ml-xl-7, + .mx-xl-7 { + margin-left: 3rem !important; + } + .m-xl-8 { + margin: 4rem !important; + } + .mt-xl-8, + .my-xl-8 { + margin-top: 4rem !important; + } + .mr-xl-8, + .mx-xl-8 { + margin-right: 4rem !important; + } + .mb-xl-8, + .my-xl-8 { + margin-bottom: 4rem !important; + } + .ml-xl-8, + .mx-xl-8 { + margin-left: 4rem !important; + } + .m-xl-9 { + margin: 6rem !important; + } + .mt-xl-9, + .my-xl-9 { + margin-top: 6rem !important; + } + .mr-xl-9, + .mx-xl-9 { + margin-right: 6rem !important; + } + .mb-xl-9, + .my-xl-9 { + margin-bottom: 6rem !important; + } + .ml-xl-9, + .mx-xl-9 { + margin-left: 6rem !important; + } + .p-xl-0 { + padding: 0 !important; + } + .pt-xl-0, + .py-xl-0 { + padding-top: 0 !important; + } + .pr-xl-0, + .px-xl-0 { + padding-right: 0 !important; + } + .pb-xl-0, + .py-xl-0 { + padding-bottom: 0 !important; + } + .pl-xl-0, + .px-xl-0 { + padding-left: 0 !important; + } + .p-xl-1 { + padding: 0.25rem !important; + } + .pt-xl-1, + .py-xl-1 { + padding-top: 0.25rem !important; + } + .pr-xl-1, + .px-xl-1 { + padding-right: 0.25rem !important; + } + .pb-xl-1, + .py-xl-1 { + padding-bottom: 0.25rem !important; + } + .pl-xl-1, + .px-xl-1 { + padding-left: 0.25rem !important; + } + .p-xl-2 { + padding: 0.5rem !important; + } + .pt-xl-2, + .py-xl-2 { + padding-top: 0.5rem !important; + } + .pr-xl-2, + .px-xl-2 { + padding-right: 0.5rem !important; + } + .pb-xl-2, + .py-xl-2 { + padding-bottom: 0.5rem !important; + } + .pl-xl-2, + .px-xl-2 { + padding-left: 0.5rem !important; + } + .p-xl-3 { + padding: 0.75rem !important; + } + .pt-xl-3, + .py-xl-3 { + padding-top: 0.75rem !important; + } + .pr-xl-3, + .px-xl-3 { + padding-right: 0.75rem !important; + } + .pb-xl-3, + .py-xl-3 { + padding-bottom: 0.75rem !important; + } + .pl-xl-3, + .px-xl-3 { + padding-left: 0.75rem !important; + } + .p-xl-4 { + padding: 1rem !important; + } + .pt-xl-4, + .py-xl-4 { + padding-top: 1rem !important; + } + .pr-xl-4, + .px-xl-4 { + padding-right: 1rem !important; + } + .pb-xl-4, + .py-xl-4 { + padding-bottom: 1rem !important; + } + .pl-xl-4, + .px-xl-4 { + padding-left: 1rem !important; + } + .p-xl-5 { + padding: 1.5rem !important; + } + .pt-xl-5, + .py-xl-5 { + padding-top: 1.5rem !important; + } + .pr-xl-5, + .px-xl-5 { + padding-right: 1.5rem !important; + } + .pb-xl-5, + .py-xl-5 { + padding-bottom: 1.5rem !important; + } + .pl-xl-5, + .px-xl-5 { + padding-left: 1.5rem !important; + } + .p-xl-6 { + padding: 2rem !important; + } + .pt-xl-6, + .py-xl-6 { + padding-top: 2rem !important; + } + .pr-xl-6, + .px-xl-6 { + padding-right: 2rem !important; + } + .pb-xl-6, + .py-xl-6 { + padding-bottom: 2rem !important; + } + .pl-xl-6, + .px-xl-6 { + padding-left: 2rem !important; + } + .p-xl-7 { + padding: 3rem !important; + } + .pt-xl-7, + .py-xl-7 { + padding-top: 3rem !important; + } + .pr-xl-7, + .px-xl-7 { + padding-right: 3rem !important; + } + .pb-xl-7, + .py-xl-7 { + padding-bottom: 3rem !important; + } + .pl-xl-7, + .px-xl-7 { + padding-left: 3rem !important; + } + .p-xl-8 { + padding: 4rem !important; + } + .pt-xl-8, + .py-xl-8 { + padding-top: 4rem !important; + } + .pr-xl-8, + .px-xl-8 { + padding-right: 4rem !important; + } + .pb-xl-8, + .py-xl-8 { + padding-bottom: 4rem !important; + } + .pl-xl-8, + .px-xl-8 { + padding-left: 4rem !important; + } + .p-xl-9 { + padding: 6rem !important; + } + .pt-xl-9, + .py-xl-9 { + padding-top: 6rem !important; + } + .pr-xl-9, + .px-xl-9 { + padding-right: 6rem !important; + } + .pb-xl-9, + .py-xl-9 { + padding-bottom: 6rem !important; + } + .pl-xl-9, + .px-xl-9 { + padding-left: 6rem !important; + } + .m-xl-auto { + margin: auto !important; + } + .mt-xl-auto, + .my-xl-auto { + margin-top: auto !important; + } + .mr-xl-auto, + .mx-xl-auto { + margin-right: auto !important; + } + .mb-xl-auto, + .my-xl-auto { + margin-bottom: auto !important; + } + .ml-xl-auto, + .mx-xl-auto { + margin-left: auto !important; + } +} + +.text-monospace { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +.text-justify { + text-align: justify !important; +} + +.text-nowrap { + white-space: nowrap !important; +} + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +.text-left { + text-align: left !important; +} + +.text-right { + text-align: right !important; +} + +.text-center { + text-align: center !important; +} + +@media (min-width: 576px) { + .text-sm-left { + text-align: left !important; + } + .text-sm-right { + text-align: right !important; + } + .text-sm-center { + text-align: center !important; + } +} + +@media (min-width: 768px) { + .text-md-left { + text-align: left !important; + } + .text-md-right { + text-align: right !important; + } + .text-md-center { + text-align: center !important; + } +} + +@media (min-width: 992px) { + .text-lg-left { + text-align: left !important; + } + .text-lg-right { + text-align: right !important; + } + .text-lg-center { + text-align: center !important; + } +} + +@media (min-width: 1280px) { + .text-xl-left { + text-align: left !important; + } + .text-xl-right { + text-align: right !important; + } + .text-xl-center { + text-align: center !important; + } +} + +.text-lowercase { + text-transform: lowercase !important; +} + +.text-uppercase { + text-transform: uppercase !important; +} + +.text-capitalize { + text-transform: capitalize !important; +} + +.font-weight-light { + font-weight: 300 !important; +} + +.font-weight-normal { + font-weight: 400 !important; +} + +.font-weight-bold { + font-weight: 700 !important; +} + +.font-italic { + font-style: italic !important; +} + +.text-white { + color: #fff !important; +} + +.text-primary { + color: #467fcf !important; +} + +a.text-primary:hover, a.text-primary:focus { + color: #2f66b3 !important; +} + +.text-secondary { + color: #868e96 !important; +} + +a.text-secondary:hover, a.text-secondary:focus { + color: #6c757d !important; +} + +.text-success { + color: #5eba00 !important; +} + +a.text-success:hover, a.text-success:focus { + color: #448700 !important; +} + +.text-info { + color: #45aaf2 !important; +} + +a.text-info:hover, a.text-info:focus { + color: #1594ef !important; +} + +.text-warning { + color: #f1c40f !important; +} + +a.text-warning:hover, a.text-warning:focus { + color: #c29d0b !important; +} + +.text-danger { + color: #cd201f !important; +} + +a.text-danger:hover, a.text-danger:focus { + color: #a11918 !important; +} + +.text-light { + color: #f8f9fa !important; +} + +a.text-light:hover, a.text-light:focus { + color: #dae0e5 !important; +} + +.text-dark { + color: #343a40 !important; +} + +a.text-dark:hover, a.text-dark:focus { + color: #1d2124 !important; +} + +.text-body { + color: #495057 !important; +} + +.text-muted { + color: #9aa0ac !important; +} + +.text-black-50 { + color: rgba(0, 0, 0, 0.5) !important; +} + +.text-white-50 { + color: rgba(255, 255, 255, 0.5) !important; +} + +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} + +.visible { + visibility: visible !important; +} + +.invisible { + visibility: hidden !important; +} + +@media print { + *, + *::before, + *::after { + text-shadow: none !important; + box-shadow: none !important; + } + a:not(.btn) { + text-decoration: underline; + } + abbr[title]::after { + content: " (" attr(title) ")"; + } + pre { + white-space: pre-wrap !important; + } + pre, + blockquote { + border: 1px solid #adb5bd; + page-break-inside: avoid; + } + thead { + display: table-header-group; + } + tr, + img { + page-break-inside: avoid; + } + p, + h2, + h3 { + orphans: 3; + widows: 3; + } + h2, + h3 { + page-break-after: avoid; + } + @page { + size: a3; + } + body { + min-width: 992px !important; + } + .container { + min-width: 992px !important; + } + .navbar { + display: none; + } + .badge { + border: 1px solid #000; + } + .table, .text-wrap table { + border-collapse: collapse !important; + } + + .table td, + .text-wrap table td, .table th, .text-wrap table th { + background-color: #fff !important; + } + .table-bordered th, .text-wrap table th, + .table-bordered td, + .text-wrap table td { + border: 1px solid #dee2e6 !important; + } +} + +html { + font-size: 16px; + height: 100%; + direction: ltr; +} + +body { + direction: ltr; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; + -webkit-tap-highlight-color: transparent; + -webkit-text-size-adjust: none; + -ms-touch-action: manipulation; + touch-action: manipulation; + -webkit-font-feature-settings: "liga" 0; + font-feature-settings: "liga" 0; + height: 100%; + overflow-y: scroll; + position: relative; +} + +@media print { + body { + background: none; + } +} + +body *::-webkit-scrollbar { + width: 6px; + height: 6px; + transition: .3s background; +} + +body *::-webkit-scrollbar-thumb { + background: #ced4da; +} + +body *:hover::-webkit-scrollbar-thumb { + background: #adb5bd; +} + +.lead { + line-height: 1.4; +} + +a { + -webkit-text-decoration-skip: ink; + text-decoration-skip: ink; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a, +.h1 a, .h2 a, .h3 a, .h4 a, .h5 a, .h6 a { + color: inherit; +} + +strong, +b { + font-weight: 600; +} + +p, +ul, +ol, +blockquote { + margin-bottom: 1em; +} + +blockquote { + font-style: italic; + color: #6e7687; + padding-left: 2rem; + border-left: 2px solid rgba(0, 40, 100, 0.12); +} + +blockquote p { + margin-bottom: 1rem; +} + +blockquote cite { + display: block; + text-align: right; +} + +blockquote cite:before { + content: '— '; +} + +code { + background: rgba(0, 0, 0, 0.025); + border: 1px solid rgba(0, 0, 0, 0.05); + border-radius: 3px; + padding: 3px; +} + +pre code { + padding: 0; + border-radius: 0; + border: none; + background: none; +} + +hr { + margin-top: 2rem; + margin-bottom: 2rem; +} + +pre { + color: #343a40; + padding: 1rem; + overflow: auto; + font-size: 85%; + line-height: 1.45; + background-color: #f8fafc; + border-radius: 3px; + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + text-shadow: 0 1px white; + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} + +img { + max-width: 100%; +} + +.text-wrap { + font-size: 1rem; + line-height: 1.66; +} + +.text-wrap > :first-child { + margin-top: 0; +} + +.text-wrap > :last-child { + margin-bottom: 0; +} + +.text-wrap > h1, .text-wrap > h2, .text-wrap > h3, .text-wrap > h4, .text-wrap > h5, .text-wrap > h6 { + margin-top: 1em; +} + +.section-nav { + background-color: #f8f9fa; + margin: 1rem 0; + padding: .5rem 1rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + list-style: none; +} + +.section-nav:before { + content: 'Table of contents:'; + display: block; + font-weight: 600; +} + +@media print { + .container { + max-width: none; + } +} + +.row-cards > .col, +.row-cards > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.row-deck > .col, +.row-deck > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-align: stretch; + align-items: stretch; +} + +.row-deck > .col .card, +.row-deck > [class*='col-'] .card { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.col-text { + max-width: 48rem; +} + +.col-login { + max-width: 24rem; +} + +.gutters-0 { + margin-right: 0; + margin-left: 0; +} + +.gutters-0 > .col, +.gutters-0 > [class*="col-"] { + padding-right: 0; + padding-left: 0; +} + +.gutters-0 .card { + margin-bottom: 0; +} + +.gutters-xs { + margin-right: -0.25rem; + margin-left: -0.25rem; +} + +.gutters-xs > .col, +.gutters-xs > [class*="col-"] { + padding-right: 0.25rem; + padding-left: 0.25rem; +} + +.gutters-xs .card { + margin-bottom: 0.5rem; +} + +.gutters-sm { + margin-right: -0.5rem; + margin-left: -0.5rem; +} + +.gutters-sm > .col, +.gutters-sm > [class*="col-"] { + padding-right: 0.5rem; + padding-left: 0.5rem; +} + +.gutters-sm .card { + margin-bottom: 1rem; +} + +.gutters-lg { + margin-right: -1rem; + margin-left: -1rem; +} + +.gutters-lg > .col, +.gutters-lg > [class*="col-"] { + padding-right: 1rem; + padding-left: 1rem; +} + +.gutters-lg .card { + margin-bottom: 2rem; +} + +.gutters-xl { + margin-right: -1.5rem; + margin-left: -1.5rem; +} + +.gutters-xl > .col, +.gutters-xl > [class*="col-"] { + padding-right: 1.5rem; + padding-left: 1.5rem; +} + +.gutters-xl .card { + margin-bottom: 3rem; +} + +.page { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + min-height: 100%; +} + +body.fixed-header .page { + padding-top: 4.5rem; +} + +@media (min-width: 1600px) { + body.aside-opened .page { + margin-right: 22rem; + } +} + +.page-main { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.page-content { + margin: .75rem 0; +} + +@media (min-width: 768px) { + .page-content { + margin: 1.5rem 0; + } +} + +.page-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + margin: 1.5rem 0 1.5rem; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.page-title { + margin: 0; + font-size: 1.5rem; + font-weight: 400; + line-height: 2.5rem; +} + +.page-title-icon { + color: #9aa0ac; + font-size: 1.25rem; +} + +.page-subtitle { + font-size: 0.8125rem; + color: #6e7687; + margin-left: 2rem; +} + +.page-subtitle a { + color: inherit; +} + +.page-options { + margin-left: auto; +} + +.page-breadcrumb { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; +} + +.page-description { + margin: .25rem 0 0; + color: #6e7687; +} + +.page-description a { + color: inherit; +} + +.page-single { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + padding: 1rem 0; +} + +.content-heading { + font-weight: 400; + margin: 2rem 0 1.5rem; + font-size: 1.25rem; + line-height: 1.25; +} + +.content-heading:first-child { + margin-top: 0; +} + +.aside { + position: fixed; + top: 0; + right: 0; + bottom: 0; + width: 22rem; + background: #ffffff; + border-left: 1px solid rgba(0, 40, 100, 0.12); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + z-index: 100; + visibility: hidden; + box-shadow: 0 0 5px 2px rgba(0, 0, 0, 0.05); +} + +@media (min-width: 1600px) { + body.aside-opened .aside { + visibility: visible; + } +} + +.aside-body { + padding: 1.5rem; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + overflow: auto; +} + +.aside-footer { + padding: 1rem 1.5rem; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.aside-header { + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.header { + padding-top: .75rem; + padding-bottom: .75rem; + background: #fff; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +body.fixed-header .header { + position: fixed; + top: 0; + left: 0; + right: 0; + z-index: 1030; +} + +@media print { + .header { + display: none; + } +} + +.header .dropdown-menu { + margin-top: .75rem; +} + +.nav-unread { + position: absolute; + top: .25rem; + right: .25rem; + background: #cd201f; + width: .5rem; + height: .5rem; + border-radius: 50%; +} + +.header-brand { + color: inherit; + margin-right: 1rem; + font-size: 1.25rem; + white-space: nowrap; + font-weight: 600; + padding: 0; + transition: .3s opacity; + line-height: 2rem; +} + +.header-brand:hover { + opacity: .8; + color: inherit; + text-decoration: none; +} + +.header-brand-img { + height: 2rem; + line-height: 2rem; + vertical-align: bottom; + margin-right: .5rem; + width: auto; +} + +.header-avatar { + width: 2rem; + height: 2rem; + display: inline-block; + vertical-align: bottom; + border-radius: 50%; +} + +.header-btn { + display: inline-block; + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + font-size: 1rem; +} + +.header-btn.has-new { + position: relative; +} + +.header-btn.has-new:before { + content: ''; + width: 6px; + height: 6px; + background: #cd201f; + position: absolute; + top: 4px; + right: 4px; + border-radius: 50%; +} + +.header-toggler { + width: 2rem; + height: 2rem; + position: relative; + color: #9aa0ac; +} + +.header-toggler:hover { + color: #6e7687; +} + +.header-toggler-icon { + position: absolute; + width: 1rem; + height: 2px; + color: inherit; + background: currentColor; + border-radius: 3px; + top: 50%; + left: 50%; + margin: -2px 0 0 -.5rem; + box-shadow: 0 5px currentColor, 0 -5px currentColor; +} + +.footer { + background: #fff; + border-top: 1px solid rgba(0, 40, 100, 0.12); + font-size: 0.875rem; + padding: 1.25rem 0; + color: #9aa0ac; +} + +.footer a:not(.btn) { + color: #6e7687; +} + +@media print { + .footer { + display: none; + } +} + +.bg-blue-lightest { + background-color: #edf2fa !important; +} + +a.bg-blue-lightest:hover, a.bg-blue-lightest:focus, +button.bg-blue-lightest:hover, +button.bg-blue-lightest:focus { + background-color: #c5d5ef !important; +} + +.bg-blue-lighter { + background-color: #c8d9f1 !important; +} + +a.bg-blue-lighter:hover, a.bg-blue-lighter:focus, +button.bg-blue-lighter:hover, +button.bg-blue-lighter:focus { + background-color: #9fbde7 !important; +} + +.bg-blue-light { + background-color: #7ea5dd !important; +} + +a.bg-blue-light:hover, a.bg-blue-light:focus, +button.bg-blue-light:hover, +button.bg-blue-light:focus { + background-color: #5689d2 !important; +} + +.bg-blue-dark { + background-color: #3866a6 !important; +} + +a.bg-blue-dark:hover, a.bg-blue-dark:focus, +button.bg-blue-dark:hover, +button.bg-blue-dark:focus { + background-color: #2b4f80 !important; +} + +.bg-blue-darker { + background-color: #1c3353 !important; +} + +a.bg-blue-darker:hover, a.bg-blue-darker:focus, +button.bg-blue-darker:hover, +button.bg-blue-darker:focus { + background-color: #0f1c2d !important; +} + +.bg-blue-darkest { + background-color: #0e1929 !important; +} + +a.bg-blue-darkest:hover, a.bg-blue-darkest:focus, +button.bg-blue-darkest:hover, +button.bg-blue-darkest:focus { + background-color: #010203 !important; +} + +.bg-indigo-lightest { + background-color: #f0f1fa !important; +} + +a.bg-indigo-lightest:hover, a.bg-indigo-lightest:focus, +button.bg-indigo-lightest:hover, +button.bg-indigo-lightest:focus { + background-color: #cacded !important; +} + +.bg-indigo-lighter { + background-color: #d1d5f0 !important; +} + +a.bg-indigo-lighter:hover, a.bg-indigo-lighter:focus, +button.bg-indigo-lighter:hover, +button.bg-indigo-lighter:focus { + background-color: #abb2e3 !important; +} + +.bg-indigo-light { + background-color: #939edc !important; +} + +a.bg-indigo-light:hover, a.bg-indigo-light:focus, +button.bg-indigo-light:hover, +button.bg-indigo-light:focus { + background-color: #6c7bd0 !important; +} + +.bg-indigo-dark { + background-color: #515da4 !important; +} + +a.bg-indigo-dark:hover, a.bg-indigo-dark:focus, +button.bg-indigo-dark:hover, +button.bg-indigo-dark:focus { + background-color: #404a82 !important; +} + +.bg-indigo-darker { + background-color: #282e52 !important; +} + +a.bg-indigo-darker:hover, a.bg-indigo-darker:focus, +button.bg-indigo-darker:hover, +button.bg-indigo-darker:focus { + background-color: #171b30 !important; +} + +.bg-indigo-darkest { + background-color: #141729 !important; +} + +a.bg-indigo-darkest:hover, a.bg-indigo-darkest:focus, +button.bg-indigo-darkest:hover, +button.bg-indigo-darkest:focus { + background-color: #030407 !important; +} + +.bg-purple-lightest { + background-color: #f6effd !important; +} + +a.bg-purple-lightest:hover, a.bg-purple-lightest:focus, +button.bg-purple-lightest:hover, +button.bg-purple-lightest:focus { + background-color: #ddc2f7 !important; +} + +.bg-purple-lighter { + background-color: #e4cff9 !important; +} + +a.bg-purple-lighter:hover, a.bg-purple-lighter:focus, +button.bg-purple-lighter:hover, +button.bg-purple-lighter:focus { + background-color: #cba2f3 !important; +} + +.bg-purple-light { + background-color: #c08ef0 !important; +} + +a.bg-purple-light:hover, a.bg-purple-light:focus, +button.bg-purple-light:hover, +button.bg-purple-light:focus { + background-color: #a761ea !important; +} + +.bg-purple-dark { + background-color: #844bbb !important; +} + +a.bg-purple-dark:hover, a.bg-purple-dark:focus, +button.bg-purple-dark:hover, +button.bg-purple-dark:focus { + background-color: #6a3a99 !important; +} + +.bg-purple-darker { + background-color: #42265e !important; +} + +a.bg-purple-darker:hover, a.bg-purple-darker:focus, +button.bg-purple-darker:hover, +button.bg-purple-darker:focus { + background-color: #29173a !important; +} + +.bg-purple-darkest { + background-color: #21132f !important; +} + +a.bg-purple-darkest:hover, a.bg-purple-darkest:focus, +button.bg-purple-darkest:hover, +button.bg-purple-darkest:focus { + background-color: #08040b !important; +} + +.bg-pink-lightest { + background-color: #fef0f5 !important; +} + +a.bg-pink-lightest:hover, a.bg-pink-lightest:focus, +button.bg-pink-lightest:hover, +button.bg-pink-lightest:focus { + background-color: #fbc0d5 !important; +} + +.bg-pink-lighter { + background-color: #fcd3e1 !important; +} + +a.bg-pink-lighter:hover, a.bg-pink-lighter:focus, +button.bg-pink-lighter:hover, +button.bg-pink-lighter:focus { + background-color: #f9a3c0 !important; +} + +.bg-pink-light { + background-color: #f999b9 !important; +} + +a.bg-pink-light:hover, a.bg-pink-light:focus, +button.bg-pink-light:hover, +button.bg-pink-light:focus { + background-color: #f66998 !important; +} + +.bg-pink-dark { + background-color: #c5577c !important; +} + +a.bg-pink-dark:hover, a.bg-pink-dark:focus, +button.bg-pink-dark:hover, +button.bg-pink-dark:focus { + background-color: #ad3c62 !important; +} + +.bg-pink-darker { + background-color: #622c3e !important; +} + +a.bg-pink-darker:hover, a.bg-pink-darker:focus, +button.bg-pink-darker:hover, +button.bg-pink-darker:focus { + background-color: #3f1c28 !important; +} + +.bg-pink-darkest { + background-color: #31161f !important; +} + +a.bg-pink-darkest:hover, a.bg-pink-darkest:focus, +button.bg-pink-darkest:hover, +button.bg-pink-darkest:focus { + background-color: #0e0609 !important; +} + +.bg-red-lightest { + background-color: #fae9e9 !important; +} + +a.bg-red-lightest:hover, a.bg-red-lightest:focus, +button.bg-red-lightest:hover, +button.bg-red-lightest:focus { + background-color: #f1bfbf !important; +} + +.bg-red-lighter { + background-color: #f0bcbc !important; +} + +a.bg-red-lighter:hover, a.bg-red-lighter:focus, +button.bg-red-lighter:hover, +button.bg-red-lighter:focus { + background-color: #e79292 !important; +} + +.bg-red-light { + background-color: #dc6362 !important; +} + +a.bg-red-light:hover, a.bg-red-light:focus, +button.bg-red-light:hover, +button.bg-red-light:focus { + background-color: #d33a38 !important; +} + +.bg-red-dark { + background-color: #a41a19 !important; +} + +a.bg-red-dark:hover, a.bg-red-dark:focus, +button.bg-red-dark:hover, +button.bg-red-dark:focus { + background-color: #781312 !important; +} + +.bg-red-darker { + background-color: #520d0c !important; +} + +a.bg-red-darker:hover, a.bg-red-darker:focus, +button.bg-red-darker:hover, +button.bg-red-darker:focus { + background-color: #260605 !important; +} + +.bg-red-darkest { + background-color: #290606 !important; +} + +a.bg-red-darkest:hover, a.bg-red-darkest:focus, +button.bg-red-darkest:hover, +button.bg-red-darkest:focus { + background-color: black !important; +} + +.bg-orange-lightest { + background-color: #fff5ec !important; +} + +a.bg-orange-lightest:hover, a.bg-orange-lightest:focus, +button.bg-orange-lightest:hover, +button.bg-orange-lightest:focus { + background-color: peachpuff !important; +} + +.bg-orange-lighter { + background-color: #fee0c7 !important; +} + +a.bg-orange-lighter:hover, a.bg-orange-lighter:focus, +button.bg-orange-lighter:hover, +button.bg-orange-lighter:focus { + background-color: #fdc495 !important; +} + +.bg-orange-light { + background-color: #feb67c !important; +} + +a.bg-orange-light:hover, a.bg-orange-light:focus, +button.bg-orange-light:hover, +button.bg-orange-light:focus { + background-color: #fe9a49 !important; +} + +.bg-orange-dark { + background-color: #ca7836 !important; +} + +a.bg-orange-dark:hover, a.bg-orange-dark:focus, +button.bg-orange-dark:hover, +button.bg-orange-dark:focus { + background-color: #a2602b !important; +} + +.bg-orange-darker { + background-color: #653c1b !important; +} + +a.bg-orange-darker:hover, a.bg-orange-darker:focus, +button.bg-orange-darker:hover, +button.bg-orange-darker:focus { + background-color: #3d2410 !important; +} + +.bg-orange-darkest { + background-color: #331e0e !important; +} + +a.bg-orange-darkest:hover, a.bg-orange-darkest:focus, +button.bg-orange-darkest:hover, +button.bg-orange-darkest:focus { + background-color: #0b0603 !important; +} + +.bg-yellow-lightest { + background-color: #fef9e7 !important; +} + +a.bg-yellow-lightest:hover, a.bg-yellow-lightest:focus, +button.bg-yellow-lightest:hover, +button.bg-yellow-lightest:focus { + background-color: #fcedb6 !important; +} + +.bg-yellow-lighter { + background-color: #fbedb7 !important; +} + +a.bg-yellow-lighter:hover, a.bg-yellow-lighter:focus, +button.bg-yellow-lighter:hover, +button.bg-yellow-lighter:focus { + background-color: #f8e187 !important; +} + +.bg-yellow-light { + background-color: #f5d657 !important; +} + +a.bg-yellow-light:hover, a.bg-yellow-light:focus, +button.bg-yellow-light:hover, +button.bg-yellow-light:focus { + background-color: #f2ca27 !important; +} + +.bg-yellow-dark { + background-color: #c19d0c !important; +} + +a.bg-yellow-dark:hover, a.bg-yellow-dark:focus, +button.bg-yellow-dark:hover, +button.bg-yellow-dark:focus { + background-color: #917609 !important; +} + +.bg-yellow-darker { + background-color: #604e06 !important; +} + +a.bg-yellow-darker:hover, a.bg-yellow-darker:focus, +button.bg-yellow-darker:hover, +button.bg-yellow-darker:focus { + background-color: #302703 !important; +} + +.bg-yellow-darkest { + background-color: #302703 !important; +} + +a.bg-yellow-darkest:hover, a.bg-yellow-darkest:focus, +button.bg-yellow-darkest:hover, +button.bg-yellow-darkest:focus { + background-color: black !important; +} + +.bg-green-lightest { + background-color: #eff8e6 !important; +} + +a.bg-green-lightest:hover, a.bg-green-lightest:focus, +button.bg-green-lightest:hover, +button.bg-green-lightest:focus { + background-color: #d6edbe !important; +} + +.bg-green-lighter { + background-color: #cfeab3 !important; +} + +a.bg-green-lighter:hover, a.bg-green-lighter:focus, +button.bg-green-lighter:hover, +button.bg-green-lighter:focus { + background-color: #b6df8b !important; +} + +.bg-green-light { + background-color: #8ecf4d !important; +} + +a.bg-green-light:hover, a.bg-green-light:focus, +button.bg-green-light:hover, +button.bg-green-light:focus { + background-color: #75b831 !important; +} + +.bg-green-dark { + background-color: #4b9500 !important; +} + +a.bg-green-dark:hover, a.bg-green-dark:focus, +button.bg-green-dark:hover, +button.bg-green-dark:focus { + background-color: #316200 !important; +} + +.bg-green-darker { + background-color: #264a00 !important; +} + +a.bg-green-darker:hover, a.bg-green-darker:focus, +button.bg-green-darker:hover, +button.bg-green-darker:focus { + background-color: #0c1700 !important; +} + +.bg-green-darkest { + background-color: #132500 !important; +} + +a.bg-green-darkest:hover, a.bg-green-darkest:focus, +button.bg-green-darkest:hover, +button.bg-green-darkest:focus { + background-color: black !important; +} + +.bg-teal-lightest { + background-color: #eafaf8 !important; +} + +a.bg-teal-lightest:hover, a.bg-teal-lightest:focus, +button.bg-teal-lightest:hover, +button.bg-teal-lightest:focus { + background-color: #c1f0ea !important; +} + +.bg-teal-lighter { + background-color: #bfefea !important; +} + +a.bg-teal-lighter:hover, a.bg-teal-lighter:focus, +button.bg-teal-lighter:hover, +button.bg-teal-lighter:focus { + background-color: #96e5dd !important; +} + +.bg-teal-light { + background-color: #6bdbcf !important; +} + +a.bg-teal-light:hover, a.bg-teal-light:focus, +button.bg-teal-light:hover, +button.bg-teal-light:focus { + background-color: #42d1c2 !important; +} + +.bg-teal-dark { + background-color: #22a295 !important; +} + +a.bg-teal-dark:hover, a.bg-teal-dark:focus, +button.bg-teal-dark:hover, +button.bg-teal-dark:focus { + background-color: #19786e !important; +} + +.bg-teal-darker { + background-color: #11514a !important; +} + +a.bg-teal-darker:hover, a.bg-teal-darker:focus, +button.bg-teal-darker:hover, +button.bg-teal-darker:focus { + background-color: #082723 !important; +} + +.bg-teal-darkest { + background-color: #092925 !important; +} + +a.bg-teal-darkest:hover, a.bg-teal-darkest:focus, +button.bg-teal-darkest:hover, +button.bg-teal-darkest:focus { + background-color: black !important; +} + +.bg-cyan-lightest { + background-color: #e8f6f8 !important; +} + +a.bg-cyan-lightest:hover, a.bg-cyan-lightest:focus, +button.bg-cyan-lightest:hover, +button.bg-cyan-lightest:focus { + background-color: #c1e7ec !important; +} + +.bg-cyan-lighter { + background-color: #b9e3ea !important; +} + +a.bg-cyan-lighter:hover, a.bg-cyan-lighter:focus, +button.bg-cyan-lighter:hover, +button.bg-cyan-lighter:focus { + background-color: #92d3de !important; +} + +.bg-cyan-light { + background-color: #5dbecd !important; +} + +a.bg-cyan-light:hover, a.bg-cyan-light:focus, +button.bg-cyan-light:hover, +button.bg-cyan-light:focus { + background-color: #3aabbd !important; +} + +.bg-cyan-dark { + background-color: #128293 !important; +} + +a.bg-cyan-dark:hover, a.bg-cyan-dark:focus, +button.bg-cyan-dark:hover, +button.bg-cyan-dark:focus { + background-color: #0c5a66 !important; +} + +.bg-cyan-darker { + background-color: #09414a !important; +} + +a.bg-cyan-darker:hover, a.bg-cyan-darker:focus, +button.bg-cyan-darker:hover, +button.bg-cyan-darker:focus { + background-color: #03191d !important; +} + +.bg-cyan-darkest { + background-color: #052025 !important; +} + +a.bg-cyan-darkest:hover, a.bg-cyan-darkest:focus, +button.bg-cyan-darkest:hover, +button.bg-cyan-darkest:focus { + background-color: black !important; +} + +.bg-white-lightest { + background-color: white !important; +} + +a.bg-white-lightest:hover, a.bg-white-lightest:focus, +button.bg-white-lightest:hover, +button.bg-white-lightest:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-lighter { + background-color: white !important; +} + +a.bg-white-lighter:hover, a.bg-white-lighter:focus, +button.bg-white-lighter:hover, +button.bg-white-lighter:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-light { + background-color: white !important; +} + +a.bg-white-light:hover, a.bg-white-light:focus, +button.bg-white-light:hover, +button.bg-white-light:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-dark { + background-color: #cccccc !important; +} + +a.bg-white-dark:hover, a.bg-white-dark:focus, +button.bg-white-dark:hover, +button.bg-white-dark:focus { + background-color: #b3b2b2 !important; +} + +.bg-white-darker { + background-color: #666666 !important; +} + +a.bg-white-darker:hover, a.bg-white-darker:focus, +button.bg-white-darker:hover, +button.bg-white-darker:focus { + background-color: #4d4c4c !important; +} + +.bg-white-darkest { + background-color: #333333 !important; +} + +a.bg-white-darkest:hover, a.bg-white-darkest:focus, +button.bg-white-darkest:hover, +button.bg-white-darkest:focus { + background-color: #1a1919 !important; +} + +.bg-gray-lightest { + background-color: #f3f4f5 !important; +} + +a.bg-gray-lightest:hover, a.bg-gray-lightest:focus, +button.bg-gray-lightest:hover, +button.bg-gray-lightest:focus { + background-color: #d7dbde !important; +} + +.bg-gray-lighter { + background-color: #dbdde0 !important; +} + +a.bg-gray-lighter:hover, a.bg-gray-lighter:focus, +button.bg-gray-lighter:hover, +button.bg-gray-lighter:focus { + background-color: #c0c3c8 !important; +} + +.bg-gray-light { + background-color: #aab0b6 !important; +} + +a.bg-gray-light:hover, a.bg-gray-light:focus, +button.bg-gray-light:hover, +button.bg-gray-light:focus { + background-color: #8f979e !important; +} + +.bg-gray-dark { + background-color: #6b7278 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #53585d !important; +} + +.bg-gray-darker { + background-color: #36393c !important; +} + +a.bg-gray-darker:hover, a.bg-gray-darker:focus, +button.bg-gray-darker:hover, +button.bg-gray-darker:focus { + background-color: #1e2021 !important; +} + +.bg-gray-darkest { + background-color: #1b1c1e !important; +} + +a.bg-gray-darkest:hover, a.bg-gray-darkest:focus, +button.bg-gray-darkest:hover, +button.bg-gray-darkest:focus { + background-color: #030303 !important; +} + +.bg-gray-dark-lightest { + background-color: #ebebec !important; +} + +a.bg-gray-dark-lightest:hover, a.bg-gray-dark-lightest:focus, +button.bg-gray-dark-lightest:hover, +button.bg-gray-dark-lightest:focus { + background-color: #d1d1d3 !important; +} + +.bg-gray-dark-lighter { + background-color: #c2c4c6 !important; +} + +a.bg-gray-dark-lighter:hover, a.bg-gray-dark-lighter:focus, +button.bg-gray-dark-lighter:hover, +button.bg-gray-dark-lighter:focus { + background-color: #a8abad !important; +} + +.bg-gray-dark-light { + background-color: #717579 !important; +} + +a.bg-gray-dark-light:hover, a.bg-gray-dark-light:focus, +button.bg-gray-dark-light:hover, +button.bg-gray-dark-light:focus { + background-color: #585c5f !important; +} + +.bg-gray-dark-dark { + background-color: #2a2e33 !important; +} + +a.bg-gray-dark-dark:hover, a.bg-gray-dark-dark:focus, +button.bg-gray-dark-dark:hover, +button.bg-gray-dark-dark:focus { + background-color: #131517 !important; +} + +.bg-gray-dark-darker { + background-color: #15171a !important; +} + +a.bg-gray-dark-darker:hover, a.bg-gray-dark-darker:focus, +button.bg-gray-dark-darker:hover, +button.bg-gray-dark-darker:focus { + background-color: black !important; +} + +.bg-gray-dark-darkest { + background-color: #0a0c0d !important; +} + +a.bg-gray-dark-darkest:hover, a.bg-gray-dark-darkest:focus, +button.bg-gray-dark-darkest:hover, +button.bg-gray-dark-darkest:focus { + background-color: black !important; +} + +.bg-azure-lightest { + background-color: #ecf7fe !important; +} + +a.bg-azure-lightest:hover, a.bg-azure-lightest:focus, +button.bg-azure-lightest:hover, +button.bg-azure-lightest:focus { + background-color: #bce3fb !important; +} + +.bg-azure-lighter { + background-color: #c7e6fb !important; +} + +a.bg-azure-lighter:hover, a.bg-azure-lighter:focus, +button.bg-azure-lighter:hover, +button.bg-azure-lighter:focus { + background-color: #97d1f8 !important; +} + +.bg-azure-light { + background-color: #7dc4f6 !important; +} + +a.bg-azure-light:hover, a.bg-azure-light:focus, +button.bg-azure-light:hover, +button.bg-azure-light:focus { + background-color: #4daef3 !important; +} + +.bg-azure-dark { + background-color: #3788c2 !important; +} + +a.bg-azure-dark:hover, a.bg-azure-dark:focus, +button.bg-azure-dark:hover, +button.bg-azure-dark:focus { + background-color: #2c6c9a !important; +} + +.bg-azure-darker { + background-color: #1c4461 !important; +} + +a.bg-azure-darker:hover, a.bg-azure-darker:focus, +button.bg-azure-darker:hover, +button.bg-azure-darker:focus { + background-color: #112839 !important; +} + +.bg-azure-darkest { + background-color: #0e2230 !important; +} + +a.bg-azure-darkest:hover, a.bg-azure-darkest:focus, +button.bg-azure-darkest:hover, +button.bg-azure-darkest:focus { + background-color: #020609 !important; +} + +.bg-lime-lightest { + background-color: #f2fbeb !important; +} + +a.bg-lime-lightest:hover, a.bg-lime-lightest:focus, +button.bg-lime-lightest:hover, +button.bg-lime-lightest:focus { + background-color: #d6f3c1 !important; +} + +.bg-lime-lighter { + background-color: #d7f2c2 !important; +} + +a.bg-lime-lighter:hover, a.bg-lime-lighter:focus, +button.bg-lime-lighter:hover, +button.bg-lime-lighter:focus { + background-color: #bbe998 !important; +} + +.bg-lime-light { + background-color: #a3e072 !important; +} + +a.bg-lime-light:hover, a.bg-lime-light:focus, +button.bg-lime-light:hover, +button.bg-lime-light:focus { + background-color: #88d748 !important; +} + +.bg-lime-dark { + background-color: #62a82a !important; +} + +a.bg-lime-dark:hover, a.bg-lime-dark:focus, +button.bg-lime-dark:hover, +button.bg-lime-dark:focus { + background-color: #4a7f20 !important; +} + +.bg-lime-darker { + background-color: #315415 !important; +} + +a.bg-lime-darker:hover, a.bg-lime-darker:focus, +button.bg-lime-darker:hover, +button.bg-lime-darker:focus { + background-color: #192b0b !important; +} + +.bg-lime-darkest { + background-color: #192a0b !important; +} + +a.bg-lime-darkest:hover, a.bg-lime-darkest:focus, +button.bg-lime-darkest:hover, +button.bg-lime-darkest:focus { + background-color: #010200 !important; +} + +.display-1 i, +.display-2 i, +.display-3 i, +.display-4 i { + vertical-align: baseline; + font-size: 0.815em; +} + +.text-inherit { + color: inherit !important; +} + +.text-default { + color: #495057 !important; +} + +.text-muted-dark { + color: #6e7687 !important; +} + +.tracking-tight { + letter-spacing: -0.05em !important; +} + +.tracking-normal { + letter-spacing: 0 !important; +} + +.tracking-wide { + letter-spacing: 0.05em !important; +} + +.leading-none { + line-height: 1 !important; +} + +.leading-tight { + line-height: 1.25 !important; +} + +.leading-normal { + line-height: 1.5 !important; +} + +.leading-loose { + line-height: 2 !important; +} + +.bg-blue { + background-color: #467fcf !important; +} + +a.bg-blue:hover, a.bg-blue:focus, +button.bg-blue:hover, +button.bg-blue:focus { + background-color: #2f66b3 !important; +} + +.text-blue { + color: #467fcf !important; +} + +.bg-indigo { + background-color: #6574cd !important; +} + +a.bg-indigo:hover, a.bg-indigo:focus, +button.bg-indigo:hover, +button.bg-indigo:focus { + background-color: #3f51c1 !important; +} + +.text-indigo { + color: #6574cd !important; +} + +.bg-purple { + background-color: #a55eea !important; +} + +a.bg-purple:hover, a.bg-purple:focus, +button.bg-purple:hover, +button.bg-purple:focus { + background-color: #8c31e4 !important; +} + +.text-purple { + color: #a55eea !important; +} + +.bg-pink { + background-color: #f66d9b !important; +} + +a.bg-pink:hover, a.bg-pink:focus, +button.bg-pink:hover, +button.bg-pink:focus { + background-color: #f33d7a !important; +} + +.text-pink { + color: #f66d9b !important; +} + +.bg-red { + background-color: #cd201f !important; +} + +a.bg-red:hover, a.bg-red:focus, +button.bg-red:hover, +button.bg-red:focus { + background-color: #a11918 !important; +} + +.text-red { + color: #cd201f !important; +} + +.bg-orange { + background-color: #fd9644 !important; +} + +a.bg-orange:hover, a.bg-orange:focus, +button.bg-orange:hover, +button.bg-orange:focus { + background-color: #fc7a12 !important; +} + +.text-orange { + color: #fd9644 !important; +} + +.bg-yellow { + background-color: #f1c40f !important; +} + +a.bg-yellow:hover, a.bg-yellow:focus, +button.bg-yellow:hover, +button.bg-yellow:focus { + background-color: #c29d0b !important; +} + +.text-yellow { + color: #f1c40f !important; +} + +.bg-green { + background-color: #5eba00 !important; +} + +a.bg-green:hover, a.bg-green:focus, +button.bg-green:hover, +button.bg-green:focus { + background-color: #448700 !important; +} + +.text-green { + color: #5eba00 !important; +} + +.bg-teal { + background-color: #2bcbba !important; +} + +a.bg-teal:hover, a.bg-teal:focus, +button.bg-teal:hover, +button.bg-teal:focus { + background-color: #22a193 !important; +} + +.text-teal { + color: #2bcbba !important; +} + +.bg-cyan { + background-color: #17a2b8 !important; +} + +a.bg-cyan:hover, a.bg-cyan:focus, +button.bg-cyan:hover, +button.bg-cyan:focus { + background-color: #117a8b !important; +} + +.text-cyan { + color: #17a2b8 !important; +} + +.bg-white { + background-color: #fff !important; +} + +a.bg-white:hover, a.bg-white:focus, +button.bg-white:hover, +button.bg-white:focus { + background-color: #e6e5e5 !important; +} + +.text-white { + color: #fff !important; +} + +.bg-gray { + background-color: #868e96 !important; +} + +a.bg-gray:hover, a.bg-gray:focus, +button.bg-gray:hover, +button.bg-gray:focus { + background-color: #6c757d !important; +} + +.text-gray { + color: #868e96 !important; +} + +.bg-gray-dark { + background-color: #343a40 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #1d2124 !important; +} + +.text-gray-dark { + color: #343a40 !important; +} + +.bg-azure { + background-color: #45aaf2 !important; +} + +a.bg-azure:hover, a.bg-azure:focus, +button.bg-azure:hover, +button.bg-azure:focus { + background-color: #1594ef !important; +} + +.text-azure { + color: #45aaf2 !important; +} + +.bg-lime { + background-color: #7bd235 !important; +} + +a.bg-lime:hover, a.bg-lime:focus, +button.bg-lime:hover, +button.bg-lime:focus { + background-color: #63ad27 !important; +} + +.text-lime { + color: #7bd235 !important; +} + +.icon { + color: #9aa0ac !important; +} + +.icon i { + vertical-align: -1px; +} + +a.icon { + text-decoration: none; + cursor: pointer; +} + +a.icon:hover { + color: #495057 !important; +} + +.o-auto { + overflow: auto !important; +} + +.o-hidden { + overflow: hidden !important; +} + +.shadow { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.nav-link, +.nav-item { + padding: 0 .75rem; + min-width: 2rem; + transition: .3s color; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.nav-link .badge, +.nav-item .badge { + position: absolute; + top: 0; + right: 0; + padding: .2rem .25rem; + min-width: 1rem; +} + +.nav-tabs { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + color: #9aa0ac; + margin: 0 -.75rem; +} + +.nav-tabs .nav-link { + border: 0; + color: inherit; + border-bottom: 1px solid transparent; + margin-bottom: -1px; + transition: .3s border-color; + font-weight: 400; + padding: 1rem 0; +} + +.nav-tabs .nav-link:hover:not(.disabled) { + border-color: #6e7687; + color: #6e7687; +} + +.nav-tabs .nav-link.active { + border-color: #467fcf; + color: #467fcf; + background: transparent; +} + +.nav-tabs .nav-link.disabled { + opacity: .4; + cursor: default; + pointer-events: none; +} + +.nav-tabs .nav-item { + margin-bottom: 0; + position: relative; +} + +.nav-tabs .nav-item i { + margin-right: .25rem; + line-height: 1; + font-size: 0.875rem; + width: 0.875rem; + vertical-align: baseline; + display: inline-block; +} + +.nav-tabs .nav-item:hover .nav-submenu { + display: block; +} + +.nav-tabs .nav-submenu { + display: none; + position: absolute; + background: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-top: none; + z-index: 10; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 10rem; + border-radius: 0 0 3px 3px; +} + +.nav-tabs .nav-submenu .nav-item { + display: block; + padding: .5rem 1rem; + color: #9aa0ac; + margin: 0 !important; + cursor: pointer; + transition: .3s background; +} + +.nav-tabs .nav-submenu .nav-item.active { + color: #467fcf; +} + +.nav-tabs .nav-submenu .nav-item:hover { + color: #6e7687; + text-decoration: none; + background: rgba(0, 0, 0, 0.024); +} + +.btn { + cursor: pointer; + font-weight: 600; + letter-spacing: .03em; + font-size: 0.8125rem; + min-width: 2.375rem; +} + +.btn i { + font-size: 1rem; + vertical-align: -2px; +} + +.btn-icon { + padding-left: .5rem; + padding-right: .5rem; + text-align: center; +} + +.btn-secondary { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); + box-shadow: 0 1px 1px 0 rgba(0, 0, 0, 0.05); +} + +.btn-secondary:hover { + color: #495057; + background-color: #f6f6f6; + border-color: rgba(0, 20, 49, 0.12); +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: rgba(0, 15, 36, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-pill { + border-radius: 10rem; + padding-left: 1.5em; + padding-right: 1.5em; +} + +.btn-square { + border-radius: 0; +} + +.btn-facebook { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:hover { + color: #fff; + background-color: #30497c; + border-color: #2d4373; +} + +.btn-facebook:focus, .btn-facebook.focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-facebook.disabled, .btn-facebook:disabled { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:not(:disabled):not(.disabled):active, .btn-facebook:not(:disabled):not(.disabled).active, +.show > .btn-facebook.dropdown-toggle { + color: #fff; + background-color: #2d4373; + border-color: #293e6a; +} + +.btn-facebook:not(:disabled):not(.disabled):active:focus, .btn-facebook:not(:disabled):not(.disabled).active:focus, +.show > .btn-facebook.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-twitter { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:hover { + color: #fff; + background-color: #0d8ddc; + border-color: #0c85d0; +} + +.btn-twitter:focus, .btn-twitter.focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-twitter.disabled, .btn-twitter:disabled { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:not(:disabled):not(.disabled):active, .btn-twitter:not(:disabled):not(.disabled).active, +.show > .btn-twitter.dropdown-toggle { + color: #fff; + background-color: #0c85d0; + border-color: #0b7ec4; +} + +.btn-twitter:not(:disabled):not(.disabled):active:focus, .btn-twitter:not(:disabled):not(.disabled).active:focus, +.show > .btn-twitter.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-google { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:hover { + color: #fff; + background-color: #d03526; + border-color: #c63224; +} + +.btn-google:focus, .btn-google.focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-google.disabled, .btn-google:disabled { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:not(:disabled):not(.disabled):active, .btn-google:not(:disabled):not(.disabled).active, +.show > .btn-google.dropdown-toggle { + color: #fff; + background-color: #c63224; + border-color: #bb2f22; +} + +.btn-google:not(:disabled):not(.disabled):active:focus, .btn-google:not(:disabled):not(.disabled).active:focus, +.show > .btn-google.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-youtube { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:hover { + color: #fff; + background-color: #d90000; + border-color: #cc0000; +} + +.btn-youtube:focus, .btn-youtube.focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-youtube.disabled, .btn-youtube:disabled { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:not(:disabled):not(.disabled):active, .btn-youtube:not(:disabled):not(.disabled).active, +.show > .btn-youtube.dropdown-toggle { + color: #fff; + background-color: #cc0000; + border-color: #bf0000; +} + +.btn-youtube:not(:disabled):not(.disabled):active:focus, .btn-youtube:not(:disabled):not(.disabled).active:focus, +.show > .btn-youtube.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-vimeo { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:hover { + color: #fff; + background-color: #139ecb; + border-color: #1295bf; +} + +.btn-vimeo:focus, .btn-vimeo.focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-vimeo.disabled, .btn-vimeo:disabled { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:not(:disabled):not(.disabled):active, .btn-vimeo:not(:disabled):not(.disabled).active, +.show > .btn-vimeo.dropdown-toggle { + color: #fff; + background-color: #1295bf; + border-color: #108cb4; +} + +.btn-vimeo:not(:disabled):not(.disabled):active:focus, .btn-vimeo:not(:disabled):not(.disabled).active:focus, +.show > .btn-vimeo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-dribbble { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:hover { + color: #fff; + background-color: #e62a72; + border-color: #e51e6b; +} + +.btn-dribbble:focus, .btn-dribbble.focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-dribbble.disabled, .btn-dribbble:disabled { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:not(:disabled):not(.disabled):active, .btn-dribbble:not(:disabled):not(.disabled).active, +.show > .btn-dribbble.dropdown-toggle { + color: #fff; + background-color: #e51e6b; + border-color: #dc1a65; +} + +.btn-dribbble:not(:disabled):not(.disabled):active:focus, .btn-dribbble:not(:disabled):not(.disabled).active:focus, +.show > .btn-dribbble.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-github { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:hover { + color: #fff; + background-color: #040404; + border-color: black; +} + +.btn-github:focus, .btn-github.focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-github.disabled, .btn-github:disabled { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:not(:disabled):not(.disabled):active, .btn-github:not(:disabled):not(.disabled).active, +.show > .btn-github.dropdown-toggle { + color: #fff; + background-color: black; + border-color: black; +} + +.btn-github:not(:disabled):not(.disabled):active:focus, .btn-github:not(:disabled):not(.disabled).active:focus, +.show > .btn-github.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-instagram { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:hover { + color: #fff; + background-color: #de1f44; + border-color: #d31e40; +} + +.btn-instagram:focus, .btn-instagram.focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-instagram.disabled, .btn-instagram:disabled { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:not(:disabled):not(.disabled):active, .btn-instagram:not(:disabled):not(.disabled).active, +.show > .btn-instagram.dropdown-toggle { + color: #fff; + background-color: #d31e40; + border-color: #c81c3d; +} + +.btn-instagram:not(:disabled):not(.disabled):active:focus, .btn-instagram:not(:disabled):not(.disabled).active:focus, +.show > .btn-instagram.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-pinterest { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:hover { + color: #fff; + background-color: #980617; + border-color: #8c0615; +} + +.btn-pinterest:focus, .btn-pinterest.focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-pinterest.disabled, .btn-pinterest:disabled { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:not(:disabled):not(.disabled):active, .btn-pinterest:not(:disabled):not(.disabled).active, +.show > .btn-pinterest.dropdown-toggle { + color: #fff; + background-color: #8c0615; + border-color: #800513; +} + +.btn-pinterest:not(:disabled):not(.disabled):active:focus, .btn-pinterest:not(:disabled):not(.disabled).active:focus, +.show > .btn-pinterest.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-vk { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:hover { + color: #fff; + background-color: #527093; + border-color: #4d6a8b; +} + +.btn-vk:focus, .btn-vk.focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-vk.disabled, .btn-vk:disabled { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:not(:disabled):not(.disabled):active, .btn-vk:not(:disabled):not(.disabled).active, +.show > .btn-vk.dropdown-toggle { + color: #fff; + background-color: #4d6a8b; + border-color: #496482; +} + +.btn-vk:not(:disabled):not(.disabled):active:focus, .btn-vk:not(:disabled):not(.disabled).active:focus, +.show > .btn-vk.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-rss { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:hover { + color: #fff; + background-color: #d98c00; + border-color: #cc8400; +} + +.btn-rss:focus, .btn-rss.focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-rss.disabled, .btn-rss:disabled { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:not(:disabled):not(.disabled):active, .btn-rss:not(:disabled):not(.disabled).active, +.show > .btn-rss.dropdown-toggle { + color: #fff; + background-color: #cc8400; + border-color: #bf7c00; +} + +.btn-rss:not(:disabled):not(.disabled):active:focus, .btn-rss:not(:disabled):not(.disabled).active:focus, +.show > .btn-rss.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-flickr { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:hover { + color: #fff; + background-color: #0052b6; + border-color: #004ca9; +} + +.btn-flickr:focus, .btn-flickr.focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-flickr.disabled, .btn-flickr:disabled { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:not(:disabled):not(.disabled):active, .btn-flickr:not(:disabled):not(.disabled).active, +.show > .btn-flickr.dropdown-toggle { + color: #fff; + background-color: #004ca9; + border-color: #00469c; +} + +.btn-flickr:not(:disabled):not(.disabled):active:focus, .btn-flickr:not(:disabled):not(.disabled).active:focus, +.show > .btn-flickr.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-bitbucket { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:hover { + color: #fff; + background-color: #0043a6; + border-color: #003e99; +} + +.btn-bitbucket:focus, .btn-bitbucket.focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-bitbucket.disabled, .btn-bitbucket:disabled { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active, .btn-bitbucket:not(:disabled):not(.disabled).active, +.show > .btn-bitbucket.dropdown-toggle { + color: #fff; + background-color: #003e99; + border-color: #00388c; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active:focus, .btn-bitbucket:not(:disabled):not(.disabled).active:focus, +.show > .btn-bitbucket.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-blue { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-blue:focus, .btn-blue.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-blue.disabled, .btn-blue:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:not(:disabled):not(.disabled):active, .btn-blue:not(:disabled):not(.disabled).active, +.show > .btn-blue.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-blue:not(:disabled):not(.disabled):active:focus, .btn-blue:not(:disabled):not(.disabled).active:focus, +.show > .btn-blue.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-indigo { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:hover { + color: #fff; + background-color: #485ac4; + border-color: #3f51c1; +} + +.btn-indigo:focus, .btn-indigo.focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-indigo.disabled, .btn-indigo:disabled { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:not(:disabled):not(.disabled):active, .btn-indigo:not(:disabled):not(.disabled).active, +.show > .btn-indigo.dropdown-toggle { + color: #fff; + background-color: #3f51c1; + border-color: #3b4db7; +} + +.btn-indigo:not(:disabled):not(.disabled):active:focus, .btn-indigo:not(:disabled):not(.disabled).active:focus, +.show > .btn-indigo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-purple { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:hover { + color: #fff; + background-color: #923ce6; + border-color: #8c31e4; +} + +.btn-purple:focus, .btn-purple.focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-purple.disabled, .btn-purple:disabled { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:not(:disabled):not(.disabled):active, .btn-purple:not(:disabled):not(.disabled).active, +.show > .btn-purple.dropdown-toggle { + color: #fff; + background-color: #8c31e4; + border-color: #8526e3; +} + +.btn-purple:not(:disabled):not(.disabled):active:focus, .btn-purple:not(:disabled):not(.disabled).active:focus, +.show > .btn-purple.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-pink { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:hover { + color: #fff; + background-color: #f44982; + border-color: #f33d7a; +} + +.btn-pink:focus, .btn-pink.focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-pink.disabled, .btn-pink:disabled { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:not(:disabled):not(.disabled):active, .btn-pink:not(:disabled):not(.disabled).active, +.show > .btn-pink.dropdown-toggle { + color: #fff; + background-color: #f33d7a; + border-color: #f23172; +} + +.btn-pink:not(:disabled):not(.disabled):active:focus, .btn-pink:not(:disabled):not(.disabled).active:focus, +.show > .btn-pink.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-red { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-red:focus, .btn-red.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-red.disabled, .btn-red:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:not(:disabled):not(.disabled):active, .btn-red:not(:disabled):not(.disabled).active, +.show > .btn-red.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-red:not(:disabled):not(.disabled):active:focus, .btn-red:not(:disabled):not(.disabled).active:focus, +.show > .btn-red.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-orange { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:hover { + color: #fff; + background-color: #fd811e; + border-color: #fc7a12; +} + +.btn-orange:focus, .btn-orange.focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-orange.disabled, .btn-orange:disabled { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:not(:disabled):not(.disabled):active, .btn-orange:not(:disabled):not(.disabled).active, +.show > .btn-orange.dropdown-toggle { + color: #fff; + background-color: #fc7a12; + border-color: #fc7305; +} + +.btn-orange:not(:disabled):not(.disabled):active:focus, .btn-orange:not(:disabled):not(.disabled).active:focus, +.show > .btn-orange.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-yellow { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-yellow:focus, .btn-yellow.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-yellow.disabled, .btn-yellow:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:not(:disabled):not(.disabled):active, .btn-yellow:not(:disabled):not(.disabled).active, +.show > .btn-yellow.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-yellow:not(:disabled):not(.disabled):active:focus, .btn-yellow:not(:disabled):not(.disabled).active:focus, +.show > .btn-yellow.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-green { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-green:focus, .btn-green.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-green.disabled, .btn-green:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:not(:disabled):not(.disabled):active, .btn-green:not(:disabled):not(.disabled).active, +.show > .btn-green.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-green:not(:disabled):not(.disabled):active:focus, .btn-green:not(:disabled):not(.disabled).active:focus, +.show > .btn-green.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-teal { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:hover { + color: #fff; + background-color: #24ab9d; + border-color: #22a193; +} + +.btn-teal:focus, .btn-teal.focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-teal.disabled, .btn-teal:disabled { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:not(:disabled):not(.disabled):active, .btn-teal:not(:disabled):not(.disabled).active, +.show > .btn-teal.dropdown-toggle { + color: #fff; + background-color: #22a193; + border-color: #20968a; +} + +.btn-teal:not(:disabled):not(.disabled):active:focus, .btn-teal:not(:disabled):not(.disabled).active:focus, +.show > .btn-teal.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-cyan { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:hover { + color: #fff; + background-color: #138496; + border-color: #117a8b; +} + +.btn-cyan:focus, .btn-cyan.focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-cyan.disabled, .btn-cyan:disabled { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:not(:disabled):not(.disabled):active, .btn-cyan:not(:disabled):not(.disabled).active, +.show > .btn-cyan.dropdown-toggle { + color: #fff; + background-color: #117a8b; + border-color: #10707f; +} + +.btn-cyan:not(:disabled):not(.disabled):active:focus, .btn-cyan:not(:disabled):not(.disabled).active:focus, +.show > .btn-cyan.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-white { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:hover { + color: #495057; + background-color: #ececec; + border-color: #e6e5e5; +} + +.btn-white:focus, .btn-white.focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-white.disabled, .btn-white:disabled { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:not(:disabled):not(.disabled):active, .btn-white:not(:disabled):not(.disabled).active, +.show > .btn-white.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: #dfdfdf; +} + +.btn-white:not(:disabled):not(.disabled):active:focus, .btn-white:not(:disabled):not(.disabled).active:focus, +.show > .btn-white.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-gray { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-gray:focus, .btn-gray.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray.disabled, .btn-gray:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:not(:disabled):not(.disabled):active, .btn-gray:not(:disabled):not(.disabled).active, +.show > .btn-gray.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-gray:not(:disabled):not(.disabled):active:focus, .btn-gray:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-gray-dark:focus, .btn-gray-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-gray-dark.disabled, .btn-gray-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active, .btn-gray-dark:not(:disabled):not(.disabled).active, +.show > .btn-gray-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active:focus, .btn-gray-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-azure { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-azure:focus, .btn-azure.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-azure.disabled, .btn-azure:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:not(:disabled):not(.disabled):active, .btn-azure:not(:disabled):not(.disabled).active, +.show > .btn-azure.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-azure:not(:disabled):not(.disabled):active:focus, .btn-azure:not(:disabled):not(.disabled).active:focus, +.show > .btn-azure.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-lime { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:hover { + color: #fff; + background-color: #69b829; + border-color: #63ad27; +} + +.btn-lime:focus, .btn-lime.focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-lime.disabled, .btn-lime:disabled { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:not(:disabled):not(.disabled):active, .btn-lime:not(:disabled):not(.disabled).active, +.show > .btn-lime.dropdown-toggle { + color: #fff; + background-color: #63ad27; + border-color: #5da324; +} + +.btn-lime:not(:disabled):not(.disabled):active:focus, .btn-lime:not(:disabled):not(.disabled).active:focus, +.show > .btn-lime.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-option { + background: transparent; + color: #9aa0ac; +} + +.btn-option:hover { + color: #6e7687; +} + +.btn-option:focus { + box-shadow: none; + color: #6e7687; +} + +.btn-sm, .btn-group-sm > .btn { + font-size: 0.75rem; + min-width: 1.625rem; +} + +.btn-lg, .btn-group-lg > .btn { + font-size: 1rem; + min-width: 2.75rem; + font-weight: 400; +} + +.btn-list { + margin-bottom: -.5rem; + font-size: 0; +} + +.btn-list > .btn, +.btn-list > .dropdown { + margin-bottom: .5rem; +} + +.btn-list > .btn:not(:last-child), +.btn-list > .dropdown:not(:last-child) { + margin-right: .5rem; +} + +.btn-loading { + color: transparent !important; + pointer-events: none; + position: relative; +} + +.btn-loading:after { + content: ''; + -webkit-animation: loader 500ms infinite linear; + animation: loader 500ms infinite linear; + border: 2px solid #fff; + border-radius: 50%; + border-right-color: transparent !important; + border-top-color: transparent !important; + display: block; + height: 1.4em; + width: 1.4em; + position: absolute; + left: calc(50% - (1.4em / 2)); + top: calc(50% - (1.4em / 2)); + -webkit-transform-origin: center; + transform-origin: center; + position: absolute !important; +} + +.btn-loading.btn-sm:after, .btn-group-sm > .btn-loading.btn:after { + height: 1em; + width: 1em; + left: calc(50% - (1em / 2)); + top: calc(50% - (1em / 2)); +} + +.btn-loading.btn-secondary:after { + border-color: #495057; +} + +.alert { + font-size: 0.9375rem; +} + +.alert-icon { + padding-left: 3rem; +} + +.alert-icon > i { + color: inherit !important; + font-size: 1rem; + position: absolute; + top: 1rem; + left: 1rem; +} + +.alert-avatar { + padding-left: 3.75rem; +} + +.alert-avatar .avatar { + position: absolute; + top: .5rem; + left: .75rem; +} + +.close { + font-size: 1rem; + line-height: 1.5; + transition: .3s color; +} + +.close:before { + content: '\ea00'; + font-family: "feather"; +} + +.badge { + color: #fff; +} + +.badge-default { + background: #e9ecef; + color: #868e96; +} + +.table thead th, .text-wrap table thead th { + border-top: 0; + border-bottom-width: 1px; + padding-top: .5rem; + padding-bottom: .5rem; +} + +.table th, .text-wrap table th { + color: #9aa0ac; + text-transform: uppercase; + font-size: 0.875rem; + font-weight: 400; +} + +.table-md th, +.table-md td { + padding: .5rem; +} + +.table-vcenter td, +.table-vcenter th { + vertical-align: middle; +} + +.table-center td, +.table-center th { + text-align: center; +} + +.table-striped tbody tr:nth-of-type(odd) { + background: transparent; +} + +.table-striped tbody tr:nth-of-type(even) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-calendar { + margin: 0 0 .75rem; +} + +.table-calendar td, +.table-calendar th { + border: 0; + text-align: center; + padding: 0 !important; + width: 14.28571429%; + line-height: 2.5rem; +} + +.table-calendar td { + border-top: 0; +} + +.table-calendar-link { + line-height: 2rem; + min-width: calc(2rem + 2px); + display: inline-block; + border-radius: 3px; + background: #f8f9fa; + color: #495057; + font-weight: 600; + transition: .3s background, .3s color; + position: relative; +} + +.table-calendar-link:before { + content: ''; + width: 4px; + height: 4px; + position: absolute; + left: .25rem; + top: .25rem; + border-radius: 50px; + background: #467fcf; +} + +.table-calendar-link:hover { + color: #fff; + text-decoration: none; + background: #467fcf; + transition: .3s background; +} + +.table-calendar-link:hover:before { + background: #fff; +} + +.table-header { + cursor: pointer; + transition: .3s color; +} + +.table-header:hover { + color: #495057 !important; +} + +.table-header:after { + content: '\f0dc'; + font-family: FontAwesome; + display: inline-block; + margin-left: .5rem; + font-size: .75rem; +} + +.table-header-asc { + color: #495057 !important; +} + +.table-header-asc:after { + content: '\f0de'; +} + +.table-header-desc { + color: #495057 !important; +} + +.table-header-desc:after { + content: '\f0dd'; +} + +.page-breadcrumb { + background: none; + padding: 0; + margin: 1rem 0 0; + font-size: 0.875rem; +} + +@media (min-width: 768px) { + .page-breadcrumb { + margin: -.5rem 0 0; + } +} + +.page-breadcrumb .breadcrumb-item { + color: #9aa0ac; +} + +.page-breadcrumb .breadcrumb-item.active { + color: #6e7687; +} + +.pagination-simple .page-item .page-link { + background: none; + border: none; +} + +.pagination-simple .page-item.active .page-link { + color: #495057; + font-weight: 700; +} + +.pagination-pager .page-prev { + margin-right: auto; +} + +.pagination-pager .page-next { + margin-left: auto; +} + +.page-total-text { + margin-right: 1rem; + -ms-flex-item-align: center; + align-self: center; + color: #6e7687; +} + +.card { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + position: relative; + margin-bottom: 1.5rem; + width: 100%; +} + +.card .card { + box-shadow: none; +} + +@media print { + .card { + box-shadow: none; + border: none; + } +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + margin: 0; + padding: 1.5rem 1.5rem; + position: relative; +} + +.card-body + .card-body { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-body > :last-child { + margin-bottom: 0; +} + +@media print { + .card-body { + padding: 0; + } +} + +.card-body-scrollable { + overflow: auto; +} + +.card-footer, +.card-bottom { + padding: 1rem 1.5rem; + background: none; +} + +.card-footer { + border-top: 1px solid rgba(0, 40, 100, 0.12); + color: #6e7687; +} + +.card-header { + background: none; + padding: 0.5rem 1.5rem; + display: -ms-flexbox; + display: flex; + min-height: 3.5rem; + -ms-flex-align: center; + align-items: center; +} + +.card-header .card-title { + margin-bottom: 0; +} + +.card-header.border-0 + .card-body { + padding-top: 0; +} + +@media print { + .card-header { + display: none; + } +} + +.card-img-top { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.card-img-overlay { + background-color: rgba(0, 0, 0, 0.4); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-title { + font-size: 1.125rem; + line-height: 1.2; + font-weight: 400; + margin-bottom: 1.5rem; +} + +.card-title a { + color: inherit; +} + +.card-title:only-child { + margin-bottom: 0; +} + +.card-title small, +.card-subtitle { + color: #9aa0ac; + font-size: 0.875rem; + display: block; + margin: -.75rem 0 1rem; + line-height: 1.1; + font-weight: 400; +} + +.card-table { + margin-bottom: 0; +} + +.card-table tr:first-child td, +.card-table tr:first-child th { + border-top: 0; +} + +.card-table tr td:first-child, +.card-table tr th:first-child { + padding-left: 1.5rem; +} + +.card-table tr td:last-child, +.card-table tr th:last-child { + padding-right: 1.5rem; +} + +.card-body + .card-table { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-profile .card-header { + height: 9rem; + background-size: cover; +} + +.card-profile-img { + max-width: 6rem; + margin-top: -5rem; + margin-bottom: 1rem; + border: 3px solid #fff; + border-radius: 100%; + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.1); +} + +.card-link + .card-link { + margin-left: 1rem; +} + +.card-body + .card-list-group { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-list-group .list-group-item { + border-right: 0; + border-left: 0; + border-radius: 0; + padding-left: 1.5rem; + padding-right: 1.5rem; +} + +.card-list-group .list-group-item:last-child { + border-bottom: 0; +} + +.card-list-group .list-group-item:first-child { + border-top: 0; +} + +.card-header-tabs { + margin: -1.25rem 0; + border-bottom: 0; + line-height: 2rem; +} + +.card-header-tabs .nav-item { + margin-bottom: 1px; +} + +.card-header-pills { + margin: -.75rem 0; +} + +.card-aside { + -ms-flex-direction: row; + flex-direction: row; +} + +.card-aside-column { + min-width: 5rem; + width: 30%; + -ms-flex: 0 0 30%; + flex: 0 0 30%; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; + background: no-repeat center/cover; +} + +.card-value { + font-size: 2.5rem; + line-height: 3.4rem; + height: 3.4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + font-weight: 400; +} + +.card-value i { + vertical-align: middle; +} + +.card-chart-bg { + height: 4rem; + margin-top: -1rem; + position: relative; + z-index: 1; + overflow: hidden; +} + +.card-options { + margin-left: auto; + display: -ms-flexbox; + display: flex; + -ms-flex-order: 100; + order: 100; + margin-right: -.5rem; + color: #9aa0ac; + -ms-flex-item-align: center; + align-self: center; +} + +.card-options a:not(.btn) { + margin-left: .5rem; + color: #9aa0ac; + display: inline-block; + min-width: 1rem; +} + +.card-options a:not(.btn):hover { + text-decoration: none; + color: #6e7687; +} + +.card-options a:not(.btn) i { + font-size: 1rem; + vertical-align: middle; +} + +.card-options .dropdown-toggle:after { + display: none; +} + +/* +Card options + */ +.card-collapsed > :not(.card-header):not(.card-status) { + display: none; +} + +.card-collapsed .card-options-collapse i:before { + content: '\e92d'; +} + +.card-fullscreen .card-options-fullscreen i:before { + content: '\e992'; +} + +.card-fullscreen .card-options-remove { + display: none; +} + +/* +Card maps + */ +.card-map { + height: 15rem; + background: #e9ecef; +} + +.card-map-placeholder { + background: no-repeat center; +} + +/** +Card tabs + */ +.card-tabs { + display: -ms-flexbox; + display: flex; +} + +.card-tabs-bottom .card-tabs-item { + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-tabs-bottom .card-tabs-item.active { + border-top-color: #fff; +} + +.card-tabs-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: block; + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); + color: inherit; + overflow: hidden; +} + +a.card-tabs-item { + background: #fafbfc; +} + +a.card-tabs-item:hover { + text-decoration: none; + color: inherit; +} + +a.card-tabs-item:focus { + z-index: 1; +} + +a.card-tabs-item.active { + background: #fff; + border-bottom-color: #fff; +} + +.card-tabs-item + .card-tabs-item { + border-left: 1px solid rgba(0, 40, 100, 0.12); +} + +/** +Card status + */ +.card-status { + position: absolute; + top: -1px; + left: -1px; + right: -1px; + height: 3px; + border-radius: 3px 3px 0 0; + background: rgba(0, 40, 100, 0.12); +} + +.card-status-left { + right: auto; + bottom: 0; + height: auto; + width: 3px; + border-radius: 3px 0 0 3px; +} + +/** +Card icon + */ +.card-icon { + width: 3rem; + font-size: 2.5rem; + line-height: 3rem; + text-align: center; +} + +/** +Card fullscreen + */ +.card-fullscreen { + position: fixed; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: 1; + margin: 0; +} + +/** +Card alert + */ +.card-alert { + border-radius: 0; + margin: -1px -1px 0; +} + +.card-category { + font-size: 0.875rem; + text-transform: uppercase; + text-align: center; + font-weight: 600; + letter-spacing: .05em; + margin: 0 0 .5rem; +} + +.popover { + -webkit-filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); + filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); +} + +.popover.bs-popover-top, .popover.bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.625rem; +} + +.popover .arrow { + margin-left: calc(.25rem + 2px); +} + +.dropdown { + display: inline-block; +} + +.dropdown-menu { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 12rem; +} + +.dropdown-item { + color: #6e7687; +} + +.dropdown-menu-arrow:before { + position: absolute; + top: -6px; + left: 12px; + display: inline-block; + border-right: 5px solid transparent; + border-bottom: 5px solid rgba(0, 40, 100, 0.12); + border-left: 5px solid transparent; + border-bottom-color: rgba(0, 0, 0, 0.2); + content: ''; +} + +.dropdown-menu-arrow:after { + position: absolute; + top: -5px; + left: 12px; + display: inline-block; + border-right: 5px solid transparent; + border-bottom: 5px solid #fff; + border-left: 5px solid transparent; + content: ''; +} + +.dropdown-menu-arrow.dropdown-menu-right:before, .dropdown-menu-arrow.dropdown-menu-right:after { + left: auto; + right: 12px; +} + +.dropdown-toggle { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; +} + +.dropdown-toggle:after { + vertical-align: 0.155em; +} + +.dropdown-toggle:empty:after { + margin-left: 0; +} + +.dropdown-icon { + color: #9aa0ac; + margin-right: .5rem; + margin-left: -.5rem; + width: 1em; + display: inline-block; + text-align: center; + vertical-align: -1px; +} + +.list-inline-dots .list-inline-item + .list-inline-item:before { + content: '· '; + margin-left: -2px; + margin-right: 3px; +} + +.list-separated-item { + padding: 1rem 0; +} + +.list-separated-item:first-child { + padding-top: 0; +} + +.list-separated-item:last-child { + padding-bottom: 0; +} + +.list-separated-item + .list-separated-item { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item.active .icon { + color: inherit !important; +} + +.list-group-transparent .list-group-item { + background: none; + border: 0; + padding: .5rem 1rem; + border-radius: 3px; +} + +.list-group-transparent .list-group-item.active { + background: rgba(70, 127, 207, 0.06); + font-weight: 600; +} + +.avatar { + width: 2rem; + height: 2rem; + line-height: 2rem; + border-radius: 50%; + display: inline-block; + background: #ced4da no-repeat center/cover; + position: relative; + text-align: center; + color: #868e96; + font-weight: 600; + vertical-align: bottom; + font-size: .875rem; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.avatar i { + font-size: 125%; + vertical-align: sub; +} + +.avatar-status { + position: absolute; + right: -2px; + bottom: -2px; + width: .75rem; + height: .75rem; + border: 2px solid #fff; + background: #868e96; + border-radius: 50%; +} + +.avatar-sm { + width: 1.5rem; + height: 1.5rem; + line-height: 1.5rem; + font-size: .75rem; +} + +.avatar-md { + width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; + font-size: 1rem; +} + +.avatar-lg { + width: 3rem; + height: 3rem; + line-height: 3rem; + font-size: 1.25rem; +} + +.avatar-xl { + width: 4rem; + height: 4rem; + line-height: 4rem; + font-size: 1.75rem; +} + +.avatar-xxl { + width: 5rem; + height: 5rem; + line-height: 5rem; + font-size: 2rem; +} + +.avatar-placeholder { + background: #ced4da url('data:image/svg+xml;charset=utf8,') no-repeat center/80%; +} + +.avatar-list { + margin: 0 0 -.5rem; + padding: 0; + font-size: 0; +} + +.avatar-list .avatar { + margin-bottom: .5rem; +} + +.avatar-list .avatar:not(:last-child) { + margin-right: .5rem; +} + +.avatar-list-stacked .avatar { + margin-right: -.8em !important; +} + +.avatar-list-stacked .avatar { + box-shadow: 0 0 0 2px #fff; +} + +.avatar-blue { + background-color: #c8d9f1; + color: #467fcf; +} + +.avatar-indigo { + background-color: #d1d5f0; + color: #6574cd; +} + +.avatar-purple { + background-color: #e4cff9; + color: #a55eea; +} + +.avatar-pink { + background-color: #fcd3e1; + color: #f66d9b; +} + +.avatar-red { + background-color: #f0bcbc; + color: #cd201f; +} + +.avatar-orange { + background-color: #fee0c7; + color: #fd9644; +} + +.avatar-yellow { + background-color: #fbedb7; + color: #f1c40f; +} + +.avatar-green { + background-color: #cfeab3; + color: #5eba00; +} + +.avatar-teal { + background-color: #bfefea; + color: #2bcbba; +} + +.avatar-cyan { + background-color: #b9e3ea; + color: #17a2b8; +} + +.avatar-white { + background-color: white; + color: #fff; +} + +.avatar-gray { + background-color: #dbdde0; + color: #868e96; +} + +.avatar-gray-dark { + background-color: #c2c4c6; + color: #343a40; +} + +.avatar-azure { + background-color: #c7e6fb; + color: #45aaf2; +} + +.avatar-lime { + background-color: #d7f2c2; + color: #7bd235; +} + +.product-price { + font-size: 1rem; +} + +.product-price strong { + font-size: 1.5rem; +} + +@-webkit-keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 100%, 60% { + left: 100%; + right: -90%; + } +} + +@keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 100%, 60% { + left: 100%; + right: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 100%, 60% { + left: 107%; + right: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 100%, 60% { + left: 107%; + right: -8%; + } +} + +.progress { + position: relative; +} + +.progress-xs, +.progress-xs .progress-bar { + height: .25rem; +} + +.progress-sm, +.progress-sm .progress-bar { + height: .5rem; +} + +.progress-bar-indeterminate:after, .progress-bar-indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + left: 0; + will-change: left, right; + top: 0; + bottom: 0; +} + +.progress-bar-indeterminate:before { + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress-bar-indeterminate:after { + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +@keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +/** +Dimmer +*/ +.dimmer { + position: relative; +} + +.dimmer .loader { + display: none; + margin: 0 auto; + position: absolute; + top: 50%; + left: 0; + right: 0; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); +} + +.dimmer.active .loader { + display: block; +} + +.dimmer.active .dimmer-content { + opacity: .04; + pointer-events: none; +} + +/** +Loader +*/ +.loader { + display: block; + position: relative; + height: 2.5rem; + width: 2.5rem; + color: #467fcf; +} + +.loader:before, .loader:after { + width: 2.5rem; + height: 2.5rem; + margin: -1.25rem 0 0 -1.25rem; + position: absolute; + content: ''; + top: 50%; + left: 50%; +} + +.loader:before { + border-radius: 50%; + border: 3px solid currentColor; + opacity: .15; +} + +.loader:after { + -webkit-animation: loader .6s linear; + animation: loader .6s linear; + -webkit-animation-iteration-count: infinite; + animation-iteration-count: infinite; + border-radius: 50%; + border: 3px solid; + border-color: transparent; + border-top-color: currentColor; + box-shadow: 0 0 0 1px transparent; +} + +.icons-list { + list-style: none; + margin: 0 -1px -1px 0; + padding: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.icons-list > li { + -ms-flex: 1 0 4rem; + flex: 1 0 4rem; +} + +.icons-list-wrap { + overflow: hidden; +} + +.icons-list-item { + text-align: center; + height: 4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + border-right: 1px solid rgba(0, 40, 100, 0.12); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.icons-list-item i { + font-size: 1.25rem; +} + +.img-gallery { + margin-right: -.25rem; + margin-left: -.25rem; + margin-bottom: -.5rem; +} + +.img-gallery > .col, +.img-gallery > [class*="col-"] { + padding-left: .25rem; + padding-right: .25rem; + padding-bottom: .5rem; +} + +.link-overlay { + position: relative; +} + +.link-overlay:hover .link-overlay-bg { + opacity: 1; +} + +.link-overlay-bg { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + background: rgba(70, 127, 207, 0.8); + display: -ms-flexbox; + display: flex; + color: #fff; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + font-size: 1.25rem; + opacity: 0; + transition: .3s opacity; +} + +.media-icon { + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + border-radius: 100%; +} + +.media-list { + margin: 0; + padding: 0; + list-style: none; +} + +textarea[cols] { + height: auto; +} + +.form-group { + display: block; +} + +.form-label { + display: block; + margin-bottom: .375rem; + font-weight: 600; + font-size: 0.875rem; +} + +.form-label-small { + float: right; + font-weight: 400; + font-size: 87.5%; +} + +.form-footer { + margin-top: 2rem; +} + +.custom-control { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.custom-controls-stacked .custom-control { + margin-bottom: .25rem; +} + +.custom-control-label { + vertical-align: middle; +} + +.custom-control-label:before { + border: 1px solid rgba(0, 40, 100, 0.12); + background-color: #fff; + background-size: .5rem; +} + +.custom-control-description { + line-height: 1.5rem; +} + +.input-group-prepend, +.input-group-append, +.input-group-btn { + font-size: 0.9375rem; +} + +.input-group-prepend > .btn, +.input-group-append > .btn, +.input-group-btn > .btn { + height: 100%; + border-color: rgba(0, 40, 100, 0.12); +} + +.input-group-prepend > .input-group-text { + border-right: 0; +} + +.input-group-append > .input-group-text { + border-left: 0; +} + +/** +Icon input + */ +.input-icon { + position: relative; +} + +.input-icon .form-control:not(:last-child) { + padding-right: 2.5rem; +} + +.input-icon .form-control:not(:first-child) { + padding-left: 2.5rem; +} + +.input-icon-addon { + position: absolute; + top: 0; + bottom: 0; + left: 0; + color: #9aa0ac; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + min-width: 2.5rem; + pointer-events: none; +} + +.input-icon-addon:last-child { + left: auto; + right: 0; +} + +.form-fieldset { + background: #f8f9fa; + border: 1px solid #e9ecef; + padding: 1rem; + border-radius: 3px; + margin-bottom: 1rem; +} + +.form-required { + color: #cd201f; +} + +.form-required:before { + content: ' '; +} + +.state-valid { + padding-right: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.state-invalid { + padding-right: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.form-help { + display: inline-block; + width: 1rem; + height: 1rem; + text-align: center; + line-height: 1rem; + color: #9aa0ac; + background: #f8f9fa; + border-radius: 50%; + font-size: 0.75rem; + transition: .3s background-color, .3s color; + text-decoration: none; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.form-help:hover, .form-help[aria-describedby] { + background: #467fcf; + color: #fff; +} + +.sparkline { + display: inline-block; + height: 2rem; +} + +.jqstooltip { + box-sizing: content-box; + font-family: inherit !important; + background: #333 !important; + border: none !important; + border-radius: 3px; + font-size: 11px !important; + font-weight: 700 !important; + line-height: 1 !important; + padding: 6px !important; +} + +.jqstooltip .jqsfield { + font: inherit !important; +} + +.social-links li a { + background: #f8f8f8; + border-radius: 50%; + color: #9aa0ac; + display: inline-block; + height: 1.75rem; + width: 1.75rem; + line-height: 1.75rem; + text-align: center; +} + +.map, +.chart { + position: relative; + padding-top: 56.25%; +} + +.map-square, +.chart-square { + padding-top: 100%; +} + +.map-content, +.chart-content { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.map-header { + margin-top: -1.5rem; + margin-bottom: 1.5rem; + height: 15rem; + position: relative; + margin-bottom: -1.5rem; +} + +.map-header:before { + content: ''; + position: absolute; + bottom: 0; + left: 0; + right: 0; + height: 10rem; + background: linear-gradient(to bottom, rgba(245, 247, 251, 0) 5%, #f5f7fb 95%); + pointer-events: none; +} + +.map-header-layer { + height: 100%; +} + +.map-static { + height: 120px; + width: 100%; + max-width: 640px; + background-position: center center; + background-size: 640px 120px; +} + +@-webkit-keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +@keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +.status-icon { + content: ''; + width: 0.5rem; + height: 0.5rem; + display: inline-block; + background: currentColor; + border-radius: 50%; + -webkit-transform: translateY(-1px); + transform: translateY(-1px); + margin-right: .375rem; + vertical-align: middle; +} + +.status-animated { + -webkit-animation: 1s status-pulse infinite ease; + animation: 1s status-pulse infinite ease; +} + +.chart-circle { + display: block; + height: 8rem; + width: 8rem; + position: relative; +} + +.chart-circle canvas { + margin: 0 auto; + display: block; + max-width: 100%; + max-height: 100%; +} + +.chart-circle-xs { + height: 2.5rem; + width: 2.5rem; + font-size: .8rem; +} + +.chart-circle-sm { + height: 4rem; + width: 4rem; + font-size: .8rem; +} + +.chart-circle-lg { + height: 10rem; + width: 10rem; + font-size: .8rem; +} + +.chart-circle-value { + position: absolute; + top: 0; + left: 0; + right: 0; + margin-left: auto; + margin-right: auto; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + -ms-flex-align: center; + align-items: center; + -ms-flex-direction: column; + flex-direction: column; + line-height: 1; +} + +.chart-circle-value small { + display: block; + color: #9aa0ac; + font-size: 0.9375rem; +} + +.chips { + margin: 0 0 -.5rem; +} + +.chips .chip { + margin: 0 .5rem .5rem 0; +} + +.chip { + display: inline-block; + height: 2rem; + line-height: 2rem; + font-size: 0.875rem; + font-weight: 500; + color: #6e7687; + padding: 0 .75rem; + border-radius: 1rem; + background-color: #f8f9fa; + transition: .3s background; +} + +.chip .avatar { + float: left; + margin: 0 .5rem 0 -.75rem; + height: 2rem; + width: 2rem; + border-radius: 50%; +} + +a.chip:hover { + color: inherit; + text-decoration: none; + background-color: #e9ecef; +} + +.stamp { + color: #fff; + background: #868e96; + display: inline-block; + min-width: 2rem; + height: 2rem; + padding: 0 .25rem; + line-height: 2rem; + text-align: center; + border-radius: 3px; + font-weight: 600; +} + +.stamp-md { + min-width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; +} + +.chat { + outline: 0; + margin: 0; + padding: 0; + list-style-type: none; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: end; + justify-content: flex-end; + min-height: 100%; +} + +.chat-line { + padding: 0; + text-align: right; + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: row-reverse; + flex-direction: row-reverse; +} + +.chat-line + .chat-line { + padding-top: 1rem; +} + +.chat-message { + position: relative; + display: inline-block; + background-color: #467fcf; + color: #fff; + font-size: 0.875rem; + padding: .375rem .5rem; + border-radius: 3px; + white-space: normal; + text-align: left; + margin: 0 .5rem 0 2.5rem; + line-height: 1.4; +} + +.chat-message > :last-child { + margin-bottom: 0 !important; +} + +.chat-message:after { + content: ""; + position: absolute; + right: -5px; + top: 7px; + border-bottom: 6px solid transparent; + border-left: 6px solid #467fcf; + border-top: 6px solid transparent; +} + +.chat-message img { + max-width: 100%; +} + +.chat-message p { + margin-bottom: 1em; +} + +.chat-line-friend { + -ms-flex-direction: row; + flex-direction: row; +} + +.chat-line-friend + .chat-line-friend { + margin-top: -.5rem; +} + +.chat-line-friend + .chat-line-friend .chat-author { + visibility: hidden; +} + +.chat-line-friend + .chat-line-friend .chat-message:after { + display: none; +} + +.chat-line-friend .chat-message { + background-color: #f3f3f3; + color: #495057; + margin-left: .5rem; + margin-right: 2.5rem; +} + +.chat-line-friend .chat-message:after { + right: auto; + left: -5px; + border-left-width: 0; + border-right: 5px solid #f3f3f3; +} + +.example { + padding: 1.5rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px 3px 0 0; + font-size: 0.9375rem; +} + +.example-bg { + background: #f5f7fb; +} + +.example + .highlight { + border-top: none; + margin-top: 0; + border-radius: 0 0 3px 3px; +} + +.highlight { + margin: 1rem 0 2rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-size: 0.9375rem; + max-height: 40rem; + overflow: auto; + background: #fcfcfc; +} + +.highlight pre { + margin-bottom: 0; + background-color: transparent; +} + +.example-column { + margin: 0 auto; +} + +.example-column > .card:last-of-type { + margin-bottom: 0; +} + +.example-column-1 { + max-width: 20rem; +} + +.example-column-2 { + max-width: 40rem; +} + +.tag { + font-size: 0.75rem; + color: #6e7687; + background-color: #e9ecef; + border-radius: 3px; + padding: 0 .5rem; + line-height: 2em; + display: -ms-inline-flexbox; + display: inline-flex; + cursor: default; + font-weight: 400; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +a.tag { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag:hover { + background-color: rgba(110, 118, 135, 0.2); + color: inherit; +} + +.tag-addon { + display: inline-block; + padding: 0 .5rem; + color: inherit; + text-decoration: none; + background: rgba(0, 0, 0, 0.06); + margin: 0 -.5rem 0 .5rem; + text-align: center; + min-width: 1.5rem; +} + +.tag-addon:last-child { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.tag-addon i { + vertical-align: middle; + margin: 0 -.25rem; +} + +a.tag-addon { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag-addon:hover { + background: rgba(0, 0, 0, 0.16); + color: inherit; +} + +.tag-avatar { + width: 1.5rem; + height: 1.5rem; + border-radius: 3px 0 0 3px; + margin: 0 .5rem 0 -.5rem; +} + +.tag-blue { + background-color: #467fcf; + color: #fff; +} + +.tag-indigo { + background-color: #6574cd; + color: #fff; +} + +.tag-purple { + background-color: #a55eea; + color: #fff; +} + +.tag-pink { + background-color: #f66d9b; + color: #fff; +} + +.tag-red { + background-color: #cd201f; + color: #fff; +} + +.tag-orange { + background-color: #fd9644; + color: #fff; +} + +.tag-yellow { + background-color: #f1c40f; + color: #fff; +} + +.tag-green { + background-color: #5eba00; + color: #fff; +} + +.tag-teal { + background-color: #2bcbba; + color: #fff; +} + +.tag-cyan { + background-color: #17a2b8; + color: #fff; +} + +.tag-white { + background-color: #fff; + color: #fff; +} + +.tag-gray { + background-color: #868e96; + color: #fff; +} + +.tag-gray-dark { + background-color: #343a40; + color: #fff; +} + +.tag-azure { + background-color: #45aaf2; + color: #fff; +} + +.tag-lime { + background-color: #7bd235; + color: #fff; +} + +.tag-primary { + background-color: #467fcf; + color: #fff; +} + +.tag-secondary { + background-color: #868e96; + color: #fff; +} + +.tag-success { + background-color: #5eba00; + color: #fff; +} + +.tag-info { + background-color: #45aaf2; + color: #fff; +} + +.tag-warning { + background-color: #f1c40f; + color: #fff; +} + +.tag-danger { + background-color: #cd201f; + color: #fff; +} + +.tag-light { + background-color: #f8f9fa; + color: #fff; +} + +.tag-dark { + background-color: #343a40; + color: #fff; +} + +.tag-rounded { + border-radius: 50px; +} + +.tag-rounded .tag-avatar { + border-radius: 50px; +} + +.tags { + margin-bottom: -.5rem; + font-size: 0; +} + +.tags > .tag { + margin-bottom: .5rem; +} + +.tags > .tag:not(:last-child) { + margin-right: .5rem; +} + +.highlight .hll { + background-color: #ffc; +} + +.highlight .c { + color: #999; +} + +.highlight .k { + color: #069; +} + +.highlight .o { + color: #555; +} + +.highlight .cm { + color: #999; +} + +.highlight .cp { + color: #099; +} + +.highlight .c1 { + color: #999; +} + +.highlight .cs { + color: #999; +} + +.highlight .gd { + background-color: #fcc; + border: 1px solid #c00; +} + +.highlight .ge { + font-style: italic; +} + +.highlight .gr { + color: #f00; +} + +.highlight .gh { + color: #030; +} + +.highlight .gi { + background-color: #cfc; + border: 1px solid #0c0; +} + +.highlight .go { + color: #aaa; +} + +.highlight .gp { + color: #009; +} + +.highlight .gu { + color: #030; +} + +.highlight .gt { + color: #9c6; +} + +.highlight .kc { + color: #069; +} + +.highlight .kd { + color: #069; +} + +.highlight .kn { + color: #069; +} + +.highlight .kp { + color: #069; +} + +.highlight .kr { + color: #069; +} + +.highlight .kt { + color: #078; +} + +.highlight .m { + color: #f60; +} + +.highlight .s { + color: #d44950; +} + +.highlight .na { + color: #4f9fcf; +} + +.highlight .nb { + color: #366; +} + +.highlight .nc { + color: #0a8; +} + +.highlight .no { + color: #360; +} + +.highlight .nd { + color: #99f; +} + +.highlight .ni { + color: #999; +} + +.highlight .ne { + color: #c00; +} + +.highlight .nf { + color: #c0f; +} + +.highlight .nl { + color: #99f; +} + +.highlight .nn { + color: #0cf; +} + +.highlight .nt { + color: #2f6f9f; +} + +.highlight .nv { + color: #033; +} + +.highlight .ow { + color: #000; +} + +.highlight .w { + color: #bbb; +} + +.highlight .mf { + color: #f60; +} + +.highlight .mh { + color: #f60; +} + +.highlight .mi { + color: #f60; +} + +.highlight .mo { + color: #f60; +} + +.highlight .sb { + color: #c30; +} + +.highlight .sc { + color: #c30; +} + +.highlight .sd { + font-style: italic; + color: #c30; +} + +.highlight .s2 { + color: #c30; +} + +.highlight .se { + color: #c30; +} + +.highlight .sh { + color: #c30; +} + +.highlight .si { + color: #a00; +} + +.highlight .sx { + color: #c30; +} + +.highlight .sr { + color: #3aa; +} + +.highlight .s1 { + color: #c30; +} + +.highlight .ss { + color: #fc3; +} + +.highlight .bp { + color: #366; +} + +.highlight .vc { + color: #033; +} + +.highlight .vg { + color: #033; +} + +.highlight .vi { + color: #033; +} + +.highlight .il { + color: #f60; +} + +.highlight .css .o, +.highlight .css .o + .nt, +.highlight .css .nt + .nt { + color: #999; +} + +.highlight .language-bash::before, +.highlight .language-sh::before { + color: #009; + content: "$ "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.highlight .language-powershell::before { + color: #009; + content: "PM> "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.carousel-item-background { + content: ''; + background: rgba(0, 0, 0, 0.5); + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.custom-range { + -ms-flex-align: center; + align-items: center; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + height: 100%; + min-height: 2.375rem; + overflow: hidden; + padding: 0; + border: 0; +} + +.custom-range:focus { + box-shadow: none; + outline: none; +} + +.custom-range:focus::-webkit-slider-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-moz-range-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-ms-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-runnable-track { + background: #467fcf; + content: ''; + height: 2px; + pointer-events: none; +} + +.custom-range::-webkit-slider-thumb { + width: 14px; + height: 14px; + -webkit-appearance: none; + appearance: none; + background: #fff; + border-radius: 50px; + box-shadow: 1px 0 0 -6px rgba(0, 50, 126, 0.12), 6px 0 0 -6px rgba(0, 50, 126, 0.12), 7px 0 0 -6px rgba(0, 50, 126, 0.12), 8px 0 0 -6px rgba(0, 50, 126, 0.12), 9px 0 0 -6px rgba(0, 50, 126, 0.12), 10px 0 0 -6px rgba(0, 50, 126, 0.12), 11px 0 0 -6px rgba(0, 50, 126, 0.12), 12px 0 0 -6px rgba(0, 50, 126, 0.12), 13px 0 0 -6px rgba(0, 50, 126, 0.12), 14px 0 0 -6px rgba(0, 50, 126, 0.12), 15px 0 0 -6px rgba(0, 50, 126, 0.12), 16px 0 0 -6px rgba(0, 50, 126, 0.12), 17px 0 0 -6px rgba(0, 50, 126, 0.12), 18px 0 0 -6px rgba(0, 50, 126, 0.12), 19px 0 0 -6px rgba(0, 50, 126, 0.12), 20px 0 0 -6px rgba(0, 50, 126, 0.12), 21px 0 0 -6px rgba(0, 50, 126, 0.12), 22px 0 0 -6px rgba(0, 50, 126, 0.12), 23px 0 0 -6px rgba(0, 50, 126, 0.12), 24px 0 0 -6px rgba(0, 50, 126, 0.12), 25px 0 0 -6px rgba(0, 50, 126, 0.12), 26px 0 0 -6px rgba(0, 50, 126, 0.12), 27px 0 0 -6px rgba(0, 50, 126, 0.12), 28px 0 0 -6px rgba(0, 50, 126, 0.12), 29px 0 0 -6px rgba(0, 50, 126, 0.12), 30px 0 0 -6px rgba(0, 50, 126, 0.12), 31px 0 0 -6px rgba(0, 50, 126, 0.12), 32px 0 0 -6px rgba(0, 50, 126, 0.12), 33px 0 0 -6px rgba(0, 50, 126, 0.12), 34px 0 0 -6px rgba(0, 50, 126, 0.12), 35px 0 0 -6px rgba(0, 50, 126, 0.12), 36px 0 0 -6px rgba(0, 50, 126, 0.12), 37px 0 0 -6px rgba(0, 50, 126, 0.12), 38px 0 0 -6px rgba(0, 50, 126, 0.12), 39px 0 0 -6px rgba(0, 50, 126, 0.12), 40px 0 0 -6px rgba(0, 50, 126, 0.12), 41px 0 0 -6px rgba(0, 50, 126, 0.12), 42px 0 0 -6px rgba(0, 50, 126, 0.12), 43px 0 0 -6px rgba(0, 50, 126, 0.12), 44px 0 0 -6px rgba(0, 50, 126, 0.12), 45px 0 0 -6px rgba(0, 50, 126, 0.12), 46px 0 0 -6px rgba(0, 50, 126, 0.12), 47px 0 0 -6px rgba(0, 50, 126, 0.12), 48px 0 0 -6px rgba(0, 50, 126, 0.12), 49px 0 0 -6px rgba(0, 50, 126, 0.12), 50px 0 0 -6px rgba(0, 50, 126, 0.12), 51px 0 0 -6px rgba(0, 50, 126, 0.12), 52px 0 0 -6px rgba(0, 50, 126, 0.12), 53px 0 0 -6px rgba(0, 50, 126, 0.12), 54px 0 0 -6px rgba(0, 50, 126, 0.12), 55px 0 0 -6px rgba(0, 50, 126, 0.12), 56px 0 0 -6px rgba(0, 50, 126, 0.12), 57px 0 0 -6px rgba(0, 50, 126, 0.12), 58px 0 0 -6px rgba(0, 50, 126, 0.12), 59px 0 0 -6px rgba(0, 50, 126, 0.12), 60px 0 0 -6px rgba(0, 50, 126, 0.12), 61px 0 0 -6px rgba(0, 50, 126, 0.12), 62px 0 0 -6px rgba(0, 50, 126, 0.12), 63px 0 0 -6px rgba(0, 50, 126, 0.12), 64px 0 0 -6px rgba(0, 50, 126, 0.12), 65px 0 0 -6px rgba(0, 50, 126, 0.12), 66px 0 0 -6px rgba(0, 50, 126, 0.12), 67px 0 0 -6px rgba(0, 50, 126, 0.12), 68px 0 0 -6px rgba(0, 50, 126, 0.12), 69px 0 0 -6px rgba(0, 50, 126, 0.12), 70px 0 0 -6px rgba(0, 50, 126, 0.12), 71px 0 0 -6px rgba(0, 50, 126, 0.12), 72px 0 0 -6px rgba(0, 50, 126, 0.12), 73px 0 0 -6px rgba(0, 50, 126, 0.12), 74px 0 0 -6px rgba(0, 50, 126, 0.12), 75px 0 0 -6px rgba(0, 50, 126, 0.12), 76px 0 0 -6px rgba(0, 50, 126, 0.12), 77px 0 0 -6px rgba(0, 50, 126, 0.12), 78px 0 0 -6px rgba(0, 50, 126, 0.12), 79px 0 0 -6px rgba(0, 50, 126, 0.12), 80px 0 0 -6px rgba(0, 50, 126, 0.12), 81px 0 0 -6px rgba(0, 50, 126, 0.12), 82px 0 0 -6px rgba(0, 50, 126, 0.12), 83px 0 0 -6px rgba(0, 50, 126, 0.12), 84px 0 0 -6px rgba(0, 50, 126, 0.12), 85px 0 0 -6px rgba(0, 50, 126, 0.12), 86px 0 0 -6px rgba(0, 50, 126, 0.12), 87px 0 0 -6px rgba(0, 50, 126, 0.12), 88px 0 0 -6px rgba(0, 50, 126, 0.12), 89px 0 0 -6px rgba(0, 50, 126, 0.12), 90px 0 0 -6px rgba(0, 50, 126, 0.12), 91px 0 0 -6px rgba(0, 50, 126, 0.12), 92px 0 0 -6px rgba(0, 50, 126, 0.12), 93px 0 0 -6px rgba(0, 50, 126, 0.12), 94px 0 0 -6px rgba(0, 50, 126, 0.12), 95px 0 0 -6px rgba(0, 50, 126, 0.12), 96px 0 0 -6px rgba(0, 50, 126, 0.12), 97px 0 0 -6px rgba(0, 50, 126, 0.12), 98px 0 0 -6px rgba(0, 50, 126, 0.12), 99px 0 0 -6px rgba(0, 50, 126, 0.12), 100px 0 0 -6px rgba(0, 50, 126, 0.12), 101px 0 0 -6px rgba(0, 50, 126, 0.12), 102px 0 0 -6px rgba(0, 50, 126, 0.12), 103px 0 0 -6px rgba(0, 50, 126, 0.12), 104px 0 0 -6px rgba(0, 50, 126, 0.12), 105px 0 0 -6px rgba(0, 50, 126, 0.12), 106px 0 0 -6px rgba(0, 50, 126, 0.12), 107px 0 0 -6px rgba(0, 50, 126, 0.12), 108px 0 0 -6px rgba(0, 50, 126, 0.12), 109px 0 0 -6px rgba(0, 50, 126, 0.12), 110px 0 0 -6px rgba(0, 50, 126, 0.12), 111px 0 0 -6px rgba(0, 50, 126, 0.12), 112px 0 0 -6px rgba(0, 50, 126, 0.12), 113px 0 0 -6px rgba(0, 50, 126, 0.12), 114px 0 0 -6px rgba(0, 50, 126, 0.12), 115px 0 0 -6px rgba(0, 50, 126, 0.12), 116px 0 0 -6px rgba(0, 50, 126, 0.12), 117px 0 0 -6px rgba(0, 50, 126, 0.12), 118px 0 0 -6px rgba(0, 50, 126, 0.12), 119px 0 0 -6px rgba(0, 50, 126, 0.12), 120px 0 0 -6px rgba(0, 50, 126, 0.12), 121px 0 0 -6px rgba(0, 50, 126, 0.12), 122px 0 0 -6px rgba(0, 50, 126, 0.12), 123px 0 0 -6px rgba(0, 50, 126, 0.12), 124px 0 0 -6px rgba(0, 50, 126, 0.12), 125px 0 0 -6px rgba(0, 50, 126, 0.12), 126px 0 0 -6px rgba(0, 50, 126, 0.12), 127px 0 0 -6px rgba(0, 50, 126, 0.12), 128px 0 0 -6px rgba(0, 50, 126, 0.12), 129px 0 0 -6px rgba(0, 50, 126, 0.12), 130px 0 0 -6px rgba(0, 50, 126, 0.12), 131px 0 0 -6px rgba(0, 50, 126, 0.12), 132px 0 0 -6px rgba(0, 50, 126, 0.12), 133px 0 0 -6px rgba(0, 50, 126, 0.12), 134px 0 0 -6px rgba(0, 50, 126, 0.12), 135px 0 0 -6px rgba(0, 50, 126, 0.12), 136px 0 0 -6px rgba(0, 50, 126, 0.12), 137px 0 0 -6px rgba(0, 50, 126, 0.12), 138px 0 0 -6px rgba(0, 50, 126, 0.12), 139px 0 0 -6px rgba(0, 50, 126, 0.12), 140px 0 0 -6px rgba(0, 50, 126, 0.12), 141px 0 0 -6px rgba(0, 50, 126, 0.12), 142px 0 0 -6px rgba(0, 50, 126, 0.12), 143px 0 0 -6px rgba(0, 50, 126, 0.12), 144px 0 0 -6px rgba(0, 50, 126, 0.12), 145px 0 0 -6px rgba(0, 50, 126, 0.12), 146px 0 0 -6px rgba(0, 50, 126, 0.12), 147px 0 0 -6px rgba(0, 50, 126, 0.12), 148px 0 0 -6px rgba(0, 50, 126, 0.12), 149px 0 0 -6px rgba(0, 50, 126, 0.12), 150px 0 0 -6px rgba(0, 50, 126, 0.12), 151px 0 0 -6px rgba(0, 50, 126, 0.12), 152px 0 0 -6px rgba(0, 50, 126, 0.12), 153px 0 0 -6px rgba(0, 50, 126, 0.12), 154px 0 0 -6px rgba(0, 50, 126, 0.12), 155px 0 0 -6px rgba(0, 50, 126, 0.12), 156px 0 0 -6px rgba(0, 50, 126, 0.12), 157px 0 0 -6px rgba(0, 50, 126, 0.12), 158px 0 0 -6px rgba(0, 50, 126, 0.12), 159px 0 0 -6px rgba(0, 50, 126, 0.12), 160px 0 0 -6px rgba(0, 50, 126, 0.12), 161px 0 0 -6px rgba(0, 50, 126, 0.12), 162px 0 0 -6px rgba(0, 50, 126, 0.12), 163px 0 0 -6px rgba(0, 50, 126, 0.12), 164px 0 0 -6px rgba(0, 50, 126, 0.12), 165px 0 0 -6px rgba(0, 50, 126, 0.12), 166px 0 0 -6px rgba(0, 50, 126, 0.12), 167px 0 0 -6px rgba(0, 50, 126, 0.12), 168px 0 0 -6px rgba(0, 50, 126, 0.12), 169px 0 0 -6px rgba(0, 50, 126, 0.12), 170px 0 0 -6px rgba(0, 50, 126, 0.12), 171px 0 0 -6px rgba(0, 50, 126, 0.12), 172px 0 0 -6px rgba(0, 50, 126, 0.12), 173px 0 0 -6px rgba(0, 50, 126, 0.12), 174px 0 0 -6px rgba(0, 50, 126, 0.12), 175px 0 0 -6px rgba(0, 50, 126, 0.12), 176px 0 0 -6px rgba(0, 50, 126, 0.12), 177px 0 0 -6px rgba(0, 50, 126, 0.12), 178px 0 0 -6px rgba(0, 50, 126, 0.12), 179px 0 0 -6px rgba(0, 50, 126, 0.12), 180px 0 0 -6px rgba(0, 50, 126, 0.12), 181px 0 0 -6px rgba(0, 50, 126, 0.12), 182px 0 0 -6px rgba(0, 50, 126, 0.12), 183px 0 0 -6px rgba(0, 50, 126, 0.12), 184px 0 0 -6px rgba(0, 50, 126, 0.12), 185px 0 0 -6px rgba(0, 50, 126, 0.12), 186px 0 0 -6px rgba(0, 50, 126, 0.12), 187px 0 0 -6px rgba(0, 50, 126, 0.12), 188px 0 0 -6px rgba(0, 50, 126, 0.12), 189px 0 0 -6px rgba(0, 50, 126, 0.12), 190px 0 0 -6px rgba(0, 50, 126, 0.12), 191px 0 0 -6px rgba(0, 50, 126, 0.12), 192px 0 0 -6px rgba(0, 50, 126, 0.12), 193px 0 0 -6px rgba(0, 50, 126, 0.12), 194px 0 0 -6px rgba(0, 50, 126, 0.12), 195px 0 0 -6px rgba(0, 50, 126, 0.12), 196px 0 0 -6px rgba(0, 50, 126, 0.12), 197px 0 0 -6px rgba(0, 50, 126, 0.12), 198px 0 0 -6px rgba(0, 50, 126, 0.12), 199px 0 0 -6px rgba(0, 50, 126, 0.12), 200px 0 0 -6px rgba(0, 50, 126, 0.12), 201px 0 0 -6px rgba(0, 50, 126, 0.12), 202px 0 0 -6px rgba(0, 50, 126, 0.12), 203px 0 0 -6px rgba(0, 50, 126, 0.12), 204px 0 0 -6px rgba(0, 50, 126, 0.12), 205px 0 0 -6px rgba(0, 50, 126, 0.12), 206px 0 0 -6px rgba(0, 50, 126, 0.12), 207px 0 0 -6px rgba(0, 50, 126, 0.12), 208px 0 0 -6px rgba(0, 50, 126, 0.12), 209px 0 0 -6px rgba(0, 50, 126, 0.12), 210px 0 0 -6px rgba(0, 50, 126, 0.12), 211px 0 0 -6px rgba(0, 50, 126, 0.12), 212px 0 0 -6px rgba(0, 50, 126, 0.12), 213px 0 0 -6px rgba(0, 50, 126, 0.12), 214px 0 0 -6px rgba(0, 50, 126, 0.12), 215px 0 0 -6px rgba(0, 50, 126, 0.12), 216px 0 0 -6px rgba(0, 50, 126, 0.12), 217px 0 0 -6px rgba(0, 50, 126, 0.12), 218px 0 0 -6px rgba(0, 50, 126, 0.12), 219px 0 0 -6px rgba(0, 50, 126, 0.12), 220px 0 0 -6px rgba(0, 50, 126, 0.12), 221px 0 0 -6px rgba(0, 50, 126, 0.12), 222px 0 0 -6px rgba(0, 50, 126, 0.12), 223px 0 0 -6px rgba(0, 50, 126, 0.12), 224px 0 0 -6px rgba(0, 50, 126, 0.12), 225px 0 0 -6px rgba(0, 50, 126, 0.12), 226px 0 0 -6px rgba(0, 50, 126, 0.12), 227px 0 0 -6px rgba(0, 50, 126, 0.12), 228px 0 0 -6px rgba(0, 50, 126, 0.12), 229px 0 0 -6px rgba(0, 50, 126, 0.12), 230px 0 0 -6px rgba(0, 50, 126, 0.12), 231px 0 0 -6px rgba(0, 50, 126, 0.12), 232px 0 0 -6px rgba(0, 50, 126, 0.12), 233px 0 0 -6px rgba(0, 50, 126, 0.12), 234px 0 0 -6px rgba(0, 50, 126, 0.12), 235px 0 0 -6px rgba(0, 50, 126, 0.12), 236px 0 0 -6px rgba(0, 50, 126, 0.12), 237px 0 0 -6px rgba(0, 50, 126, 0.12), 238px 0 0 -6px rgba(0, 50, 126, 0.12), 239px 0 0 -6px rgba(0, 50, 126, 0.12), 240px 0 0 -6px rgba(0, 50, 126, 0.12); + margin-top: -6px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-track { + width: 240px; + height: 2px; + background: rgba(0, 50, 126, 0.12); +} + +.custom-range::-moz-range-thumb { + width: 14px; + height: 14px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + position: relative; + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-progress { + height: 2px; + background: #467fcf; + border: 0; + margin-top: 0; +} + +.custom-range::-ms-track { + background: transparent; + border: 0; + border-color: transparent; + border-radius: 0; + border-width: 0; + color: transparent; + height: 2px; + margin-top: 10px; + width: 240px; +} + +.custom-range::-ms-thumb { + width: 240px; + height: 2px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-ms-fill-lower { + background: #467fcf; + border-radius: 0; +} + +.custom-range::-ms-fill-upper { + background: rgba(0, 50, 126, 0.12); + border-radius: 0; +} + +.custom-range::-ms-tooltip { + display: none; +} + +.selectgroup { + display: -ms-inline-flexbox; + display: inline-flex; +} + +.selectgroup-item { + -ms-flex-positive: 1; + flex-grow: 1; + position: relative; +} + +.selectgroup-item + .selectgroup-item { + margin-left: -1px; +} + +.selectgroup-item:not(:first-child) .selectgroup-button { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.selectgroup-item:not(:last-child) .selectgroup-button { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.selectgroup-input { + opacity: 0; + position: absolute; + z-index: -1; + top: 0; + left: 0; +} + +.selectgroup-button { + display: block; + border: 1px solid rgba(0, 40, 100, 0.12); + text-align: center; + padding: 0.375rem 1rem; + position: relative; + cursor: pointer; + border-radius: 3px; + color: #9aa0ac; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + font-size: 0.9375rem; + line-height: 1.5rem; + min-width: 2.375rem; +} + +.selectgroup-button-icon { + padding-left: .5rem; + padding-right: .5rem; + font-size: 1rem; +} + +.selectgroup-input:checked + .selectgroup-button { + border-color: #467fcf; + z-index: 1; + color: #467fcf; + background: #edf2fa; +} + +.selectgroup-input:focus + .selectgroup-button { + border-color: #467fcf; + z-index: 2; + color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectgroup-pills { + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: start; + align-items: flex-start; +} + +.selectgroup-pills .selectgroup-item { + margin-right: .5rem; + -ms-flex-positive: 0; + flex-grow: 0; +} + +.selectgroup-pills .selectgroup-button { + border-radius: 50px !important; +} + +.custom-switch { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: default; + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + margin: 0; +} + +.custom-switch-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-switches-stacked { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.custom-switches-stacked .custom-switch { + margin-bottom: .5rem; +} + +.custom-switch-indicator { + display: inline-block; + height: 1.25rem; + width: 2.25rem; + background: #e9ecef; + border-radius: 50px; + position: relative; + vertical-align: bottom; + border: 1px solid rgba(0, 40, 100, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-switch-indicator:before { + content: ''; + position: absolute; + height: calc(1.25rem - 4px); + width: calc(1.25rem - 4px); + top: 1px; + left: 1px; + background: #fff; + border-radius: 50%; + transition: .3s left; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); +} + +.custom-switch-input:checked ~ .custom-switch-indicator { + background: #467fcf; +} + +.custom-switch-input:checked ~ .custom-switch-indicator:before { + left: calc(1rem + 1px); +} + +.custom-switch-input:focus ~ .custom-switch-indicator { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); + border-color: #467fcf; +} + +.custom-switch-description { + margin-left: .5rem; + color: #6e7687; + transition: .3s color; +} + +.custom-switch-input:checked ~ .custom-switch-description { + color: #495057; +} + +.imagecheck { + margin: 0; + position: relative; + cursor: pointer; +} + +.imagecheck-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.imagecheck-figure { + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + margin: 0; + position: relative; +} + +.imagecheck-input:focus ~ .imagecheck-figure { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.imagecheck-input:checked ~ .imagecheck-figure { + border-color: rgba(0, 40, 100, 0.24); +} + +.imagecheck-figure:before { + content: ''; + position: absolute; + top: .25rem; + left: .25rem; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background: #467fcf url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; + color: #fff; + z-index: 1; + border-radius: 3px; + opacity: 0; + transition: .3s opacity; +} + +.imagecheck-input:checked ~ .imagecheck-figure:before { + opacity: 1; +} + +.imagecheck-image { + max-width: 100%; + opacity: .64; + transition: .3s opacity; +} + +.imagecheck-image:first-child { + border-top-left-radius: 2px; + border-top-right-radius: 2px; +} + +.imagecheck-image:last-child { + border-bottom-left-radius: 2px; + border-bottom-right-radius: 2px; +} + +.imagecheck:hover .imagecheck-image, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-image, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-image { + opacity: 1; +} + +.imagecheck-caption { + text-align: center; + padding: .25rem .25rem; + color: #9aa0ac; + font-size: 0.875rem; + transition: .3s color; +} + +.imagecheck:hover .imagecheck-caption, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-caption, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-caption { + color: #495057; +} + +.colorinput { + margin: 0; + position: relative; + cursor: pointer; +} + +.colorinput-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.colorinput-color { + display: inline-block; + width: 1.75rem; + height: 1.75rem; + border-radius: 3px; + border: 1px solid rgba(0, 40, 100, 0.12); + color: #fff; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); +} + +.colorinput-color:before { + content: ''; + opacity: 0; + position: absolute; + top: .25rem; + left: .25rem; + height: 1.25rem; + width: 1.25rem; + transition: .3s opacity; + background: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; +} + +.colorinput-input:checked ~ .colorinput-color:before { + opacity: 1; +} + +.colorinput-input:focus ~ .colorinput-color { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.timeline { + position: relative; + margin: 0 0 2rem; + padding: 0; + list-style: none; +} + +.timeline:before { + background-color: #e9ecef; + position: absolute; + display: block; + content: ''; + width: 1px; + height: 100%; + top: 0; + bottom: 0; + left: 4px; +} + +.timeline-item { + position: relative; + display: -ms-flexbox; + display: flex; + padding-left: 2rem; + margin: .5rem 0; +} + +.timeline-item:first-child:before, .timeline-item:last-child:before { + content: ''; + position: absolute; + background: #fff; + width: 1px; + left: .25rem; +} + +.timeline-item:first-child { + margin-top: 0; +} + +.timeline-item:first-child:before { + top: 0; + height: .5rem; +} + +.timeline-item:last-child { + margin-bottom: 0; +} + +.timeline-item:last-child:before { + top: .5rem; + bottom: 0; +} + +.timeline-badge { + position: absolute; + display: block; + width: 0.4375rem; + height: 0.4375rem; + left: 1px; + top: .5rem; + border-radius: 100%; + border: 1px solid #fff; + background: #adb5bd; +} + +.timeline-time { + white-space: nowrap; + margin-left: auto; + color: #9aa0ac; + font-size: 87.5%; +} + +.browser { + width: 1.25rem; + height: 1.25rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; +} + +.browser-android-browser { + background-image: url("../images/browsers/android-browser.svg"); +} + +.browser-aol-explorer { + background-image: url("../images/browsers/aol-explorer.svg"); +} + +.browser-blackberry { + background-image: url("../images/browsers/blackberry.svg"); +} + +.browser-camino { + background-image: url("../images/browsers/camino.svg"); +} + +.browser-chrome { + background-image: url("../images/browsers/chrome.svg"); +} + +.browser-chromium { + background-image: url("../images/browsers/chromium.svg"); +} + +.browser-dolphin { + background-image: url("../images/browsers/dolphin.svg"); +} + +.browser-edge { + background-image: url("../images/browsers/edge.svg"); +} + +.browser-firefox { + background-image: url("../images/browsers/firefox.svg"); +} + +.browser-ie { + background-image: url("../images/browsers/ie.svg"); +} + +.browser-maxthon { + background-image: url("../images/browsers/maxthon.svg"); +} + +.browser-mozilla { + background-image: url("../images/browsers/mozilla.svg"); +} + +.browser-netscape { + background-image: url("../images/browsers/netscape.svg"); +} + +.browser-opera { + background-image: url("../images/browsers/opera.svg"); +} + +.browser-safari { + background-image: url("../images/browsers/safari.svg"); +} + +.browser-sleipnir { + background-image: url("../images/browsers/sleipnir.svg"); +} + +.browser-uc-browser { + background-image: url("../images/browsers/uc-browser.svg"); +} + +.browser-vivaldi { + background-image: url("../images/browsers/vivaldi.svg"); +} + +.flag { + width: 1.6rem; + height: 1.2rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.flag-ad { + background-image: url("../images/flags/ad.svg"); +} + +.flag-ae { + background-image: url("../images/flags/ae.svg"); +} + +.flag-af { + background-image: url("../images/flags/af.svg"); +} + +.flag-ag { + background-image: url("../images/flags/ag.svg"); +} + +.flag-ai { + background-image: url("../images/flags/ai.svg"); +} + +.flag-al { + background-image: url("../images/flags/al.svg"); +} + +.flag-am { + background-image: url("../images/flags/am.svg"); +} + +.flag-ao { + background-image: url("../images/flags/ao.svg"); +} + +.flag-aq { + background-image: url("../images/flags/aq.svg"); +} + +.flag-ar { + background-image: url("../images/flags/ar.svg"); +} + +.flag-as { + background-image: url("../images/flags/as.svg"); +} + +.flag-at { + background-image: url("../images/flags/at.svg"); +} + +.flag-au { + background-image: url("../images/flags/au.svg"); +} + +.flag-aw { + background-image: url("../images/flags/aw.svg"); +} + +.flag-ax { + background-image: url("../images/flags/ax.svg"); +} + +.flag-az { + background-image: url("../images/flags/az.svg"); +} + +.flag-ba { + background-image: url("../images/flags/ba.svg"); +} + +.flag-bb { + background-image: url("../images/flags/bb.svg"); +} + +.flag-bd { + background-image: url("../images/flags/bd.svg"); +} + +.flag-be { + background-image: url("../images/flags/be.svg"); +} + +.flag-bf { + background-image: url("../images/flags/bf.svg"); +} + +.flag-bg { + background-image: url("../images/flags/bg.svg"); +} + +.flag-bh { + background-image: url("../images/flags/bh.svg"); +} + +.flag-bi { + background-image: url("../images/flags/bi.svg"); +} + +.flag-bj { + background-image: url("../images/flags/bj.svg"); +} + +.flag-bl { + background-image: url("../images/flags/bl.svg"); +} + +.flag-bm { + background-image: url("../images/flags/bm.svg"); +} + +.flag-bn { + background-image: url("../images/flags/bn.svg"); +} + +.flag-bo { + background-image: url("../images/flags/bo.svg"); +} + +.flag-bq { + background-image: url("../images/flags/bq.svg"); +} + +.flag-br { + background-image: url("../images/flags/br.svg"); +} + +.flag-bs { + background-image: url("../images/flags/bs.svg"); +} + +.flag-bt { + background-image: url("../images/flags/bt.svg"); +} + +.flag-bv { + background-image: url("../images/flags/bv.svg"); +} + +.flag-bw { + background-image: url("../images/flags/bw.svg"); +} + +.flag-by { + background-image: url("../images/flags/by.svg"); +} + +.flag-bz { + background-image: url("../images/flags/bz.svg"); +} + +.flag-ca { + background-image: url("../images/flags/ca.svg"); +} + +.flag-cc { + background-image: url("../images/flags/cc.svg"); +} + +.flag-cd { + background-image: url("../images/flags/cd.svg"); +} + +.flag-cf { + background-image: url("../images/flags/cf.svg"); +} + +.flag-cg { + background-image: url("../images/flags/cg.svg"); +} + +.flag-ch { + background-image: url("../images/flags/ch.svg"); +} + +.flag-ci { + background-image: url("../images/flags/ci.svg"); +} + +.flag-ck { + background-image: url("../images/flags/ck.svg"); +} + +.flag-cl { + background-image: url("../images/flags/cl.svg"); +} + +.flag-cm { + background-image: url("../images/flags/cm.svg"); +} + +.flag-cn { + background-image: url("../images/flags/cn.svg"); +} + +.flag-co { + background-image: url("../images/flags/co.svg"); +} + +.flag-cr { + background-image: url("../images/flags/cr.svg"); +} + +.flag-cu { + background-image: url("../images/flags/cu.svg"); +} + +.flag-cv { + background-image: url("../images/flags/cv.svg"); +} + +.flag-cw { + background-image: url("../images/flags/cw.svg"); +} + +.flag-cx { + background-image: url("../images/flags/cx.svg"); +} + +.flag-cy { + background-image: url("../images/flags/cy.svg"); +} + +.flag-cz { + background-image: url("../images/flags/cz.svg"); +} + +.flag-de { + background-image: url("../images/flags/de.svg"); +} + +.flag-dj { + background-image: url("../images/flags/dj.svg"); +} + +.flag-dk { + background-image: url("../images/flags/dk.svg"); +} + +.flag-dm { + background-image: url("../images/flags/dm.svg"); +} + +.flag-do { + background-image: url("../images/flags/do.svg"); +} + +.flag-dz { + background-image: url("../images/flags/dz.svg"); +} + +.flag-ec { + background-image: url("../images/flags/ec.svg"); +} + +.flag-ee { + background-image: url("../images/flags/ee.svg"); +} + +.flag-eg { + background-image: url("../images/flags/eg.svg"); +} + +.flag-eh { + background-image: url("../images/flags/eh.svg"); +} + +.flag-er { + background-image: url("../images/flags/er.svg"); +} + +.flag-es { + background-image: url("../images/flags/es.svg"); +} + +.flag-et { + background-image: url("../images/flags/et.svg"); +} + +.flag-eu { + background-image: url("../images/flags/eu.svg"); +} + +.flag-fi { + background-image: url("../images/flags/fi.svg"); +} + +.flag-fj { + background-image: url("../images/flags/fj.svg"); +} + +.flag-fk { + background-image: url("../images/flags/fk.svg"); +} + +.flag-fm { + background-image: url("../images/flags/fm.svg"); +} + +.flag-fo { + background-image: url("../images/flags/fo.svg"); +} + +.flag-fr { + background-image: url("../images/flags/fr.svg"); +} + +.flag-ga { + background-image: url("../images/flags/ga.svg"); +} + +.flag-gb-eng { + background-image: url("../images/flags/gb-eng.svg"); +} + +.flag-gb-nir { + background-image: url("../images/flags/gb-nir.svg"); +} + +.flag-gb-sct { + background-image: url("../images/flags/gb-sct.svg"); +} + +.flag-gb-wls { + background-image: url("../images/flags/gb-wls.svg"); +} + +.flag-gb { + background-image: url("../images/flags/gb.svg"); +} + +.flag-gd { + background-image: url("../images/flags/gd.svg"); +} + +.flag-ge { + background-image: url("../images/flags/ge.svg"); +} + +.flag-gf { + background-image: url("../images/flags/gf.svg"); +} + +.flag-gg { + background-image: url("../images/flags/gg.svg"); +} + +.flag-gh { + background-image: url("../images/flags/gh.svg"); +} + +.flag-gi { + background-image: url("../images/flags/gi.svg"); +} + +.flag-gl { + background-image: url("../images/flags/gl.svg"); +} + +.flag-gm { + background-image: url("../images/flags/gm.svg"); +} + +.flag-gn { + background-image: url("../images/flags/gn.svg"); +} + +.flag-gp { + background-image: url("../images/flags/gp.svg"); +} + +.flag-gq { + background-image: url("../images/flags/gq.svg"); +} + +.flag-gr { + background-image: url("../images/flags/gr.svg"); +} + +.flag-gs { + background-image: url("../images/flags/gs.svg"); +} + +.flag-gt { + background-image: url("../images/flags/gt.svg"); +} + +.flag-gu { + background-image: url("../images/flags/gu.svg"); +} + +.flag-gw { + background-image: url("../images/flags/gw.svg"); +} + +.flag-gy { + background-image: url("../images/flags/gy.svg"); +} + +.flag-hk { + background-image: url("../images/flags/hk.svg"); +} + +.flag-hm { + background-image: url("../images/flags/hm.svg"); +} + +.flag-hn { + background-image: url("../images/flags/hn.svg"); +} + +.flag-hr { + background-image: url("../images/flags/hr.svg"); +} + +.flag-ht { + background-image: url("../images/flags/ht.svg"); +} + +.flag-hu { + background-image: url("../images/flags/hu.svg"); +} + +.flag-id { + background-image: url("../images/flags/id.svg"); +} + +.flag-ie { + background-image: url("../images/flags/ie.svg"); +} + +.flag-il { + background-image: url("../images/flags/il.svg"); +} + +.flag-im { + background-image: url("../images/flags/im.svg"); +} + +.flag-in { + background-image: url("../images/flags/in.svg"); +} + +.flag-io { + background-image: url("../images/flags/io.svg"); +} + +.flag-iq { + background-image: url("../images/flags/iq.svg"); +} + +.flag-ir { + background-image: url("../images/flags/ir.svg"); +} + +.flag-is { + background-image: url("../images/flags/is.svg"); +} + +.flag-it { + background-image: url("../images/flags/it.svg"); +} + +.flag-je { + background-image: url("../images/flags/je.svg"); +} + +.flag-jm { + background-image: url("../images/flags/jm.svg"); +} + +.flag-jo { + background-image: url("../images/flags/jo.svg"); +} + +.flag-jp { + background-image: url("../images/flags/jp.svg"); +} + +.flag-ke { + background-image: url("../images/flags/ke.svg"); +} + +.flag-kg { + background-image: url("../images/flags/kg.svg"); +} + +.flag-kh { + background-image: url("../images/flags/kh.svg"); +} + +.flag-ki { + background-image: url("../images/flags/ki.svg"); +} + +.flag-km { + background-image: url("../images/flags/km.svg"); +} + +.flag-kn { + background-image: url("../images/flags/kn.svg"); +} + +.flag-kp { + background-image: url("../images/flags/kp.svg"); +} + +.flag-kr { + background-image: url("../images/flags/kr.svg"); +} + +.flag-kw { + background-image: url("../images/flags/kw.svg"); +} + +.flag-ky { + background-image: url("../images/flags/ky.svg"); +} + +.flag-kz { + background-image: url("../images/flags/kz.svg"); +} + +.flag-la { + background-image: url("../images/flags/la.svg"); +} + +.flag-lb { + background-image: url("../images/flags/lb.svg"); +} + +.flag-lc { + background-image: url("../images/flags/lc.svg"); +} + +.flag-li { + background-image: url("../images/flags/li.svg"); +} + +.flag-lk { + background-image: url("../images/flags/lk.svg"); +} + +.flag-lr { + background-image: url("../images/flags/lr.svg"); +} + +.flag-ls { + background-image: url("../images/flags/ls.svg"); +} + +.flag-lt { + background-image: url("../images/flags/lt.svg"); +} + +.flag-lu { + background-image: url("../images/flags/lu.svg"); +} + +.flag-lv { + background-image: url("../images/flags/lv.svg"); +} + +.flag-ly { + background-image: url("../images/flags/ly.svg"); +} + +.flag-ma { + background-image: url("../images/flags/ma.svg"); +} + +.flag-mc { + background-image: url("../images/flags/mc.svg"); +} + +.flag-md { + background-image: url("../images/flags/md.svg"); +} + +.flag-me { + background-image: url("../images/flags/me.svg"); +} + +.flag-mf { + background-image: url("../images/flags/mf.svg"); +} + +.flag-mg { + background-image: url("../images/flags/mg.svg"); +} + +.flag-mh { + background-image: url("../images/flags/mh.svg"); +} + +.flag-mk { + background-image: url("../images/flags/mk.svg"); +} + +.flag-ml { + background-image: url("../images/flags/ml.svg"); +} + +.flag-mm { + background-image: url("../images/flags/mm.svg"); +} + +.flag-mn { + background-image: url("../images/flags/mn.svg"); +} + +.flag-mo { + background-image: url("../images/flags/mo.svg"); +} + +.flag-mp { + background-image: url("../images/flags/mp.svg"); +} + +.flag-mq { + background-image: url("../images/flags/mq.svg"); +} + +.flag-mr { + background-image: url("../images/flags/mr.svg"); +} + +.flag-ms { + background-image: url("../images/flags/ms.svg"); +} + +.flag-mt { + background-image: url("../images/flags/mt.svg"); +} + +.flag-mu { + background-image: url("../images/flags/mu.svg"); +} + +.flag-mv { + background-image: url("../images/flags/mv.svg"); +} + +.flag-mw { + background-image: url("../images/flags/mw.svg"); +} + +.flag-mx { + background-image: url("../images/flags/mx.svg"); +} + +.flag-my { + background-image: url("../images/flags/my.svg"); +} + +.flag-mz { + background-image: url("../images/flags/mz.svg"); +} + +.flag-na { + background-image: url("../images/flags/na.svg"); +} + +.flag-nc { + background-image: url("../images/flags/nc.svg"); +} + +.flag-ne { + background-image: url("../images/flags/ne.svg"); +} + +.flag-nf { + background-image: url("../images/flags/nf.svg"); +} + +.flag-ng { + background-image: url("../images/flags/ng.svg"); +} + +.flag-ni { + background-image: url("../images/flags/ni.svg"); +} + +.flag-nl { + background-image: url("../images/flags/nl.svg"); +} + +.flag-no { + background-image: url("../images/flags/no.svg"); +} + +.flag-np { + background-image: url("../images/flags/np.svg"); +} + +.flag-nr { + background-image: url("../images/flags/nr.svg"); +} + +.flag-nu { + background-image: url("../images/flags/nu.svg"); +} + +.flag-nz { + background-image: url("../images/flags/nz.svg"); +} + +.flag-om { + background-image: url("../images/flags/om.svg"); +} + +.flag-pa { + background-image: url("../images/flags/pa.svg"); +} + +.flag-pe { + background-image: url("../images/flags/pe.svg"); +} + +.flag-pf { + background-image: url("../images/flags/pf.svg"); +} + +.flag-pg { + background-image: url("../images/flags/pg.svg"); +} + +.flag-ph { + background-image: url("../images/flags/ph.svg"); +} + +.flag-pk { + background-image: url("../images/flags/pk.svg"); +} + +.flag-pl { + background-image: url("../images/flags/pl.svg"); +} + +.flag-pm { + background-image: url("../images/flags/pm.svg"); +} + +.flag-pn { + background-image: url("../images/flags/pn.svg"); +} + +.flag-pr { + background-image: url("../images/flags/pr.svg"); +} + +.flag-ps { + background-image: url("../images/flags/ps.svg"); +} + +.flag-pt { + background-image: url("../images/flags/pt.svg"); +} + +.flag-pw { + background-image: url("../images/flags/pw.svg"); +} + +.flag-py { + background-image: url("../images/flags/py.svg"); +} + +.flag-qa { + background-image: url("../images/flags/qa.svg"); +} + +.flag-re { + background-image: url("../images/flags/re.svg"); +} + +.flag-ro { + background-image: url("../images/flags/ro.svg"); +} + +.flag-rs { + background-image: url("../images/flags/rs.svg"); +} + +.flag-ru { + background-image: url("../images/flags/ru.svg"); +} + +.flag-rw { + background-image: url("../images/flags/rw.svg"); +} + +.flag-sa { + background-image: url("../images/flags/sa.svg"); +} + +.flag-sb { + background-image: url("../images/flags/sb.svg"); +} + +.flag-sc { + background-image: url("../images/flags/sc.svg"); +} + +.flag-sd { + background-image: url("../images/flags/sd.svg"); +} + +.flag-se { + background-image: url("../images/flags/se.svg"); +} + +.flag-sg { + background-image: url("../images/flags/sg.svg"); +} + +.flag-sh { + background-image: url("../images/flags/sh.svg"); +} + +.flag-si { + background-image: url("../images/flags/si.svg"); +} + +.flag-sj { + background-image: url("../images/flags/sj.svg"); +} + +.flag-sk { + background-image: url("../images/flags/sk.svg"); +} + +.flag-sl { + background-image: url("../images/flags/sl.svg"); +} + +.flag-sm { + background-image: url("../images/flags/sm.svg"); +} + +.flag-sn { + background-image: url("../images/flags/sn.svg"); +} + +.flag-so { + background-image: url("../images/flags/so.svg"); +} + +.flag-sr { + background-image: url("../images/flags/sr.svg"); +} + +.flag-ss { + background-image: url("../images/flags/ss.svg"); +} + +.flag-st { + background-image: url("../images/flags/st.svg"); +} + +.flag-sv { + background-image: url("../images/flags/sv.svg"); +} + +.flag-sx { + background-image: url("../images/flags/sx.svg"); +} + +.flag-sy { + background-image: url("../images/flags/sy.svg"); +} + +.flag-sz { + background-image: url("../images/flags/sz.svg"); +} + +.flag-tc { + background-image: url("../images/flags/tc.svg"); +} + +.flag-td { + background-image: url("../images/flags/td.svg"); +} + +.flag-tf { + background-image: url("../images/flags/tf.svg"); +} + +.flag-tg { + background-image: url("../images/flags/tg.svg"); +} + +.flag-th { + background-image: url("../images/flags/th.svg"); +} + +.flag-tj { + background-image: url("../images/flags/tj.svg"); +} + +.flag-tk { + background-image: url("../images/flags/tk.svg"); +} + +.flag-tl { + background-image: url("../images/flags/tl.svg"); +} + +.flag-tm { + background-image: url("../images/flags/tm.svg"); +} + +.flag-tn { + background-image: url("../images/flags/tn.svg"); +} + +.flag-to { + background-image: url("../images/flags/to.svg"); +} + +.flag-tr { + background-image: url("../images/flags/tr.svg"); +} + +.flag-tt { + background-image: url("../images/flags/tt.svg"); +} + +.flag-tv { + background-image: url("../images/flags/tv.svg"); +} + +.flag-tw { + background-image: url("../images/flags/tw.svg"); +} + +.flag-tz { + background-image: url("../images/flags/tz.svg"); +} + +.flag-ua { + background-image: url("../images/flags/ua.svg"); +} + +.flag-ug { + background-image: url("../images/flags/ug.svg"); +} + +.flag-um { + background-image: url("../images/flags/um.svg"); +} + +.flag-un { + background-image: url("../images/flags/un.svg"); +} + +.flag-us { + background-image: url("../images/flags/us.svg"); +} + +.flag-uy { + background-image: url("../images/flags/uy.svg"); +} + +.flag-uz { + background-image: url("../images/flags/uz.svg"); +} + +.flag-va { + background-image: url("../images/flags/va.svg"); +} + +.flag-vc { + background-image: url("../images/flags/vc.svg"); +} + +.flag-ve { + background-image: url("../images/flags/ve.svg"); +} + +.flag-vg { + background-image: url("../images/flags/vg.svg"); +} + +.flag-vi { + background-image: url("../images/flags/vi.svg"); +} + +.flag-vn { + background-image: url("../images/flags/vn.svg"); +} + +.flag-vu { + background-image: url("../images/flags/vu.svg"); +} + +.flag-wf { + background-image: url("../images/flags/wf.svg"); +} + +.flag-ws { + background-image: url("../images/flags/ws.svg"); +} + +.flag-ye { + background-image: url("../images/flags/ye.svg"); +} + +.flag-yt { + background-image: url("../images/flags/yt.svg"); +} + +.flag-za { + background-image: url("../images/flags/za.svg"); +} + +.flag-zm { + background-image: url("../images/flags/zm.svg"); +} + +.flag-zw { + background-image: url("../images/flags/zw.svg"); +} + +.payment { + width: 2.5rem; + height: 1.5rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.payment-2checkout-dark { + background-image: url("../images/payments/2checkout-dark.svg"); +} + +.payment-2checkout { + background-image: url("../images/payments/2checkout.svg"); +} + +.payment-alipay-dark { + background-image: url("../images/payments/alipay-dark.svg"); +} + +.payment-alipay { + background-image: url("../images/payments/alipay.svg"); +} + +.payment-amazon-dark { + background-image: url("../images/payments/amazon-dark.svg"); +} + +.payment-amazon { + background-image: url("../images/payments/amazon.svg"); +} + +.payment-americanexpress-dark { + background-image: url("../images/payments/americanexpress-dark.svg"); +} + +.payment-americanexpress { + background-image: url("../images/payments/americanexpress.svg"); +} + +.payment-applepay-dark { + background-image: url("../images/payments/applepay-dark.svg"); +} + +.payment-applepay { + background-image: url("../images/payments/applepay.svg"); +} + +.payment-bancontact-dark { + background-image: url("../images/payments/bancontact-dark.svg"); +} + +.payment-bancontact { + background-image: url("../images/payments/bancontact.svg"); +} + +.payment-bitcoin-dark { + background-image: url("../images/payments/bitcoin-dark.svg"); +} + +.payment-bitcoin { + background-image: url("../images/payments/bitcoin.svg"); +} + +.payment-bitpay-dark { + background-image: url("../images/payments/bitpay-dark.svg"); +} + +.payment-bitpay { + background-image: url("../images/payments/bitpay.svg"); +} + +.payment-cirrus-dark { + background-image: url("../images/payments/cirrus-dark.svg"); +} + +.payment-cirrus { + background-image: url("../images/payments/cirrus.svg"); +} + +.payment-clickandbuy-dark { + background-image: url("../images/payments/clickandbuy-dark.svg"); +} + +.payment-clickandbuy { + background-image: url("../images/payments/clickandbuy.svg"); +} + +.payment-coinkite-dark { + background-image: url("../images/payments/coinkite-dark.svg"); +} + +.payment-coinkite { + background-image: url("../images/payments/coinkite.svg"); +} + +.payment-dinersclub-dark { + background-image: url("../images/payments/dinersclub-dark.svg"); +} + +.payment-dinersclub { + background-image: url("../images/payments/dinersclub.svg"); +} + +.payment-directdebit-dark { + background-image: url("../images/payments/directdebit-dark.svg"); +} + +.payment-directdebit { + background-image: url("../images/payments/directdebit.svg"); +} + +.payment-discover-dark { + background-image: url("../images/payments/discover-dark.svg"); +} + +.payment-discover { + background-image: url("../images/payments/discover.svg"); +} + +.payment-dwolla-dark { + background-image: url("../images/payments/dwolla-dark.svg"); +} + +.payment-dwolla { + background-image: url("../images/payments/dwolla.svg"); +} + +.payment-ebay-dark { + background-image: url("../images/payments/ebay-dark.svg"); +} + +.payment-ebay { + background-image: url("../images/payments/ebay.svg"); +} + +.payment-eway-dark { + background-image: url("../images/payments/eway-dark.svg"); +} + +.payment-eway { + background-image: url("../images/payments/eway.svg"); +} + +.payment-giropay-dark { + background-image: url("../images/payments/giropay-dark.svg"); +} + +.payment-giropay { + background-image: url("../images/payments/giropay.svg"); +} + +.payment-googlewallet-dark { + background-image: url("../images/payments/googlewallet-dark.svg"); +} + +.payment-googlewallet { + background-image: url("../images/payments/googlewallet.svg"); +} + +.payment-ingenico-dark { + background-image: url("../images/payments/ingenico-dark.svg"); +} + +.payment-ingenico { + background-image: url("../images/payments/ingenico.svg"); +} + +.payment-jcb-dark { + background-image: url("../images/payments/jcb-dark.svg"); +} + +.payment-jcb { + background-image: url("../images/payments/jcb.svg"); +} + +.payment-klarna-dark { + background-image: url("../images/payments/klarna-dark.svg"); +} + +.payment-klarna { + background-image: url("../images/payments/klarna.svg"); +} + +.payment-laser-dark { + background-image: url("../images/payments/laser-dark.svg"); +} + +.payment-laser { + background-image: url("../images/payments/laser.svg"); +} + +.payment-maestro-dark { + background-image: url("../images/payments/maestro-dark.svg"); +} + +.payment-maestro { + background-image: url("../images/payments/maestro.svg"); +} + +.payment-mastercard-dark { + background-image: url("../images/payments/mastercard-dark.svg"); +} + +.payment-mastercard { + background-image: url("../images/payments/mastercard.svg"); +} + +.payment-monero-dark { + background-image: url("../images/payments/monero-dark.svg"); +} + +.payment-monero { + background-image: url("../images/payments/monero.svg"); +} + +.payment-neteller-dark { + background-image: url("../images/payments/neteller-dark.svg"); +} + +.payment-neteller { + background-image: url("../images/payments/neteller.svg"); +} + +.payment-ogone-dark { + background-image: url("../images/payments/ogone-dark.svg"); +} + +.payment-ogone { + background-image: url("../images/payments/ogone.svg"); +} + +.payment-okpay-dark { + background-image: url("../images/payments/okpay-dark.svg"); +} + +.payment-okpay { + background-image: url("../images/payments/okpay.svg"); +} + +.payment-paybox-dark { + background-image: url("../images/payments/paybox-dark.svg"); +} + +.payment-paybox { + background-image: url("../images/payments/paybox.svg"); +} + +.payment-paymill-dark { + background-image: url("../images/payments/paymill-dark.svg"); +} + +.payment-paymill { + background-image: url("../images/payments/paymill.svg"); +} + +.payment-payone-dark { + background-image: url("../images/payments/payone-dark.svg"); +} + +.payment-payone { + background-image: url("../images/payments/payone.svg"); +} + +.payment-payoneer-dark { + background-image: url("../images/payments/payoneer-dark.svg"); +} + +.payment-payoneer { + background-image: url("../images/payments/payoneer.svg"); +} + +.payment-paypal-dark { + background-image: url("../images/payments/paypal-dark.svg"); +} + +.payment-paypal { + background-image: url("../images/payments/paypal.svg"); +} + +.payment-paysafecard-dark { + background-image: url("../images/payments/paysafecard-dark.svg"); +} + +.payment-paysafecard { + background-image: url("../images/payments/paysafecard.svg"); +} + +.payment-payu-dark { + background-image: url("../images/payments/payu-dark.svg"); +} + +.payment-payu { + background-image: url("../images/payments/payu.svg"); +} + +.payment-payza-dark { + background-image: url("../images/payments/payza-dark.svg"); +} + +.payment-payza { + background-image: url("../images/payments/payza.svg"); +} + +.payment-ripple-dark { + background-image: url("../images/payments/ripple-dark.svg"); +} + +.payment-ripple { + background-image: url("../images/payments/ripple.svg"); +} + +.payment-sage-dark { + background-image: url("../images/payments/sage-dark.svg"); +} + +.payment-sage { + background-image: url("../images/payments/sage.svg"); +} + +.payment-sepa-dark { + background-image: url("../images/payments/sepa-dark.svg"); +} + +.payment-sepa { + background-image: url("../images/payments/sepa.svg"); +} + +.payment-shopify-dark { + background-image: url("../images/payments/shopify-dark.svg"); +} + +.payment-shopify { + background-image: url("../images/payments/shopify.svg"); +} + +.payment-skrill-dark { + background-image: url("../images/payments/skrill-dark.svg"); +} + +.payment-skrill { + background-image: url("../images/payments/skrill.svg"); +} + +.payment-solo-dark { + background-image: url("../images/payments/solo-dark.svg"); +} + +.payment-solo { + background-image: url("../images/payments/solo.svg"); +} + +.payment-square-dark { + background-image: url("../images/payments/square-dark.svg"); +} + +.payment-square { + background-image: url("../images/payments/square.svg"); +} + +.payment-stripe-dark { + background-image: url("../images/payments/stripe-dark.svg"); +} + +.payment-stripe { + background-image: url("../images/payments/stripe.svg"); +} + +.payment-switch-dark { + background-image: url("../images/payments/switch-dark.svg"); +} + +.payment-switch { + background-image: url("../images/payments/switch.svg"); +} + +.payment-ukash-dark { + background-image: url("../images/payments/ukash-dark.svg"); +} + +.payment-ukash { + background-image: url("../images/payments/ukash.svg"); +} + +.payment-unionpay-dark { + background-image: url("../images/payments/unionpay-dark.svg"); +} + +.payment-unionpay { + background-image: url("../images/payments/unionpay.svg"); +} + +.payment-verifone-dark { + background-image: url("../images/payments/verifone-dark.svg"); +} + +.payment-verifone { + background-image: url("../images/payments/verifone.svg"); +} + +.payment-verisign-dark { + background-image: url("../images/payments/verisign-dark.svg"); +} + +.payment-verisign { + background-image: url("../images/payments/verisign.svg"); +} + +.payment-visa-dark { + background-image: url("../images/payments/visa-dark.svg"); +} + +.payment-visa { + background-image: url("../images/payments/visa.svg"); +} + +.payment-webmoney-dark { + background-image: url("../images/payments/webmoney-dark.svg"); +} + +.payment-webmoney { + background-image: url("../images/payments/webmoney.svg"); +} + +.payment-westernunion-dark { + background-image: url("../images/payments/westernunion-dark.svg"); +} + +.payment-westernunion { + background-image: url("../images/payments/westernunion.svg"); +} + +.payment-worldpay-dark { + background-image: url("../images/payments/worldpay-dark.svg"); +} + +.payment-worldpay { + background-image: url("../images/payments/worldpay.svg"); +} + +svg { + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-container { + width: 100%; + height: 100%; + position: relative; + overflow: hidden; + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-tip { + position: absolute; + display: none; + border-radius: 3px; + background: #212529; + color: white; + padding: 6px; + font-size: 11px; + line-height: 1; + font-weight: 700; +} + +.jvectormap-tip small { + font-size: inherit; + font-weight: 400; +} + +.jvectormap-zoomin, .jvectormap-zoomout, .jvectormap-goback { + position: absolute; + left: 10px; + border-radius: 3px; + background: #292929; + padding: 3px; + color: white; + cursor: pointer; + line-height: 10px; + text-align: center; + box-sizing: content-box; +} + +.jvectormap-zoomin, .jvectormap-zoomout { + width: 10px; + height: 10px; +} + +.jvectormap-zoomin { + top: 10px; +} + +.jvectormap-zoomout { + top: 30px; +} + +.jvectormap-goback { + bottom: 10px; + z-index: 1000; + padding: 6px; +} + +.jvectormap-spinner { + position: absolute; + left: 0; + top: 0; + right: 0; + bottom: 0; + background: center no-repeat url(data:image/gif;base64,R0lGODlhIAAgAPMAAP///wAAAMbGxoSEhLa2tpqamjY2NlZWVtjY2OTk5Ly8vB4eHgQEBAAAAAAAAAAAACH/C05FVFNDQVBFMi4wAwEAAAAh/hpDcmVhdGVkIHdpdGggYWpheGxvYWQuaW5mbwAh+QQJCgAAACwAAAAAIAAgAAAE5xDISWlhperN52JLhSSdRgwVo1ICQZRUsiwHpTJT4iowNS8vyW2icCF6k8HMMBkCEDskxTBDAZwuAkkqIfxIQyhBQBFvAQSDITM5VDW6XNE4KagNh6Bgwe60smQUB3d4Rz1ZBApnFASDd0hihh12BkE9kjAJVlycXIg7CQIFA6SlnJ87paqbSKiKoqusnbMdmDC2tXQlkUhziYtyWTxIfy6BE8WJt5YJvpJivxNaGmLHT0VnOgSYf0dZXS7APdpB309RnHOG5gDqXGLDaC457D1zZ/V/nmOM82XiHRLYKhKP1oZmADdEAAAh+QQJCgAAACwAAAAAIAAgAAAE6hDISWlZpOrNp1lGNRSdRpDUolIGw5RUYhhHukqFu8DsrEyqnWThGvAmhVlteBvojpTDDBUEIFwMFBRAmBkSgOrBFZogCASwBDEY/CZSg7GSE0gSCjQBMVG023xWBhklAnoEdhQEfyNqMIcKjhRsjEdnezB+A4k8gTwJhFuiW4dokXiloUepBAp5qaKpp6+Ho7aWW54wl7obvEe0kRuoplCGepwSx2jJvqHEmGt6whJpGpfJCHmOoNHKaHx61WiSR92E4lbFoq+B6QDtuetcaBPnW6+O7wDHpIiK9SaVK5GgV543tzjgGcghAgAh+QQJCgAAACwAAAAAIAAgAAAE7hDISSkxpOrN5zFHNWRdhSiVoVLHspRUMoyUakyEe8PTPCATW9A14E0UvuAKMNAZKYUZCiBMuBakSQKG8G2FzUWox2AUtAQFcBKlVQoLgQReZhQlCIJesQXI5B0CBnUMOxMCenoCfTCEWBsJColTMANldx15BGs8B5wlCZ9Po6OJkwmRpnqkqnuSrayqfKmqpLajoiW5HJq7FL1Gr2mMMcKUMIiJgIemy7xZtJsTmsM4xHiKv5KMCXqfyUCJEonXPN2rAOIAmsfB3uPoAK++G+w48edZPK+M6hLJpQg484enXIdQFSS1u6UhksENEQAAIfkECQoAAAAsAAAAACAAIAAABOcQyEmpGKLqzWcZRVUQnZYg1aBSh2GUVEIQ2aQOE+G+cD4ntpWkZQj1JIiZIogDFFyHI0UxQwFugMSOFIPJftfVAEoZLBbcLEFhlQiqGp1Vd140AUklUN3eCA51C1EWMzMCezCBBmkxVIVHBWd3HHl9JQOIJSdSnJ0TDKChCwUJjoWMPaGqDKannasMo6WnM562R5YluZRwur0wpgqZE7NKUm+FNRPIhjBJxKZteWuIBMN4zRMIVIhffcgojwCF117i4nlLnY5ztRLsnOk+aV+oJY7V7m76PdkS4trKcdg0Zc0tTcKkRAAAIfkECQoAAAAsAAAAACAAIAAABO4QyEkpKqjqzScpRaVkXZWQEximw1BSCUEIlDohrft6cpKCk5xid5MNJTaAIkekKGQkWyKHkvhKsR7ARmitkAYDYRIbUQRQjWBwJRzChi9CRlBcY1UN4g0/VNB0AlcvcAYHRyZPdEQFYV8ccwR5HWxEJ02YmRMLnJ1xCYp0Y5idpQuhopmmC2KgojKasUQDk5BNAwwMOh2RtRq5uQuPZKGIJQIGwAwGf6I0JXMpC8C7kXWDBINFMxS4DKMAWVWAGYsAdNqW5uaRxkSKJOZKaU3tPOBZ4DuK2LATgJhkPJMgTwKCdFjyPHEnKxFCDhEAACH5BAkKAAAALAAAAAAgACAAAATzEMhJaVKp6s2nIkolIJ2WkBShpkVRWqqQrhLSEu9MZJKK9y1ZrqYK9WiClmvoUaF8gIQSNeF1Er4MNFn4SRSDARWroAIETg1iVwuHjYB1kYc1mwruwXKC9gmsJXliGxc+XiUCby9ydh1sOSdMkpMTBpaXBzsfhoc5l58Gm5yToAaZhaOUqjkDgCWNHAULCwOLaTmzswadEqggQwgHuQsHIoZCHQMMQgQGubVEcxOPFAcMDAYUA85eWARmfSRQCdcMe0zeP1AAygwLlJtPNAAL19DARdPzBOWSm1brJBi45soRAWQAAkrQIykShQ9wVhHCwCQCACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiRMDjI0Fd30/iI2UA5GSS5UDj2l6NoqgOgN4gksEBgYFf0FDqKgHnyZ9OX8HrgYHdHpcHQULXAS2qKpENRg7eAMLC7kTBaixUYFkKAzWAAnLC7FLVxLWDBLKCwaKTULgEwbLA4hJtOkSBNqITT3xEgfLpBtzE/jiuL04RGEBgwWhShRgQExHBAAh+QQJCgAAACwAAAAAIAAgAAAE7xDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfZiCqGk5dTESJeaOAlClzsJsqwiJwiqnFrb2nS9kmIcgEsjQydLiIlHehhpejaIjzh9eomSjZR+ipslWIRLAgMDOR2DOqKogTB9pCUJBagDBXR6XB0EBkIIsaRsGGMMAxoDBgYHTKJiUYEGDAzHC9EACcUGkIgFzgwZ0QsSBcXHiQvOwgDdEwfFs0sDzt4S6BK4xYjkDOzn0unFeBzOBijIm1Dgmg5YFQwsCMjp1oJ8LyIAACH5BAkKAAAALAAAAAAgACAAAATwEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GGl6NoiPOH16iZKNlH6KmyWFOggHhEEvAwwMA0N9GBsEC6amhnVcEwavDAazGwIDaH1ipaYLBUTCGgQDA8NdHz0FpqgTBwsLqAbWAAnIA4FWKdMLGdYGEgraigbT0OITBcg5QwPT4xLrROZL6AuQAPUS7bxLpoWidY0JtxLHKhwwMJBTHgPKdEQAACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GAULDJCRiXo1CpGXDJOUjY+Yip9DhToJA4RBLwMLCwVDfRgbBAaqqoZ1XBMHswsHtxtFaH1iqaoGNgAIxRpbFAgfPQSqpbgGBqUD1wBXeCYp1AYZ19JJOYgH1KwA4UBvQwXUBxPqVD9L3sbp2BNk2xvvFPJd+MFCN6HAAIKgNggY0KtEBAAh+QQJCgAAACwAAAAAIAAgAAAE6BDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfYIDMaAFdTESJeaEDAIMxYFqrOUaNW4E4ObYcCXaiBVEgULe0NJaxxtYksjh2NLkZISgDgJhHthkpU4mW6blRiYmZOlh4JWkDqILwUGBnE6TYEbCgevr0N1gH4At7gHiRpFaLNrrq8HNgAJA70AWxQIH1+vsYMDAzZQPC9VCNkDWUhGkuE5PxJNwiUK4UfLzOlD4WvzAHaoG9nxPi5d+jYUqfAhhykOFwJWiAAAIfkECQoAAAAsAAAAACAAIAAABPAQyElpUqnqzaciSoVkXVUMFaFSwlpOCcMYlErAavhOMnNLNo8KsZsMZItJEIDIFSkLGQoQTNhIsFehRww2CQLKF0tYGKYSg+ygsZIuNqJksKgbfgIGepNo2cIUB3V1B3IvNiBYNQaDSTtfhhx0CwVPI0UJe0+bm4g5VgcGoqOcnjmjqDSdnhgEoamcsZuXO1aWQy8KAwOAuTYYGwi7w5h+Kr0SJ8MFihpNbx+4Erq7BYBuzsdiH1jCAzoSfl0rVirNbRXlBBlLX+BP0XJLAPGzTkAuAOqb0WT5AH7OcdCm5B8TgRwSRKIHQtaLCwg1RAAAOwAAAAAAAAAAAA==); +} + +.jvectormap-legend-title { + font-weight: bold; + font-size: 14px; + text-align: center; +} + +.jvectormap-legend-cnt { + position: absolute; +} + +.jvectormap-legend-cnt-h { + bottom: 0; + right: 0; +} + +.jvectormap-legend-cnt-v { + top: 0; + right: 0; +} + +.jvectormap-legend { + background: black; + color: white; + border-radius: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend { + float: left; + margin: 0 10px 10px 0; + padding: 3px 3px 1px 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend .jvectormap-legend-tick { + float: left; +} + +.jvectormap-legend-cnt-v .jvectormap-legend { + margin: 10px 10px 0 0; + padding: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick { + width: 40px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-sample { + height: 15px; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-sample { + height: 20px; + width: 20px; + display: inline-block; + vertical-align: middle; +} + +.jvectormap-legend-tick-text { + font-size: 12px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-text { + text-align: center; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-text { + display: inline-block; + vertical-align: middle; + line-height: 20px; + padding-left: 3px; +} + +/** + * selectize.css (v0.12.4) + * Copyright (c) 2013–2015 Brian Reavis & contributors + * + * Licensed under the Apache License, Version 2.0 (the "License"); you may not use this + * file except in compliance with the License. You may obtain a copy of the License at: + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under + * the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF + * ANY KIND, either express or implied. See the License for the specific language + * governing permissions and limitations under the License. + * + * @author Brian Reavis + */ +.selectize-control.plugin-drag_drop.multi > .selectize-input > div.ui-sortable-placeholder { + visibility: visible !important; + background: #f2f2f2 !important; + background: rgba(0, 0, 0, 0.06) !important; + border: 0 none !important; + box-shadow: inset 0 0 12px 4px #fff; +} + +.selectize-control.plugin-drag_drop .ui-sortable-placeholder::after { + content: '!'; + visibility: hidden; +} + +.selectize-control.plugin-drag_drop .ui-sortable-helper { + box-shadow: 0 2px 5px rgba(0, 0, 0, 0.2); +} + +.selectize-dropdown-header { + position: relative; + padding: 5px 8px; + border-bottom: 1px solid #d0d0d0; + background: #f8f8f8; + border-radius: 3px 3px 0 0; +} + +.selectize-dropdown-header-close { + position: absolute; + right: 8px; + top: 50%; + color: #495057; + opacity: 0.4; + margin-top: -12px; + line-height: 20px; + font-size: 20px !important; +} + +.selectize-dropdown-header-close:hover { + color: #000; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup { + border-right: 1px solid #f2f2f2; + border-top: 0 none; + float: left; + box-sizing: border-box; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:last-child { + border-right: 0 none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:before { + display: none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup-header { + border-top: 0 none; +} + +.selectize-control.plugin-remove_button [data-value] { + position: relative; + padding-right: 24px !important; +} + +.selectize-control.plugin-remove_button [data-value] .remove { + z-index: 1; + /* fixes ie bug (see #392) */ + position: absolute; + top: 0; + right: 0; + bottom: 0; + width: 17px; + text-align: center; + font-weight: bold; + font-size: 12px; + color: inherit; + text-decoration: none; + vertical-align: middle; + display: inline-block; + padding: 2px 0 0 0; + border-left: 1px solid #d0d0d0; + border-radius: 0 2px 2px 0; + box-sizing: border-box; +} + +.selectize-control.plugin-remove_button [data-value] .remove:hover { + background: rgba(0, 0, 0, 0.05); +} + +.selectize-control.plugin-remove_button [data-value].active .remove { + border-left-color: #cacaca; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove:hover { + background: none; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove { + border-left-color: #fff; +} + +.selectize-control.plugin-remove_button .remove-single { + position: absolute; + right: 28px; + top: 6px; + font-size: 23px; +} + +.selectize-control { + position: relative; + padding: 0; + border: 0; +} + +.selectize-dropdown, +.selectize-input, +.selectize-input input { + color: #495057; + font-family: inherit; + font-size: 15px; + line-height: 18px; + -webkit-font-smoothing: inherit; +} + +.selectize-input, +.selectize-control.single .selectize-input.input-active { + background: #fff; + cursor: text; + display: inline-block; +} + +.selectize-input { + border: 1px solid rgba(0, 40, 100, 0.12); + padding: 0.5625rem 0.75rem; + display: inline-block; + display: block; + width: 100%; + overflow: hidden; + position: relative; + z-index: 1; + box-sizing: border-box; + border-radius: 3px; + transition: .3s border-color, .3s box-shadow; +} + +.selectize-control.multi .selectize-input.has-items { + padding: 7px 0.75rem 4px 7px; +} + +.selectize-input.full { + background-color: #fff; +} + +.selectize-input.disabled, +.selectize-input.disabled * { + cursor: default !important; +} + +.selectize-input.focus { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectize-input.dropdown-active { + border-radius: 3px 3px 0 0; +} + +.selectize-input > * { + vertical-align: baseline; + display: -moz-inline-stack; + display: inline-block; + zoom: 1; + *display: inline; +} + +.selectize-control.multi .selectize-input > div { + cursor: pointer; + margin: 0 3px 3px 0; + padding: 2px 6px; + background: #e9ecef; + color: #495057; + font-size: 13px; + border: 0 solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-weight: 400; +} + +.selectize-control.multi .selectize-input > div.active { + background: #e8e8e8; + color: #303030; + border: 0 solid #cacaca; +} + +.selectize-control.multi .selectize-input.disabled > div, +.selectize-control.multi .selectize-input.disabled > div.active { + color: #7d7d7d; + background: #fff; + border: 0 solid #fff; +} + +.selectize-input > input { + display: inline-block !important; + padding: 0 !important; + min-height: 0 !important; + max-height: none !important; + max-width: 100% !important; + margin: 0 2px 0 0 !important; + text-indent: 0 !important; + border: 0 none !important; + background: none !important; + line-height: inherit !important; + box-shadow: none !important; +} + +.selectize-input > input::-ms-clear { + display: none; +} + +.selectize-input > input:focus { + outline: none !important; +} + +.selectize-input::after { + content: ' '; + display: block; + clear: left; +} + +.selectize-input.dropdown-active::before { + content: ' '; + display: block; + position: absolute; + background: #f0f0f0; + height: 1px; + bottom: 0; + left: 0; + right: 0; +} + +.selectize-dropdown { + position: absolute; + z-index: 10; + border: 1px solid rgba(0, 40, 100, 0.12); + background: #fff; + margin: -1px 0 0 0; + border-top: 0 none; + box-sizing: border-box; + border-radius: 0 0 3px 3px; + height: auto; + padding: 0; +} + +.selectize-dropdown [data-selectable] { + cursor: pointer; + overflow: hidden; +} + +.selectize-dropdown [data-selectable] .highlight { + background: rgba(125, 168, 208, 0.2); + border-radius: 1px; +} + +.selectize-dropdown [data-selectable], +.selectize-dropdown .optgroup-header { + padding: 6px .75rem; +} + +.selectize-dropdown .optgroup:first-child .optgroup-header { + border-top: 0 none; +} + +.selectize-dropdown .optgroup-header { + color: #495057; + background: #fff; + cursor: default; +} + +.selectize-dropdown .active { + background-color: #F1F4F8; + color: #467fcf; +} + +.selectize-dropdown .active.create { + color: #495057; +} + +.selectize-dropdown .create { + color: rgba(48, 48, 48, 0.5); +} + +.selectize-dropdown-content { + overflow-y: auto; + overflow-x: hidden; + max-height: 200px; + -webkit-overflow-scrolling: touch; +} + +.selectize-control.single .selectize-input, +.selectize-control.single .selectize-input input { + cursor: pointer; +} + +.selectize-control.single .selectize-input.input-active, +.selectize-control.single .selectize-input.input-active input { + cursor: text; +} + +.selectize-control.single .selectize-input:after { + content: ''; + display: block; + position: absolute; + top: 13px; + right: 12px; + width: 8px; + height: 10px; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat center; + background-size: 8px 10px; + transition: .3s transform; +} + +.selectize-control.single .selectize-input.dropdown-active:after { + -webkit-transform: rotate(180deg); + transform: rotate(180deg); +} + +.selectize-control .selectize-input.disabled { + opacity: 0.5; + background-color: #fafafa; +} + +.selectize-dropdown .image, +.selectize-input .image { + width: 1.25rem; + height: 1.25rem; + background-size: contain; + margin: -1px .5rem -1px -4px; + line-height: 1.25rem; + float: left; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; +} + +.selectize-dropdown .image img, +.selectize-input .image img { + max-width: 100%; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); + border-radius: 2px; +} + +.selectize-input .image { + width: 1.5rem; + height: 1.5rem; + margin: -3px .75rem -3px -5px; +} + +@font-face { + font-family: "feather"; + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106"); + /* IE9*/ + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106#iefix") format("embedded-opentype"), url("../fonts/feather/feather-webfont.woff?t=1501841394106") format("woff"), url("../fonts/feather/feather-webfont.ttf?t=1501841394106") format("truetype"), url("../fonts/feather/feather-webfont.svg?t=1501841394106#feather") format("svg"); + /* iOS 4.1- */ +} + +.fe { + font-family: 'feather' !important; + speak: none; + font-style: normal; + font-weight: normal; + font-variant: normal; + text-transform: none; + line-height: 1; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +.fe-activity:before { + content: "\e900"; +} + +.fe-airplay:before { + content: "\e901"; +} + +.fe-alert-circle:before { + content: "\e902"; +} + +.fe-alert-octagon:before { + content: "\e903"; +} + +.fe-alert-triangle:before { + content: "\e904"; +} + +.fe-align-center:before { + content: "\e905"; +} + +.fe-align-justify:before { + content: "\e906"; +} + +.fe-align-left:before { + content: "\e907"; +} + +.fe-align-right:before { + content: "\e908"; +} + +.fe-anchor:before { + content: "\e909"; +} + +.fe-aperture:before { + content: "\e90a"; +} + +.fe-arrow-down:before { + content: "\e90b"; +} + +.fe-arrow-down-circle:before { + content: "\e90c"; +} + +.fe-arrow-down-left:before { + content: "\e90d"; +} + +.fe-arrow-down-right:before { + content: "\e90e"; +} + +.fe-arrow-left:before { + content: "\e90f"; +} + +.fe-arrow-left-circle:before { + content: "\e910"; +} + +.fe-arrow-right:before { + content: "\e911"; +} + +.fe-arrow-right-circle:before { + content: "\e912"; +} + +.fe-arrow-up:before { + content: "\e913"; +} + +.fe-arrow-up-circle:before { + content: "\e914"; +} + +.fe-arrow-up-left:before { + content: "\e915"; +} + +.fe-arrow-up-right:before { + content: "\e916"; +} + +.fe-at-sign:before { + content: "\e917"; +} + +.fe-award:before { + content: "\e918"; +} + +.fe-bar-chart:before { + content: "\e919"; +} + +.fe-bar-chart-2:before { + content: "\e91a"; +} + +.fe-battery:before { + content: "\e91b"; +} + +.fe-battery-charging:before { + content: "\e91c"; +} + +.fe-bell:before { + content: "\e91d"; +} + +.fe-bell-off:before { + content: "\e91e"; +} + +.fe-bluetooth:before { + content: "\e91f"; +} + +.fe-bold:before { + content: "\e920"; +} + +.fe-book:before { + content: "\e921"; +} + +.fe-book-open:before { + content: "\e922"; +} + +.fe-bookmark:before { + content: "\e923"; +} + +.fe-box:before { + content: "\e924"; +} + +.fe-briefcase:before { + content: "\e925"; +} + +.fe-calendar:before { + content: "\e926"; +} + +.fe-camera:before { + content: "\e927"; +} + +.fe-camera-off:before { + content: "\e928"; +} + +.fe-cast:before { + content: "\e929"; +} + +.fe-check:before { + content: "\e92a"; +} + +.fe-check-circle:before { + content: "\e92b"; +} + +.fe-check-square:before { + content: "\e92c"; +} + +.fe-chevron-down:before { + content: "\e92d"; +} + +.fe-chevron-left:before { + content: "\e92e"; +} + +.fe-chevron-right:before { + content: "\e92f"; +} + +.fe-chevron-up:before { + content: "\e930"; +} + +.fe-chevrons-down:before { + content: "\e931"; +} + +.fe-chevrons-left:before { + content: "\e932"; +} + +.fe-chevrons-right:before { + content: "\e933"; +} + +.fe-chevrons-up:before { + content: "\e934"; +} + +.fe-chrome:before { + content: "\e935"; +} + +.fe-circle:before { + content: "\e936"; +} + +.fe-clipboard:before { + content: "\e937"; +} + +.fe-clock:before { + content: "\e938"; +} + +.fe-cloud:before { + content: "\e939"; +} + +.fe-cloud-drizzle:before { + content: "\e93a"; +} + +.fe-cloud-lightning:before { + content: "\e93b"; +} + +.fe-cloud-off:before { + content: "\e93c"; +} + +.fe-cloud-rain:before { + content: "\e93d"; +} + +.fe-cloud-snow:before { + content: "\e93e"; +} + +.fe-code:before { + content: "\e93f"; +} + +.fe-codepen:before { + content: "\e940"; +} + +.fe-command:before { + content: "\e941"; +} + +.fe-compass:before { + content: "\e942"; +} + +.fe-copy:before { + content: "\e943"; +} + +.fe-corner-down-left:before { + content: "\e944"; +} + +.fe-corner-down-right:before { + content: "\e945"; +} + +.fe-corner-left-down:before { + content: "\e946"; +} + +.fe-corner-left-up:before { + content: "\e947"; +} + +.fe-corner-right-down:before { + content: "\e948"; +} + +.fe-corner-right-up:before { + content: "\e949"; +} + +.fe-corner-up-left:before { + content: "\e94a"; +} + +.fe-corner-up-right:before { + content: "\e94b"; +} + +.fe-cpu:before { + content: "\e94c"; +} + +.fe-credit-card:before { + content: "\e94d"; +} + +.fe-crop:before { + content: "\e94e"; +} + +.fe-crosshair:before { + content: "\e94f"; +} + +.fe-database:before { + content: "\e950"; +} + +.fe-delete:before { + content: "\e951"; +} + +.fe-disc:before { + content: "\e952"; +} + +.fe-dollar-sign:before { + content: "\e953"; +} + +.fe-download:before { + content: "\e954"; +} + +.fe-download-cloud:before { + content: "\e955"; +} + +.fe-droplet:before { + content: "\e956"; +} + +.fe-edit:before { + content: "\e957"; +} + +.fe-edit-2:before { + content: "\e958"; +} + +.fe-edit-3:before { + content: "\e959"; +} + +.fe-external-link:before { + content: "\e95a"; +} + +.fe-eye:before { + content: "\e95b"; +} + +.fe-eye-off:before { + content: "\e95c"; +} + +.fe-facebook:before { + content: "\e95d"; +} + +.fe-fast-forward:before { + content: "\e95e"; +} + +.fe-feather:before { + content: "\e95f"; +} + +.fe-file:before { + content: "\e960"; +} + +.fe-file-minus:before { + content: "\e961"; +} + +.fe-file-plus:before { + content: "\e962"; +} + +.fe-file-text:before { + content: "\e963"; +} + +.fe-film:before { + content: "\e964"; +} + +.fe-filter:before { + content: "\e965"; +} + +.fe-flag:before { + content: "\e966"; +} + +.fe-folder:before { + content: "\e967"; +} + +.fe-folder-minus:before { + content: "\e968"; +} + +.fe-folder-plus:before { + content: "\e969"; +} + +.fe-git-branch:before { + content: "\e96a"; +} + +.fe-git-commit:before { + content: "\e96b"; +} + +.fe-git-merge:before { + content: "\e96c"; +} + +.fe-git-pull-request:before { + content: "\e96d"; +} + +.fe-github:before { + content: "\e96e"; +} + +.fe-gitlab:before { + content: "\e96f"; +} + +.fe-globe:before { + content: "\e970"; +} + +.fe-grid:before { + content: "\e971"; +} + +.fe-hard-drive:before { + content: "\e972"; +} + +.fe-hash:before { + content: "\e973"; +} + +.fe-headphones:before { + content: "\e974"; +} + +.fe-heart:before { + content: "\e975"; +} + +.fe-help-circle:before { + content: "\e976"; +} + +.fe-home:before { + content: "\e977"; +} + +.fe-image:before { + content: "\e978"; +} + +.fe-inbox:before { + content: "\e979"; +} + +.fe-info:before { + content: "\e97a"; +} + +.fe-instagram:before { + content: "\e97b"; +} + +.fe-italic:before { + content: "\e97c"; +} + +.fe-layers:before { + content: "\e97d"; +} + +.fe-layout:before { + content: "\e97e"; +} + +.fe-life-buoy:before { + content: "\e97f"; +} + +.fe-link:before { + content: "\e980"; +} + +.fe-link-2:before { + content: "\e981"; +} + +.fe-linkedin:before { + content: "\e982"; +} + +.fe-list:before { + content: "\e983"; +} + +.fe-loader:before { + content: "\e984"; +} + +.fe-lock:before { + content: "\e985"; +} + +.fe-log-in:before { + content: "\e986"; +} + +.fe-log-out:before { + content: "\e987"; +} + +.fe-mail:before { + content: "\e988"; +} + +.fe-map:before { + content: "\e989"; +} + +.fe-map-pin:before { + content: "\e98a"; +} + +.fe-maximize:before { + content: "\e98b"; +} + +.fe-maximize-2:before { + content: "\e98c"; +} + +.fe-menu:before { + content: "\e98d"; +} + +.fe-message-circle:before { + content: "\e98e"; +} + +.fe-message-square:before { + content: "\e98f"; +} + +.fe-mic:before { + content: "\e990"; +} + +.fe-mic-off:before { + content: "\e991"; +} + +.fe-minimize:before { + content: "\e992"; +} + +.fe-minimize-2:before { + content: "\e993"; +} + +.fe-minus:before { + content: "\e994"; +} + +.fe-minus-circle:before { + content: "\e995"; +} + +.fe-minus-square:before { + content: "\e996"; +} + +.fe-monitor:before { + content: "\e997"; +} + +.fe-moon:before { + content: "\e998"; +} + +.fe-more-horizontal:before { + content: "\e999"; +} + +.fe-more-vertical:before { + content: "\e99a"; +} + +.fe-move:before { + content: "\e99b"; +} + +.fe-music:before { + content: "\e99c"; +} + +.fe-navigation:before { + content: "\e99d"; +} + +.fe-navigation-2:before { + content: "\e99e"; +} + +.fe-octagon:before { + content: "\e99f"; +} + +.fe-package:before { + content: "\e9a0"; +} + +.fe-paperclip:before { + content: "\e9a1"; +} + +.fe-pause:before { + content: "\e9a2"; +} + +.fe-pause-circle:before { + content: "\e9a3"; +} + +.fe-percent:before { + content: "\e9a4"; +} + +.fe-phone:before { + content: "\e9a5"; +} + +.fe-phone-call:before { + content: "\e9a6"; +} + +.fe-phone-forwarded:before { + content: "\e9a7"; +} + +.fe-phone-incoming:before { + content: "\e9a8"; +} + +.fe-phone-missed:before { + content: "\e9a9"; +} + +.fe-phone-off:before { + content: "\e9aa"; +} + +.fe-phone-outgoing:before { + content: "\e9ab"; +} + +.fe-pie-chart:before { + content: "\e9ac"; +} + +.fe-play:before { + content: "\e9ad"; +} + +.fe-play-circle:before { + content: "\e9ae"; +} + +.fe-plus:before { + content: "\e9af"; +} + +.fe-plus-circle:before { + content: "\e9b0"; +} + +.fe-plus-square:before { + content: "\e9b1"; +} + +.fe-pocket:before { + content: "\e9b2"; +} + +.fe-power:before { + content: "\e9b3"; +} + +.fe-printer:before { + content: "\e9b4"; +} + +.fe-radio:before { + content: "\e9b5"; +} + +.fe-refresh-ccw:before { + content: "\e9b6"; +} + +.fe-refresh-cw:before { + content: "\e9b7"; +} + +.fe-repeat:before { + content: "\e9b8"; +} + +.fe-rewind:before { + content: "\e9b9"; +} + +.fe-rotate-ccw:before { + content: "\e9ba"; +} + +.fe-rotate-cw:before { + content: "\e9bb"; +} + +.fe-rss:before { + content: "\e9bc"; +} + +.fe-save:before { + content: "\e9bd"; +} + +.fe-scissors:before { + content: "\e9be"; +} + +.fe-search:before { + content: "\e9bf"; +} + +.fe-send:before { + content: "\e9c0"; +} + +.fe-server:before { + content: "\e9c1"; +} + +.fe-settings:before { + content: "\e9c2"; +} + +.fe-share:before { + content: "\e9c3"; +} + +.fe-share-2:before { + content: "\e9c4"; +} + +.fe-shield:before { + content: "\e9c5"; +} + +.fe-shield-off:before { + content: "\e9c6"; +} + +.fe-shopping-bag:before { + content: "\e9c7"; +} + +.fe-shopping-cart:before { + content: "\e9c8"; +} + +.fe-shuffle:before { + content: "\e9c9"; +} + +.fe-sidebar:before { + content: "\e9ca"; +} + +.fe-skip-back:before { + content: "\e9cb"; +} + +.fe-skip-forward:before { + content: "\e9cc"; +} + +.fe-slack:before { + content: "\e9cd"; +} + +.fe-slash:before { + content: "\e9ce"; +} + +.fe-sliders:before { + content: "\e9cf"; +} + +.fe-smartphone:before { + content: "\e9d0"; +} + +.fe-speaker:before { + content: "\e9d1"; +} + +.fe-square:before { + content: "\e9d2"; +} + +.fe-star:before { + content: "\e9d3"; +} + +.fe-stop-circle:before { + content: "\e9d4"; +} + +.fe-sun:before { + content: "\e9d5"; +} + +.fe-sunrise:before { + content: "\e9d6"; +} + +.fe-sunset:before { + content: "\e9d7"; +} + +.fe-tablet:before { + content: "\e9d8"; +} + +.fe-tag:before { + content: "\e9d9"; +} + +.fe-target:before { + content: "\e9da"; +} + +.fe-terminal:before { + content: "\e9db"; +} + +.fe-thermometer:before { + content: "\e9dc"; +} + +.fe-thumbs-down:before { + content: "\e9dd"; +} + +.fe-thumbs-up:before { + content: "\e9de"; +} + +.fe-toggle-left:before { + content: "\e9df"; +} + +.fe-toggle-right:before { + content: "\e9e0"; +} + +.fe-trash:before { + content: "\e9e1"; +} + +.fe-trash-2:before { + content: "\e9e2"; +} + +.fe-trending-down:before { + content: "\e9e3"; +} + +.fe-trending-up:before { + content: "\e9e4"; +} + +.fe-triangle:before { + content: "\e9e5"; +} + +.fe-truck:before { + content: "\e9e6"; +} + +.fe-tv:before { + content: "\e9e7"; +} + +.fe-twitter:before { + content: "\e9e8"; +} + +.fe-type:before { + content: "\e9e9"; +} + +.fe-umbrella:before { + content: "\e9ea"; +} + +.fe-underline:before { + content: "\e9eb"; +} + +.fe-unlock:before { + content: "\e9ec"; +} + +.fe-upload:before { + content: "\e9ed"; +} + +.fe-upload-cloud:before { + content: "\e9ee"; +} + +.fe-user:before { + content: "\e9ef"; +} + +.fe-user-check:before { + content: "\e9f0"; +} + +.fe-user-minus:before { + content: "\e9f1"; +} + +.fe-user-plus:before { + content: "\e9f2"; +} + +.fe-user-x:before { + content: "\e9f3"; +} + +.fe-users:before { + content: "\e9f4"; +} + +.fe-video:before { + content: "\e9f5"; +} + +.fe-video-off:before { + content: "\e9f6"; +} + +.fe-voicemail:before { + content: "\e9f7"; +} + +.fe-volume:before { + content: "\e9f8"; +} + +.fe-volume-1:before { + content: "\e9f9"; +} + +.fe-volume-2:before { + content: "\e9fa"; +} + +.fe-volume-x:before { + content: "\e9fb"; +} + +.fe-watch:before { + content: "\e9fc"; +} + +.fe-wifi:before { + content: "\e9fd"; +} + +.fe-wifi-off:before { + content: "\e9fe"; +} + +.fe-wind:before { + content: "\e9ff"; +} + +.fe-x:before { + content: "\ea00"; +} + +.fe-x-circle:before { + content: "\ea01"; +} + +.fe-x-square:before { + content: "\ea02"; +} + +.fe-zap:before { + content: "\ea03"; +} + +.fe-zap-off:before { + content: "\ea04"; +} + +.fe-zoom-in:before { + content: "\ea05"; +} + +.fe-zoom-out:before { + content: "\ea06"; +} diff --git a/public/v2/assets/css/tabler.rtl.css b/public/v2/assets/css/tabler.rtl.css new file mode 100755 index 0000000000..825506ec93 --- /dev/null +++ b/public/v2/assets/css/tabler.rtl.css @@ -0,0 +1,18610 @@ +@charset "UTF-8"; +/** +Dashboard UI + */ +/*! + * Bootstrap v4.1.0 (https://getbootstrap.com/) + * Copyright 2011-2018 The Bootstrap Authors + * Copyright 2011-2018 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +:root { + --blue: #467fcf; + --indigo: #6574cd; + --purple: #a55eea; + --pink: #f66d9b; + --red: #cd201f; + --orange: #fd9644; + --yellow: #f1c40f; + --green: #5eba00; + --teal: #2bcbba; + --cyan: #17a2b8; + --white: #fff; + --gray: #868e96; + --gray-dark: #343a40; + --azure: #45aaf2; + --lime: #7bd235; + --primary: #467fcf; + --secondary: #868e96; + --success: #5eba00; + --info: #45aaf2; + --warning: #f1c40f; + --danger: #cd201f; + --light: #f8f9fa; + --dark: #343a40; + --breakpoint-xs: 0; + --breakpoint-sm: 576px; + --breakpoint-md: 768px; + --breakpoint-lg: 992px; + --breakpoint-xl: 1280px; + --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol"; + --font-family-monospace: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +*, +*::before, +*::after { + box-sizing: border-box; +} + +html { + font-family: sans-serif; + line-height: 1.15; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; + -ms-overflow-style: scrollbar; + -webkit-tap-highlight-color: transparent; +} + +@-ms-viewport { + width: device-width; +} + +article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section { + display: block; +} + +body { + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.5; + color: #495057; + text-align: right; + background-color: #f5f7fb; +} + +[tabindex="-1"]:focus { + outline: 0 !important; +} + +hr { + box-sizing: content-box; + height: 0; + overflow: visible; +} + +h1, h2, h3, h4, h5, h6 { + margin-top: 0; + margin-bottom: 0.66em; +} + +p { + margin-top: 0; + margin-bottom: 1rem; +} + +abbr[title], +abbr[data-original-title] { + text-decoration: underline; + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; + cursor: help; + border-bottom: 0; +} + +address { + margin-bottom: 1rem; + font-style: normal; + line-height: inherit; +} + +ol, +ul, +dl { + margin-top: 0; + margin-bottom: 1rem; +} + +ol ol, +ul ul, +ol ul, +ul ol { + margin-bottom: 0; +} + +dt { + font-weight: 700; +} + +dd { + margin-bottom: .5rem; + margin-right: 0; +} + +blockquote { + margin: 0 0 1rem; +} + +dfn { + font-style: italic; +} + +b, +strong { + font-weight: bolder; +} + +small { + font-size: 80%; +} + +sub, +sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} + +sub { + bottom: -.25em; +} + +sup { + top: -.5em; +} + +a { + color: #467fcf; + text-decoration: none; + background-color: transparent; + -webkit-text-decoration-skip: objects; +} + +a:hover { + color: #295a9f; + text-decoration: underline; +} + +a:not([href]):not([tabindex]) { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):focus { + outline: 0; +} + +pre, +code, +kbd, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +pre { + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + -ms-overflow-style: scrollbar; +} + +figure { + margin: 0 0 1rem; +} + +img { + vertical-align: middle; + border-style: none; +} + +svg:not(:root) { + overflow: hidden; +} + +table { + border-collapse: collapse; +} + +caption { + padding-top: 0.75rem; + padding-bottom: 0.75rem; + color: #9aa0ac; + text-align: right; + caption-side: bottom; +} + +th { + text-align: inherit; +} + +label { + display: inline-block; + margin-bottom: 0.5rem; +} + +button { + border-radius: 0; +} + +button:focus { + outline: 1px dotted; + outline: 5px auto -webkit-focus-ring-color; +} + +input, +button, +select, +optgroup, +textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height: inherit; +} + +button, +input { + overflow: visible; +} + +button, +select { + text-transform: none; +} + +button, +html [type="button"], +[type="reset"], +[type="submit"] { + -webkit-appearance: button; +} + +button::-moz-focus-inner, +[type="button"]::-moz-focus-inner, +[type="reset"]::-moz-focus-inner, +[type="submit"]::-moz-focus-inner { + padding: 0; + border-style: none; +} + +input[type="radio"], +input[type="checkbox"] { + box-sizing: border-box; + padding: 0; +} + +input[type="date"], +input[type="time"], +input[type="datetime-local"], +input[type="month"] { + -webkit-appearance: listbox; +} + +textarea { + overflow: auto; + resize: vertical; +} + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; +} + +legend { + display: block; + width: 100%; + max-width: 100%; + padding: 0; + margin-bottom: .5rem; + font-size: 1.5rem; + line-height: inherit; + color: inherit; + white-space: normal; +} + +progress { + vertical-align: baseline; +} + +[type="number"]::-webkit-inner-spin-button, +[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +[type="search"] { + outline-offset: -2px; + -webkit-appearance: none; +} + +[type="search"]::-webkit-search-cancel-button, +[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +::-webkit-file-upload-button { + font: inherit; + -webkit-appearance: button; +} + +output { + display: inline-block; +} + +summary { + display: list-item; + cursor: pointer; +} + +template { + display: none; +} + +[hidden] { + display: none !important; +} + +h1, h2, h3, h4, h5, h6, +.h1, .h2, .h3, .h4, .h5, .h6 { + margin-bottom: 0.66em; + font-family: inherit; + font-weight: 600; + line-height: 1.1; + color: inherit; +} + +h1, .h1 { + font-size: 2rem; +} + +h2, .h2 { + font-size: 1.75rem; +} + +h3, .h3 { + font-size: 1.5rem; +} + +h4, .h4 { + font-size: 1.125rem; +} + +h5, .h5 { + font-size: 1rem; +} + +h6, .h6 { + font-size: 0.875rem; +} + +.lead { + font-size: 1.171875rem; + font-weight: 300; +} + +.display-1 { + font-size: 4.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-2 { + font-size: 4rem; + font-weight: 300; + line-height: 1.1; +} + +.display-3 { + font-size: 3.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-4 { + font-size: 3rem; + font-weight: 300; + line-height: 1.1; +} + +hr { + margin-top: 1rem; + margin-bottom: 1rem; + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +small, +.small { + font-size: 87.5%; + font-weight: 400; +} + +mark, +.mark { + padding: 0.2em; + background-color: #fcf8e3; +} + +.list-unstyled { + padding-right: 0; + list-style: none; +} + +.list-inline { + padding-right: 0; + list-style: none; +} + +.list-inline-item { + display: inline-block; +} + +.list-inline-item:not(:last-child) { + margin-left: 0.5rem; +} + +.initialism { + font-size: 90%; + text-transform: uppercase; +} + +.blockquote { + margin-bottom: 1rem; + font-size: 1.171875rem; +} + +.blockquote-footer { + display: block; + font-size: 80%; + color: #868e96; +} + +.blockquote-footer::before { + content: "\2014 \00A0"; +} + +.img-fluid { + max-width: 100%; + height: auto; +} + +.img-thumbnail { + padding: 0.25rem; + background-color: #fff; + border: 1px solid #dee2e6; + border-radius: 3px; + max-width: 100%; + height: auto; +} + +.figure { + display: inline-block; +} + +.figure-img { + margin-bottom: 0.5rem; + line-height: 1; +} + +.figure-caption { + font-size: 90%; + color: #868e96; +} + +code, +kbd, +pre, +samp { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +code { + font-size: 85%; + color: inherit; + word-break: break-word; +} + +a > code { + color: inherit; +} + +kbd { + padding: 0.2rem 0.4rem; + font-size: 85%; + color: #fff; + background-color: #343a40; + border-radius: 3px; +} + +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: 700; +} + +pre { + display: block; + font-size: 85%; + color: #212529; +} + +pre code { + font-size: inherit; + color: inherit; + word-break: normal; +} + +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} + +.container { + width: 100%; + padding-left: 0.75rem; + padding-right: 0.75rem; + margin-left: auto; + margin-right: auto; +} + +@media (min-width: 576px) { + .container { + max-width: 540px; + } +} + +@media (min-width: 768px) { + .container { + max-width: 720px; + } +} + +@media (min-width: 992px) { + .container { + max-width: 960px; + } +} + +@media (min-width: 1280px) { + .container { + max-width: 1200px; + } +} + +.container-fluid { + width: 100%; + padding-left: 0.75rem; + padding-right: 0.75rem; + margin-left: auto; + margin-right: auto; +} + +.row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-left: -0.75rem; + margin-right: -0.75rem; +} + +.no-gutters { + margin-left: 0; + margin-right: 0; +} + +.no-gutters > .col, +.no-gutters > [class*="col-"] { + padding-left: 0; + padding-right: 0; +} + +.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col, +.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm, +.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md, +.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg, +.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl, +.col-xl-auto { + position: relative; + width: 100%; + min-height: 1px; + padding-left: 0.75rem; + padding-right: 0.75rem; +} + +.col { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; +} + +.col-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; +} + +.col-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; +} + +.col-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; +} + +.col-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; +} + +.col-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; +} + +.col-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; +} + +.col-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; +} + +.col-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; +} + +.col-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; +} + +.col-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; +} + +.col-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; +} + +.col-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; +} + +.col-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; +} + +.order-first { + -ms-flex-order: -1; + order: -1; +} + +.order-last { + -ms-flex-order: 13; + order: 13; +} + +.order-0 { + -ms-flex-order: 0; + order: 0; +} + +.order-1 { + -ms-flex-order: 1; + order: 1; +} + +.order-2 { + -ms-flex-order: 2; + order: 2; +} + +.order-3 { + -ms-flex-order: 3; + order: 3; +} + +.order-4 { + -ms-flex-order: 4; + order: 4; +} + +.order-5 { + -ms-flex-order: 5; + order: 5; +} + +.order-6 { + -ms-flex-order: 6; + order: 6; +} + +.order-7 { + -ms-flex-order: 7; + order: 7; +} + +.order-8 { + -ms-flex-order: 8; + order: 8; +} + +.order-9 { + -ms-flex-order: 9; + order: 9; +} + +.order-10 { + -ms-flex-order: 10; + order: 10; +} + +.order-11 { + -ms-flex-order: 11; + order: 11; +} + +.order-12 { + -ms-flex-order: 12; + order: 12; +} + +.offset-1 { + margin-right: 8.33333333%; +} + +.offset-2 { + margin-right: 16.66666667%; +} + +.offset-3 { + margin-right: 25%; +} + +.offset-4 { + margin-right: 33.33333333%; +} + +.offset-5 { + margin-right: 41.66666667%; +} + +.offset-6 { + margin-right: 50%; +} + +.offset-7 { + margin-right: 58.33333333%; +} + +.offset-8 { + margin-right: 66.66666667%; +} + +.offset-9 { + margin-right: 75%; +} + +.offset-10 { + margin-right: 83.33333333%; +} + +.offset-11 { + margin-right: 91.66666667%; +} + +@media (min-width: 576px) { + .col-sm { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-sm-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-sm-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-sm-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-sm-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-sm-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-sm-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-sm-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-sm-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-sm-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-sm-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-sm-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-sm-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-sm-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-sm-first { + -ms-flex-order: -1; + order: -1; + } + .order-sm-last { + -ms-flex-order: 13; + order: 13; + } + .order-sm-0 { + -ms-flex-order: 0; + order: 0; + } + .order-sm-1 { + -ms-flex-order: 1; + order: 1; + } + .order-sm-2 { + -ms-flex-order: 2; + order: 2; + } + .order-sm-3 { + -ms-flex-order: 3; + order: 3; + } + .order-sm-4 { + -ms-flex-order: 4; + order: 4; + } + .order-sm-5 { + -ms-flex-order: 5; + order: 5; + } + .order-sm-6 { + -ms-flex-order: 6; + order: 6; + } + .order-sm-7 { + -ms-flex-order: 7; + order: 7; + } + .order-sm-8 { + -ms-flex-order: 8; + order: 8; + } + .order-sm-9 { + -ms-flex-order: 9; + order: 9; + } + .order-sm-10 { + -ms-flex-order: 10; + order: 10; + } + .order-sm-11 { + -ms-flex-order: 11; + order: 11; + } + .order-sm-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-sm-0 { + margin-right: 0; + } + .offset-sm-1 { + margin-right: 8.33333333%; + } + .offset-sm-2 { + margin-right: 16.66666667%; + } + .offset-sm-3 { + margin-right: 25%; + } + .offset-sm-4 { + margin-right: 33.33333333%; + } + .offset-sm-5 { + margin-right: 41.66666667%; + } + .offset-sm-6 { + margin-right: 50%; + } + .offset-sm-7 { + margin-right: 58.33333333%; + } + .offset-sm-8 { + margin-right: 66.66666667%; + } + .offset-sm-9 { + margin-right: 75%; + } + .offset-sm-10 { + margin-right: 83.33333333%; + } + .offset-sm-11 { + margin-right: 91.66666667%; + } +} + +@media (min-width: 768px) { + .col-md { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-md-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-md-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-md-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-md-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-md-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-md-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-md-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-md-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-md-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-md-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-md-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-md-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-md-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-md-first { + -ms-flex-order: -1; + order: -1; + } + .order-md-last { + -ms-flex-order: 13; + order: 13; + } + .order-md-0 { + -ms-flex-order: 0; + order: 0; + } + .order-md-1 { + -ms-flex-order: 1; + order: 1; + } + .order-md-2 { + -ms-flex-order: 2; + order: 2; + } + .order-md-3 { + -ms-flex-order: 3; + order: 3; + } + .order-md-4 { + -ms-flex-order: 4; + order: 4; + } + .order-md-5 { + -ms-flex-order: 5; + order: 5; + } + .order-md-6 { + -ms-flex-order: 6; + order: 6; + } + .order-md-7 { + -ms-flex-order: 7; + order: 7; + } + .order-md-8 { + -ms-flex-order: 8; + order: 8; + } + .order-md-9 { + -ms-flex-order: 9; + order: 9; + } + .order-md-10 { + -ms-flex-order: 10; + order: 10; + } + .order-md-11 { + -ms-flex-order: 11; + order: 11; + } + .order-md-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-md-0 { + margin-right: 0; + } + .offset-md-1 { + margin-right: 8.33333333%; + } + .offset-md-2 { + margin-right: 16.66666667%; + } + .offset-md-3 { + margin-right: 25%; + } + .offset-md-4 { + margin-right: 33.33333333%; + } + .offset-md-5 { + margin-right: 41.66666667%; + } + .offset-md-6 { + margin-right: 50%; + } + .offset-md-7 { + margin-right: 58.33333333%; + } + .offset-md-8 { + margin-right: 66.66666667%; + } + .offset-md-9 { + margin-right: 75%; + } + .offset-md-10 { + margin-right: 83.33333333%; + } + .offset-md-11 { + margin-right: 91.66666667%; + } +} + +@media (min-width: 992px) { + .col-lg { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-lg-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-lg-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-lg-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-lg-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-lg-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-lg-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-lg-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-lg-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-lg-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-lg-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-lg-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-lg-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-lg-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-lg-first { + -ms-flex-order: -1; + order: -1; + } + .order-lg-last { + -ms-flex-order: 13; + order: 13; + } + .order-lg-0 { + -ms-flex-order: 0; + order: 0; + } + .order-lg-1 { + -ms-flex-order: 1; + order: 1; + } + .order-lg-2 { + -ms-flex-order: 2; + order: 2; + } + .order-lg-3 { + -ms-flex-order: 3; + order: 3; + } + .order-lg-4 { + -ms-flex-order: 4; + order: 4; + } + .order-lg-5 { + -ms-flex-order: 5; + order: 5; + } + .order-lg-6 { + -ms-flex-order: 6; + order: 6; + } + .order-lg-7 { + -ms-flex-order: 7; + order: 7; + } + .order-lg-8 { + -ms-flex-order: 8; + order: 8; + } + .order-lg-9 { + -ms-flex-order: 9; + order: 9; + } + .order-lg-10 { + -ms-flex-order: 10; + order: 10; + } + .order-lg-11 { + -ms-flex-order: 11; + order: 11; + } + .order-lg-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-lg-0 { + margin-right: 0; + } + .offset-lg-1 { + margin-right: 8.33333333%; + } + .offset-lg-2 { + margin-right: 16.66666667%; + } + .offset-lg-3 { + margin-right: 25%; + } + .offset-lg-4 { + margin-right: 33.33333333%; + } + .offset-lg-5 { + margin-right: 41.66666667%; + } + .offset-lg-6 { + margin-right: 50%; + } + .offset-lg-7 { + margin-right: 58.33333333%; + } + .offset-lg-8 { + margin-right: 66.66666667%; + } + .offset-lg-9 { + margin-right: 75%; + } + .offset-lg-10 { + margin-right: 83.33333333%; + } + .offset-lg-11 { + margin-right: 91.66666667%; + } +} + +@media (min-width: 1280px) { + .col-xl { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-xl-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-xl-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-xl-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-xl-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-xl-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-xl-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-xl-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-xl-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-xl-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-xl-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-xl-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-xl-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-xl-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-xl-first { + -ms-flex-order: -1; + order: -1; + } + .order-xl-last { + -ms-flex-order: 13; + order: 13; + } + .order-xl-0 { + -ms-flex-order: 0; + order: 0; + } + .order-xl-1 { + -ms-flex-order: 1; + order: 1; + } + .order-xl-2 { + -ms-flex-order: 2; + order: 2; + } + .order-xl-3 { + -ms-flex-order: 3; + order: 3; + } + .order-xl-4 { + -ms-flex-order: 4; + order: 4; + } + .order-xl-5 { + -ms-flex-order: 5; + order: 5; + } + .order-xl-6 { + -ms-flex-order: 6; + order: 6; + } + .order-xl-7 { + -ms-flex-order: 7; + order: 7; + } + .order-xl-8 { + -ms-flex-order: 8; + order: 8; + } + .order-xl-9 { + -ms-flex-order: 9; + order: 9; + } + .order-xl-10 { + -ms-flex-order: 10; + order: 10; + } + .order-xl-11 { + -ms-flex-order: 11; + order: 11; + } + .order-xl-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-xl-0 { + margin-right: 0; + } + .offset-xl-1 { + margin-right: 8.33333333%; + } + .offset-xl-2 { + margin-right: 16.66666667%; + } + .offset-xl-3 { + margin-right: 25%; + } + .offset-xl-4 { + margin-right: 33.33333333%; + } + .offset-xl-5 { + margin-right: 41.66666667%; + } + .offset-xl-6 { + margin-right: 50%; + } + .offset-xl-7 { + margin-right: 58.33333333%; + } + .offset-xl-8 { + margin-right: 66.66666667%; + } + .offset-xl-9 { + margin-right: 75%; + } + .offset-xl-10 { + margin-right: 83.33333333%; + } + .offset-xl-11 { + margin-right: 91.66666667%; + } +} + +.table, .text-wrap table { + width: 100%; + max-width: 100%; + margin-bottom: 1rem; + background-color: transparent; +} + +.table th, .text-wrap table th, +.table td, +.text-wrap table td { + padding: 0.75rem; + vertical-align: top; + border-top: 1px solid #dee2e6; +} + +.table thead th, .text-wrap table thead th { + vertical-align: bottom; + border-bottom: 2px solid #dee2e6; +} + +.table tbody + tbody, .text-wrap table tbody + tbody { + border-top: 2px solid #dee2e6; +} + +.table .table, .text-wrap table .table, .table .text-wrap table, .text-wrap .table table, .text-wrap table table { + background-color: #f5f7fb; +} + +.table-sm th, +.table-sm td { + padding: 0.3rem; +} + +.table-bordered, .text-wrap table { + border: 1px solid #dee2e6; +} + +.table-bordered th, .text-wrap table th, +.table-bordered td, +.text-wrap table td { + border: 1px solid #dee2e6; +} + +.table-bordered thead th, .text-wrap table thead th, +.table-bordered thead td, +.text-wrap table thead td { + border-bottom-width: 2px; +} + +.table-borderless th, +.table-borderless td, +.table-borderless thead th, +.table-borderless tbody + tbody { + border: 0; +} + +.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-hover tbody tr:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-primary, +.table-primary > th, +.table-primary > td { + background-color: #cbdbf2; +} + +.table-hover .table-primary:hover { + background-color: #b7cded; +} + +.table-hover .table-primary:hover > td, +.table-hover .table-primary:hover > th { + background-color: #b7cded; +} + +.table-secondary, +.table-secondary > th, +.table-secondary > td { + background-color: #dddfe2; +} + +.table-hover .table-secondary:hover { + background-color: #cfd2d6; +} + +.table-hover .table-secondary:hover > td, +.table-hover .table-secondary:hover > th { + background-color: #cfd2d6; +} + +.table-success, +.table-success > th, +.table-success > td { + background-color: #d2ecb8; +} + +.table-hover .table-success:hover { + background-color: #c5e7a4; +} + +.table-hover .table-success:hover > td, +.table-hover .table-success:hover > th { + background-color: #c5e7a4; +} + +.table-info, +.table-info > th, +.table-info > td { + background-color: #cbe7fb; +} + +.table-hover .table-info:hover { + background-color: #b3dcf9; +} + +.table-hover .table-info:hover > td, +.table-hover .table-info:hover > th { + background-color: #b3dcf9; +} + +.table-warning, +.table-warning > th, +.table-warning > td { + background-color: #fbeebc; +} + +.table-hover .table-warning:hover { + background-color: #fae8a4; +} + +.table-hover .table-warning:hover > td, +.table-hover .table-warning:hover > th { + background-color: #fae8a4; +} + +.table-danger, +.table-danger > th, +.table-danger > td { + background-color: #f1c1c0; +} + +.table-hover .table-danger:hover { + background-color: #ecacab; +} + +.table-hover .table-danger:hover > td, +.table-hover .table-danger:hover > th { + background-color: #ecacab; +} + +.table-light, +.table-light > th, +.table-light > td { + background-color: #fdfdfe; +} + +.table-hover .table-light:hover { + background-color: #ececf6; +} + +.table-hover .table-light:hover > td, +.table-hover .table-light:hover > th { + background-color: #ececf6; +} + +.table-dark, +.table-dark > th, +.table-dark > td { + background-color: #c6c8ca; +} + +.table-hover .table-dark:hover { + background-color: #b9bbbe; +} + +.table-hover .table-dark:hover > td, +.table-hover .table-dark:hover > th { + background-color: #b9bbbe; +} + +.table-active, +.table-active > th, +.table-active > td { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover > td, +.table-hover .table-active:hover > th { + background-color: rgba(0, 0, 0, 0.04); +} + +.table .thead-dark th, .text-wrap table .thead-dark th { + color: #f5f7fb; + background-color: #212529; + border-color: #32383e; +} + +.table .thead-light th, .text-wrap table .thead-light th { + color: #495057; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.table-dark { + color: #f5f7fb; + background-color: #212529; +} + +.table-dark th, +.table-dark td, +.table-dark thead th { + border-color: #32383e; +} + +.table-dark.table-bordered, .text-wrap table.table-dark { + border: 0; +} + +.table-dark.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(255, 255, 255, 0.05); +} + +.table-dark.table-hover tbody tr:hover { + background-color: rgba(255, 255, 255, 0.075); +} + +@media (max-width: 575.98px) { + .table-responsive-sm { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-sm > .table-bordered, .text-wrap .table-responsive-sm > table { + border: 0; + } +} + +@media (max-width: 767.98px) { + .table-responsive-md { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-md > .table-bordered, .text-wrap .table-responsive-md > table { + border: 0; + } +} + +@media (max-width: 991.98px) { + .table-responsive-lg { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-lg > .table-bordered, .text-wrap .table-responsive-lg > table { + border: 0; + } +} + +@media (max-width: 1279.98px) { + .table-responsive-xl { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-xl > .table-bordered, .text-wrap .table-responsive-xl > table { + border: 0; + } +} + +.table-responsive { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; +} + +.table-responsive > .table-bordered, .text-wrap .table-responsive > table { + border: 0; +} + +.form-control { + display: block; + width: 100%; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.6; + color: #495057; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .form-control { + transition: none; + } +} + +.form-control::-ms-expand { + background-color: transparent; + border: 0; +} + +.form-control:focus { + color: #495057; + background-color: #fff; + border-color: #1991eb; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.form-control::-webkit-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-moz-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:disabled, .form-control[readonly] { + background-color: #f8f9fa; + opacity: 1; +} + +select.form-control:not([size]):not([multiple]) { + height: 2.375rem; +} + +select.form-control:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.form-control-file, +.form-control-range { + display: block; + width: 100%; +} + +.col-form-label { + padding-top: calc(0.375rem + 1px); + padding-bottom: calc(0.375rem + 1px); + margin-bottom: 0; + font-size: inherit; + line-height: 1.6; +} + +.col-form-label-lg { + padding-top: calc(0.5rem + 1px); + padding-bottom: calc(0.5rem + 1px); + font-size: 1.125rem; + line-height: 1.44444444; +} + +.col-form-label-sm { + padding-top: calc(0.25rem + 1px); + padding-bottom: calc(0.25rem + 1px); + font-size: 0.875rem; + line-height: 1.14285714; +} + +.form-control-plaintext { + display: block; + width: 100%; + padding-top: 0.375rem; + padding-bottom: 0.375rem; + margin-bottom: 0; + line-height: 1.6; + color: #495057; + background-color: transparent; + border: solid transparent; + border-width: 1px 0; +} + +.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control, +.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-prepend > .form-control-plaintext.btn, +.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control, +.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-prepend > .form-control-plaintext.btn, +.input-group-lg > .input-group-append > .form-control-plaintext.btn { + padding-left: 0; + padding-right: 0; +} + +.form-control-sm, .input-group-sm > .form-control, +.input-group-sm > .input-group-prepend > .input-group-text, +.input-group-sm > .input-group-append > .input-group-text, +.input-group-sm > .input-group-prepend > .btn, +.input-group-sm > .input-group-append > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.14285714; + border-radius: 3px; +} + +select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(1.8125rem + 2px); +} + +.form-control-lg, .input-group-lg > .form-control, +.input-group-lg > .input-group-prepend > .input-group-text, +.input-group-lg > .input-group-append > .input-group-text, +.input-group-lg > .input-group-prepend > .btn, +.input-group-lg > .input-group-append > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.44444444; + border-radius: 3px; +} + +select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(2.6875rem + 2px); +} + +.form-group { + margin-bottom: 1rem; +} + +.form-text { + display: block; + margin-top: 0.25rem; +} + +.form-row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-left: -5px; + margin-right: -5px; +} + +.form-row > .col, +.form-row > [class*="col-"] { + padding-left: 5px; + padding-right: 5px; +} + +.form-check { + position: relative; + display: block; + padding-right: 1.25rem; +} + +.form-check-input { + position: absolute; + margin-top: 0.3rem; + margin-right: -1.25rem; +} + +.form-check-input:disabled ~ .form-check-label { + color: #9aa0ac; +} + +.form-check-label { + margin-bottom: 0; +} + +.form-check-inline { + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + padding-right: 0; + margin-left: 0.75rem; +} + +.form-check-inline .form-check-input { + position: static; + margin-top: 0; + margin-left: 0.3125rem; + margin-right: 0; +} + +.valid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #5eba00; +} + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(94, 186, 0, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:valid, .form-control.is-valid, .was-validated +.custom-select:valid, +.custom-select.is-valid { + border-color: #5eba00; +} + +.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated +.custom-select:valid:focus, +.custom-select.is-valid:focus { + border-color: #5eba00; + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .form-control:valid ~ .valid-feedback, +.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback, +.form-control.is-valid ~ .valid-tooltip, .was-validated +.custom-select:valid ~ .valid-feedback, +.was-validated +.custom-select:valid ~ .valid-tooltip, +.custom-select.is-valid ~ .valid-feedback, +.custom-select.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { + color: #5eba00; +} + +.was-validated .form-check-input:valid ~ .valid-feedback, +.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback, +.form-check-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label { + color: #5eba00; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before { + background-color: #9eff3b; +} + +.was-validated .custom-control-input:valid ~ .valid-feedback, +.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback, +.custom-control-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before { + background-color: #78ed00; +} + +.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label { + border-color: #5eba00; +} + +.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:valid ~ .valid-feedback, +.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback, +.custom-file-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.invalid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #cd201f; +} + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(205, 32, 31, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated +.custom-select:invalid, +.custom-select.is-invalid { + border-color: #cd201f; +} + +.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated +.custom-select:invalid:focus, +.custom-select.is-invalid:focus { + border-color: #cd201f; + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .form-control:invalid ~ .invalid-feedback, +.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback, +.form-control.is-invalid ~ .invalid-tooltip, .was-validated +.custom-select:invalid ~ .invalid-feedback, +.was-validated +.custom-select:invalid ~ .invalid-tooltip, +.custom-select.is-invalid ~ .invalid-feedback, +.custom-select.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { + color: #cd201f; +} + +.was-validated .form-check-input:invalid ~ .invalid-feedback, +.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback, +.form-check-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label { + color: #cd201f; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before { + background-color: #ec8080; +} + +.was-validated .custom-control-input:invalid ~ .invalid-feedback, +.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback, +.custom-control-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before { + background-color: #e23e3d; +} + +.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label { + border-color: #cd201f; +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:invalid ~ .invalid-feedback, +.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback, +.custom-file-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.form-inline { + display: -ms-flexbox; + display: flex; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; +} + +.form-inline .form-check { + width: 100%; +} + +@media (min-width: 576px) { + .form-inline label { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + margin-bottom: 0; + } + .form-inline .form-group { + display: -ms-flexbox; + display: flex; + -ms-flex: 0 0 auto; + flex: 0 0 auto; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; + margin-bottom: 0; + } + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .form-inline .form-control-plaintext { + display: inline-block; + } + .form-inline .input-group, + .form-inline .custom-select { + width: auto; + } + .form-inline .form-check { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: auto; + padding-right: 0; + } + .form-inline .form-check-input { + position: relative; + margin-top: 0; + margin-left: 0.25rem; + margin-right: 0; + } + .form-inline .custom-control { + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + } + .form-inline .custom-control-label { + margin-bottom: 0; + } +} + +.btn { + display: inline-block; + font-weight: 400; + text-align: center; + white-space: nowrap; + vertical-align: middle; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + border: 1px solid transparent; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.84615385; + border-radius: 3px; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +@media screen and (prefers-reduced-motion: reduce) { + .btn { + transition: none; + } +} + +.btn:hover, .btn:focus { + text-decoration: none; +} + +.btn:focus, .btn.focus { + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.btn.disabled, .btn:disabled { + opacity: 0.65; +} + +.btn:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active { + background-image: none; +} + +a.btn.disabled, +fieldset:disabled a.btn { + pointer-events: none; +} + +.btn-primary { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-primary:focus, .btn-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-primary.disabled, .btn-primary:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, +.show > .btn-primary.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-secondary { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-success { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-success:focus, .btn-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-success.disabled, .btn-success:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, +.show > .btn-success.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-info { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-info:focus, .btn-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-info.disabled, .btn-info:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, +.show > .btn-info.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-warning { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-warning:focus, .btn-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-warning.disabled, .btn-warning:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, +.show > .btn-warning.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-danger { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-danger:focus, .btn-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-danger.disabled, .btn-danger:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, +.show > .btn-danger.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-light { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:hover { + color: #495057; + background-color: #e2e6ea; + border-color: #dae0e5; +} + +.btn-light:focus, .btn-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-light.disabled, .btn-light:disabled { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, +.show > .btn-light.dropdown-toggle { + color: #495057; + background-color: #dae0e5; + border-color: #d3d9df; +} + +.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-dark:focus, .btn-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-dark.disabled, .btn-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, +.show > .btn-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-primary { + color: #467fcf; + background-color: transparent; + background-image: none; + border-color: #467fcf; +} + +.btn-outline-primary:hover { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:focus, .btn-outline-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-primary.disabled, .btn-outline-primary:disabled { + color: #467fcf; + background-color: transparent; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, +.show > .btn-outline-primary.dropdown-toggle { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-secondary { + color: #868e96; + background-color: transparent; + background-image: none; + border-color: #868e96; +} + +.btn-outline-secondary:hover { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:focus, .btn-outline-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-secondary.disabled, .btn-outline-secondary:disabled { + color: #868e96; + background-color: transparent; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, +.show > .btn-outline-secondary.dropdown-toggle { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-success { + color: #5eba00; + background-color: transparent; + background-image: none; + border-color: #5eba00; +} + +.btn-outline-success:hover { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:focus, .btn-outline-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-success.disabled, .btn-outline-success:disabled { + color: #5eba00; + background-color: transparent; +} + +.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, +.show > .btn-outline-success.dropdown-toggle { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-info { + color: #45aaf2; + background-color: transparent; + background-image: none; + border-color: #45aaf2; +} + +.btn-outline-info:hover { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:focus, .btn-outline-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-info.disabled, .btn-outline-info:disabled { + color: #45aaf2; + background-color: transparent; +} + +.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, +.show > .btn-outline-info.dropdown-toggle { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-warning { + color: #f1c40f; + background-color: transparent; + background-image: none; + border-color: #f1c40f; +} + +.btn-outline-warning:hover { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:focus, .btn-outline-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-warning.disabled, .btn-outline-warning:disabled { + color: #f1c40f; + background-color: transparent; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, +.show > .btn-outline-warning.dropdown-toggle { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-danger { + color: #cd201f; + background-color: transparent; + background-image: none; + border-color: #cd201f; +} + +.btn-outline-danger:hover { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:focus, .btn-outline-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-danger.disabled, .btn-outline-danger:disabled { + color: #cd201f; + background-color: transparent; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, +.show > .btn-outline-danger.dropdown-toggle { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-light { + color: #f8f9fa; + background-color: transparent; + background-image: none; + border-color: #f8f9fa; +} + +.btn-outline-light:hover { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:focus, .btn-outline-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-light.disabled, .btn-outline-light:disabled { + color: #f8f9fa; + background-color: transparent; +} + +.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, +.show > .btn-outline-light.dropdown-toggle { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-dark { + color: #343a40; + background-color: transparent; + background-image: none; + border-color: #343a40; +} + +.btn-outline-dark:hover { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:focus, .btn-outline-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-dark.disabled, .btn-outline-dark:disabled { + color: #343a40; + background-color: transparent; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, +.show > .btn-outline-dark.dropdown-toggle { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-link { + font-weight: 400; + color: #467fcf; + background-color: transparent; +} + +.btn-link:hover { + color: #295a9f; + text-decoration: underline; + background-color: transparent; + border-color: transparent; +} + +.btn-link:focus, .btn-link.focus { + text-decoration: underline; + border-color: transparent; + box-shadow: none; +} + +.btn-link:disabled, .btn-link.disabled { + color: #868e96; + pointer-events: none; +} + +.btn-lg, .btn-group-lg > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.625; + border-radius: 3px; +} + +.btn-sm, .btn-group-sm > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.33333333; + border-radius: 3px; +} + +.btn-block { + display: block; + width: 100%; +} + +.btn-block + .btn-block { + margin-top: 0.5rem; +} + +input[type="submit"].btn-block, +input[type="reset"].btn-block, +input[type="button"].btn-block { + width: 100%; +} + +.fade { + transition: opacity 0.15s linear; +} + +@media screen and (prefers-reduced-motion: reduce) { + .fade { + transition: none; + } +} + +.fade:not(.show) { + opacity: 0; +} + +.collapse:not(.show) { + display: none; +} + +.collapsing { + position: relative; + height: 0; + overflow: hidden; + transition: height 0.35s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .collapsing { + transition: none; + } +} + +.dropup, +.dropright, +.dropdown, +.dropleft { + position: relative; +} + +.dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid; + border-left: 0.3em solid transparent; + border-bottom: 0; + border-right: 0.3em solid transparent; +} + +.dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropdown-menu { + position: absolute; + top: 100%; + right: 0; + z-index: 1000; + display: none; + float: right; + min-width: 10rem; + padding: 0.5rem 0; + margin: 0.125rem 0 0; + font-size: 0.9375rem; + color: #495057; + text-align: right; + list-style: none; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.dropdown-menu-right { + left: 0; + right: auto; +} + +.dropup .dropdown-menu { + top: auto; + bottom: 100%; + margin-top: 0; + margin-bottom: 0.125rem; +} + +.dropup .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0; + border-left: 0.3em solid transparent; + border-bottom: 0.3em solid; + border-right: 0.3em solid transparent; +} + +.dropup .dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropright .dropdown-menu { + top: 0; + left: auto; + right: 100%; + margin-top: 0; + margin-right: 0.125rem; +} + +.dropright .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-left: 0; + border-bottom: 0.3em solid transparent; + border-right: 0.3em solid; +} + +.dropright .dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropright .dropdown-toggle::after { + vertical-align: 0; +} + +.dropleft .dropdown-menu { + top: 0; + left: 100%; + right: auto; + margin-top: 0; + margin-left: 0.125rem; +} + +.dropleft .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; +} + +.dropleft .dropdown-toggle::after { + display: none; +} + +.dropleft .dropdown-toggle::before { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-left: 0.3em solid; + border-bottom: 0.3em solid transparent; +} + +.dropleft .dropdown-toggle:empty::after { + margin-right: 0; +} + +.dropleft .dropdown-toggle::before { + vertical-align: 0; +} + +.dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] { + left: auto; + bottom: auto; +} + +.dropdown-divider { + height: 0; + margin: 0.5rem 0; + overflow: hidden; + border-top: 1px solid #e9ecef; +} + +.dropdown-item { + display: block; + width: 100%; + padding: 0.25rem 1.5rem; + clear: both; + font-weight: 400; + color: #212529; + text-align: inherit; + white-space: nowrap; + background-color: transparent; + border: 0; +} + +.dropdown-item:hover, .dropdown-item:focus { + color: #16181b; + text-decoration: none; + background-color: #f8f9fa; +} + +.dropdown-item.active, .dropdown-item:active { + color: #fff; + text-decoration: none; + background-color: #467fcf; +} + +.dropdown-item.disabled, .dropdown-item:disabled { + color: #868e96; + background-color: transparent; +} + +.dropdown-menu.show { + display: block; +} + +.dropdown-header { + display: block; + padding: 0.5rem 1.5rem; + margin-bottom: 0; + font-size: 0.875rem; + color: #868e96; + white-space: nowrap; +} + +.dropdown-item-text { + display: block; + padding: 0.25rem 1.5rem; + color: #212529; +} + +.btn-group, +.btn-group-vertical { + position: relative; + display: -ms-inline-flexbox; + display: inline-flex; + vertical-align: middle; +} + +.btn-group > .btn, +.btn-group-vertical > .btn { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; +} + +.btn-group > .btn:hover, +.btn-group-vertical > .btn:hover { + z-index: 1; +} + +.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active, +.btn-group-vertical > .btn:focus, +.btn-group-vertical > .btn:active, +.btn-group-vertical > .btn.active { + z-index: 1; +} + +.btn-group .btn + .btn, +.btn-group .btn + .btn-group, +.btn-group .btn-group + .btn, +.btn-group .btn-group + .btn-group, +.btn-group-vertical .btn + .btn, +.btn-group-vertical .btn + .btn-group, +.btn-group-vertical .btn-group + .btn, +.btn-group-vertical .btn-group + .btn-group { + margin-right: -1px; +} + +.btn-toolbar { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.btn-toolbar .input-group { + width: auto; +} + +.btn-group > .btn:first-child { + margin-right: 0; +} + +.btn-group > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group > .btn-group:not(:last-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group > .btn:not(:first-child), +.btn-group > .btn-group:not(:first-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.dropdown-toggle-split { + padding-left: 0.5625rem; + padding-right: 0.5625rem; +} + +.dropdown-toggle-split::after, +.dropup .dropdown-toggle-split::after, +.dropright .dropdown-toggle-split::after { + margin-right: 0; +} + +.dropleft .dropdown-toggle-split::before { + margin-left: 0; +} + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { + padding-left: 0.375rem; + padding-right: 0.375rem; +} + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { + padding-left: 0.75rem; + padding-right: 0.75rem; +} + +.btn-group-vertical { + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: center; + justify-content: center; +} + +.btn-group-vertical .btn, +.btn-group-vertical .btn-group { + width: 100%; +} + +.btn-group-vertical > .btn + .btn, +.btn-group-vertical > .btn + .btn-group, +.btn-group-vertical > .btn-group + .btn, +.btn-group-vertical > .btn-group + .btn-group { + margin-top: -1px; + margin-right: 0; +} + +.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group-vertical > .btn-group:not(:last-child) > .btn { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +.btn-group-vertical > .btn:not(:first-child), +.btn-group-vertical > .btn-group:not(:first-child) > .btn { + border-top-right-radius: 0; + border-top-left-radius: 0; +} + +.btn-group-toggle > .btn, +.btn-group-toggle > .btn-group > .btn { + margin-bottom: 0; +} + +.btn-group-toggle > .btn input[type="radio"], +.btn-group-toggle > .btn input[type="checkbox"], +.btn-group-toggle > .btn-group > .btn input[type="radio"], +.btn-group-toggle > .btn-group > .btn input[type="checkbox"] { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; +} + +.input-group { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: stretch; + align-items: stretch; + width: 100%; +} + +.input-group > .form-control, +.input-group > .custom-select, +.input-group > .custom-file { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + width: 1%; + margin-bottom: 0; +} + +.input-group > .form-control:focus, +.input-group > .custom-select:focus, +.input-group > .custom-file:focus { + z-index: 3; +} + +.input-group > .form-control + .form-control, +.input-group > .form-control + .custom-select, +.input-group > .form-control + .custom-file, +.input-group > .custom-select + .form-control, +.input-group > .custom-select + .custom-select, +.input-group > .custom-select + .custom-file, +.input-group > .custom-file + .form-control, +.input-group > .custom-file + .custom-select, +.input-group > .custom-file + .custom-file { + margin-right: -1px; +} + +.input-group > .form-control:not(:last-child), +.input-group > .custom-select:not(:last-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .form-control:not(:first-child), +.input-group > .custom-select:not(:first-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .custom-file { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.input-group > .custom-file:not(:last-child) .custom-file-label, +.input-group > .custom-file:not(:last-child) .custom-file-label::after { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .custom-file:not(:first-child) .custom-file-label, +.input-group > .custom-file:not(:first-child) .custom-file-label::after { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group-prepend, +.input-group-append { + display: -ms-flexbox; + display: flex; +} + +.input-group-prepend .btn, +.input-group-append .btn { + position: relative; + z-index: 2; +} + +.input-group-prepend .btn + .btn, +.input-group-prepend .btn + .input-group-text, +.input-group-prepend .input-group-text + .input-group-text, +.input-group-prepend .input-group-text + .btn, +.input-group-append .btn + .btn, +.input-group-append .btn + .input-group-text, +.input-group-append .input-group-text + .input-group-text, +.input-group-append .input-group-text + .btn { + margin-right: -1px; +} + +.input-group-prepend { + margin-left: -1px; +} + +.input-group-append { + margin-right: -1px; +} + +.input-group-text { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + padding: 0.375rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.6; + color: #495057; + text-align: center; + white-space: nowrap; + background-color: #fbfbfc; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.input-group-text input[type="radio"], +.input-group-text input[type="checkbox"] { + margin-top: 0; +} + +.input-group > .input-group-prepend > .btn, +.input-group > .input-group-prepend > .input-group-text, +.input-group > .input-group-append:not(:last-child) > .btn, +.input-group > .input-group-append:not(:last-child) > .input-group-text, +.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), +.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .input-group-append > .btn, +.input-group > .input-group-append > .input-group-text, +.input-group > .input-group-prepend:not(:first-child) > .btn, +.input-group > .input-group-prepend:not(:first-child) > .input-group-text, +.input-group > .input-group-prepend:first-child > .btn:not(:first-child), +.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.custom-control { + position: relative; + display: block; + min-height: 1.5rem; + padding-right: 1.5rem; +} + +.custom-control-inline { + display: -ms-inline-flexbox; + display: inline-flex; + margin-left: 1rem; +} + +.custom-control-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-control-input:checked ~ .custom-control-label::before { + color: #fff; + background-color: #467fcf; +} + +.custom-control-input:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-control-input:active ~ .custom-control-label::before { + color: #fff; + background-color: #d4e1f4; +} + +.custom-control-input:disabled ~ .custom-control-label { + color: #868e96; +} + +.custom-control-input:disabled ~ .custom-control-label::before { + background-color: #e9ecef; +} + +.custom-control-label { + margin-bottom: 0; +} + +.custom-control-label::before { + position: absolute; + top: 0.25rem; + right: 0; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + content: ""; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background-color: #dee2e6; +} + +.custom-control-label::after { + position: absolute; + top: 0.25rem; + right: 0; + display: block; + width: 1rem; + height: 1rem; + content: ""; + background-repeat: no-repeat; + background-position: center center; + background-size: 50% 50%; +} + +.custom-checkbox .custom-control-label::before { + border-radius: 3px; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-radio .custom-control-label::before { + border-radius: 50%; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E"); +} + +.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-select { + display: inline-block; + width: 100%; + height: 2.375rem; + padding: 0.5rem 0.75rem 0.5rem 1.75rem; + line-height: 1.5; + color: #495057; + vertical-align: middle; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat left 0.75rem center; + background-size: 8px 10px; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-select:focus { + border-color: #1991eb; + outline: 0; + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(25, 145, 235, 0.5); +} + +.custom-select:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.custom-select[multiple], .custom-select[size]:not([size="1"]) { + height: auto; + padding-left: 0.75rem; + background-image: none; +} + +.custom-select:disabled { + color: #868e96; + background-color: #e9ecef; +} + +.custom-select::-ms-expand { + opacity: 0; +} + +.custom-select-sm { + height: calc(1.8125rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 75%; +} + +.custom-select-lg { + height: calc(2.6875rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 125%; +} + +.custom-file { + position: relative; + display: inline-block; + width: 100%; + height: 2.375rem; + margin-bottom: 0; +} + +.custom-file-input { + position: relative; + z-index: 2; + width: 100%; + height: 2.375rem; + margin: 0; + opacity: 0; +} + +.custom-file-input:focus ~ .custom-file-label { + border-color: #1991eb; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-file-input:focus ~ .custom-file-label::after { + border-color: #1991eb; +} + +.custom-file-input:lang(en) ~ .custom-file-label::after { + content: "Browse"; +} + +.custom-file-label { + position: absolute; + top: 0; + left: 0; + right: 0; + z-index: 1; + height: 2.375rem; + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.custom-file-label::after { + position: absolute; + top: 0; + left: 0; + bottom: 0; + z-index: 3; + display: block; + height: calc(2.375rem - 1px * 2); + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + content: "Browse"; + background-color: #fbfbfc; + border-right: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px 0 0 3px; +} + +.custom-range { + width: 100%; + padding-right: 0; + background-color: transparent; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-range:focus { + outline: none; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-thumb { + width: 1rem; + height: 1rem; + margin-top: -0.25rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -webkit-appearance: none; + appearance: none; +} + +.custom-range::-webkit-slider-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-webkit-slider-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-webkit-slider-runnable-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-moz-range-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + -moz-appearance: none; + appearance: none; +} + +.custom-range::-moz-range-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-moz-range-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-moz-range-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; +} + +.custom-range::-ms-thumb { + width: 1rem; + height: 1rem; + background-color: #467fcf; + border: 0; + border-radius: 1rem; + appearance: none; +} + +.custom-range::-ms-thumb:focus { + outline: none; + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-range::-ms-thumb:active { + background-color: #d4e1f4; +} + +.custom-range::-ms-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: transparent; + border-color: transparent; + border-width: 0.5rem; +} + +.custom-range::-ms-fill-lower { + background-color: #dee2e6; + border-radius: 1rem; +} + +.custom-range::-ms-fill-upper { + margin-left: 15px; + background-color: #dee2e6; + border-radius: 1rem; +} + +.nav { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding-right: 0; + margin-bottom: 0; + list-style: none; +} + +.nav-link { + display: block; + padding: 0.5rem 1rem; +} + +.nav-link:hover, .nav-link:focus { + text-decoration: none; +} + +.nav-link.disabled { + color: #868e96; +} + +.nav-tabs { + border-bottom: 1px solid #dee2e6; +} + +.nav-tabs .nav-item { + margin-bottom: -1px; +} + +.nav-tabs .nav-link { + border: 1px solid transparent; + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { + border-color: #e9ecef #e9ecef #dee2e6; +} + +.nav-tabs .nav-link.disabled { + color: #868e96; + background-color: transparent; + border-color: transparent; +} + +.nav-tabs .nav-link.active, +.nav-tabs .nav-item.show .nav-link { + color: #495057; + background-color: transparent; + border-color: #dee2e6 #dee2e6 transparent; +} + +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-right-radius: 0; + border-top-left-radius: 0; +} + +.nav-pills .nav-link { + border-radius: 3px; +} + +.nav-pills .nav-link.active, +.nav-pills .show > .nav-link { + color: #fff; + background-color: #467fcf; +} + +.nav-fill .nav-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + text-align: center; +} + +.nav-justified .nav-item { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + text-align: center; +} + +.tab-content > .tab-pane { + display: none; +} + +.tab-content > .active { + display: block; +} + +.navbar { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 0.5rem 1rem; +} + +.navbar > .container, +.navbar > .container-fluid { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.navbar-brand { + display: inline-block; + padding-top: 0.359375rem; + padding-bottom: 0.359375rem; + margin-left: 1rem; + font-size: 1.125rem; + line-height: inherit; + white-space: nowrap; +} + +.navbar-brand:hover, .navbar-brand:focus { + text-decoration: none; +} + +.navbar-nav { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-right: 0; + margin-bottom: 0; + list-style: none; +} + +.navbar-nav .nav-link { + padding-left: 0; + padding-right: 0; +} + +.navbar-nav .dropdown-menu { + position: static; + float: none; +} + +.navbar-text { + display: inline-block; + padding-top: 0.5rem; + padding-bottom: 0.5rem; +} + +.navbar-collapse { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; + -ms-flex-positive: 1; + flex-grow: 1; + -ms-flex-align: center; + align-items: center; +} + +.navbar-toggler { + padding: 0.25rem 0.75rem; + font-size: 1.125rem; + line-height: 1; + background-color: transparent; + border: 1px solid transparent; + border-radius: 3px; +} + +.navbar-toggler:hover, .navbar-toggler:focus { + text-decoration: none; +} + +.navbar-toggler:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + content: ""; + background: no-repeat center center; + background-size: 100% 100%; +} + +@media (max-width: 575.98px) { + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 576px) { + .navbar-expand-sm { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-sm .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-sm .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-sm .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-sm .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-sm .navbar-toggler { + display: none; + } +} + +@media (max-width: 767.98px) { + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 768px) { + .navbar-expand-md { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-md .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-md .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-md .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-md .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-md .navbar-toggler { + display: none; + } +} + +@media (max-width: 991.98px) { + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 992px) { + .navbar-expand-lg { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-lg .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-lg .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-lg .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-lg .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-lg .navbar-toggler { + display: none; + } +} + +@media (max-width: 1279.98px) { + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + padding-left: 0; + padding-right: 0; + } +} + +@media (min-width: 1280px) { + .navbar-expand-xl { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-xl .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-xl .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-xl .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; + } + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-xl .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-xl .navbar-toggler { + display: none; + } +} + +.navbar-expand { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + padding-left: 0; + padding-right: 0; +} + +.navbar-expand .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; +} + +.navbar-expand .navbar-nav .dropdown-menu { + position: absolute; +} + +.navbar-expand .navbar-nav .nav-link { + padding-left: 0.5rem; + padding-right: 0.5rem; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; +} + +.navbar-expand .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; +} + +.navbar-expand .navbar-toggler { + display: none; +} + +.navbar-light .navbar-brand { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-nav .nav-link { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus { + color: rgba(0, 0, 0, 0.7); +} + +.navbar-light .navbar-nav .nav-link.disabled { + color: rgba(0, 0, 0, 0.3); +} + +.navbar-light .navbar-nav .show > .nav-link, +.navbar-light .navbar-nav .active > .nav-link, +.navbar-light .navbar-nav .nav-link.show, +.navbar-light .navbar-nav .nav-link.active { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-toggler { + color: rgba(0, 0, 0, 0.5); + border-color: rgba(0, 0, 0, 0.1); +} + +.navbar-light .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-light .navbar-text { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-text a { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-dark .navbar-brand { + color: #fff; +} + +.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus { + color: #fff; +} + +.navbar-dark .navbar-nav .nav-link { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus { + color: rgba(255, 255, 255, 0.75); +} + +.navbar-dark .navbar-nav .nav-link.disabled { + color: rgba(255, 255, 255, 0.25); +} + +.navbar-dark .navbar-nav .show > .nav-link, +.navbar-dark .navbar-nav .active > .nav-link, +.navbar-dark .navbar-nav .nav-link.show, +.navbar-dark .navbar-nav .nav-link.active { + color: #fff; +} + +.navbar-dark .navbar-toggler { + color: rgba(255, 255, 255, 0.5); + border-color: rgba(255, 255, 255, 0.1); +} + +.navbar-dark .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-dark .navbar-text { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-text a { + color: #fff; +} + +.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus { + color: #fff; +} + +.card { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + min-width: 0; + word-wrap: break-word; + background-color: #fff; + background-clip: border-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.card > hr { + margin-left: 0; + margin-right: 0; +} + +.card > .list-group:first-child .list-group-item:first-child { + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.card > .list-group:last-child .list-group-item:last-child { + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1.5rem; +} + +.card-title { + margin-bottom: 1.5rem; +} + +.card-subtitle { + margin-top: -0.75rem; + margin-bottom: 0; +} + +.card-text:last-child { + margin-bottom: 0; +} + +.card-link:hover { + text-decoration: none; +} + +.card-link + .card-link { + margin-right: 1.5rem; +} + +.card-header { + padding: 1.5rem 1.5rem; + margin-bottom: 0; + background-color: rgba(0, 0, 0, 0.03); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-header:first-child { + border-radius: calc(3px - 1px) calc(3px - 1px) 0 0; +} + +.card-header + .list-group .list-group-item:first-child { + border-top: 0; +} + +.card-footer { + padding: 1.5rem 1.5rem; + background-color: rgba(0, 0, 0, 0.03); + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-footer:last-child { + border-radius: 0 0 calc(3px - 1px) calc(3px - 1px); +} + +.card-header-tabs { + margin-left: -0.75rem; + margin-bottom: -1.5rem; + margin-right: -0.75rem; + border-bottom: 0; +} + +.card-header-pills { + margin-left: -0.75rem; + margin-right: -0.75rem; +} + +.card-img-overlay { + position: absolute; + top: 0; + left: 0; + bottom: 0; + right: 0; + padding: 1.25rem; +} + +.card-img { + width: 100%; + border-radius: calc(3px - 1px); +} + +.card-img-top { + width: 100%; + border-top-right-radius: calc(3px - 1px); + border-top-left-radius: calc(3px - 1px); +} + +.card-img-bottom { + width: 100%; + border-bottom-left-radius: calc(3px - 1px); + border-bottom-right-radius: calc(3px - 1px); +} + +.card-deck { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-deck .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-deck { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + margin-left: -0.75rem; + margin-right: -0.75rem; + } + .card-deck .card { + display: -ms-flexbox; + display: flex; + -ms-flex: 1 0 0%; + flex: 1 0 0%; + -ms-flex-direction: column; + flex-direction: column; + margin-left: 0.75rem; + margin-bottom: 0; + margin-right: 0.75rem; + } +} + +.card-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-group > .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-group { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + } + .card-group > .card { + -ms-flex: 1 0 0%; + flex: 1 0 0%; + margin-bottom: 0; + } + .card-group > .card + .card { + margin-right: 0; + border-right: 0; + } + .card-group > .card:first-child { + border-top-left-radius: 0; + border-bottom-left-radius: 0; + } + .card-group > .card:first-child .card-img-top, + .card-group > .card:first-child .card-header { + border-top-left-radius: 0; + } + .card-group > .card:first-child .card-img-bottom, + .card-group > .card:first-child .card-footer { + border-bottom-left-radius: 0; + } + .card-group > .card:last-child { + border-top-right-radius: 0; + border-bottom-right-radius: 0; + } + .card-group > .card:last-child .card-img-top, + .card-group > .card:last-child .card-header { + border-top-right-radius: 0; + } + .card-group > .card:last-child .card-img-bottom, + .card-group > .card:last-child .card-footer { + border-bottom-right-radius: 0; + } + .card-group > .card:only-child { + border-radius: 3px; + } + .card-group > .card:only-child .card-img-top, + .card-group > .card:only-child .card-header { + border-top-right-radius: 3px; + border-top-left-radius: 3px; + } + .card-group > .card:only-child .card-img-bottom, + .card-group > .card:only-child .card-footer { + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) { + border-radius: 0; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer { + border-radius: 0; + } +} + +.card-columns .card { + margin-bottom: 1.5rem; +} + +@media (min-width: 576px) { + .card-columns { + -webkit-column-count: 3; + -moz-column-count: 3; + column-count: 3; + -webkit-column-gap: 1.25rem; + -moz-column-gap: 1.25rem; + column-gap: 1.25rem; + orphans: 1; + widows: 1; + } + .card-columns .card { + display: inline-block; + width: 100%; + } +} + +.accordion .card:not(:first-of-type):not(:last-of-type) { + border-bottom: 0; + border-radius: 0; +} + +.accordion .card:not(:first-of-type) .card-header:first-child { + border-radius: 0; +} + +.accordion .card:first-of-type { + border-bottom: 0; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +.accordion .card:last-of-type { + border-top-right-radius: 0; + border-top-left-radius: 0; +} + +.breadcrumb { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding: 0.75rem 1rem; + margin-bottom: 1rem; + list-style: none; + background-color: #e9ecef; + border-radius: 3px; +} + +.breadcrumb-item + .breadcrumb-item { + padding-right: 0.5rem; +} + +.breadcrumb-item + .breadcrumb-item::before { + display: inline-block; + padding-left: 0.5rem; + color: #868e96; + content: "/"; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: underline; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: none; +} + +.breadcrumb-item.active { + color: #868e96; +} + +.pagination { + display: -ms-flexbox; + display: flex; + padding-right: 0; + list-style: none; + border-radius: 3px; +} + +.page-link { + position: relative; + display: block; + padding: 0.5rem 0.75rem; + margin-right: -1px; + line-height: 1.25; + color: #495057; + background-color: #fff; + border: 1px solid #dee2e6; +} + +.page-link:hover { + z-index: 2; + color: #295a9f; + text-decoration: none; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.page-link:focus { + z-index: 2; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.page-link:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.page-item:first-child .page-link { + margin-right: 0; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.page-item:last-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.page-item.active .page-link { + z-index: 1; + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.page-item.disabled .page-link { + color: #ced4da; + pointer-events: none; + cursor: auto; + background-color: #fff; + border-color: #dee2e6; +} + +.pagination-lg .page-link { + padding: 0.75rem 1.5rem; + font-size: 1.125rem; + line-height: 1.5; +} + +.pagination-lg .page-item:first-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pagination-lg .page-item:last-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-sm .page-link { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.5; +} + +.pagination-sm .page-item:first-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pagination-sm .page-item:last-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.badge { + display: inline-block; + padding: 0.25em 0.4em; + font-size: 75%; + font-weight: 600; + line-height: 1; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: 3px; +} + +.badge:empty { + display: none; +} + +.btn .badge { + position: relative; + top: -1px; +} + +.badge-pill { + padding-left: 0.6em; + padding-right: 0.6em; + border-radius: 10rem; +} + +.badge-primary { + color: #fff; + background-color: #467fcf; +} + +.badge-primary[href]:hover, .badge-primary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #2f66b3; +} + +.badge-secondary { + color: #fff; + background-color: #868e96; +} + +.badge-secondary[href]:hover, .badge-secondary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #6c757d; +} + +.badge-success { + color: #fff; + background-color: #5eba00; +} + +.badge-success[href]:hover, .badge-success[href]:focus { + color: #fff; + text-decoration: none; + background-color: #448700; +} + +.badge-info { + color: #fff; + background-color: #45aaf2; +} + +.badge-info[href]:hover, .badge-info[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1594ef; +} + +.badge-warning { + color: #fff; + background-color: #f1c40f; +} + +.badge-warning[href]:hover, .badge-warning[href]:focus { + color: #fff; + text-decoration: none; + background-color: #c29d0b; +} + +.badge-danger { + color: #fff; + background-color: #cd201f; +} + +.badge-danger[href]:hover, .badge-danger[href]:focus { + color: #fff; + text-decoration: none; + background-color: #a11918; +} + +.badge-light { + color: #495057; + background-color: #f8f9fa; +} + +.badge-light[href]:hover, .badge-light[href]:focus { + color: #495057; + text-decoration: none; + background-color: #dae0e5; +} + +.badge-dark { + color: #fff; + background-color: #343a40; +} + +.badge-dark[href]:hover, .badge-dark[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1d2124; +} + +.jumbotron { + padding: 2rem 1rem; + margin-bottom: 2rem; + background-color: #e9ecef; + border-radius: 3px; +} + +@media (min-width: 576px) { + .jumbotron { + padding: 4rem 2rem; + } +} + +.jumbotron-fluid { + padding-left: 0; + padding-right: 0; + border-radius: 0; +} + +.alert { + position: relative; + padding: 0.75rem 1.25rem; + margin-bottom: 1rem; + border: 1px solid transparent; + border-radius: 3px; +} + +.alert-heading { + color: inherit; +} + +.alert-link { + font-weight: 600; +} + +.alert-dismissible { + padding-left: 3.90625rem; +} + +.alert-dismissible .close { + position: absolute; + top: 0; + left: 0; + padding: 0.75rem 1.25rem; + color: inherit; +} + +.alert-primary { + color: #24426c; + background-color: #dae5f5; + border-color: #cbdbf2; +} + +.alert-primary hr { + border-top-color: #b7cded; +} + +.alert-primary .alert-link { + color: #172b46; +} + +.alert-secondary { + color: #464a4e; + background-color: #e7e8ea; + border-color: #dddfe2; +} + +.alert-secondary hr { + border-top-color: #cfd2d6; +} + +.alert-secondary .alert-link { + color: #2e3133; +} + +.alert-success { + color: #316100; + background-color: #dff1cc; + border-color: #d2ecb8; +} + +.alert-success hr { + border-top-color: #c5e7a4; +} + +.alert-success .alert-link { + color: #172e00; +} + +.alert-info { + color: #24587e; + background-color: #daeefc; + border-color: #cbe7fb; +} + +.alert-info hr { + border-top-color: #b3dcf9; +} + +.alert-info .alert-link { + color: #193c56; +} + +.alert-warning { + color: #7d6608; + background-color: #fcf3cf; + border-color: #fbeebc; +} + +.alert-warning hr { + border-top-color: #fae8a4; +} + +.alert-warning .alert-link { + color: #4d3f05; +} + +.alert-danger { + color: #6b1110; + background-color: #f5d2d2; + border-color: #f1c1c0; +} + +.alert-danger hr { + border-top-color: #ecacab; +} + +.alert-danger .alert-link { + color: #3f0a09; +} + +.alert-light { + color: #818182; + background-color: #fefefe; + border-color: #fdfdfe; +} + +.alert-light hr { + border-top-color: #ececf6; +} + +.alert-light .alert-link { + color: #686868; +} + +.alert-dark { + color: #1b1e21; + background-color: #d6d8d9; + border-color: #c6c8ca; +} + +.alert-dark hr { + border-top-color: #b9bbbe; +} + +.alert-dark .alert-link { + color: #040505; +} + +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 100% 0; + } +} + +@keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 100% 0; + } +} + +.progress { + display: -ms-flexbox; + display: flex; + height: 1rem; + overflow: hidden; + font-size: 0.703125rem; + background-color: #e9ecef; + border-radius: 3px; +} + +.progress-bar { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + color: #fff; + text-align: center; + white-space: nowrap; + background-color: #467fcf; + transition: width 0.6s ease; +} + +@media screen and (prefers-reduced-motion: reduce) { + .progress-bar { + transition: none; + } +} + +.progress-bar-striped { + background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: 1rem 1rem; +} + +.progress-bar-animated { + -webkit-animation: progress-bar-stripes 1s linear infinite; + animation: progress-bar-stripes 1s linear infinite; +} + +.media { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; +} + +.media-body { + -ms-flex: 1; + flex: 1; +} + +.list-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-right: 0; + margin-bottom: 0; +} + +.list-group-item-action { + width: 100%; + color: #495057; + text-align: inherit; +} + +.list-group-item-action:hover, .list-group-item-action:focus { + color: #495057; + text-decoration: none; + background-color: #f8f9fa; +} + +.list-group-item-action:active { + color: #495057; + background-color: #e9ecef; +} + +.list-group-item { + position: relative; + display: block; + padding: 0.75rem 1.25rem; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item:first-child { + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; +} + +.list-group-item:hover, .list-group-item:focus { + z-index: 1; + text-decoration: none; +} + +.list-group-item.disabled, .list-group-item:disabled { + color: #868e96; + background-color: #fff; +} + +.list-group-item.active { + z-index: 2; + color: #467fcf; + background-color: #f8fafd; + border-color: rgba(0, 40, 100, 0.12); +} + +.list-group-flush .list-group-item { + border-left: 0; + border-right: 0; + border-radius: 0; +} + +.list-group-flush:first-child .list-group-item:first-child { + border-top: 0; +} + +.list-group-flush:last-child .list-group-item:last-child { + border-bottom: 0; +} + +.list-group-item-primary { + color: #24426c; + background-color: #cbdbf2; +} + +.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { + color: #24426c; + background-color: #b7cded; +} + +.list-group-item-primary.list-group-item-action.active { + color: #fff; + background-color: #24426c; + border-color: #24426c; +} + +.list-group-item-secondary { + color: #464a4e; + background-color: #dddfe2; +} + +.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { + color: #464a4e; + background-color: #cfd2d6; +} + +.list-group-item-secondary.list-group-item-action.active { + color: #fff; + background-color: #464a4e; + border-color: #464a4e; +} + +.list-group-item-success { + color: #316100; + background-color: #d2ecb8; +} + +.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { + color: #316100; + background-color: #c5e7a4; +} + +.list-group-item-success.list-group-item-action.active { + color: #fff; + background-color: #316100; + border-color: #316100; +} + +.list-group-item-info { + color: #24587e; + background-color: #cbe7fb; +} + +.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { + color: #24587e; + background-color: #b3dcf9; +} + +.list-group-item-info.list-group-item-action.active { + color: #fff; + background-color: #24587e; + border-color: #24587e; +} + +.list-group-item-warning { + color: #7d6608; + background-color: #fbeebc; +} + +.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { + color: #7d6608; + background-color: #fae8a4; +} + +.list-group-item-warning.list-group-item-action.active { + color: #fff; + background-color: #7d6608; + border-color: #7d6608; +} + +.list-group-item-danger { + color: #6b1110; + background-color: #f1c1c0; +} + +.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { + color: #6b1110; + background-color: #ecacab; +} + +.list-group-item-danger.list-group-item-action.active { + color: #fff; + background-color: #6b1110; + border-color: #6b1110; +} + +.list-group-item-light { + color: #818182; + background-color: #fdfdfe; +} + +.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { + color: #818182; + background-color: #ececf6; +} + +.list-group-item-light.list-group-item-action.active { + color: #fff; + background-color: #818182; + border-color: #818182; +} + +.list-group-item-dark { + color: #1b1e21; + background-color: #c6c8ca; +} + +.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { + color: #1b1e21; + background-color: #b9bbbe; +} + +.list-group-item-dark.list-group-item-action.active { + color: #fff; + background-color: #1b1e21; + border-color: #1b1e21; +} + +.close { + float: left; + font-size: 1.40625rem; + font-weight: 700; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + opacity: .5; +} + +.close:hover, .close:focus { + color: #000; + text-decoration: none; + opacity: .75; +} + +.close:not(:disabled):not(.disabled) { + cursor: pointer; +} + +button.close { + padding: 0; + background-color: transparent; + border: 0; + -webkit-appearance: none; +} + +.modal-open { + overflow: hidden; +} + +.modal { + position: fixed; + top: 0; + left: 0; + bottom: 0; + right: 0; + z-index: 1050; + display: none; + overflow: hidden; + outline: 0; +} + +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} + +.modal-dialog { + position: relative; + width: auto; + margin: 0.5rem; + pointer-events: none; +} + +.modal.fade .modal-dialog { + transition: -webkit-transform 0.3s ease-out; + transition: transform 0.3s ease-out; + transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out; + -webkit-transform: translate(0, -25%); + transform: translate(0, -25%); +} + +@media screen and (prefers-reduced-motion: reduce) { + .modal.fade .modal-dialog { + transition: none; + } +} + +.modal.show .modal-dialog { + -webkit-transform: translate(0, 0); + transform: translate(0, 0); +} + +.modal-dialog-centered { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + min-height: calc(100% - (0.5rem * 2)); +} + +.modal-content { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + width: 100%; + pointer-events: auto; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 0, 0, 0.2); + border-radius: 3px; + outline: 0; +} + +.modal-backdrop { + position: fixed; + top: 0; + left: 0; + bottom: 0; + right: 0; + z-index: 1040; + background-color: #000; +} + +.modal-backdrop.fade { + opacity: 0; +} + +.modal-backdrop.show { + opacity: 0.5; +} + +.modal-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 1rem; + border-bottom: 1px solid #e9ecef; + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.modal-header .close { + padding: 1rem; + margin: -1rem auto -1rem -1rem; +} + +.modal-title { + margin-bottom: 0; + line-height: 1.5; +} + +.modal-body { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1rem; +} + +.modal-footer { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: end; + justify-content: flex-end; + padding: 1rem; + border-top: 1px solid #e9ecef; +} + +.modal-footer > :not(:first-child) { + margin-right: .25rem; +} + +.modal-footer > :not(:last-child) { + margin-left: .25rem; +} + +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} + +@media (min-width: 576px) { + .modal-dialog { + max-width: 500px; + margin: 1.75rem auto; + } + .modal-dialog-centered { + min-height: calc(100% - (1.75rem * 2)); + } + .modal-sm { + max-width: 300px; + } +} + +@media (min-width: 992px) { + .modal-lg { + max-width: 800px; + } +} + +.tooltip { + position: absolute; + z-index: 1070; + display: block; + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: right; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + opacity: 0; +} + +.tooltip.show { + opacity: 0.9; +} + +.tooltip .arrow { + position: absolute; + display: block; + width: 0.8rem; + height: 0.4rem; +} + +.tooltip .arrow::before { + position: absolute; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] { + padding: 0.4rem 0; +} + +.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow { + bottom: 0; +} + +.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before { + top: 0; + border-width: 0.4rem 0.4rem 0; + border-top-color: #000; +} + +.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] { + padding: 0 0.4rem; +} + +.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow { + right: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before { + left: 0; + border-width: 0.4rem 0 0.4rem 0.4rem; + border-left-color: #000; +} + +.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] { + padding: 0.4rem 0; +} + +.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow { + top: 0; +} + +.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before { + bottom: 0; + border-width: 0 0.4rem 0.4rem; + border-bottom-color: #000; +} + +.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] { + padding: 0 0.4rem; +} + +.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow { + left: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before { + right: 0; + border-width: 0.4rem 0.4rem 0.4rem 0; + border-right-color: #000; +} + +.tooltip-inner { + max-width: 200px; + padding: 0.25rem 0.5rem; + color: #fff; + text-align: center; + background-color: #000; + border-radius: 3px; +} + +.popover { + position: absolute; + top: 0; + right: 0; + z-index: 1060; + display: block; + max-width: 276px; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: right; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #dee3eb; + border-radius: 3px; +} + +.popover .arrow { + position: absolute; + display: block; + width: 0.5rem; + height: 0.5rem; + margin: 0 3px; +} + +.popover .arrow::before, .popover .arrow::after { + position: absolute; + display: block; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-popover-top, .bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.5rem; +} + +.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow { + bottom: calc((0.5rem + 1px) * -1); +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before, +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + border-width: 0.5rem 0.25rem 0; +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before { + bottom: 0; + border-top-color: #dee3eb; +} + + +.bs-popover-top .arrow::after, +.bs-popover-auto[x-placement^="top"] .arrow::after { + bottom: 1px; + border-top-color: #fff; +} + +.bs-popover-right, .bs-popover-auto[x-placement^="right"] { + margin-right: 0.5rem; +} + +.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow { + right: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before, +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + border-width: 0.25rem 0 0.25rem 0.5rem; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before { + right: 0; + border-left-color: #dee3eb; +} + + +.bs-popover-right .arrow::after, +.bs-popover-auto[x-placement^="right"] .arrow::after { + right: 1px; + border-left-color: #fff; +} + +.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] { + margin-top: 0.5rem; +} + +.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow { + top: calc((0.5rem + 1px) * -1); +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before, +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + border-width: 0 0.25rem 0.5rem 0.25rem; +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before { + top: 0; + border-bottom-color: #dee3eb; +} + + +.bs-popover-bottom .arrow::after, +.bs-popover-auto[x-placement^="bottom"] .arrow::after { + top: 1px; + border-bottom-color: #fff; +} + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before { + position: absolute; + top: 0; + right: 50%; + display: block; + width: 0.5rem; + margin-right: -0.25rem; + content: ""; + border-bottom: 1px solid #f7f7f7; +} + +.bs-popover-left, .bs-popover-auto[x-placement^="left"] { + margin-left: 0.5rem; +} + +.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow { + left: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before, +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + border-width: 0.25rem 0.5rem 0.25rem 0; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before { + left: 0; + border-right-color: #dee3eb; +} + + +.bs-popover-left .arrow::after, +.bs-popover-auto[x-placement^="left"] .arrow::after { + left: 1px; + border-right-color: #fff; +} + +.popover-header { + padding: 0.5rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + color: inherit; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-top-right-radius: calc(3px - 1px); + border-top-left-radius: calc(3px - 1px); +} + +.popover-header:empty { + display: none; +} + +.popover-body { + padding: 0.75rem 1rem; + color: #6e7687; +} + +.carousel { + position: relative; +} + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; +} + +.carousel-item { + position: relative; + display: none; + -ms-flex-align: center; + align-items: center; + width: 100%; + transition: -webkit-transform 0.6s ease; + transition: transform 0.6s ease; + transition: transform 0.6s ease, -webkit-transform 0.6s ease; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000px; + perspective: 1000px; +} + +@media screen and (prefers-reduced-motion: reduce) { + .carousel-item { + transition: none; + } +} + +.carousel-item.active, +.carousel-item-next, +.carousel-item-prev { + display: block; +} + +.carousel-item-next, +.carousel-item-prev { + position: absolute; + top: 0; +} + +.carousel-item-next.carousel-item-left, +.carousel-item-prev.carousel-item-right { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next.carousel-item-left, + .carousel-item-prev.carousel-item-right { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-item-next, +.active.carousel-item-right { + -webkit-transform: translateX(-100%); + transform: translateX(-100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next, + .active.carousel-item-right { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +.carousel-item-prev, +.active.carousel-item-left { + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-prev, + .active.carousel-item-left { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +.carousel-fade .carousel-item { + opacity: 0; + transition-duration: .6s; + transition-property: opacity; +} + +.carousel-fade .carousel-item.active, +.carousel-fade .carousel-item-next.carousel-item-left, +.carousel-fade .carousel-item-prev.carousel-item-right { + opacity: 1; +} + +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-right { + opacity: 0; +} + +.carousel-fade .carousel-item-next, +.carousel-fade .carousel-item-prev, +.carousel-fade .carousel-item.active, +.carousel-fade .active.carousel-item-left, +.carousel-fade .active.carousel-item-prev { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-fade .carousel-item-next, + .carousel-fade .carousel-item-prev, + .carousel-fade .carousel-item.active, + .carousel-fade .active.carousel-item-left, + .carousel-fade .active.carousel-item-prev { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-control-prev, +.carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: 15%; + color: #fff; + text-align: center; + opacity: 0.5; +} + +.carousel-control-prev:hover, .carousel-control-prev:focus, +.carousel-control-next:hover, +.carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity: .9; +} + +.carousel-control-prev { + right: 0; +} + +.carousel-control-next { + left: 0; +} + +.carousel-control-prev-icon, +.carousel-control-next-icon { + display: inline-block; + width: 20px; + height: 20px; + background: transparent no-repeat center center; + background-size: 100% 100%; +} + +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E"); +} + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E"); +} + +.carousel-indicators { + position: absolute; + left: 0; + bottom: 10px; + right: 0; + z-index: 15; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + padding-right: 0; + margin-left: 15%; + margin-right: 15%; + list-style: none; +} + +.carousel-indicators li { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; + width: 30px; + height: 3px; + margin-left: 3px; + margin-right: 3px; + text-indent: -999px; + background-color: rgba(255, 255, 255, 0.5); +} + +.carousel-indicators li::before { + position: absolute; + top: -10px; + right: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators li::after { + position: absolute; + bottom: -10px; + right: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators .active { + background-color: #fff; +} + +.carousel-caption { + position: absolute; + left: 15%; + bottom: 20px; + right: 15%; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; +} + +.align-baseline { + vertical-align: baseline !important; +} + +.align-top { + vertical-align: top !important; +} + +.align-middle { + vertical-align: middle !important; +} + +.align-bottom { + vertical-align: bottom !important; +} + +.align-text-bottom { + vertical-align: text-bottom !important; +} + +.align-text-top { + vertical-align: text-top !important; +} + +.bg-primary { + background-color: #467fcf !important; +} + +a.bg-primary:hover, a.bg-primary:focus, +button.bg-primary:hover, +button.bg-primary:focus { + background-color: #2f66b3 !important; +} + +.bg-secondary { + background-color: #868e96 !important; +} + +a.bg-secondary:hover, a.bg-secondary:focus, +button.bg-secondary:hover, +button.bg-secondary:focus { + background-color: #6c757d !important; +} + +.bg-success { + background-color: #5eba00 !important; +} + +a.bg-success:hover, a.bg-success:focus, +button.bg-success:hover, +button.bg-success:focus { + background-color: #448700 !important; +} + +.bg-info { + background-color: #45aaf2 !important; +} + +a.bg-info:hover, a.bg-info:focus, +button.bg-info:hover, +button.bg-info:focus { + background-color: #1594ef !important; +} + +.bg-warning { + background-color: #f1c40f !important; +} + +a.bg-warning:hover, a.bg-warning:focus, +button.bg-warning:hover, +button.bg-warning:focus { + background-color: #c29d0b !important; +} + +.bg-danger { + background-color: #cd201f !important; +} + +a.bg-danger:hover, a.bg-danger:focus, +button.bg-danger:hover, +button.bg-danger:focus { + background-color: #a11918 !important; +} + +.bg-light { + background-color: #f8f9fa !important; +} + +a.bg-light:hover, a.bg-light:focus, +button.bg-light:hover, +button.bg-light:focus { + background-color: #dae0e5 !important; +} + +.bg-dark { + background-color: #343a40 !important; +} + +a.bg-dark:hover, a.bg-dark:focus, +button.bg-dark:hover, +button.bg-dark:focus { + background-color: #1d2124 !important; +} + +.bg-white { + background-color: #fff !important; +} + +.bg-transparent { + background-color: transparent !important; +} + +.border { + border: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-top { + border-top: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-right { + border-left: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-bottom { + border-bottom: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-left { + border-right: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-0 { + border: 0 !important; +} + +.border-top-0 { + border-top: 0 !important; +} + +.border-right-0 { + border-left: 0 !important; +} + +.border-bottom-0 { + border-bottom: 0 !important; +} + +.border-left-0 { + border-right: 0 !important; +} + +.border-primary { + border-color: #467fcf !important; +} + +.border-secondary { + border-color: #868e96 !important; +} + +.border-success { + border-color: #5eba00 !important; +} + +.border-info { + border-color: #45aaf2 !important; +} + +.border-warning { + border-color: #f1c40f !important; +} + +.border-danger { + border-color: #cd201f !important; +} + +.border-light { + border-color: #f8f9fa !important; +} + +.border-dark { + border-color: #343a40 !important; +} + +.border-white { + border-color: #fff !important; +} + +.rounded { + border-radius: 3px !important; +} + +.rounded-top { + border-top-right-radius: 3px !important; + border-top-left-radius: 3px !important; +} + +.rounded-right { + border-top-left-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-bottom { + border-bottom-left-radius: 3px !important; + border-bottom-right-radius: 3px !important; +} + +.rounded-left { + border-top-right-radius: 3px !important; + border-bottom-right-radius: 3px !important; +} + +.rounded-circle { + border-radius: 50% !important; +} + +.rounded-0 { + border-radius: 0 !important; +} + +.clearfix::after { + display: block; + clear: both; + content: ""; +} + +.d-none { + display: none !important; +} + +.d-inline { + display: inline !important; +} + +.d-inline-block { + display: inline-block !important; +} + +.d-block { + display: block !important; +} + +.d-table { + display: table !important; +} + +.d-table-row { + display: table-row !important; +} + +.d-table-cell { + display: table-cell !important; +} + +.d-flex { + display: -ms-flexbox !important; + display: flex !important; +} + +.d-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; +} + +@media (min-width: 576px) { + .d-sm-none { + display: none !important; + } + .d-sm-inline { + display: inline !important; + } + .d-sm-inline-block { + display: inline-block !important; + } + .d-sm-block { + display: block !important; + } + .d-sm-table { + display: table !important; + } + .d-sm-table-row { + display: table-row !important; + } + .d-sm-table-cell { + display: table-cell !important; + } + .d-sm-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-sm-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 768px) { + .d-md-none { + display: none !important; + } + .d-md-inline { + display: inline !important; + } + .d-md-inline-block { + display: inline-block !important; + } + .d-md-block { + display: block !important; + } + .d-md-table { + display: table !important; + } + .d-md-table-row { + display: table-row !important; + } + .d-md-table-cell { + display: table-cell !important; + } + .d-md-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-md-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 992px) { + .d-lg-none { + display: none !important; + } + .d-lg-inline { + display: inline !important; + } + .d-lg-inline-block { + display: inline-block !important; + } + .d-lg-block { + display: block !important; + } + .d-lg-table { + display: table !important; + } + .d-lg-table-row { + display: table-row !important; + } + .d-lg-table-cell { + display: table-cell !important; + } + .d-lg-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-lg-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 1280px) { + .d-xl-none { + display: none !important; + } + .d-xl-inline { + display: inline !important; + } + .d-xl-inline-block { + display: inline-block !important; + } + .d-xl-block { + display: block !important; + } + .d-xl-table { + display: table !important; + } + .d-xl-table-row { + display: table-row !important; + } + .d-xl-table-cell { + display: table-cell !important; + } + .d-xl-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-xl-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media print { + .d-print-none { + display: none !important; + } + .d-print-inline { + display: inline !important; + } + .d-print-inline-block { + display: inline-block !important; + } + .d-print-block { + display: block !important; + } + .d-print-table { + display: table !important; + } + .d-print-table-row { + display: table-row !important; + } + .d-print-table-cell { + display: table-cell !important; + } + .d-print-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-print-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +.embed-responsive { + position: relative; + display: block; + width: 100%; + padding: 0; + overflow: hidden; +} + +.embed-responsive::before { + display: block; + content: ""; +} + +.embed-responsive .embed-responsive-item, +.embed-responsive iframe, +.embed-responsive embed, +.embed-responsive object, +.embed-responsive video { + position: absolute; + top: 0; + bottom: 0; + right: 0; + width: 100%; + height: 100%; + border: 0; +} + +.embed-responsive-21by9::before { + padding-top: 42.85714286%; +} + +.embed-responsive-16by9::before { + padding-top: 56.25%; +} + +.embed-responsive-4by3::before { + padding-top: 75%; +} + +.embed-responsive-1by1::before { + padding-top: 100%; +} + +.flex-row { + -ms-flex-direction: row !important; + flex-direction: row !important; +} + +.flex-column { + -ms-flex-direction: column !important; + flex-direction: column !important; +} + +.flex-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; +} + +.flex-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; +} + +.flex-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; +} + +.flex-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; +} + +.flex-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; +} + +.flex-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; +} + +.flex-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; +} + +.flex-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; +} + +.flex-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; +} + +.flex-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; +} + +.justify-content-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; +} + +.justify-content-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; +} + +.justify-content-center { + -ms-flex-pack: center !important; + justify-content: center !important; +} + +.justify-content-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; +} + +.justify-content-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; +} + +.align-items-start { + -ms-flex-align: start !important; + align-items: flex-start !important; +} + +.align-items-end { + -ms-flex-align: end !important; + align-items: flex-end !important; +} + +.align-items-center { + -ms-flex-align: center !important; + align-items: center !important; +} + +.align-items-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; +} + +.align-items-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; +} + +.align-content-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; +} + +.align-content-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; +} + +.align-content-center { + -ms-flex-line-pack: center !important; + align-content: center !important; +} + +.align-content-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; +} + +.align-content-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; +} + +.align-content-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; +} + +.align-self-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; +} + +.align-self-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; +} + +.align-self-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; +} + +.align-self-center { + -ms-flex-item-align: center !important; + align-self: center !important; +} + +.align-self-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; +} + +.align-self-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; +} + +@media (min-width: 576px) { + .flex-sm-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-sm-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-sm-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-sm-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-sm-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-sm-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-sm-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-sm-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-sm-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-sm-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-sm-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-sm-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-sm-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-sm-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-sm-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-sm-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-sm-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-sm-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-sm-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-sm-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-sm-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-sm-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-sm-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-sm-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-sm-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-sm-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-sm-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-sm-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-sm-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-sm-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-sm-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-sm-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-sm-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-sm-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 768px) { + .flex-md-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-md-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-md-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-md-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-md-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-md-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-md-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-md-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-md-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-md-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-md-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-md-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-md-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-md-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-md-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-md-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-md-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-md-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-md-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-md-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-md-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-md-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-md-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-md-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-md-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-md-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-md-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-md-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-md-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-md-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-md-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-md-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-md-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-md-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 992px) { + .flex-lg-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-lg-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-lg-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-lg-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-lg-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-lg-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-lg-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-lg-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-lg-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-lg-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-lg-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-lg-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-lg-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-lg-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-lg-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-lg-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-lg-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-lg-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-lg-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-lg-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-lg-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-lg-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-lg-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-lg-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-lg-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-lg-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-lg-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-lg-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-lg-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-lg-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-lg-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-lg-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-lg-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-lg-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 1280px) { + .flex-xl-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-xl-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-xl-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-xl-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-xl-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-xl-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-xl-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .flex-xl-fill { + -ms-flex: 1 1 auto !important; + flex: 1 1 auto !important; + } + .flex-xl-grow-0 { + -ms-flex-positive: 0 !important; + flex-grow: 0 !important; + } + .flex-xl-grow-1 { + -ms-flex-positive: 1 !important; + flex-grow: 1 !important; + } + .flex-xl-shrink-0 { + -ms-flex-negative: 0 !important; + flex-shrink: 0 !important; + } + .flex-xl-shrink-1 { + -ms-flex-negative: 1 !important; + flex-shrink: 1 !important; + } + .justify-content-xl-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-xl-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-xl-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-xl-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-xl-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-xl-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-xl-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-xl-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-xl-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-xl-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-xl-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-xl-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-xl-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-xl-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-xl-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-xl-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-xl-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-xl-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-xl-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-xl-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-xl-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-xl-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +.float-left { + float: right !important; +} + +.float-right { + float: left !important; +} + +.float-none { + float: none !important; +} + +@media (min-width: 576px) { + .float-sm-left { + float: right !important; + } + .float-sm-right { + float: left !important; + } + .float-sm-none { + float: none !important; + } +} + +@media (min-width: 768px) { + .float-md-left { + float: right !important; + } + .float-md-right { + float: left !important; + } + .float-md-none { + float: none !important; + } +} + +@media (min-width: 992px) { + .float-lg-left { + float: right !important; + } + .float-lg-right { + float: left !important; + } + .float-lg-none { + float: none !important; + } +} + +@media (min-width: 1280px) { + .float-xl-left { + float: right !important; + } + .float-xl-right { + float: left !important; + } + .float-xl-none { + float: none !important; + } +} + +.position-static { + position: static !important; +} + +.position-relative { + position: relative !important; +} + +.position-absolute { + position: absolute !important; +} + +.position-fixed { + position: fixed !important; +} + +.position-sticky { + position: -webkit-sticky !important; + position: sticky !important; +} + +.fixed-top { + position: fixed; + top: 0; + left: 0; + right: 0; + z-index: 1030; +} + +.fixed-bottom { + position: fixed; + left: 0; + bottom: 0; + right: 0; + z-index: 1030; +} + +@supports ((position: -webkit-sticky) or (position: sticky)) { + .sticky-top { + position: -webkit-sticky; + position: sticky; + top: 0; + z-index: 1020; + } +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border: 0; +} + +.sr-only-focusable:active, .sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + overflow: visible; + clip: auto; + white-space: normal; +} + +.shadow-sm { + box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; +} + +.shadow { + box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; +} + +.shadow-lg { + box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.w-25 { + width: 25% !important; +} + +.w-50 { + width: 50% !important; +} + +.w-75 { + width: 75% !important; +} + +.w-100 { + width: 100% !important; +} + +.w-auto { + width: auto !important; +} + +.w-0 { + width: 0 !important; +} + +.w-1 { + width: 0.25rem !important; +} + +.w-2 { + width: 0.5rem !important; +} + +.w-3 { + width: 0.75rem !important; +} + +.w-4 { + width: 1rem !important; +} + +.w-5 { + width: 1.5rem !important; +} + +.w-6 { + width: 2rem !important; +} + +.w-7 { + width: 3rem !important; +} + +.w-8 { + width: 4rem !important; +} + +.w-9 { + width: 6rem !important; +} + +.h-25 { + height: 25% !important; +} + +.h-50 { + height: 50% !important; +} + +.h-75 { + height: 75% !important; +} + +.h-100 { + height: 100% !important; +} + +.h-auto { + height: auto !important; +} + +.h-0 { + height: 0 !important; +} + +.h-1 { + height: 0.25rem !important; +} + +.h-2 { + height: 0.5rem !important; +} + +.h-3 { + height: 0.75rem !important; +} + +.h-4 { + height: 1rem !important; +} + +.h-5 { + height: 1.5rem !important; +} + +.h-6 { + height: 2rem !important; +} + +.h-7 { + height: 3rem !important; +} + +.h-8 { + height: 4rem !important; +} + +.h-9 { + height: 6rem !important; +} + +.mw-100 { + max-width: 100% !important; +} + +.mh-100 { + max-height: 100% !important; +} + +.m-0 { + margin: 0 !important; +} + +.mt-0, +.my-0 { + margin-top: 0 !important; +} + +.mr-0, +.mx-0 { + margin-left: 0 !important; +} + +.mb-0, +.my-0 { + margin-bottom: 0 !important; +} + +.ml-0, +.mx-0 { + margin-right: 0 !important; +} + +.m-1 { + margin: 0.25rem !important; +} + +.mt-1, +.my-1 { + margin-top: 0.25rem !important; +} + +.mr-1, +.mx-1 { + margin-left: 0.25rem !important; +} + +.mb-1, +.my-1 { + margin-bottom: 0.25rem !important; +} + +.ml-1, +.mx-1 { + margin-right: 0.25rem !important; +} + +.m-2 { + margin: 0.5rem !important; +} + +.mt-2, +.my-2 { + margin-top: 0.5rem !important; +} + +.mr-2, +.mx-2 { + margin-left: 0.5rem !important; +} + +.mb-2, +.my-2 { + margin-bottom: 0.5rem !important; +} + +.ml-2, +.mx-2 { + margin-right: 0.5rem !important; +} + +.m-3 { + margin: 0.75rem !important; +} + +.mt-3, +.my-3 { + margin-top: 0.75rem !important; +} + +.mr-3, +.mx-3 { + margin-left: 0.75rem !important; +} + +.mb-3, +.my-3 { + margin-bottom: 0.75rem !important; +} + +.ml-3, +.mx-3 { + margin-right: 0.75rem !important; +} + +.m-4 { + margin: 1rem !important; +} + +.mt-4, +.my-4 { + margin-top: 1rem !important; +} + +.mr-4, +.mx-4 { + margin-left: 1rem !important; +} + +.mb-4, +.my-4 { + margin-bottom: 1rem !important; +} + +.ml-4, +.mx-4 { + margin-right: 1rem !important; +} + +.m-5 { + margin: 1.5rem !important; +} + +.mt-5, +.my-5 { + margin-top: 1.5rem !important; +} + +.mr-5, +.mx-5 { + margin-left: 1.5rem !important; +} + +.mb-5, +.my-5 { + margin-bottom: 1.5rem !important; +} + +.ml-5, +.mx-5 { + margin-right: 1.5rem !important; +} + +.m-6 { + margin: 2rem !important; +} + +.mt-6, +.my-6 { + margin-top: 2rem !important; +} + +.mr-6, +.mx-6 { + margin-left: 2rem !important; +} + +.mb-6, +.my-6 { + margin-bottom: 2rem !important; +} + +.ml-6, +.mx-6 { + margin-right: 2rem !important; +} + +.m-7 { + margin: 3rem !important; +} + +.mt-7, +.my-7 { + margin-top: 3rem !important; +} + +.mr-7, +.mx-7 { + margin-left: 3rem !important; +} + +.mb-7, +.my-7 { + margin-bottom: 3rem !important; +} + +.ml-7, +.mx-7 { + margin-right: 3rem !important; +} + +.m-8 { + margin: 4rem !important; +} + +.mt-8, +.my-8 { + margin-top: 4rem !important; +} + +.mr-8, +.mx-8 { + margin-left: 4rem !important; +} + +.mb-8, +.my-8 { + margin-bottom: 4rem !important; +} + +.ml-8, +.mx-8 { + margin-right: 4rem !important; +} + +.m-9 { + margin: 6rem !important; +} + +.mt-9, +.my-9 { + margin-top: 6rem !important; +} + +.mr-9, +.mx-9 { + margin-left: 6rem !important; +} + +.mb-9, +.my-9 { + margin-bottom: 6rem !important; +} + +.ml-9, +.mx-9 { + margin-right: 6rem !important; +} + +.p-0 { + padding: 0 !important; +} + +.pt-0, +.py-0 { + padding-top: 0 !important; +} + +.pr-0, +.px-0 { + padding-left: 0 !important; +} + +.pb-0, +.py-0 { + padding-bottom: 0 !important; +} + +.pl-0, +.px-0 { + padding-right: 0 !important; +} + +.p-1 { + padding: 0.25rem !important; +} + +.pt-1, +.py-1 { + padding-top: 0.25rem !important; +} + +.pr-1, +.px-1 { + padding-left: 0.25rem !important; +} + +.pb-1, +.py-1 { + padding-bottom: 0.25rem !important; +} + +.pl-1, +.px-1 { + padding-right: 0.25rem !important; +} + +.p-2 { + padding: 0.5rem !important; +} + +.pt-2, +.py-2 { + padding-top: 0.5rem !important; +} + +.pr-2, +.px-2 { + padding-left: 0.5rem !important; +} + +.pb-2, +.py-2 { + padding-bottom: 0.5rem !important; +} + +.pl-2, +.px-2 { + padding-right: 0.5rem !important; +} + +.p-3 { + padding: 0.75rem !important; +} + +.pt-3, +.py-3 { + padding-top: 0.75rem !important; +} + +.pr-3, +.px-3 { + padding-left: 0.75rem !important; +} + +.pb-3, +.py-3 { + padding-bottom: 0.75rem !important; +} + +.pl-3, +.px-3 { + padding-right: 0.75rem !important; +} + +.p-4 { + padding: 1rem !important; +} + +.pt-4, +.py-4 { + padding-top: 1rem !important; +} + +.pr-4, +.px-4 { + padding-left: 1rem !important; +} + +.pb-4, +.py-4 { + padding-bottom: 1rem !important; +} + +.pl-4, +.px-4 { + padding-right: 1rem !important; +} + +.p-5 { + padding: 1.5rem !important; +} + +.pt-5, +.py-5 { + padding-top: 1.5rem !important; +} + +.pr-5, +.px-5 { + padding-left: 1.5rem !important; +} + +.pb-5, +.py-5 { + padding-bottom: 1.5rem !important; +} + +.pl-5, +.px-5 { + padding-right: 1.5rem !important; +} + +.p-6 { + padding: 2rem !important; +} + +.pt-6, +.py-6 { + padding-top: 2rem !important; +} + +.pr-6, +.px-6 { + padding-left: 2rem !important; +} + +.pb-6, +.py-6 { + padding-bottom: 2rem !important; +} + +.pl-6, +.px-6 { + padding-right: 2rem !important; +} + +.p-7 { + padding: 3rem !important; +} + +.pt-7, +.py-7 { + padding-top: 3rem !important; +} + +.pr-7, +.px-7 { + padding-left: 3rem !important; +} + +.pb-7, +.py-7 { + padding-bottom: 3rem !important; +} + +.pl-7, +.px-7 { + padding-right: 3rem !important; +} + +.p-8 { + padding: 4rem !important; +} + +.pt-8, +.py-8 { + padding-top: 4rem !important; +} + +.pr-8, +.px-8 { + padding-left: 4rem !important; +} + +.pb-8, +.py-8 { + padding-bottom: 4rem !important; +} + +.pl-8, +.px-8 { + padding-right: 4rem !important; +} + +.p-9 { + padding: 6rem !important; +} + +.pt-9, +.py-9 { + padding-top: 6rem !important; +} + +.pr-9, +.px-9 { + padding-left: 6rem !important; +} + +.pb-9, +.py-9 { + padding-bottom: 6rem !important; +} + +.pl-9, +.px-9 { + padding-right: 6rem !important; +} + +.m-auto { + margin: auto !important; +} + +.mt-auto, +.my-auto { + margin-top: auto !important; +} + +.mr-auto, +.mx-auto { + margin-left: auto !important; +} + +.mb-auto, +.my-auto { + margin-bottom: auto !important; +} + +.ml-auto, +.mx-auto { + margin-right: auto !important; +} + +@media (min-width: 576px) { + .m-sm-0 { + margin: 0 !important; + } + .mt-sm-0, + .my-sm-0 { + margin-top: 0 !important; + } + .mr-sm-0, + .mx-sm-0 { + margin-left: 0 !important; + } + .mb-sm-0, + .my-sm-0 { + margin-bottom: 0 !important; + } + .ml-sm-0, + .mx-sm-0 { + margin-right: 0 !important; + } + .m-sm-1 { + margin: 0.25rem !important; + } + .mt-sm-1, + .my-sm-1 { + margin-top: 0.25rem !important; + } + .mr-sm-1, + .mx-sm-1 { + margin-left: 0.25rem !important; + } + .mb-sm-1, + .my-sm-1 { + margin-bottom: 0.25rem !important; + } + .ml-sm-1, + .mx-sm-1 { + margin-right: 0.25rem !important; + } + .m-sm-2 { + margin: 0.5rem !important; + } + .mt-sm-2, + .my-sm-2 { + margin-top: 0.5rem !important; + } + .mr-sm-2, + .mx-sm-2 { + margin-left: 0.5rem !important; + } + .mb-sm-2, + .my-sm-2 { + margin-bottom: 0.5rem !important; + } + .ml-sm-2, + .mx-sm-2 { + margin-right: 0.5rem !important; + } + .m-sm-3 { + margin: 0.75rem !important; + } + .mt-sm-3, + .my-sm-3 { + margin-top: 0.75rem !important; + } + .mr-sm-3, + .mx-sm-3 { + margin-left: 0.75rem !important; + } + .mb-sm-3, + .my-sm-3 { + margin-bottom: 0.75rem !important; + } + .ml-sm-3, + .mx-sm-3 { + margin-right: 0.75rem !important; + } + .m-sm-4 { + margin: 1rem !important; + } + .mt-sm-4, + .my-sm-4 { + margin-top: 1rem !important; + } + .mr-sm-4, + .mx-sm-4 { + margin-left: 1rem !important; + } + .mb-sm-4, + .my-sm-4 { + margin-bottom: 1rem !important; + } + .ml-sm-4, + .mx-sm-4 { + margin-right: 1rem !important; + } + .m-sm-5 { + margin: 1.5rem !important; + } + .mt-sm-5, + .my-sm-5 { + margin-top: 1.5rem !important; + } + .mr-sm-5, + .mx-sm-5 { + margin-left: 1.5rem !important; + } + .mb-sm-5, + .my-sm-5 { + margin-bottom: 1.5rem !important; + } + .ml-sm-5, + .mx-sm-5 { + margin-right: 1.5rem !important; + } + .m-sm-6 { + margin: 2rem !important; + } + .mt-sm-6, + .my-sm-6 { + margin-top: 2rem !important; + } + .mr-sm-6, + .mx-sm-6 { + margin-left: 2rem !important; + } + .mb-sm-6, + .my-sm-6 { + margin-bottom: 2rem !important; + } + .ml-sm-6, + .mx-sm-6 { + margin-right: 2rem !important; + } + .m-sm-7 { + margin: 3rem !important; + } + .mt-sm-7, + .my-sm-7 { + margin-top: 3rem !important; + } + .mr-sm-7, + .mx-sm-7 { + margin-left: 3rem !important; + } + .mb-sm-7, + .my-sm-7 { + margin-bottom: 3rem !important; + } + .ml-sm-7, + .mx-sm-7 { + margin-right: 3rem !important; + } + .m-sm-8 { + margin: 4rem !important; + } + .mt-sm-8, + .my-sm-8 { + margin-top: 4rem !important; + } + .mr-sm-8, + .mx-sm-8 { + margin-left: 4rem !important; + } + .mb-sm-8, + .my-sm-8 { + margin-bottom: 4rem !important; + } + .ml-sm-8, + .mx-sm-8 { + margin-right: 4rem !important; + } + .m-sm-9 { + margin: 6rem !important; + } + .mt-sm-9, + .my-sm-9 { + margin-top: 6rem !important; + } + .mr-sm-9, + .mx-sm-9 { + margin-left: 6rem !important; + } + .mb-sm-9, + .my-sm-9 { + margin-bottom: 6rem !important; + } + .ml-sm-9, + .mx-sm-9 { + margin-right: 6rem !important; + } + .p-sm-0 { + padding: 0 !important; + } + .pt-sm-0, + .py-sm-0 { + padding-top: 0 !important; + } + .pr-sm-0, + .px-sm-0 { + padding-left: 0 !important; + } + .pb-sm-0, + .py-sm-0 { + padding-bottom: 0 !important; + } + .pl-sm-0, + .px-sm-0 { + padding-right: 0 !important; + } + .p-sm-1 { + padding: 0.25rem !important; + } + .pt-sm-1, + .py-sm-1 { + padding-top: 0.25rem !important; + } + .pr-sm-1, + .px-sm-1 { + padding-left: 0.25rem !important; + } + .pb-sm-1, + .py-sm-1 { + padding-bottom: 0.25rem !important; + } + .pl-sm-1, + .px-sm-1 { + padding-right: 0.25rem !important; + } + .p-sm-2 { + padding: 0.5rem !important; + } + .pt-sm-2, + .py-sm-2 { + padding-top: 0.5rem !important; + } + .pr-sm-2, + .px-sm-2 { + padding-left: 0.5rem !important; + } + .pb-sm-2, + .py-sm-2 { + padding-bottom: 0.5rem !important; + } + .pl-sm-2, + .px-sm-2 { + padding-right: 0.5rem !important; + } + .p-sm-3 { + padding: 0.75rem !important; + } + .pt-sm-3, + .py-sm-3 { + padding-top: 0.75rem !important; + } + .pr-sm-3, + .px-sm-3 { + padding-left: 0.75rem !important; + } + .pb-sm-3, + .py-sm-3 { + padding-bottom: 0.75rem !important; + } + .pl-sm-3, + .px-sm-3 { + padding-right: 0.75rem !important; + } + .p-sm-4 { + padding: 1rem !important; + } + .pt-sm-4, + .py-sm-4 { + padding-top: 1rem !important; + } + .pr-sm-4, + .px-sm-4 { + padding-left: 1rem !important; + } + .pb-sm-4, + .py-sm-4 { + padding-bottom: 1rem !important; + } + .pl-sm-4, + .px-sm-4 { + padding-right: 1rem !important; + } + .p-sm-5 { + padding: 1.5rem !important; + } + .pt-sm-5, + .py-sm-5 { + padding-top: 1.5rem !important; + } + .pr-sm-5, + .px-sm-5 { + padding-left: 1.5rem !important; + } + .pb-sm-5, + .py-sm-5 { + padding-bottom: 1.5rem !important; + } + .pl-sm-5, + .px-sm-5 { + padding-right: 1.5rem !important; + } + .p-sm-6 { + padding: 2rem !important; + } + .pt-sm-6, + .py-sm-6 { + padding-top: 2rem !important; + } + .pr-sm-6, + .px-sm-6 { + padding-left: 2rem !important; + } + .pb-sm-6, + .py-sm-6 { + padding-bottom: 2rem !important; + } + .pl-sm-6, + .px-sm-6 { + padding-right: 2rem !important; + } + .p-sm-7 { + padding: 3rem !important; + } + .pt-sm-7, + .py-sm-7 { + padding-top: 3rem !important; + } + .pr-sm-7, + .px-sm-7 { + padding-left: 3rem !important; + } + .pb-sm-7, + .py-sm-7 { + padding-bottom: 3rem !important; + } + .pl-sm-7, + .px-sm-7 { + padding-right: 3rem !important; + } + .p-sm-8 { + padding: 4rem !important; + } + .pt-sm-8, + .py-sm-8 { + padding-top: 4rem !important; + } + .pr-sm-8, + .px-sm-8 { + padding-left: 4rem !important; + } + .pb-sm-8, + .py-sm-8 { + padding-bottom: 4rem !important; + } + .pl-sm-8, + .px-sm-8 { + padding-right: 4rem !important; + } + .p-sm-9 { + padding: 6rem !important; + } + .pt-sm-9, + .py-sm-9 { + padding-top: 6rem !important; + } + .pr-sm-9, + .px-sm-9 { + padding-left: 6rem !important; + } + .pb-sm-9, + .py-sm-9 { + padding-bottom: 6rem !important; + } + .pl-sm-9, + .px-sm-9 { + padding-right: 6rem !important; + } + .m-sm-auto { + margin: auto !important; + } + .mt-sm-auto, + .my-sm-auto { + margin-top: auto !important; + } + .mr-sm-auto, + .mx-sm-auto { + margin-left: auto !important; + } + .mb-sm-auto, + .my-sm-auto { + margin-bottom: auto !important; + } + .ml-sm-auto, + .mx-sm-auto { + margin-right: auto !important; + } +} + +@media (min-width: 768px) { + .m-md-0 { + margin: 0 !important; + } + .mt-md-0, + .my-md-0 { + margin-top: 0 !important; + } + .mr-md-0, + .mx-md-0 { + margin-left: 0 !important; + } + .mb-md-0, + .my-md-0 { + margin-bottom: 0 !important; + } + .ml-md-0, + .mx-md-0 { + margin-right: 0 !important; + } + .m-md-1 { + margin: 0.25rem !important; + } + .mt-md-1, + .my-md-1 { + margin-top: 0.25rem !important; + } + .mr-md-1, + .mx-md-1 { + margin-left: 0.25rem !important; + } + .mb-md-1, + .my-md-1 { + margin-bottom: 0.25rem !important; + } + .ml-md-1, + .mx-md-1 { + margin-right: 0.25rem !important; + } + .m-md-2 { + margin: 0.5rem !important; + } + .mt-md-2, + .my-md-2 { + margin-top: 0.5rem !important; + } + .mr-md-2, + .mx-md-2 { + margin-left: 0.5rem !important; + } + .mb-md-2, + .my-md-2 { + margin-bottom: 0.5rem !important; + } + .ml-md-2, + .mx-md-2 { + margin-right: 0.5rem !important; + } + .m-md-3 { + margin: 0.75rem !important; + } + .mt-md-3, + .my-md-3 { + margin-top: 0.75rem !important; + } + .mr-md-3, + .mx-md-3 { + margin-left: 0.75rem !important; + } + .mb-md-3, + .my-md-3 { + margin-bottom: 0.75rem !important; + } + .ml-md-3, + .mx-md-3 { + margin-right: 0.75rem !important; + } + .m-md-4 { + margin: 1rem !important; + } + .mt-md-4, + .my-md-4 { + margin-top: 1rem !important; + } + .mr-md-4, + .mx-md-4 { + margin-left: 1rem !important; + } + .mb-md-4, + .my-md-4 { + margin-bottom: 1rem !important; + } + .ml-md-4, + .mx-md-4 { + margin-right: 1rem !important; + } + .m-md-5 { + margin: 1.5rem !important; + } + .mt-md-5, + .my-md-5 { + margin-top: 1.5rem !important; + } + .mr-md-5, + .mx-md-5 { + margin-left: 1.5rem !important; + } + .mb-md-5, + .my-md-5 { + margin-bottom: 1.5rem !important; + } + .ml-md-5, + .mx-md-5 { + margin-right: 1.5rem !important; + } + .m-md-6 { + margin: 2rem !important; + } + .mt-md-6, + .my-md-6 { + margin-top: 2rem !important; + } + .mr-md-6, + .mx-md-6 { + margin-left: 2rem !important; + } + .mb-md-6, + .my-md-6 { + margin-bottom: 2rem !important; + } + .ml-md-6, + .mx-md-6 { + margin-right: 2rem !important; + } + .m-md-7 { + margin: 3rem !important; + } + .mt-md-7, + .my-md-7 { + margin-top: 3rem !important; + } + .mr-md-7, + .mx-md-7 { + margin-left: 3rem !important; + } + .mb-md-7, + .my-md-7 { + margin-bottom: 3rem !important; + } + .ml-md-7, + .mx-md-7 { + margin-right: 3rem !important; + } + .m-md-8 { + margin: 4rem !important; + } + .mt-md-8, + .my-md-8 { + margin-top: 4rem !important; + } + .mr-md-8, + .mx-md-8 { + margin-left: 4rem !important; + } + .mb-md-8, + .my-md-8 { + margin-bottom: 4rem !important; + } + .ml-md-8, + .mx-md-8 { + margin-right: 4rem !important; + } + .m-md-9 { + margin: 6rem !important; + } + .mt-md-9, + .my-md-9 { + margin-top: 6rem !important; + } + .mr-md-9, + .mx-md-9 { + margin-left: 6rem !important; + } + .mb-md-9, + .my-md-9 { + margin-bottom: 6rem !important; + } + .ml-md-9, + .mx-md-9 { + margin-right: 6rem !important; + } + .p-md-0 { + padding: 0 !important; + } + .pt-md-0, + .py-md-0 { + padding-top: 0 !important; + } + .pr-md-0, + .px-md-0 { + padding-left: 0 !important; + } + .pb-md-0, + .py-md-0 { + padding-bottom: 0 !important; + } + .pl-md-0, + .px-md-0 { + padding-right: 0 !important; + } + .p-md-1 { + padding: 0.25rem !important; + } + .pt-md-1, + .py-md-1 { + padding-top: 0.25rem !important; + } + .pr-md-1, + .px-md-1 { + padding-left: 0.25rem !important; + } + .pb-md-1, + .py-md-1 { + padding-bottom: 0.25rem !important; + } + .pl-md-1, + .px-md-1 { + padding-right: 0.25rem !important; + } + .p-md-2 { + padding: 0.5rem !important; + } + .pt-md-2, + .py-md-2 { + padding-top: 0.5rem !important; + } + .pr-md-2, + .px-md-2 { + padding-left: 0.5rem !important; + } + .pb-md-2, + .py-md-2 { + padding-bottom: 0.5rem !important; + } + .pl-md-2, + .px-md-2 { + padding-right: 0.5rem !important; + } + .p-md-3 { + padding: 0.75rem !important; + } + .pt-md-3, + .py-md-3 { + padding-top: 0.75rem !important; + } + .pr-md-3, + .px-md-3 { + padding-left: 0.75rem !important; + } + .pb-md-3, + .py-md-3 { + padding-bottom: 0.75rem !important; + } + .pl-md-3, + .px-md-3 { + padding-right: 0.75rem !important; + } + .p-md-4 { + padding: 1rem !important; + } + .pt-md-4, + .py-md-4 { + padding-top: 1rem !important; + } + .pr-md-4, + .px-md-4 { + padding-left: 1rem !important; + } + .pb-md-4, + .py-md-4 { + padding-bottom: 1rem !important; + } + .pl-md-4, + .px-md-4 { + padding-right: 1rem !important; + } + .p-md-5 { + padding: 1.5rem !important; + } + .pt-md-5, + .py-md-5 { + padding-top: 1.5rem !important; + } + .pr-md-5, + .px-md-5 { + padding-left: 1.5rem !important; + } + .pb-md-5, + .py-md-5 { + padding-bottom: 1.5rem !important; + } + .pl-md-5, + .px-md-5 { + padding-right: 1.5rem !important; + } + .p-md-6 { + padding: 2rem !important; + } + .pt-md-6, + .py-md-6 { + padding-top: 2rem !important; + } + .pr-md-6, + .px-md-6 { + padding-left: 2rem !important; + } + .pb-md-6, + .py-md-6 { + padding-bottom: 2rem !important; + } + .pl-md-6, + .px-md-6 { + padding-right: 2rem !important; + } + .p-md-7 { + padding: 3rem !important; + } + .pt-md-7, + .py-md-7 { + padding-top: 3rem !important; + } + .pr-md-7, + .px-md-7 { + padding-left: 3rem !important; + } + .pb-md-7, + .py-md-7 { + padding-bottom: 3rem !important; + } + .pl-md-7, + .px-md-7 { + padding-right: 3rem !important; + } + .p-md-8 { + padding: 4rem !important; + } + .pt-md-8, + .py-md-8 { + padding-top: 4rem !important; + } + .pr-md-8, + .px-md-8 { + padding-left: 4rem !important; + } + .pb-md-8, + .py-md-8 { + padding-bottom: 4rem !important; + } + .pl-md-8, + .px-md-8 { + padding-right: 4rem !important; + } + .p-md-9 { + padding: 6rem !important; + } + .pt-md-9, + .py-md-9 { + padding-top: 6rem !important; + } + .pr-md-9, + .px-md-9 { + padding-left: 6rem !important; + } + .pb-md-9, + .py-md-9 { + padding-bottom: 6rem !important; + } + .pl-md-9, + .px-md-9 { + padding-right: 6rem !important; + } + .m-md-auto { + margin: auto !important; + } + .mt-md-auto, + .my-md-auto { + margin-top: auto !important; + } + .mr-md-auto, + .mx-md-auto { + margin-left: auto !important; + } + .mb-md-auto, + .my-md-auto { + margin-bottom: auto !important; + } + .ml-md-auto, + .mx-md-auto { + margin-right: auto !important; + } +} + +@media (min-width: 992px) { + .m-lg-0 { + margin: 0 !important; + } + .mt-lg-0, + .my-lg-0 { + margin-top: 0 !important; + } + .mr-lg-0, + .mx-lg-0 { + margin-left: 0 !important; + } + .mb-lg-0, + .my-lg-0 { + margin-bottom: 0 !important; + } + .ml-lg-0, + .mx-lg-0 { + margin-right: 0 !important; + } + .m-lg-1 { + margin: 0.25rem !important; + } + .mt-lg-1, + .my-lg-1 { + margin-top: 0.25rem !important; + } + .mr-lg-1, + .mx-lg-1 { + margin-left: 0.25rem !important; + } + .mb-lg-1, + .my-lg-1 { + margin-bottom: 0.25rem !important; + } + .ml-lg-1, + .mx-lg-1 { + margin-right: 0.25rem !important; + } + .m-lg-2 { + margin: 0.5rem !important; + } + .mt-lg-2, + .my-lg-2 { + margin-top: 0.5rem !important; + } + .mr-lg-2, + .mx-lg-2 { + margin-left: 0.5rem !important; + } + .mb-lg-2, + .my-lg-2 { + margin-bottom: 0.5rem !important; + } + .ml-lg-2, + .mx-lg-2 { + margin-right: 0.5rem !important; + } + .m-lg-3 { + margin: 0.75rem !important; + } + .mt-lg-3, + .my-lg-3 { + margin-top: 0.75rem !important; + } + .mr-lg-3, + .mx-lg-3 { + margin-left: 0.75rem !important; + } + .mb-lg-3, + .my-lg-3 { + margin-bottom: 0.75rem !important; + } + .ml-lg-3, + .mx-lg-3 { + margin-right: 0.75rem !important; + } + .m-lg-4 { + margin: 1rem !important; + } + .mt-lg-4, + .my-lg-4 { + margin-top: 1rem !important; + } + .mr-lg-4, + .mx-lg-4 { + margin-left: 1rem !important; + } + .mb-lg-4, + .my-lg-4 { + margin-bottom: 1rem !important; + } + .ml-lg-4, + .mx-lg-4 { + margin-right: 1rem !important; + } + .m-lg-5 { + margin: 1.5rem !important; + } + .mt-lg-5, + .my-lg-5 { + margin-top: 1.5rem !important; + } + .mr-lg-5, + .mx-lg-5 { + margin-left: 1.5rem !important; + } + .mb-lg-5, + .my-lg-5 { + margin-bottom: 1.5rem !important; + } + .ml-lg-5, + .mx-lg-5 { + margin-right: 1.5rem !important; + } + .m-lg-6 { + margin: 2rem !important; + } + .mt-lg-6, + .my-lg-6 { + margin-top: 2rem !important; + } + .mr-lg-6, + .mx-lg-6 { + margin-left: 2rem !important; + } + .mb-lg-6, + .my-lg-6 { + margin-bottom: 2rem !important; + } + .ml-lg-6, + .mx-lg-6 { + margin-right: 2rem !important; + } + .m-lg-7 { + margin: 3rem !important; + } + .mt-lg-7, + .my-lg-7 { + margin-top: 3rem !important; + } + .mr-lg-7, + .mx-lg-7 { + margin-left: 3rem !important; + } + .mb-lg-7, + .my-lg-7 { + margin-bottom: 3rem !important; + } + .ml-lg-7, + .mx-lg-7 { + margin-right: 3rem !important; + } + .m-lg-8 { + margin: 4rem !important; + } + .mt-lg-8, + .my-lg-8 { + margin-top: 4rem !important; + } + .mr-lg-8, + .mx-lg-8 { + margin-left: 4rem !important; + } + .mb-lg-8, + .my-lg-8 { + margin-bottom: 4rem !important; + } + .ml-lg-8, + .mx-lg-8 { + margin-right: 4rem !important; + } + .m-lg-9 { + margin: 6rem !important; + } + .mt-lg-9, + .my-lg-9 { + margin-top: 6rem !important; + } + .mr-lg-9, + .mx-lg-9 { + margin-left: 6rem !important; + } + .mb-lg-9, + .my-lg-9 { + margin-bottom: 6rem !important; + } + .ml-lg-9, + .mx-lg-9 { + margin-right: 6rem !important; + } + .p-lg-0 { + padding: 0 !important; + } + .pt-lg-0, + .py-lg-0 { + padding-top: 0 !important; + } + .pr-lg-0, + .px-lg-0 { + padding-left: 0 !important; + } + .pb-lg-0, + .py-lg-0 { + padding-bottom: 0 !important; + } + .pl-lg-0, + .px-lg-0 { + padding-right: 0 !important; + } + .p-lg-1 { + padding: 0.25rem !important; + } + .pt-lg-1, + .py-lg-1 { + padding-top: 0.25rem !important; + } + .pr-lg-1, + .px-lg-1 { + padding-left: 0.25rem !important; + } + .pb-lg-1, + .py-lg-1 { + padding-bottom: 0.25rem !important; + } + .pl-lg-1, + .px-lg-1 { + padding-right: 0.25rem !important; + } + .p-lg-2 { + padding: 0.5rem !important; + } + .pt-lg-2, + .py-lg-2 { + padding-top: 0.5rem !important; + } + .pr-lg-2, + .px-lg-2 { + padding-left: 0.5rem !important; + } + .pb-lg-2, + .py-lg-2 { + padding-bottom: 0.5rem !important; + } + .pl-lg-2, + .px-lg-2 { + padding-right: 0.5rem !important; + } + .p-lg-3 { + padding: 0.75rem !important; + } + .pt-lg-3, + .py-lg-3 { + padding-top: 0.75rem !important; + } + .pr-lg-3, + .px-lg-3 { + padding-left: 0.75rem !important; + } + .pb-lg-3, + .py-lg-3 { + padding-bottom: 0.75rem !important; + } + .pl-lg-3, + .px-lg-3 { + padding-right: 0.75rem !important; + } + .p-lg-4 { + padding: 1rem !important; + } + .pt-lg-4, + .py-lg-4 { + padding-top: 1rem !important; + } + .pr-lg-4, + .px-lg-4 { + padding-left: 1rem !important; + } + .pb-lg-4, + .py-lg-4 { + padding-bottom: 1rem !important; + } + .pl-lg-4, + .px-lg-4 { + padding-right: 1rem !important; + } + .p-lg-5 { + padding: 1.5rem !important; + } + .pt-lg-5, + .py-lg-5 { + padding-top: 1.5rem !important; + } + .pr-lg-5, + .px-lg-5 { + padding-left: 1.5rem !important; + } + .pb-lg-5, + .py-lg-5 { + padding-bottom: 1.5rem !important; + } + .pl-lg-5, + .px-lg-5 { + padding-right: 1.5rem !important; + } + .p-lg-6 { + padding: 2rem !important; + } + .pt-lg-6, + .py-lg-6 { + padding-top: 2rem !important; + } + .pr-lg-6, + .px-lg-6 { + padding-left: 2rem !important; + } + .pb-lg-6, + .py-lg-6 { + padding-bottom: 2rem !important; + } + .pl-lg-6, + .px-lg-6 { + padding-right: 2rem !important; + } + .p-lg-7 { + padding: 3rem !important; + } + .pt-lg-7, + .py-lg-7 { + padding-top: 3rem !important; + } + .pr-lg-7, + .px-lg-7 { + padding-left: 3rem !important; + } + .pb-lg-7, + .py-lg-7 { + padding-bottom: 3rem !important; + } + .pl-lg-7, + .px-lg-7 { + padding-right: 3rem !important; + } + .p-lg-8 { + padding: 4rem !important; + } + .pt-lg-8, + .py-lg-8 { + padding-top: 4rem !important; + } + .pr-lg-8, + .px-lg-8 { + padding-left: 4rem !important; + } + .pb-lg-8, + .py-lg-8 { + padding-bottom: 4rem !important; + } + .pl-lg-8, + .px-lg-8 { + padding-right: 4rem !important; + } + .p-lg-9 { + padding: 6rem !important; + } + .pt-lg-9, + .py-lg-9 { + padding-top: 6rem !important; + } + .pr-lg-9, + .px-lg-9 { + padding-left: 6rem !important; + } + .pb-lg-9, + .py-lg-9 { + padding-bottom: 6rem !important; + } + .pl-lg-9, + .px-lg-9 { + padding-right: 6rem !important; + } + .m-lg-auto { + margin: auto !important; + } + .mt-lg-auto, + .my-lg-auto { + margin-top: auto !important; + } + .mr-lg-auto, + .mx-lg-auto { + margin-left: auto !important; + } + .mb-lg-auto, + .my-lg-auto { + margin-bottom: auto !important; + } + .ml-lg-auto, + .mx-lg-auto { + margin-right: auto !important; + } +} + +@media (min-width: 1280px) { + .m-xl-0 { + margin: 0 !important; + } + .mt-xl-0, + .my-xl-0 { + margin-top: 0 !important; + } + .mr-xl-0, + .mx-xl-0 { + margin-left: 0 !important; + } + .mb-xl-0, + .my-xl-0 { + margin-bottom: 0 !important; + } + .ml-xl-0, + .mx-xl-0 { + margin-right: 0 !important; + } + .m-xl-1 { + margin: 0.25rem !important; + } + .mt-xl-1, + .my-xl-1 { + margin-top: 0.25rem !important; + } + .mr-xl-1, + .mx-xl-1 { + margin-left: 0.25rem !important; + } + .mb-xl-1, + .my-xl-1 { + margin-bottom: 0.25rem !important; + } + .ml-xl-1, + .mx-xl-1 { + margin-right: 0.25rem !important; + } + .m-xl-2 { + margin: 0.5rem !important; + } + .mt-xl-2, + .my-xl-2 { + margin-top: 0.5rem !important; + } + .mr-xl-2, + .mx-xl-2 { + margin-left: 0.5rem !important; + } + .mb-xl-2, + .my-xl-2 { + margin-bottom: 0.5rem !important; + } + .ml-xl-2, + .mx-xl-2 { + margin-right: 0.5rem !important; + } + .m-xl-3 { + margin: 0.75rem !important; + } + .mt-xl-3, + .my-xl-3 { + margin-top: 0.75rem !important; + } + .mr-xl-3, + .mx-xl-3 { + margin-left: 0.75rem !important; + } + .mb-xl-3, + .my-xl-3 { + margin-bottom: 0.75rem !important; + } + .ml-xl-3, + .mx-xl-3 { + margin-right: 0.75rem !important; + } + .m-xl-4 { + margin: 1rem !important; + } + .mt-xl-4, + .my-xl-4 { + margin-top: 1rem !important; + } + .mr-xl-4, + .mx-xl-4 { + margin-left: 1rem !important; + } + .mb-xl-4, + .my-xl-4 { + margin-bottom: 1rem !important; + } + .ml-xl-4, + .mx-xl-4 { + margin-right: 1rem !important; + } + .m-xl-5 { + margin: 1.5rem !important; + } + .mt-xl-5, + .my-xl-5 { + margin-top: 1.5rem !important; + } + .mr-xl-5, + .mx-xl-5 { + margin-left: 1.5rem !important; + } + .mb-xl-5, + .my-xl-5 { + margin-bottom: 1.5rem !important; + } + .ml-xl-5, + .mx-xl-5 { + margin-right: 1.5rem !important; + } + .m-xl-6 { + margin: 2rem !important; + } + .mt-xl-6, + .my-xl-6 { + margin-top: 2rem !important; + } + .mr-xl-6, + .mx-xl-6 { + margin-left: 2rem !important; + } + .mb-xl-6, + .my-xl-6 { + margin-bottom: 2rem !important; + } + .ml-xl-6, + .mx-xl-6 { + margin-right: 2rem !important; + } + .m-xl-7 { + margin: 3rem !important; + } + .mt-xl-7, + .my-xl-7 { + margin-top: 3rem !important; + } + .mr-xl-7, + .mx-xl-7 { + margin-left: 3rem !important; + } + .mb-xl-7, + .my-xl-7 { + margin-bottom: 3rem !important; + } + .ml-xl-7, + .mx-xl-7 { + margin-right: 3rem !important; + } + .m-xl-8 { + margin: 4rem !important; + } + .mt-xl-8, + .my-xl-8 { + margin-top: 4rem !important; + } + .mr-xl-8, + .mx-xl-8 { + margin-left: 4rem !important; + } + .mb-xl-8, + .my-xl-8 { + margin-bottom: 4rem !important; + } + .ml-xl-8, + .mx-xl-8 { + margin-right: 4rem !important; + } + .m-xl-9 { + margin: 6rem !important; + } + .mt-xl-9, + .my-xl-9 { + margin-top: 6rem !important; + } + .mr-xl-9, + .mx-xl-9 { + margin-left: 6rem !important; + } + .mb-xl-9, + .my-xl-9 { + margin-bottom: 6rem !important; + } + .ml-xl-9, + .mx-xl-9 { + margin-right: 6rem !important; + } + .p-xl-0 { + padding: 0 !important; + } + .pt-xl-0, + .py-xl-0 { + padding-top: 0 !important; + } + .pr-xl-0, + .px-xl-0 { + padding-left: 0 !important; + } + .pb-xl-0, + .py-xl-0 { + padding-bottom: 0 !important; + } + .pl-xl-0, + .px-xl-0 { + padding-right: 0 !important; + } + .p-xl-1 { + padding: 0.25rem !important; + } + .pt-xl-1, + .py-xl-1 { + padding-top: 0.25rem !important; + } + .pr-xl-1, + .px-xl-1 { + padding-left: 0.25rem !important; + } + .pb-xl-1, + .py-xl-1 { + padding-bottom: 0.25rem !important; + } + .pl-xl-1, + .px-xl-1 { + padding-right: 0.25rem !important; + } + .p-xl-2 { + padding: 0.5rem !important; + } + .pt-xl-2, + .py-xl-2 { + padding-top: 0.5rem !important; + } + .pr-xl-2, + .px-xl-2 { + padding-left: 0.5rem !important; + } + .pb-xl-2, + .py-xl-2 { + padding-bottom: 0.5rem !important; + } + .pl-xl-2, + .px-xl-2 { + padding-right: 0.5rem !important; + } + .p-xl-3 { + padding: 0.75rem !important; + } + .pt-xl-3, + .py-xl-3 { + padding-top: 0.75rem !important; + } + .pr-xl-3, + .px-xl-3 { + padding-left: 0.75rem !important; + } + .pb-xl-3, + .py-xl-3 { + padding-bottom: 0.75rem !important; + } + .pl-xl-3, + .px-xl-3 { + padding-right: 0.75rem !important; + } + .p-xl-4 { + padding: 1rem !important; + } + .pt-xl-4, + .py-xl-4 { + padding-top: 1rem !important; + } + .pr-xl-4, + .px-xl-4 { + padding-left: 1rem !important; + } + .pb-xl-4, + .py-xl-4 { + padding-bottom: 1rem !important; + } + .pl-xl-4, + .px-xl-4 { + padding-right: 1rem !important; + } + .p-xl-5 { + padding: 1.5rem !important; + } + .pt-xl-5, + .py-xl-5 { + padding-top: 1.5rem !important; + } + .pr-xl-5, + .px-xl-5 { + padding-left: 1.5rem !important; + } + .pb-xl-5, + .py-xl-5 { + padding-bottom: 1.5rem !important; + } + .pl-xl-5, + .px-xl-5 { + padding-right: 1.5rem !important; + } + .p-xl-6 { + padding: 2rem !important; + } + .pt-xl-6, + .py-xl-6 { + padding-top: 2rem !important; + } + .pr-xl-6, + .px-xl-6 { + padding-left: 2rem !important; + } + .pb-xl-6, + .py-xl-6 { + padding-bottom: 2rem !important; + } + .pl-xl-6, + .px-xl-6 { + padding-right: 2rem !important; + } + .p-xl-7 { + padding: 3rem !important; + } + .pt-xl-7, + .py-xl-7 { + padding-top: 3rem !important; + } + .pr-xl-7, + .px-xl-7 { + padding-left: 3rem !important; + } + .pb-xl-7, + .py-xl-7 { + padding-bottom: 3rem !important; + } + .pl-xl-7, + .px-xl-7 { + padding-right: 3rem !important; + } + .p-xl-8 { + padding: 4rem !important; + } + .pt-xl-8, + .py-xl-8 { + padding-top: 4rem !important; + } + .pr-xl-8, + .px-xl-8 { + padding-left: 4rem !important; + } + .pb-xl-8, + .py-xl-8 { + padding-bottom: 4rem !important; + } + .pl-xl-8, + .px-xl-8 { + padding-right: 4rem !important; + } + .p-xl-9 { + padding: 6rem !important; + } + .pt-xl-9, + .py-xl-9 { + padding-top: 6rem !important; + } + .pr-xl-9, + .px-xl-9 { + padding-left: 6rem !important; + } + .pb-xl-9, + .py-xl-9 { + padding-bottom: 6rem !important; + } + .pl-xl-9, + .px-xl-9 { + padding-right: 6rem !important; + } + .m-xl-auto { + margin: auto !important; + } + .mt-xl-auto, + .my-xl-auto { + margin-top: auto !important; + } + .mr-xl-auto, + .mx-xl-auto { + margin-left: auto !important; + } + .mb-xl-auto, + .my-xl-auto { + margin-bottom: auto !important; + } + .ml-xl-auto, + .mx-xl-auto { + margin-right: auto !important; + } +} + +.text-monospace { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +.text-justify { + text-align: justify !important; +} + +.text-nowrap { + white-space: nowrap !important; +} + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +.text-left { + text-align: right !important; +} + +.text-right { + text-align: left !important; +} + +.text-center { + text-align: center !important; +} + +@media (min-width: 576px) { + .text-sm-left { + text-align: right !important; + } + .text-sm-right { + text-align: left !important; + } + .text-sm-center { + text-align: center !important; + } +} + +@media (min-width: 768px) { + .text-md-left { + text-align: right !important; + } + .text-md-right { + text-align: left !important; + } + .text-md-center { + text-align: center !important; + } +} + +@media (min-width: 992px) { + .text-lg-left { + text-align: right !important; + } + .text-lg-right { + text-align: left !important; + } + .text-lg-center { + text-align: center !important; + } +} + +@media (min-width: 1280px) { + .text-xl-left { + text-align: right !important; + } + .text-xl-right { + text-align: left !important; + } + .text-xl-center { + text-align: center !important; + } +} + +.text-lowercase { + text-transform: lowercase !important; +} + +.text-uppercase { + text-transform: uppercase !important; +} + +.text-capitalize { + text-transform: capitalize !important; +} + +.font-weight-light { + font-weight: 300 !important; +} + +.font-weight-normal { + font-weight: 400 !important; +} + +.font-weight-bold { + font-weight: 700 !important; +} + +.font-italic { + font-style: italic !important; +} + +.text-white { + color: #fff !important; +} + +.text-primary { + color: #467fcf !important; +} + +a.text-primary:hover, a.text-primary:focus { + color: #2f66b3 !important; +} + +.text-secondary { + color: #868e96 !important; +} + +a.text-secondary:hover, a.text-secondary:focus { + color: #6c757d !important; +} + +.text-success { + color: #5eba00 !important; +} + +a.text-success:hover, a.text-success:focus { + color: #448700 !important; +} + +.text-info { + color: #45aaf2 !important; +} + +a.text-info:hover, a.text-info:focus { + color: #1594ef !important; +} + +.text-warning { + color: #f1c40f !important; +} + +a.text-warning:hover, a.text-warning:focus { + color: #c29d0b !important; +} + +.text-danger { + color: #cd201f !important; +} + +a.text-danger:hover, a.text-danger:focus { + color: #a11918 !important; +} + +.text-light { + color: #f8f9fa !important; +} + +a.text-light:hover, a.text-light:focus { + color: #dae0e5 !important; +} + +.text-dark { + color: #343a40 !important; +} + +a.text-dark:hover, a.text-dark:focus { + color: #1d2124 !important; +} + +.text-body { + color: #495057 !important; +} + +.text-muted { + color: #9aa0ac !important; +} + +.text-black-50 { + color: rgba(0, 0, 0, 0.5) !important; +} + +.text-white-50 { + color: rgba(255, 255, 255, 0.5) !important; +} + +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} + +.visible { + visibility: visible !important; +} + +.invisible { + visibility: hidden !important; +} + +@media print { + *, + *::before, + *::after { + text-shadow: none !important; + box-shadow: none !important; + } + a:not(.btn) { + text-decoration: underline; + } + abbr[title]::after { + content: " (" attr(title) ")"; + } + pre { + white-space: pre-wrap !important; + } + pre, + blockquote { + border: 1px solid #adb5bd; + page-break-inside: avoid; + } + thead { + display: table-header-group; + } + tr, + img { + page-break-inside: avoid; + } + p, + h2, + h3 { + orphans: 3; + widows: 3; + } + h2, + h3 { + page-break-after: avoid; + } + @page { + size: a3; + } + body { + min-width: 992px !important; + } + .container { + min-width: 992px !important; + } + .navbar { + display: none; + } + .badge { + border: 1px solid #000; + } + .table, .text-wrap table { + border-collapse: collapse !important; + } + + .table td, + .text-wrap table td, .table th, .text-wrap table th { + background-color: #fff !important; + } + .table-bordered th, .text-wrap table th, + .table-bordered td, + .text-wrap table td { + border: 1px solid #dee2e6 !important; + } +} + +html { + font-size: 16px; + height: 100%; + direction: rtl; +} + +body { + direction: rtl; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; + -webkit-tap-highlight-color: transparent; + -webkit-text-size-adjust: none; + -ms-touch-action: manipulation; + touch-action: manipulation; + -webkit-font-feature-settings: "liga" 0; + font-feature-settings: "liga" 0; + height: 100%; + overflow-y: scroll; + position: relative; +} + +@media print { + body { + background: none; + } +} + +body *::-webkit-scrollbar { + width: 6px; + height: 6px; + transition: .3s background; +} + +body *::-webkit-scrollbar-thumb { + background: #ced4da; +} + +body *:hover::-webkit-scrollbar-thumb { + background: #adb5bd; +} + +.lead { + line-height: 1.4; +} + +a { + -webkit-text-decoration-skip: ink; + text-decoration-skip: ink; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a, +.h1 a, .h2 a, .h3 a, .h4 a, .h5 a, .h6 a { + color: inherit; +} + +strong, +b { + font-weight: 600; +} + +p, +ul, +ol, +blockquote { + margin-bottom: 1em; +} + +blockquote { + font-style: italic; + color: #6e7687; + padding-right: 2rem; + border-right: 2px solid rgba(0, 40, 100, 0.12); +} + +blockquote p { + margin-bottom: 1rem; +} + +blockquote cite { + display: block; + text-align: left; +} + +blockquote cite:before { + content: '— '; +} + +code { + background: rgba(0, 0, 0, 0.025); + border: 1px solid rgba(0, 0, 0, 0.05); + border-radius: 3px; + padding: 3px; +} + +pre code { + padding: 0; + border-radius: 0; + border: none; + background: none; +} + +hr { + margin-top: 2rem; + margin-bottom: 2rem; +} + +pre { + color: #343a40; + padding: 1rem; + overflow: auto; + font-size: 85%; + line-height: 1.45; + background-color: #f8fafc; + border-radius: 3px; + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + text-shadow: 0 1px white; + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} + +img { + max-width: 100%; +} + +.text-wrap { + font-size: 1rem; + line-height: 1.66; +} + +.text-wrap > :first-child { + margin-top: 0; +} + +.text-wrap > :last-child { + margin-bottom: 0; +} + +.text-wrap > h1, .text-wrap > h2, .text-wrap > h3, .text-wrap > h4, .text-wrap > h5, .text-wrap > h6 { + margin-top: 1em; +} + +.section-nav { + background-color: #f8f9fa; + margin: 1rem 0; + padding: .5rem 1rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + list-style: none; +} + +.section-nav:before { + content: 'Table of contents:'; + display: block; + font-weight: 600; +} + +@media print { + .container { + max-width: none; + } +} + +.row-cards > .col, +.row-cards > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.row-deck > .col, +.row-deck > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-align: stretch; + align-items: stretch; +} + +.row-deck > .col .card, +.row-deck > [class*='col-'] .card { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.col-text { + max-width: 48rem; +} + +.col-login { + max-width: 24rem; +} + +.gutters-0 { + margin-left: 0; + margin-right: 0; +} + +.gutters-0 > .col, +.gutters-0 > [class*="col-"] { + padding-left: 0; + padding-right: 0; +} + +.gutters-0 .card { + margin-bottom: 0; +} + +.gutters-xs { + margin-left: -0.25rem; + margin-right: -0.25rem; +} + +.gutters-xs > .col, +.gutters-xs > [class*="col-"] { + padding-left: 0.25rem; + padding-right: 0.25rem; +} + +.gutters-xs .card { + margin-bottom: 0.5rem; +} + +.gutters-sm { + margin-left: -0.5rem; + margin-right: -0.5rem; +} + +.gutters-sm > .col, +.gutters-sm > [class*="col-"] { + padding-left: 0.5rem; + padding-right: 0.5rem; +} + +.gutters-sm .card { + margin-bottom: 1rem; +} + +.gutters-lg { + margin-left: -1rem; + margin-right: -1rem; +} + +.gutters-lg > .col, +.gutters-lg > [class*="col-"] { + padding-left: 1rem; + padding-right: 1rem; +} + +.gutters-lg .card { + margin-bottom: 2rem; +} + +.gutters-xl { + margin-left: -1.5rem; + margin-right: -1.5rem; +} + +.gutters-xl > .col, +.gutters-xl > [class*="col-"] { + padding-left: 1.5rem; + padding-right: 1.5rem; +} + +.gutters-xl .card { + margin-bottom: 3rem; +} + +.page { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + min-height: 100%; +} + +body.fixed-header .page { + padding-top: 4.5rem; +} + +@media (min-width: 1600px) { + body.aside-opened .page { + margin-left: 22rem; + } +} + +.page-main { + -ms-flex: 1 1 auto; + flex: 1 1 auto; +} + +.page-content { + margin: .75rem 0; +} + +@media (min-width: 768px) { + .page-content { + margin: 1.5rem 0; + } +} + +.page-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + margin: 1.5rem 0 1.5rem; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.page-title { + margin: 0; + font-size: 1.5rem; + font-weight: 400; + line-height: 2.5rem; +} + +.page-title-icon { + color: #9aa0ac; + font-size: 1.25rem; +} + +.page-subtitle { + font-size: 0.8125rem; + color: #6e7687; + margin-right: 2rem; +} + +.page-subtitle a { + color: inherit; +} + +.page-options { + margin-right: auto; +} + +.page-breadcrumb { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; +} + +.page-description { + margin: .25rem 0 0; + color: #6e7687; +} + +.page-description a { + color: inherit; +} + +.page-single { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + padding: 1rem 0; +} + +.content-heading { + font-weight: 400; + margin: 2rem 0 1.5rem; + font-size: 1.25rem; + line-height: 1.25; +} + +.content-heading:first-child { + margin-top: 0; +} + +.aside { + position: fixed; + top: 0; + left: 0; + bottom: 0; + width: 22rem; + background: #ffffff; + border-right: 1px solid rgba(0, 40, 100, 0.12); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + z-index: 100; + visibility: hidden; + box-shadow: 0 0 5px 2px rgba(0, 0, 0, 0.05); +} + +@media (min-width: 1600px) { + body.aside-opened .aside { + visibility: visible; + } +} + +.aside-body { + padding: 1.5rem; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + overflow: auto; +} + +.aside-footer { + padding: 1rem 1.5rem; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.aside-header { + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.header { + padding-top: .75rem; + padding-bottom: .75rem; + background: #fff; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +body.fixed-header .header { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index: 1030; +} + +@media print { + .header { + display: none; + } +} + +.header .dropdown-menu { + margin-top: .75rem; +} + +.nav-unread { + position: absolute; + top: .25rem; + left: .25rem; + background: #cd201f; + width: .5rem; + height: .5rem; + border-radius: 50%; +} + +.header-brand { + color: inherit; + margin-left: 1rem; + font-size: 1.25rem; + white-space: nowrap; + font-weight: 600; + padding: 0; + transition: .3s opacity; + line-height: 2rem; +} + +.header-brand:hover { + opacity: .8; + color: inherit; + text-decoration: none; +} + +.header-brand-img { + height: 2rem; + line-height: 2rem; + vertical-align: bottom; + margin-left: .5rem; + width: auto; +} + +.header-avatar { + width: 2rem; + height: 2rem; + display: inline-block; + vertical-align: bottom; + border-radius: 50%; +} + +.header-btn { + display: inline-block; + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + font-size: 1rem; +} + +.header-btn.has-new { + position: relative; +} + +.header-btn.has-new:before { + content: ''; + width: 6px; + height: 6px; + background: #cd201f; + position: absolute; + top: 4px; + left: 4px; + border-radius: 50%; +} + +.header-toggler { + width: 2rem; + height: 2rem; + position: relative; + color: #9aa0ac; +} + +.header-toggler:hover { + color: #6e7687; +} + +.header-toggler-icon { + position: absolute; + width: 1rem; + height: 2px; + color: inherit; + background: currentColor; + border-radius: 3px; + top: 50%; + right: 50%; + margin: -2px -.5rem 0 0; + box-shadow: 0 5px currentColor, 0 -5px currentColor; +} + +.footer { + background: #fff; + border-top: 1px solid rgba(0, 40, 100, 0.12); + font-size: 0.875rem; + padding: 1.25rem 0; + color: #9aa0ac; +} + +.footer a:not(.btn) { + color: #6e7687; +} + +@media print { + .footer { + display: none; + } +} + +.bg-blue-lightest { + background-color: #edf2fa !important; +} + +a.bg-blue-lightest:hover, a.bg-blue-lightest:focus, +button.bg-blue-lightest:hover, +button.bg-blue-lightest:focus { + background-color: #c5d5ef !important; +} + +.bg-blue-lighter { + background-color: #c8d9f1 !important; +} + +a.bg-blue-lighter:hover, a.bg-blue-lighter:focus, +button.bg-blue-lighter:hover, +button.bg-blue-lighter:focus { + background-color: #9fbde7 !important; +} + +.bg-blue-light { + background-color: #7ea5dd !important; +} + +a.bg-blue-light:hover, a.bg-blue-light:focus, +button.bg-blue-light:hover, +button.bg-blue-light:focus { + background-color: #5689d2 !important; +} + +.bg-blue-dark { + background-color: #3866a6 !important; +} + +a.bg-blue-dark:hover, a.bg-blue-dark:focus, +button.bg-blue-dark:hover, +button.bg-blue-dark:focus { + background-color: #2b4f80 !important; +} + +.bg-blue-darker { + background-color: #1c3353 !important; +} + +a.bg-blue-darker:hover, a.bg-blue-darker:focus, +button.bg-blue-darker:hover, +button.bg-blue-darker:focus { + background-color: #0f1c2d !important; +} + +.bg-blue-darkest { + background-color: #0e1929 !important; +} + +a.bg-blue-darkest:hover, a.bg-blue-darkest:focus, +button.bg-blue-darkest:hover, +button.bg-blue-darkest:focus { + background-color: #010203 !important; +} + +.bg-indigo-lightest { + background-color: #f0f1fa !important; +} + +a.bg-indigo-lightest:hover, a.bg-indigo-lightest:focus, +button.bg-indigo-lightest:hover, +button.bg-indigo-lightest:focus { + background-color: #cacded !important; +} + +.bg-indigo-lighter { + background-color: #d1d5f0 !important; +} + +a.bg-indigo-lighter:hover, a.bg-indigo-lighter:focus, +button.bg-indigo-lighter:hover, +button.bg-indigo-lighter:focus { + background-color: #abb2e3 !important; +} + +.bg-indigo-light { + background-color: #939edc !important; +} + +a.bg-indigo-light:hover, a.bg-indigo-light:focus, +button.bg-indigo-light:hover, +button.bg-indigo-light:focus { + background-color: #6c7bd0 !important; +} + +.bg-indigo-dark { + background-color: #515da4 !important; +} + +a.bg-indigo-dark:hover, a.bg-indigo-dark:focus, +button.bg-indigo-dark:hover, +button.bg-indigo-dark:focus { + background-color: #404a82 !important; +} + +.bg-indigo-darker { + background-color: #282e52 !important; +} + +a.bg-indigo-darker:hover, a.bg-indigo-darker:focus, +button.bg-indigo-darker:hover, +button.bg-indigo-darker:focus { + background-color: #171b30 !important; +} + +.bg-indigo-darkest { + background-color: #141729 !important; +} + +a.bg-indigo-darkest:hover, a.bg-indigo-darkest:focus, +button.bg-indigo-darkest:hover, +button.bg-indigo-darkest:focus { + background-color: #030407 !important; +} + +.bg-purple-lightest { + background-color: #f6effd !important; +} + +a.bg-purple-lightest:hover, a.bg-purple-lightest:focus, +button.bg-purple-lightest:hover, +button.bg-purple-lightest:focus { + background-color: #ddc2f7 !important; +} + +.bg-purple-lighter { + background-color: #e4cff9 !important; +} + +a.bg-purple-lighter:hover, a.bg-purple-lighter:focus, +button.bg-purple-lighter:hover, +button.bg-purple-lighter:focus { + background-color: #cba2f3 !important; +} + +.bg-purple-light { + background-color: #c08ef0 !important; +} + +a.bg-purple-light:hover, a.bg-purple-light:focus, +button.bg-purple-light:hover, +button.bg-purple-light:focus { + background-color: #a761ea !important; +} + +.bg-purple-dark { + background-color: #844bbb !important; +} + +a.bg-purple-dark:hover, a.bg-purple-dark:focus, +button.bg-purple-dark:hover, +button.bg-purple-dark:focus { + background-color: #6a3a99 !important; +} + +.bg-purple-darker { + background-color: #42265e !important; +} + +a.bg-purple-darker:hover, a.bg-purple-darker:focus, +button.bg-purple-darker:hover, +button.bg-purple-darker:focus { + background-color: #29173a !important; +} + +.bg-purple-darkest { + background-color: #21132f !important; +} + +a.bg-purple-darkest:hover, a.bg-purple-darkest:focus, +button.bg-purple-darkest:hover, +button.bg-purple-darkest:focus { + background-color: #08040b !important; +} + +.bg-pink-lightest { + background-color: #fef0f5 !important; +} + +a.bg-pink-lightest:hover, a.bg-pink-lightest:focus, +button.bg-pink-lightest:hover, +button.bg-pink-lightest:focus { + background-color: #fbc0d5 !important; +} + +.bg-pink-lighter { + background-color: #fcd3e1 !important; +} + +a.bg-pink-lighter:hover, a.bg-pink-lighter:focus, +button.bg-pink-lighter:hover, +button.bg-pink-lighter:focus { + background-color: #f9a3c0 !important; +} + +.bg-pink-light { + background-color: #f999b9 !important; +} + +a.bg-pink-light:hover, a.bg-pink-light:focus, +button.bg-pink-light:hover, +button.bg-pink-light:focus { + background-color: #f66998 !important; +} + +.bg-pink-dark { + background-color: #c5577c !important; +} + +a.bg-pink-dark:hover, a.bg-pink-dark:focus, +button.bg-pink-dark:hover, +button.bg-pink-dark:focus { + background-color: #ad3c62 !important; +} + +.bg-pink-darker { + background-color: #622c3e !important; +} + +a.bg-pink-darker:hover, a.bg-pink-darker:focus, +button.bg-pink-darker:hover, +button.bg-pink-darker:focus { + background-color: #3f1c28 !important; +} + +.bg-pink-darkest { + background-color: #31161f !important; +} + +a.bg-pink-darkest:hover, a.bg-pink-darkest:focus, +button.bg-pink-darkest:hover, +button.bg-pink-darkest:focus { + background-color: #0e0609 !important; +} + +.bg-red-lightest { + background-color: #fae9e9 !important; +} + +a.bg-red-lightest:hover, a.bg-red-lightest:focus, +button.bg-red-lightest:hover, +button.bg-red-lightest:focus { + background-color: #f1bfbf !important; +} + +.bg-red-lighter { + background-color: #f0bcbc !important; +} + +a.bg-red-lighter:hover, a.bg-red-lighter:focus, +button.bg-red-lighter:hover, +button.bg-red-lighter:focus { + background-color: #e79292 !important; +} + +.bg-red-light { + background-color: #dc6362 !important; +} + +a.bg-red-light:hover, a.bg-red-light:focus, +button.bg-red-light:hover, +button.bg-red-light:focus { + background-color: #d33a38 !important; +} + +.bg-red-dark { + background-color: #a41a19 !important; +} + +a.bg-red-dark:hover, a.bg-red-dark:focus, +button.bg-red-dark:hover, +button.bg-red-dark:focus { + background-color: #781312 !important; +} + +.bg-red-darker { + background-color: #520d0c !important; +} + +a.bg-red-darker:hover, a.bg-red-darker:focus, +button.bg-red-darker:hover, +button.bg-red-darker:focus { + background-color: #260605 !important; +} + +.bg-red-darkest { + background-color: #290606 !important; +} + +a.bg-red-darkest:hover, a.bg-red-darkest:focus, +button.bg-red-darkest:hover, +button.bg-red-darkest:focus { + background-color: black !important; +} + +.bg-orange-lightest { + background-color: #fff5ec !important; +} + +a.bg-orange-lightest:hover, a.bg-orange-lightest:focus, +button.bg-orange-lightest:hover, +button.bg-orange-lightest:focus { + background-color: peachpuff !important; +} + +.bg-orange-lighter { + background-color: #fee0c7 !important; +} + +a.bg-orange-lighter:hover, a.bg-orange-lighter:focus, +button.bg-orange-lighter:hover, +button.bg-orange-lighter:focus { + background-color: #fdc495 !important; +} + +.bg-orange-light { + background-color: #feb67c !important; +} + +a.bg-orange-light:hover, a.bg-orange-light:focus, +button.bg-orange-light:hover, +button.bg-orange-light:focus { + background-color: #fe9a49 !important; +} + +.bg-orange-dark { + background-color: #ca7836 !important; +} + +a.bg-orange-dark:hover, a.bg-orange-dark:focus, +button.bg-orange-dark:hover, +button.bg-orange-dark:focus { + background-color: #a2602b !important; +} + +.bg-orange-darker { + background-color: #653c1b !important; +} + +a.bg-orange-darker:hover, a.bg-orange-darker:focus, +button.bg-orange-darker:hover, +button.bg-orange-darker:focus { + background-color: #3d2410 !important; +} + +.bg-orange-darkest { + background-color: #331e0e !important; +} + +a.bg-orange-darkest:hover, a.bg-orange-darkest:focus, +button.bg-orange-darkest:hover, +button.bg-orange-darkest:focus { + background-color: #0b0603 !important; +} + +.bg-yellow-lightest { + background-color: #fef9e7 !important; +} + +a.bg-yellow-lightest:hover, a.bg-yellow-lightest:focus, +button.bg-yellow-lightest:hover, +button.bg-yellow-lightest:focus { + background-color: #fcedb6 !important; +} + +.bg-yellow-lighter { + background-color: #fbedb7 !important; +} + +a.bg-yellow-lighter:hover, a.bg-yellow-lighter:focus, +button.bg-yellow-lighter:hover, +button.bg-yellow-lighter:focus { + background-color: #f8e187 !important; +} + +.bg-yellow-light { + background-color: #f5d657 !important; +} + +a.bg-yellow-light:hover, a.bg-yellow-light:focus, +button.bg-yellow-light:hover, +button.bg-yellow-light:focus { + background-color: #f2ca27 !important; +} + +.bg-yellow-dark { + background-color: #c19d0c !important; +} + +a.bg-yellow-dark:hover, a.bg-yellow-dark:focus, +button.bg-yellow-dark:hover, +button.bg-yellow-dark:focus { + background-color: #917609 !important; +} + +.bg-yellow-darker { + background-color: #604e06 !important; +} + +a.bg-yellow-darker:hover, a.bg-yellow-darker:focus, +button.bg-yellow-darker:hover, +button.bg-yellow-darker:focus { + background-color: #302703 !important; +} + +.bg-yellow-darkest { + background-color: #302703 !important; +} + +a.bg-yellow-darkest:hover, a.bg-yellow-darkest:focus, +button.bg-yellow-darkest:hover, +button.bg-yellow-darkest:focus { + background-color: black !important; +} + +.bg-green-lightest { + background-color: #eff8e6 !important; +} + +a.bg-green-lightest:hover, a.bg-green-lightest:focus, +button.bg-green-lightest:hover, +button.bg-green-lightest:focus { + background-color: #d6edbe !important; +} + +.bg-green-lighter { + background-color: #cfeab3 !important; +} + +a.bg-green-lighter:hover, a.bg-green-lighter:focus, +button.bg-green-lighter:hover, +button.bg-green-lighter:focus { + background-color: #b6df8b !important; +} + +.bg-green-light { + background-color: #8ecf4d !important; +} + +a.bg-green-light:hover, a.bg-green-light:focus, +button.bg-green-light:hover, +button.bg-green-light:focus { + background-color: #75b831 !important; +} + +.bg-green-dark { + background-color: #4b9500 !important; +} + +a.bg-green-dark:hover, a.bg-green-dark:focus, +button.bg-green-dark:hover, +button.bg-green-dark:focus { + background-color: #316200 !important; +} + +.bg-green-darker { + background-color: #264a00 !important; +} + +a.bg-green-darker:hover, a.bg-green-darker:focus, +button.bg-green-darker:hover, +button.bg-green-darker:focus { + background-color: #0c1700 !important; +} + +.bg-green-darkest { + background-color: #132500 !important; +} + +a.bg-green-darkest:hover, a.bg-green-darkest:focus, +button.bg-green-darkest:hover, +button.bg-green-darkest:focus { + background-color: black !important; +} + +.bg-teal-lightest { + background-color: #eafaf8 !important; +} + +a.bg-teal-lightest:hover, a.bg-teal-lightest:focus, +button.bg-teal-lightest:hover, +button.bg-teal-lightest:focus { + background-color: #c1f0ea !important; +} + +.bg-teal-lighter { + background-color: #bfefea !important; +} + +a.bg-teal-lighter:hover, a.bg-teal-lighter:focus, +button.bg-teal-lighter:hover, +button.bg-teal-lighter:focus { + background-color: #96e5dd !important; +} + +.bg-teal-light { + background-color: #6bdbcf !important; +} + +a.bg-teal-light:hover, a.bg-teal-light:focus, +button.bg-teal-light:hover, +button.bg-teal-light:focus { + background-color: #42d1c2 !important; +} + +.bg-teal-dark { + background-color: #22a295 !important; +} + +a.bg-teal-dark:hover, a.bg-teal-dark:focus, +button.bg-teal-dark:hover, +button.bg-teal-dark:focus { + background-color: #19786e !important; +} + +.bg-teal-darker { + background-color: #11514a !important; +} + +a.bg-teal-darker:hover, a.bg-teal-darker:focus, +button.bg-teal-darker:hover, +button.bg-teal-darker:focus { + background-color: #082723 !important; +} + +.bg-teal-darkest { + background-color: #092925 !important; +} + +a.bg-teal-darkest:hover, a.bg-teal-darkest:focus, +button.bg-teal-darkest:hover, +button.bg-teal-darkest:focus { + background-color: black !important; +} + +.bg-cyan-lightest { + background-color: #e8f6f8 !important; +} + +a.bg-cyan-lightest:hover, a.bg-cyan-lightest:focus, +button.bg-cyan-lightest:hover, +button.bg-cyan-lightest:focus { + background-color: #c1e7ec !important; +} + +.bg-cyan-lighter { + background-color: #b9e3ea !important; +} + +a.bg-cyan-lighter:hover, a.bg-cyan-lighter:focus, +button.bg-cyan-lighter:hover, +button.bg-cyan-lighter:focus { + background-color: #92d3de !important; +} + +.bg-cyan-light { + background-color: #5dbecd !important; +} + +a.bg-cyan-light:hover, a.bg-cyan-light:focus, +button.bg-cyan-light:hover, +button.bg-cyan-light:focus { + background-color: #3aabbd !important; +} + +.bg-cyan-dark { + background-color: #128293 !important; +} + +a.bg-cyan-dark:hover, a.bg-cyan-dark:focus, +button.bg-cyan-dark:hover, +button.bg-cyan-dark:focus { + background-color: #0c5a66 !important; +} + +.bg-cyan-darker { + background-color: #09414a !important; +} + +a.bg-cyan-darker:hover, a.bg-cyan-darker:focus, +button.bg-cyan-darker:hover, +button.bg-cyan-darker:focus { + background-color: #03191d !important; +} + +.bg-cyan-darkest { + background-color: #052025 !important; +} + +a.bg-cyan-darkest:hover, a.bg-cyan-darkest:focus, +button.bg-cyan-darkest:hover, +button.bg-cyan-darkest:focus { + background-color: black !important; +} + +.bg-white-lightest { + background-color: white !important; +} + +a.bg-white-lightest:hover, a.bg-white-lightest:focus, +button.bg-white-lightest:hover, +button.bg-white-lightest:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-lighter { + background-color: white !important; +} + +a.bg-white-lighter:hover, a.bg-white-lighter:focus, +button.bg-white-lighter:hover, +button.bg-white-lighter:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-light { + background-color: white !important; +} + +a.bg-white-light:hover, a.bg-white-light:focus, +button.bg-white-light:hover, +button.bg-white-light:focus { + background-color: #e6e5e5 !important; +} + +.bg-white-dark { + background-color: #cccccc !important; +} + +a.bg-white-dark:hover, a.bg-white-dark:focus, +button.bg-white-dark:hover, +button.bg-white-dark:focus { + background-color: #b3b2b2 !important; +} + +.bg-white-darker { + background-color: #666666 !important; +} + +a.bg-white-darker:hover, a.bg-white-darker:focus, +button.bg-white-darker:hover, +button.bg-white-darker:focus { + background-color: #4d4c4c !important; +} + +.bg-white-darkest { + background-color: #333333 !important; +} + +a.bg-white-darkest:hover, a.bg-white-darkest:focus, +button.bg-white-darkest:hover, +button.bg-white-darkest:focus { + background-color: #1a1919 !important; +} + +.bg-gray-lightest { + background-color: #f3f4f5 !important; +} + +a.bg-gray-lightest:hover, a.bg-gray-lightest:focus, +button.bg-gray-lightest:hover, +button.bg-gray-lightest:focus { + background-color: #d7dbde !important; +} + +.bg-gray-lighter { + background-color: #dbdde0 !important; +} + +a.bg-gray-lighter:hover, a.bg-gray-lighter:focus, +button.bg-gray-lighter:hover, +button.bg-gray-lighter:focus { + background-color: #c0c3c8 !important; +} + +.bg-gray-light { + background-color: #aab0b6 !important; +} + +a.bg-gray-light:hover, a.bg-gray-light:focus, +button.bg-gray-light:hover, +button.bg-gray-light:focus { + background-color: #8f979e !important; +} + +.bg-gray-dark { + background-color: #6b7278 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #53585d !important; +} + +.bg-gray-darker { + background-color: #36393c !important; +} + +a.bg-gray-darker:hover, a.bg-gray-darker:focus, +button.bg-gray-darker:hover, +button.bg-gray-darker:focus { + background-color: #1e2021 !important; +} + +.bg-gray-darkest { + background-color: #1b1c1e !important; +} + +a.bg-gray-darkest:hover, a.bg-gray-darkest:focus, +button.bg-gray-darkest:hover, +button.bg-gray-darkest:focus { + background-color: #030303 !important; +} + +.bg-gray-dark-lightest { + background-color: #ebebec !important; +} + +a.bg-gray-dark-lightest:hover, a.bg-gray-dark-lightest:focus, +button.bg-gray-dark-lightest:hover, +button.bg-gray-dark-lightest:focus { + background-color: #d1d1d3 !important; +} + +.bg-gray-dark-lighter { + background-color: #c2c4c6 !important; +} + +a.bg-gray-dark-lighter:hover, a.bg-gray-dark-lighter:focus, +button.bg-gray-dark-lighter:hover, +button.bg-gray-dark-lighter:focus { + background-color: #a8abad !important; +} + +.bg-gray-dark-light { + background-color: #717579 !important; +} + +a.bg-gray-dark-light:hover, a.bg-gray-dark-light:focus, +button.bg-gray-dark-light:hover, +button.bg-gray-dark-light:focus { + background-color: #585c5f !important; +} + +.bg-gray-dark-dark { + background-color: #2a2e33 !important; +} + +a.bg-gray-dark-dark:hover, a.bg-gray-dark-dark:focus, +button.bg-gray-dark-dark:hover, +button.bg-gray-dark-dark:focus { + background-color: #131517 !important; +} + +.bg-gray-dark-darker { + background-color: #15171a !important; +} + +a.bg-gray-dark-darker:hover, a.bg-gray-dark-darker:focus, +button.bg-gray-dark-darker:hover, +button.bg-gray-dark-darker:focus { + background-color: black !important; +} + +.bg-gray-dark-darkest { + background-color: #0a0c0d !important; +} + +a.bg-gray-dark-darkest:hover, a.bg-gray-dark-darkest:focus, +button.bg-gray-dark-darkest:hover, +button.bg-gray-dark-darkest:focus { + background-color: black !important; +} + +.bg-azure-lightest { + background-color: #ecf7fe !important; +} + +a.bg-azure-lightest:hover, a.bg-azure-lightest:focus, +button.bg-azure-lightest:hover, +button.bg-azure-lightest:focus { + background-color: #bce3fb !important; +} + +.bg-azure-lighter { + background-color: #c7e6fb !important; +} + +a.bg-azure-lighter:hover, a.bg-azure-lighter:focus, +button.bg-azure-lighter:hover, +button.bg-azure-lighter:focus { + background-color: #97d1f8 !important; +} + +.bg-azure-light { + background-color: #7dc4f6 !important; +} + +a.bg-azure-light:hover, a.bg-azure-light:focus, +button.bg-azure-light:hover, +button.bg-azure-light:focus { + background-color: #4daef3 !important; +} + +.bg-azure-dark { + background-color: #3788c2 !important; +} + +a.bg-azure-dark:hover, a.bg-azure-dark:focus, +button.bg-azure-dark:hover, +button.bg-azure-dark:focus { + background-color: #2c6c9a !important; +} + +.bg-azure-darker { + background-color: #1c4461 !important; +} + +a.bg-azure-darker:hover, a.bg-azure-darker:focus, +button.bg-azure-darker:hover, +button.bg-azure-darker:focus { + background-color: #112839 !important; +} + +.bg-azure-darkest { + background-color: #0e2230 !important; +} + +a.bg-azure-darkest:hover, a.bg-azure-darkest:focus, +button.bg-azure-darkest:hover, +button.bg-azure-darkest:focus { + background-color: #020609 !important; +} + +.bg-lime-lightest { + background-color: #f2fbeb !important; +} + +a.bg-lime-lightest:hover, a.bg-lime-lightest:focus, +button.bg-lime-lightest:hover, +button.bg-lime-lightest:focus { + background-color: #d6f3c1 !important; +} + +.bg-lime-lighter { + background-color: #d7f2c2 !important; +} + +a.bg-lime-lighter:hover, a.bg-lime-lighter:focus, +button.bg-lime-lighter:hover, +button.bg-lime-lighter:focus { + background-color: #bbe998 !important; +} + +.bg-lime-light { + background-color: #a3e072 !important; +} + +a.bg-lime-light:hover, a.bg-lime-light:focus, +button.bg-lime-light:hover, +button.bg-lime-light:focus { + background-color: #88d748 !important; +} + +.bg-lime-dark { + background-color: #62a82a !important; +} + +a.bg-lime-dark:hover, a.bg-lime-dark:focus, +button.bg-lime-dark:hover, +button.bg-lime-dark:focus { + background-color: #4a7f20 !important; +} + +.bg-lime-darker { + background-color: #315415 !important; +} + +a.bg-lime-darker:hover, a.bg-lime-darker:focus, +button.bg-lime-darker:hover, +button.bg-lime-darker:focus { + background-color: #192b0b !important; +} + +.bg-lime-darkest { + background-color: #192a0b !important; +} + +a.bg-lime-darkest:hover, a.bg-lime-darkest:focus, +button.bg-lime-darkest:hover, +button.bg-lime-darkest:focus { + background-color: #010200 !important; +} + +.display-1 i, +.display-2 i, +.display-3 i, +.display-4 i { + vertical-align: baseline; + font-size: 0.815em; +} + +.text-inherit { + color: inherit !important; +} + +.text-default { + color: #495057 !important; +} + +.text-muted-dark { + color: #6e7687 !important; +} + +.tracking-tight { + letter-spacing: -0.05em !important; +} + +.tracking-normal { + letter-spacing: 0 !important; +} + +.tracking-wide { + letter-spacing: 0.05em !important; +} + +.leading-none { + line-height: 1 !important; +} + +.leading-tight { + line-height: 1.25 !important; +} + +.leading-normal { + line-height: 1.5 !important; +} + +.leading-loose { + line-height: 2 !important; +} + +.bg-blue { + background-color: #467fcf !important; +} + +a.bg-blue:hover, a.bg-blue:focus, +button.bg-blue:hover, +button.bg-blue:focus { + background-color: #2f66b3 !important; +} + +.text-blue { + color: #467fcf !important; +} + +.bg-indigo { + background-color: #6574cd !important; +} + +a.bg-indigo:hover, a.bg-indigo:focus, +button.bg-indigo:hover, +button.bg-indigo:focus { + background-color: #3f51c1 !important; +} + +.text-indigo { + color: #6574cd !important; +} + +.bg-purple { + background-color: #a55eea !important; +} + +a.bg-purple:hover, a.bg-purple:focus, +button.bg-purple:hover, +button.bg-purple:focus { + background-color: #8c31e4 !important; +} + +.text-purple { + color: #a55eea !important; +} + +.bg-pink { + background-color: #f66d9b !important; +} + +a.bg-pink:hover, a.bg-pink:focus, +button.bg-pink:hover, +button.bg-pink:focus { + background-color: #f33d7a !important; +} + +.text-pink { + color: #f66d9b !important; +} + +.bg-red { + background-color: #cd201f !important; +} + +a.bg-red:hover, a.bg-red:focus, +button.bg-red:hover, +button.bg-red:focus { + background-color: #a11918 !important; +} + +.text-red { + color: #cd201f !important; +} + +.bg-orange { + background-color: #fd9644 !important; +} + +a.bg-orange:hover, a.bg-orange:focus, +button.bg-orange:hover, +button.bg-orange:focus { + background-color: #fc7a12 !important; +} + +.text-orange { + color: #fd9644 !important; +} + +.bg-yellow { + background-color: #f1c40f !important; +} + +a.bg-yellow:hover, a.bg-yellow:focus, +button.bg-yellow:hover, +button.bg-yellow:focus { + background-color: #c29d0b !important; +} + +.text-yellow { + color: #f1c40f !important; +} + +.bg-green { + background-color: #5eba00 !important; +} + +a.bg-green:hover, a.bg-green:focus, +button.bg-green:hover, +button.bg-green:focus { + background-color: #448700 !important; +} + +.text-green { + color: #5eba00 !important; +} + +.bg-teal { + background-color: #2bcbba !important; +} + +a.bg-teal:hover, a.bg-teal:focus, +button.bg-teal:hover, +button.bg-teal:focus { + background-color: #22a193 !important; +} + +.text-teal { + color: #2bcbba !important; +} + +.bg-cyan { + background-color: #17a2b8 !important; +} + +a.bg-cyan:hover, a.bg-cyan:focus, +button.bg-cyan:hover, +button.bg-cyan:focus { + background-color: #117a8b !important; +} + +.text-cyan { + color: #17a2b8 !important; +} + +.bg-white { + background-color: #fff !important; +} + +a.bg-white:hover, a.bg-white:focus, +button.bg-white:hover, +button.bg-white:focus { + background-color: #e6e5e5 !important; +} + +.text-white { + color: #fff !important; +} + +.bg-gray { + background-color: #868e96 !important; +} + +a.bg-gray:hover, a.bg-gray:focus, +button.bg-gray:hover, +button.bg-gray:focus { + background-color: #6c757d !important; +} + +.text-gray { + color: #868e96 !important; +} + +.bg-gray-dark { + background-color: #343a40 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #1d2124 !important; +} + +.text-gray-dark { + color: #343a40 !important; +} + +.bg-azure { + background-color: #45aaf2 !important; +} + +a.bg-azure:hover, a.bg-azure:focus, +button.bg-azure:hover, +button.bg-azure:focus { + background-color: #1594ef !important; +} + +.text-azure { + color: #45aaf2 !important; +} + +.bg-lime { + background-color: #7bd235 !important; +} + +a.bg-lime:hover, a.bg-lime:focus, +button.bg-lime:hover, +button.bg-lime:focus { + background-color: #63ad27 !important; +} + +.text-lime { + color: #7bd235 !important; +} + +.icon { + color: #9aa0ac !important; +} + +.icon i { + vertical-align: -1px; +} + +a.icon { + text-decoration: none; + cursor: pointer; +} + +a.icon:hover { + color: #495057 !important; +} + +.o-auto { + overflow: auto !important; +} + +.o-hidden { + overflow: hidden !important; +} + +.shadow { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05) !important; +} + +.shadow-none { + box-shadow: none !important; +} + +.nav-link, +.nav-item { + padding: 0 .75rem; + min-width: 2rem; + transition: .3s color; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.nav-link .badge, +.nav-item .badge { + position: absolute; + top: 0; + left: 0; + padding: .2rem .25rem; + min-width: 1rem; +} + +.nav-tabs { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + color: #9aa0ac; + margin: 0 -.75rem; +} + +.nav-tabs .nav-link { + border: 0; + color: inherit; + border-bottom: 1px solid transparent; + margin-bottom: -1px; + transition: .3s border-color; + font-weight: 400; + padding: 1rem 0; +} + +.nav-tabs .nav-link:hover:not(.disabled) { + border-color: #6e7687; + color: #6e7687; +} + +.nav-tabs .nav-link.active { + border-color: #467fcf; + color: #467fcf; + background: transparent; +} + +.nav-tabs .nav-link.disabled { + opacity: .4; + cursor: default; + pointer-events: none; +} + +.nav-tabs .nav-item { + margin-bottom: 0; + position: relative; +} + +.nav-tabs .nav-item i { + margin-left: .25rem; + line-height: 1; + font-size: 0.875rem; + width: 0.875rem; + vertical-align: baseline; + display: inline-block; +} + +.nav-tabs .nav-item:hover .nav-submenu { + display: block; +} + +.nav-tabs .nav-submenu { + display: none; + position: absolute; + background: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-top: none; + z-index: 10; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 10rem; + border-radius: 0 0 3px 3px; +} + +.nav-tabs .nav-submenu .nav-item { + display: block; + padding: .5rem 1rem; + color: #9aa0ac; + margin: 0 !important; + cursor: pointer; + transition: .3s background; +} + +.nav-tabs .nav-submenu .nav-item.active { + color: #467fcf; +} + +.nav-tabs .nav-submenu .nav-item:hover { + color: #6e7687; + text-decoration: none; + background: rgba(0, 0, 0, 0.024); +} + +.btn { + cursor: pointer; + font-weight: 600; + letter-spacing: .03em; + font-size: 0.8125rem; + min-width: 2.375rem; +} + +.btn i { + font-size: 1rem; + vertical-align: -2px; +} + +.btn-icon { + padding-right: .5rem; + padding-left: .5rem; + text-align: center; +} + +.btn-secondary { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); + box-shadow: 0 1px 1px 0 rgba(0, 0, 0, 0.05); +} + +.btn-secondary:hover { + color: #495057; + background-color: #f6f6f6; + border-color: rgba(0, 20, 49, 0.12); +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: rgba(0, 15, 36, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-pill { + border-radius: 10rem; + padding-right: 1.5em; + padding-left: 1.5em; +} + +.btn-square { + border-radius: 0; +} + +.btn-facebook { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:hover { + color: #fff; + background-color: #30497c; + border-color: #2d4373; +} + +.btn-facebook:focus, .btn-facebook.focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-facebook.disabled, .btn-facebook:disabled { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:not(:disabled):not(.disabled):active, .btn-facebook:not(:disabled):not(.disabled).active, +.show > .btn-facebook.dropdown-toggle { + color: #fff; + background-color: #2d4373; + border-color: #293e6a; +} + +.btn-facebook:not(:disabled):not(.disabled):active:focus, .btn-facebook:not(:disabled):not(.disabled).active:focus, +.show > .btn-facebook.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-twitter { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:hover { + color: #fff; + background-color: #0d8ddc; + border-color: #0c85d0; +} + +.btn-twitter:focus, .btn-twitter.focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-twitter.disabled, .btn-twitter:disabled { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:not(:disabled):not(.disabled):active, .btn-twitter:not(:disabled):not(.disabled).active, +.show > .btn-twitter.dropdown-toggle { + color: #fff; + background-color: #0c85d0; + border-color: #0b7ec4; +} + +.btn-twitter:not(:disabled):not(.disabled):active:focus, .btn-twitter:not(:disabled):not(.disabled).active:focus, +.show > .btn-twitter.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-google { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:hover { + color: #fff; + background-color: #d03526; + border-color: #c63224; +} + +.btn-google:focus, .btn-google.focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-google.disabled, .btn-google:disabled { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:not(:disabled):not(.disabled):active, .btn-google:not(:disabled):not(.disabled).active, +.show > .btn-google.dropdown-toggle { + color: #fff; + background-color: #c63224; + border-color: #bb2f22; +} + +.btn-google:not(:disabled):not(.disabled):active:focus, .btn-google:not(:disabled):not(.disabled).active:focus, +.show > .btn-google.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-youtube { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:hover { + color: #fff; + background-color: #d90000; + border-color: #cc0000; +} + +.btn-youtube:focus, .btn-youtube.focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-youtube.disabled, .btn-youtube:disabled { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:not(:disabled):not(.disabled):active, .btn-youtube:not(:disabled):not(.disabled).active, +.show > .btn-youtube.dropdown-toggle { + color: #fff; + background-color: #cc0000; + border-color: #bf0000; +} + +.btn-youtube:not(:disabled):not(.disabled):active:focus, .btn-youtube:not(:disabled):not(.disabled).active:focus, +.show > .btn-youtube.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-vimeo { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:hover { + color: #fff; + background-color: #139ecb; + border-color: #1295bf; +} + +.btn-vimeo:focus, .btn-vimeo.focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-vimeo.disabled, .btn-vimeo:disabled { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:not(:disabled):not(.disabled):active, .btn-vimeo:not(:disabled):not(.disabled).active, +.show > .btn-vimeo.dropdown-toggle { + color: #fff; + background-color: #1295bf; + border-color: #108cb4; +} + +.btn-vimeo:not(:disabled):not(.disabled):active:focus, .btn-vimeo:not(:disabled):not(.disabled).active:focus, +.show > .btn-vimeo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-dribbble { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:hover { + color: #fff; + background-color: #e62a72; + border-color: #e51e6b; +} + +.btn-dribbble:focus, .btn-dribbble.focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-dribbble.disabled, .btn-dribbble:disabled { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:not(:disabled):not(.disabled):active, .btn-dribbble:not(:disabled):not(.disabled).active, +.show > .btn-dribbble.dropdown-toggle { + color: #fff; + background-color: #e51e6b; + border-color: #dc1a65; +} + +.btn-dribbble:not(:disabled):not(.disabled):active:focus, .btn-dribbble:not(:disabled):not(.disabled).active:focus, +.show > .btn-dribbble.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-github { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:hover { + color: #fff; + background-color: #040404; + border-color: black; +} + +.btn-github:focus, .btn-github.focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-github.disabled, .btn-github:disabled { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:not(:disabled):not(.disabled):active, .btn-github:not(:disabled):not(.disabled).active, +.show > .btn-github.dropdown-toggle { + color: #fff; + background-color: black; + border-color: black; +} + +.btn-github:not(:disabled):not(.disabled):active:focus, .btn-github:not(:disabled):not(.disabled).active:focus, +.show > .btn-github.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-instagram { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:hover { + color: #fff; + background-color: #de1f44; + border-color: #d31e40; +} + +.btn-instagram:focus, .btn-instagram.focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-instagram.disabled, .btn-instagram:disabled { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:not(:disabled):not(.disabled):active, .btn-instagram:not(:disabled):not(.disabled).active, +.show > .btn-instagram.dropdown-toggle { + color: #fff; + background-color: #d31e40; + border-color: #c81c3d; +} + +.btn-instagram:not(:disabled):not(.disabled):active:focus, .btn-instagram:not(:disabled):not(.disabled).active:focus, +.show > .btn-instagram.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-pinterest { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:hover { + color: #fff; + background-color: #980617; + border-color: #8c0615; +} + +.btn-pinterest:focus, .btn-pinterest.focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-pinterest.disabled, .btn-pinterest:disabled { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:not(:disabled):not(.disabled):active, .btn-pinterest:not(:disabled):not(.disabled).active, +.show > .btn-pinterest.dropdown-toggle { + color: #fff; + background-color: #8c0615; + border-color: #800513; +} + +.btn-pinterest:not(:disabled):not(.disabled):active:focus, .btn-pinterest:not(:disabled):not(.disabled).active:focus, +.show > .btn-pinterest.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-vk { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:hover { + color: #fff; + background-color: #527093; + border-color: #4d6a8b; +} + +.btn-vk:focus, .btn-vk.focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-vk.disabled, .btn-vk:disabled { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:not(:disabled):not(.disabled):active, .btn-vk:not(:disabled):not(.disabled).active, +.show > .btn-vk.dropdown-toggle { + color: #fff; + background-color: #4d6a8b; + border-color: #496482; +} + +.btn-vk:not(:disabled):not(.disabled):active:focus, .btn-vk:not(:disabled):not(.disabled).active:focus, +.show > .btn-vk.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-rss { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:hover { + color: #fff; + background-color: #d98c00; + border-color: #cc8400; +} + +.btn-rss:focus, .btn-rss.focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-rss.disabled, .btn-rss:disabled { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:not(:disabled):not(.disabled):active, .btn-rss:not(:disabled):not(.disabled).active, +.show > .btn-rss.dropdown-toggle { + color: #fff; + background-color: #cc8400; + border-color: #bf7c00; +} + +.btn-rss:not(:disabled):not(.disabled):active:focus, .btn-rss:not(:disabled):not(.disabled).active:focus, +.show > .btn-rss.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-flickr { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:hover { + color: #fff; + background-color: #0052b6; + border-color: #004ca9; +} + +.btn-flickr:focus, .btn-flickr.focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-flickr.disabled, .btn-flickr:disabled { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:not(:disabled):not(.disabled):active, .btn-flickr:not(:disabled):not(.disabled).active, +.show > .btn-flickr.dropdown-toggle { + color: #fff; + background-color: #004ca9; + border-color: #00469c; +} + +.btn-flickr:not(:disabled):not(.disabled):active:focus, .btn-flickr:not(:disabled):not(.disabled).active:focus, +.show > .btn-flickr.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-bitbucket { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:hover { + color: #fff; + background-color: #0043a6; + border-color: #003e99; +} + +.btn-bitbucket:focus, .btn-bitbucket.focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-bitbucket.disabled, .btn-bitbucket:disabled { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active, .btn-bitbucket:not(:disabled):not(.disabled).active, +.show > .btn-bitbucket.dropdown-toggle { + color: #fff; + background-color: #003e99; + border-color: #00388c; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active:focus, .btn-bitbucket:not(:disabled):not(.disabled).active:focus, +.show > .btn-bitbucket.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-blue { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-blue:focus, .btn-blue.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-blue.disabled, .btn-blue:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:not(:disabled):not(.disabled):active, .btn-blue:not(:disabled):not(.disabled).active, +.show > .btn-blue.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-blue:not(:disabled):not(.disabled):active:focus, .btn-blue:not(:disabled):not(.disabled).active:focus, +.show > .btn-blue.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-indigo { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:hover { + color: #fff; + background-color: #485ac4; + border-color: #3f51c1; +} + +.btn-indigo:focus, .btn-indigo.focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-indigo.disabled, .btn-indigo:disabled { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:not(:disabled):not(.disabled):active, .btn-indigo:not(:disabled):not(.disabled).active, +.show > .btn-indigo.dropdown-toggle { + color: #fff; + background-color: #3f51c1; + border-color: #3b4db7; +} + +.btn-indigo:not(:disabled):not(.disabled):active:focus, .btn-indigo:not(:disabled):not(.disabled).active:focus, +.show > .btn-indigo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-purple { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:hover { + color: #fff; + background-color: #923ce6; + border-color: #8c31e4; +} + +.btn-purple:focus, .btn-purple.focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-purple.disabled, .btn-purple:disabled { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:not(:disabled):not(.disabled):active, .btn-purple:not(:disabled):not(.disabled).active, +.show > .btn-purple.dropdown-toggle { + color: #fff; + background-color: #8c31e4; + border-color: #8526e3; +} + +.btn-purple:not(:disabled):not(.disabled):active:focus, .btn-purple:not(:disabled):not(.disabled).active:focus, +.show > .btn-purple.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-pink { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:hover { + color: #fff; + background-color: #f44982; + border-color: #f33d7a; +} + +.btn-pink:focus, .btn-pink.focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-pink.disabled, .btn-pink:disabled { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:not(:disabled):not(.disabled):active, .btn-pink:not(:disabled):not(.disabled).active, +.show > .btn-pink.dropdown-toggle { + color: #fff; + background-color: #f33d7a; + border-color: #f23172; +} + +.btn-pink:not(:disabled):not(.disabled):active:focus, .btn-pink:not(:disabled):not(.disabled).active:focus, +.show > .btn-pink.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-red { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-red:focus, .btn-red.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-red.disabled, .btn-red:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:not(:disabled):not(.disabled):active, .btn-red:not(:disabled):not(.disabled).active, +.show > .btn-red.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-red:not(:disabled):not(.disabled):active:focus, .btn-red:not(:disabled):not(.disabled).active:focus, +.show > .btn-red.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-orange { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:hover { + color: #fff; + background-color: #fd811e; + border-color: #fc7a12; +} + +.btn-orange:focus, .btn-orange.focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-orange.disabled, .btn-orange:disabled { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:not(:disabled):not(.disabled):active, .btn-orange:not(:disabled):not(.disabled).active, +.show > .btn-orange.dropdown-toggle { + color: #fff; + background-color: #fc7a12; + border-color: #fc7305; +} + +.btn-orange:not(:disabled):not(.disabled):active:focus, .btn-orange:not(:disabled):not(.disabled).active:focus, +.show > .btn-orange.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-yellow { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-yellow:focus, .btn-yellow.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-yellow.disabled, .btn-yellow:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:not(:disabled):not(.disabled):active, .btn-yellow:not(:disabled):not(.disabled).active, +.show > .btn-yellow.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-yellow:not(:disabled):not(.disabled):active:focus, .btn-yellow:not(:disabled):not(.disabled).active:focus, +.show > .btn-yellow.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-green { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-green:focus, .btn-green.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-green.disabled, .btn-green:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:not(:disabled):not(.disabled):active, .btn-green:not(:disabled):not(.disabled).active, +.show > .btn-green.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-green:not(:disabled):not(.disabled):active:focus, .btn-green:not(:disabled):not(.disabled).active:focus, +.show > .btn-green.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-teal { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:hover { + color: #fff; + background-color: #24ab9d; + border-color: #22a193; +} + +.btn-teal:focus, .btn-teal.focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-teal.disabled, .btn-teal:disabled { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:not(:disabled):not(.disabled):active, .btn-teal:not(:disabled):not(.disabled).active, +.show > .btn-teal.dropdown-toggle { + color: #fff; + background-color: #22a193; + border-color: #20968a; +} + +.btn-teal:not(:disabled):not(.disabled):active:focus, .btn-teal:not(:disabled):not(.disabled).active:focus, +.show > .btn-teal.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-cyan { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:hover { + color: #fff; + background-color: #138496; + border-color: #117a8b; +} + +.btn-cyan:focus, .btn-cyan.focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-cyan.disabled, .btn-cyan:disabled { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:not(:disabled):not(.disabled):active, .btn-cyan:not(:disabled):not(.disabled).active, +.show > .btn-cyan.dropdown-toggle { + color: #fff; + background-color: #117a8b; + border-color: #10707f; +} + +.btn-cyan:not(:disabled):not(.disabled):active:focus, .btn-cyan:not(:disabled):not(.disabled).active:focus, +.show > .btn-cyan.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-white { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:hover { + color: #495057; + background-color: #ececec; + border-color: #e6e5e5; +} + +.btn-white:focus, .btn-white.focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-white.disabled, .btn-white:disabled { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:not(:disabled):not(.disabled):active, .btn-white:not(:disabled):not(.disabled).active, +.show > .btn-white.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: #dfdfdf; +} + +.btn-white:not(:disabled):not(.disabled):active:focus, .btn-white:not(:disabled):not(.disabled).active:focus, +.show > .btn-white.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-gray { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-gray:focus, .btn-gray.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray.disabled, .btn-gray:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:not(:disabled):not(.disabled):active, .btn-gray:not(:disabled):not(.disabled).active, +.show > .btn-gray.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-gray:not(:disabled):not(.disabled):active:focus, .btn-gray:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-gray-dark:focus, .btn-gray-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-gray-dark.disabled, .btn-gray-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active, .btn-gray-dark:not(:disabled):not(.disabled).active, +.show > .btn-gray-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active:focus, .btn-gray-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-azure { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-azure:focus, .btn-azure.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-azure.disabled, .btn-azure:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:not(:disabled):not(.disabled):active, .btn-azure:not(:disabled):not(.disabled).active, +.show > .btn-azure.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-azure:not(:disabled):not(.disabled):active:focus, .btn-azure:not(:disabled):not(.disabled).active:focus, +.show > .btn-azure.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-lime { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:hover { + color: #fff; + background-color: #69b829; + border-color: #63ad27; +} + +.btn-lime:focus, .btn-lime.focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-lime.disabled, .btn-lime:disabled { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:not(:disabled):not(.disabled):active, .btn-lime:not(:disabled):not(.disabled).active, +.show > .btn-lime.dropdown-toggle { + color: #fff; + background-color: #63ad27; + border-color: #5da324; +} + +.btn-lime:not(:disabled):not(.disabled):active:focus, .btn-lime:not(:disabled):not(.disabled).active:focus, +.show > .btn-lime.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-option { + background: transparent; + color: #9aa0ac; +} + +.btn-option:hover { + color: #6e7687; +} + +.btn-option:focus { + box-shadow: none; + color: #6e7687; +} + +.btn-sm, .btn-group-sm > .btn { + font-size: 0.75rem; + min-width: 1.625rem; +} + +.btn-lg, .btn-group-lg > .btn { + font-size: 1rem; + min-width: 2.75rem; + font-weight: 400; +} + +.btn-list { + margin-bottom: -.5rem; + font-size: 0; +} + +.btn-list > .btn, +.btn-list > .dropdown { + margin-bottom: .5rem; +} + +.btn-list > .btn:not(:last-child), +.btn-list > .dropdown:not(:last-child) { + margin-left: .5rem; +} + +.btn-loading { + color: transparent !important; + pointer-events: none; + position: relative; +} + +.btn-loading:after { + content: ''; + -webkit-animation: loader 500ms infinite linear; + animation: loader 500ms infinite linear; + border: 2px solid #fff; + border-radius: 50%; + border-left-color: transparent !important; + border-top-color: transparent !important; + display: block; + height: 1.4em; + width: 1.4em; + position: absolute; + right: calc(50% - (1.4em / 2)); + top: calc(50% - (1.4em / 2)); + -webkit-transform-origin: center; + transform-origin: center; + position: absolute !important; +} + +.btn-loading.btn-sm:after, .btn-group-sm > .btn-loading.btn:after { + height: 1em; + width: 1em; + right: calc(50% - (1em / 2)); + top: calc(50% - (1em / 2)); +} + +.btn-loading.btn-secondary:after { + border-color: #495057; +} + +.alert { + font-size: 0.9375rem; +} + +.alert-icon { + padding-right: 3rem; +} + +.alert-icon > i { + color: inherit !important; + font-size: 1rem; + position: absolute; + top: 1rem; + right: 1rem; +} + +.alert-avatar { + padding-right: 3.75rem; +} + +.alert-avatar .avatar { + position: absolute; + top: .5rem; + right: .75rem; +} + +.close { + font-size: 1rem; + line-height: 1.5; + transition: .3s color; +} + +.close:before { + content: '\ea00'; + font-family: "feather"; +} + +.badge { + color: #fff; +} + +.badge-default { + background: #e9ecef; + color: #868e96; +} + +.table thead th, .text-wrap table thead th { + border-top: 0; + border-bottom-width: 1px; + padding-top: .5rem; + padding-bottom: .5rem; +} + +.table th, .text-wrap table th { + color: #9aa0ac; + text-transform: uppercase; + font-size: 0.875rem; + font-weight: 400; +} + +.table-md th, +.table-md td { + padding: .5rem; +} + +.table-vcenter td, +.table-vcenter th { + vertical-align: middle; +} + +.table-center td, +.table-center th { + text-align: center; +} + +.table-striped tbody tr:nth-of-type(odd) { + background: transparent; +} + +.table-striped tbody tr:nth-of-type(even) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-calendar { + margin: 0 0 .75rem; +} + +.table-calendar td, +.table-calendar th { + border: 0; + text-align: center; + padding: 0 !important; + width: 14.28571429%; + line-height: 2.5rem; +} + +.table-calendar td { + border-top: 0; +} + +.table-calendar-link { + line-height: 2rem; + min-width: calc(2rem + 2px); + display: inline-block; + border-radius: 3px; + background: #f8f9fa; + color: #495057; + font-weight: 600; + transition: .3s background, .3s color; + position: relative; +} + +.table-calendar-link:before { + content: ''; + width: 4px; + height: 4px; + position: absolute; + right: .25rem; + top: .25rem; + border-radius: 50px; + background: #467fcf; +} + +.table-calendar-link:hover { + color: #fff; + text-decoration: none; + background: #467fcf; + transition: .3s background; +} + +.table-calendar-link:hover:before { + background: #fff; +} + +.table-header { + cursor: pointer; + transition: .3s color; +} + +.table-header:hover { + color: #495057 !important; +} + +.table-header:after { + content: '\f0dc'; + font-family: FontAwesome; + display: inline-block; + margin-right: .5rem; + font-size: .75rem; +} + +.table-header-asc { + color: #495057 !important; +} + +.table-header-asc:after { + content: '\f0de'; +} + +.table-header-desc { + color: #495057 !important; +} + +.table-header-desc:after { + content: '\f0dd'; +} + +.page-breadcrumb { + background: none; + padding: 0; + margin: 1rem 0 0; + font-size: 0.875rem; +} + +@media (min-width: 768px) { + .page-breadcrumb { + margin: -.5rem 0 0; + } +} + +.page-breadcrumb .breadcrumb-item { + color: #9aa0ac; +} + +.page-breadcrumb .breadcrumb-item.active { + color: #6e7687; +} + +.pagination-simple .page-item .page-link { + background: none; + border: none; +} + +.pagination-simple .page-item.active .page-link { + color: #495057; + font-weight: 700; +} + +.pagination-pager .page-prev { + margin-left: auto; +} + +.pagination-pager .page-next { + margin-right: auto; +} + +.page-total-text { + margin-left: 1rem; + -ms-flex-item-align: center; + align-self: center; + color: #6e7687; +} + +.card { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + position: relative; + margin-bottom: 1.5rem; + width: 100%; +} + +.card .card { + box-shadow: none; +} + +@media print { + .card { + box-shadow: none; + border: none; + } +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + margin: 0; + padding: 1.5rem 1.5rem; + position: relative; +} + +.card-body + .card-body { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-body > :last-child { + margin-bottom: 0; +} + +@media print { + .card-body { + padding: 0; + } +} + +.card-body-scrollable { + overflow: auto; +} + +.card-footer, +.card-bottom { + padding: 1rem 1.5rem; + background: none; +} + +.card-footer { + border-top: 1px solid rgba(0, 40, 100, 0.12); + color: #6e7687; +} + +.card-header { + background: none; + padding: 0.5rem 1.5rem; + display: -ms-flexbox; + display: flex; + min-height: 3.5rem; + -ms-flex-align: center; + align-items: center; +} + +.card-header .card-title { + margin-bottom: 0; +} + +.card-header.border-0 + .card-body { + padding-top: 0; +} + +@media print { + .card-header { + display: none; + } +} + +.card-img-top { + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} + +.card-img-overlay { + background-color: rgba(0, 0, 0, 0.4); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-title { + font-size: 1.125rem; + line-height: 1.2; + font-weight: 400; + margin-bottom: 1.5rem; +} + +.card-title a { + color: inherit; +} + +.card-title:only-child { + margin-bottom: 0; +} + +.card-title small, +.card-subtitle { + color: #9aa0ac; + font-size: 0.875rem; + display: block; + margin: -.75rem 0 1rem; + line-height: 1.1; + font-weight: 400; +} + +.card-table { + margin-bottom: 0; +} + +.card-table tr:first-child td, +.card-table tr:first-child th { + border-top: 0; +} + +.card-table tr td:first-child, +.card-table tr th:first-child { + padding-right: 1.5rem; +} + +.card-table tr td:last-child, +.card-table tr th:last-child { + padding-left: 1.5rem; +} + +.card-body + .card-table { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-profile .card-header { + height: 9rem; + background-size: cover; +} + +.card-profile-img { + max-width: 6rem; + margin-top: -5rem; + margin-bottom: 1rem; + border: 3px solid #fff; + border-radius: 100%; + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.1); +} + +.card-link + .card-link { + margin-right: 1rem; +} + +.card-body + .card-list-group { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-list-group .list-group-item { + border-left: 0; + border-right: 0; + border-radius: 0; + padding-right: 1.5rem; + padding-left: 1.5rem; +} + +.card-list-group .list-group-item:last-child { + border-bottom: 0; +} + +.card-list-group .list-group-item:first-child { + border-top: 0; +} + +.card-header-tabs { + margin: -1.25rem 0; + border-bottom: 0; + line-height: 2rem; +} + +.card-header-tabs .nav-item { + margin-bottom: 1px; +} + +.card-header-pills { + margin: -.75rem 0; +} + +.card-aside { + -ms-flex-direction: row; + flex-direction: row; +} + +.card-aside-column { + min-width: 5rem; + width: 30%; + -ms-flex: 0 0 30%; + flex: 0 0 30%; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; + background: no-repeat center/cover; +} + +.card-value { + font-size: 2.5rem; + line-height: 3.4rem; + height: 3.4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + font-weight: 400; +} + +.card-value i { + vertical-align: middle; +} + +.card-chart-bg { + height: 4rem; + margin-top: -1rem; + position: relative; + z-index: 1; + overflow: hidden; +} + +.card-options { + margin-right: auto; + display: -ms-flexbox; + display: flex; + -ms-flex-order: 100; + order: 100; + margin-left: -.5rem; + color: #9aa0ac; + -ms-flex-item-align: center; + align-self: center; +} + +.card-options a:not(.btn) { + margin-right: .5rem; + color: #9aa0ac; + display: inline-block; + min-width: 1rem; +} + +.card-options a:not(.btn):hover { + text-decoration: none; + color: #6e7687; +} + +.card-options a:not(.btn) i { + font-size: 1rem; + vertical-align: middle; +} + +.card-options .dropdown-toggle:after { + display: none; +} + +/* +Card options + */ +.card-collapsed > :not(.card-header):not(.card-status) { + display: none; +} + +.card-collapsed .card-options-collapse i:before { + content: '\e92d'; +} + +.card-fullscreen .card-options-fullscreen i:before { + content: '\e992'; +} + +.card-fullscreen .card-options-remove { + display: none; +} + +/* +Card maps + */ +.card-map { + height: 15rem; + background: #e9ecef; +} + +.card-map-placeholder { + background: no-repeat center; +} + +/** +Card tabs + */ +.card-tabs { + display: -ms-flexbox; + display: flex; +} + +.card-tabs-bottom .card-tabs-item { + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-tabs-bottom .card-tabs-item.active { + border-top-color: #fff; +} + +.card-tabs-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + display: block; + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); + color: inherit; + overflow: hidden; +} + +a.card-tabs-item { + background: #fafbfc; +} + +a.card-tabs-item:hover { + text-decoration: none; + color: inherit; +} + +a.card-tabs-item:focus { + z-index: 1; +} + +a.card-tabs-item.active { + background: #fff; + border-bottom-color: #fff; +} + +.card-tabs-item + .card-tabs-item { + border-right: 1px solid rgba(0, 40, 100, 0.12); +} + +/** +Card status + */ +.card-status { + position: absolute; + top: -1px; + right: -1px; + left: -1px; + height: 3px; + border-radius: 3px 3px 0 0; + background: rgba(0, 40, 100, 0.12); +} + +.card-status-left { + left: auto; + bottom: 0; + height: auto; + width: 3px; + border-radius: 0 3px 3px 0; +} + +/** +Card icon + */ +.card-icon { + width: 3rem; + font-size: 2.5rem; + line-height: 3rem; + text-align: center; +} + +/** +Card fullscreen + */ +.card-fullscreen { + position: fixed; + top: 0; + right: 0; + left: 0; + bottom: 0; + z-index: 1; + margin: 0; +} + +/** +Card alert + */ +.card-alert { + border-radius: 0; + margin: -1px -1px 0; +} + +.card-category { + font-size: 0.875rem; + text-transform: uppercase; + text-align: center; + font-weight: 600; + letter-spacing: .05em; + margin: 0 0 .5rem; +} + +.popover { + -webkit-filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); + filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); +} + +.popover.bs-popover-top, .popover.bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.625rem; +} + +.popover .arrow { + margin-right: calc(.25rem + 2px); +} + +.dropdown { + display: inline-block; +} + +.dropdown-menu { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 12rem; +} + +.dropdown-item { + color: #6e7687; +} + +.dropdown-menu-arrow:before { + position: absolute; + top: -6px; + right: 12px; + display: inline-block; + border-left: 5px solid transparent; + border-bottom: 5px solid rgba(0, 40, 100, 0.12); + border-right: 5px solid transparent; + border-bottom-color: rgba(0, 0, 0, 0.2); + content: ''; +} + +.dropdown-menu-arrow:after { + position: absolute; + top: -5px; + right: 12px; + display: inline-block; + border-left: 5px solid transparent; + border-bottom: 5px solid #fff; + border-right: 5px solid transparent; + content: ''; +} + +.dropdown-menu-arrow.dropdown-menu-right:before, .dropdown-menu-arrow.dropdown-menu-right:after { + right: auto; + left: 12px; +} + +.dropdown-toggle { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; +} + +.dropdown-toggle:after { + vertical-align: 0.155em; +} + +.dropdown-toggle:empty:after { + margin-right: 0; +} + +.dropdown-icon { + color: #9aa0ac; + margin-left: .5rem; + margin-right: -.5rem; + width: 1em; + display: inline-block; + text-align: center; + vertical-align: -1px; +} + +.list-inline-dots .list-inline-item + .list-inline-item:before { + content: '· '; + margin-right: -2px; + margin-left: 3px; +} + +.list-separated-item { + padding: 1rem 0; +} + +.list-separated-item:first-child { + padding-top: 0; +} + +.list-separated-item:last-child { + padding-bottom: 0; +} + +.list-separated-item + .list-separated-item { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item.active .icon { + color: inherit !important; +} + +.list-group-transparent .list-group-item { + background: none; + border: 0; + padding: .5rem 1rem; + border-radius: 3px; +} + +.list-group-transparent .list-group-item.active { + background: rgba(70, 127, 207, 0.06); + font-weight: 600; +} + +.avatar { + width: 2rem; + height: 2rem; + line-height: 2rem; + border-radius: 50%; + display: inline-block; + background: #ced4da no-repeat center/cover; + position: relative; + text-align: center; + color: #868e96; + font-weight: 600; + vertical-align: bottom; + font-size: .875rem; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.avatar i { + font-size: 125%; + vertical-align: sub; +} + +.avatar-status { + position: absolute; + left: -2px; + bottom: -2px; + width: .75rem; + height: .75rem; + border: 2px solid #fff; + background: #868e96; + border-radius: 50%; +} + +.avatar-sm { + width: 1.5rem; + height: 1.5rem; + line-height: 1.5rem; + font-size: .75rem; +} + +.avatar-md { + width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; + font-size: 1rem; +} + +.avatar-lg { + width: 3rem; + height: 3rem; + line-height: 3rem; + font-size: 1.25rem; +} + +.avatar-xl { + width: 4rem; + height: 4rem; + line-height: 4rem; + font-size: 1.75rem; +} + +.avatar-xxl { + width: 5rem; + height: 5rem; + line-height: 5rem; + font-size: 2rem; +} + +.avatar-placeholder { + background: #ced4da url('data:image/svg+xml;charset=utf8,') no-repeat center/80%; +} + +.avatar-list { + margin: 0 0 -.5rem; + padding: 0; + font-size: 0; +} + +.avatar-list .avatar { + margin-bottom: .5rem; +} + +.avatar-list .avatar:not(:last-child) { + margin-left: .5rem; +} + +.avatar-list-stacked .avatar { + margin-left: -.8em !important; +} + +.avatar-list-stacked .avatar { + box-shadow: 0 0 0 2px #fff; +} + +.avatar-blue { + background-color: #c8d9f1; + color: #467fcf; +} + +.avatar-indigo { + background-color: #d1d5f0; + color: #6574cd; +} + +.avatar-purple { + background-color: #e4cff9; + color: #a55eea; +} + +.avatar-pink { + background-color: #fcd3e1; + color: #f66d9b; +} + +.avatar-red { + background-color: #f0bcbc; + color: #cd201f; +} + +.avatar-orange { + background-color: #fee0c7; + color: #fd9644; +} + +.avatar-yellow { + background-color: #fbedb7; + color: #f1c40f; +} + +.avatar-green { + background-color: #cfeab3; + color: #5eba00; +} + +.avatar-teal { + background-color: #bfefea; + color: #2bcbba; +} + +.avatar-cyan { + background-color: #b9e3ea; + color: #17a2b8; +} + +.avatar-white { + background-color: white; + color: #fff; +} + +.avatar-gray { + background-color: #dbdde0; + color: #868e96; +} + +.avatar-gray-dark { + background-color: #c2c4c6; + color: #343a40; +} + +.avatar-azure { + background-color: #c7e6fb; + color: #45aaf2; +} + +.avatar-lime { + background-color: #d7f2c2; + color: #7bd235; +} + +.product-price { + font-size: 1rem; +} + +.product-price strong { + font-size: 1.5rem; +} + +@-webkit-keyframes indeterminate { + 0% { + right: -35%; + left: 100%; + } + 100%, 60% { + right: 100%; + left: -90%; + } +} + +@keyframes indeterminate { + 0% { + right: -35%; + left: 100%; + } + 100%, 60% { + right: 100%; + left: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + right: -200%; + left: 100%; + } + 100%, 60% { + right: 107%; + left: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + right: -200%; + left: 100%; + } + 100%, 60% { + right: 107%; + left: -8%; + } +} + +.progress { + position: relative; +} + +.progress-xs, +.progress-xs .progress-bar { + height: .25rem; +} + +.progress-sm, +.progress-sm .progress-bar { + height: .5rem; +} + +.progress-bar-indeterminate:after, .progress-bar-indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + right: 0; + will-change: left, right; + top: 0; + bottom: 0; +} + +.progress-bar-indeterminate:before { + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress-bar-indeterminate:after { + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(-360deg); + transform: rotate(-360deg); + } +} + +@keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(-360deg); + transform: rotate(-360deg); + } +} + +/** +Dimmer +*/ +.dimmer { + position: relative; +} + +.dimmer .loader { + display: none; + margin: 0 auto; + position: absolute; + top: 50%; + right: 0; + left: 0; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); +} + +.dimmer.active .loader { + display: block; +} + +.dimmer.active .dimmer-content { + opacity: .04; + pointer-events: none; +} + +/** +Loader +*/ +.loader { + display: block; + position: relative; + height: 2.5rem; + width: 2.5rem; + color: #467fcf; +} + +.loader:before, .loader:after { + width: 2.5rem; + height: 2.5rem; + margin: -1.25rem -1.25rem 0 0; + position: absolute; + content: ''; + top: 50%; + right: 50%; +} + +.loader:before { + border-radius: 50%; + border: 3px solid currentColor; + opacity: .15; +} + +.loader:after { + -webkit-animation: loader .6s linear; + animation: loader .6s linear; + -webkit-animation-iteration-count: infinite; + animation-iteration-count: infinite; + border-radius: 50%; + border: 3px solid; + border-color: transparent; + border-top-color: currentColor; + box-shadow: 0 0 0 1px transparent; +} + +.icons-list { + list-style: none; + margin: 0 0 -1px -1px; + padding: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.icons-list > li { + -ms-flex: 1 0 4rem; + flex: 1 0 4rem; +} + +.icons-list-wrap { + overflow: hidden; +} + +.icons-list-item { + text-align: center; + height: 4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + border-left: 1px solid rgba(0, 40, 100, 0.12); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.icons-list-item i { + font-size: 1.25rem; +} + +.img-gallery { + margin-left: -.25rem; + margin-right: -.25rem; + margin-bottom: -.5rem; +} + +.img-gallery > .col, +.img-gallery > [class*="col-"] { + padding-right: .25rem; + padding-left: .25rem; + padding-bottom: .5rem; +} + +.link-overlay { + position: relative; +} + +.link-overlay:hover .link-overlay-bg { + opacity: 1; +} + +.link-overlay-bg { + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; + background: rgba(70, 127, 207, 0.8); + display: -ms-flexbox; + display: flex; + color: #fff; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + font-size: 1.25rem; + opacity: 0; + transition: .3s opacity; +} + +.media-icon { + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + border-radius: 100%; +} + +.media-list { + margin: 0; + padding: 0; + list-style: none; +} + +textarea[cols] { + height: auto; +} + +.form-group { + display: block; +} + +.form-label { + display: block; + margin-bottom: .375rem; + font-weight: 600; + font-size: 0.875rem; +} + +.form-label-small { + float: left; + font-weight: 400; + font-size: 87.5%; +} + +.form-footer { + margin-top: 2rem; +} + +.custom-control { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.custom-controls-stacked .custom-control { + margin-bottom: .25rem; +} + +.custom-control-label { + vertical-align: middle; +} + +.custom-control-label:before { + border: 1px solid rgba(0, 40, 100, 0.12); + background-color: #fff; + background-size: .5rem; +} + +.custom-control-description { + line-height: 1.5rem; +} + +.input-group-prepend, +.input-group-append, +.input-group-btn { + font-size: 0.9375rem; +} + +.input-group-prepend > .btn, +.input-group-append > .btn, +.input-group-btn > .btn { + height: 100%; + border-color: rgba(0, 40, 100, 0.12); +} + +.input-group-prepend > .input-group-text { + border-left: 0; +} + +.input-group-append > .input-group-text { + border-right: 0; +} + +/** +Icon input + */ +.input-icon { + position: relative; +} + +.input-icon .form-control:not(:last-child) { + padding-left: 2.5rem; +} + +.input-icon .form-control:not(:first-child) { + padding-right: 2.5rem; +} + +.input-icon-addon { + position: absolute; + top: 0; + bottom: 0; + right: 0; + color: #9aa0ac; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + min-width: 2.5rem; + pointer-events: none; +} + +.input-icon-addon:last-child { + right: auto; + left: 0; +} + +.form-fieldset { + background: #f8f9fa; + border: 1px solid #e9ecef; + padding: 1rem; + border-radius: 3px; + margin-bottom: 1rem; +} + +.form-required { + color: #cd201f; +} + +.form-required:before { + content: ' '; +} + +.state-valid { + padding-left: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.state-invalid { + padding-left: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.form-help { + display: inline-block; + width: 1rem; + height: 1rem; + text-align: center; + line-height: 1rem; + color: #9aa0ac; + background: #f8f9fa; + border-radius: 50%; + font-size: 0.75rem; + transition: .3s background-color, .3s color; + text-decoration: none; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.form-help:hover, .form-help[aria-describedby] { + background: #467fcf; + color: #fff; +} + +.sparkline { + display: inline-block; + height: 2rem; +} + +.jqstooltip { + box-sizing: content-box; + font-family: inherit !important; + background: #333 !important; + border: none !important; + border-radius: 3px; + font-size: 11px !important; + font-weight: 700 !important; + line-height: 1 !important; + padding: 6px !important; +} + +.jqstooltip .jqsfield { + font: inherit !important; +} + +.social-links li a { + background: #f8f8f8; + border-radius: 50%; + color: #9aa0ac; + display: inline-block; + height: 1.75rem; + width: 1.75rem; + line-height: 1.75rem; + text-align: center; +} + +.map, +.chart { + position: relative; + padding-top: 56.25%; +} + +.map-square, +.chart-square { + padding-top: 100%; +} + +.map-content, +.chart-content { + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; +} + +.map-header { + margin-top: -1.5rem; + margin-bottom: 1.5rem; + height: 15rem; + position: relative; + margin-bottom: -1.5rem; +} + +.map-header:before { + content: ''; + position: absolute; + bottom: 0; + right: 0; + left: 0; + height: 10rem; + background: linear-gradient(to bottom, rgba(245, 247, 251, 0) 5%, #f5f7fb 95%); + pointer-events: none; +} + +.map-header-layer { + height: 100%; +} + +.map-static { + height: 120px; + width: 100%; + max-width: 640px; + background-position: center center; + background-size: 640px 120px; +} + +@-webkit-keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +@keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +.status-icon { + content: ''; + width: 0.5rem; + height: 0.5rem; + display: inline-block; + background: currentColor; + border-radius: 50%; + -webkit-transform: translateY(-1px); + transform: translateY(-1px); + margin-left: .375rem; + vertical-align: middle; +} + +.status-animated { + -webkit-animation: 1s status-pulse infinite ease; + animation: 1s status-pulse infinite ease; +} + +.chart-circle { + display: block; + height: 8rem; + width: 8rem; + position: relative; +} + +.chart-circle canvas { + margin: 0 auto; + display: block; + max-width: 100%; + max-height: 100%; +} + +.chart-circle-xs { + height: 2.5rem; + width: 2.5rem; + font-size: .8rem; +} + +.chart-circle-sm { + height: 4rem; + width: 4rem; + font-size: .8rem; +} + +.chart-circle-lg { + height: 10rem; + width: 10rem; + font-size: .8rem; +} + +.chart-circle-value { + position: absolute; + top: 0; + right: 0; + left: 0; + margin-right: auto; + margin-left: auto; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + -ms-flex-align: center; + align-items: center; + -ms-flex-direction: column; + flex-direction: column; + line-height: 1; +} + +.chart-circle-value small { + display: block; + color: #9aa0ac; + font-size: 0.9375rem; +} + +.chips { + margin: 0 0 -.5rem; +} + +.chips .chip { + margin: 0 0 .5rem .5rem; +} + +.chip { + display: inline-block; + height: 2rem; + line-height: 2rem; + font-size: 0.875rem; + font-weight: 500; + color: #6e7687; + padding: 0 .75rem; + border-radius: 1rem; + background-color: #f8f9fa; + transition: .3s background; +} + +.chip .avatar { + float: right; + margin: 0 -.75rem 0 .5rem; + height: 2rem; + width: 2rem; + border-radius: 50%; +} + +a.chip:hover { + color: inherit; + text-decoration: none; + background-color: #e9ecef; +} + +.stamp { + color: #fff; + background: #868e96; + display: inline-block; + min-width: 2rem; + height: 2rem; + padding: 0 .25rem; + line-height: 2rem; + text-align: center; + border-radius: 3px; + font-weight: 600; +} + +.stamp-md { + min-width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; +} + +.chat { + outline: 0; + margin: 0; + padding: 0; + list-style-type: none; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: end; + justify-content: flex-end; + min-height: 100%; +} + +.chat-line { + padding: 0; + text-align: left; + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: row-reverse; + flex-direction: row-reverse; +} + +.chat-line + .chat-line { + padding-top: 1rem; +} + +.chat-message { + position: relative; + display: inline-block; + background-color: #467fcf; + color: #fff; + font-size: 0.875rem; + padding: .375rem .5rem; + border-radius: 3px; + white-space: normal; + text-align: right; + margin: 0 2.5rem 0 .5rem; + line-height: 1.4; +} + +.chat-message > :last-child { + margin-bottom: 0 !important; +} + +.chat-message:after { + content: ""; + position: absolute; + left: -5px; + top: 7px; + border-bottom: 6px solid transparent; + border-right: 6px solid #467fcf; + border-top: 6px solid transparent; +} + +.chat-message img { + max-width: 100%; +} + +.chat-message p { + margin-bottom: 1em; +} + +.chat-line-friend { + -ms-flex-direction: row; + flex-direction: row; +} + +.chat-line-friend + .chat-line-friend { + margin-top: -.5rem; +} + +.chat-line-friend + .chat-line-friend .chat-author { + visibility: hidden; +} + +.chat-line-friend + .chat-line-friend .chat-message:after { + display: none; +} + +.chat-line-friend .chat-message { + background-color: #f3f3f3; + color: #495057; + margin-right: .5rem; + margin-left: 2.5rem; +} + +.chat-line-friend .chat-message:after { + left: auto; + right: -5px; + border-right-width: 0; + border-left: 5px solid #f3f3f3; +} + +.example { + padding: 1.5rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px 3px 0 0; + font-size: 0.9375rem; +} + +.example-bg { + background: #f5f7fb; +} + +.example + .highlight { + border-top: none; + margin-top: 0; + border-radius: 0 0 3px 3px; +} + +.highlight { + margin: 1rem 0 2rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-size: 0.9375rem; + max-height: 40rem; + overflow: auto; + background: #fcfcfc; +} + +.highlight pre { + margin-bottom: 0; + background-color: transparent; +} + +.example-column { + margin: 0 auto; +} + +.example-column > .card:last-of-type { + margin-bottom: 0; +} + +.example-column-1 { + max-width: 20rem; +} + +.example-column-2 { + max-width: 40rem; +} + +.tag { + font-size: 0.75rem; + color: #6e7687; + background-color: #e9ecef; + border-radius: 3px; + padding: 0 .5rem; + line-height: 2em; + display: -ms-inline-flexbox; + display: inline-flex; + cursor: default; + font-weight: 400; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +a.tag { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag:hover { + background-color: rgba(110, 118, 135, 0.2); + color: inherit; +} + +.tag-addon { + display: inline-block; + padding: 0 .5rem; + color: inherit; + text-decoration: none; + background: rgba(0, 0, 0, 0.06); + margin: 0 .5rem 0 -.5rem; + text-align: center; + min-width: 1.5rem; +} + +.tag-addon:last-child { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.tag-addon i { + vertical-align: middle; + margin: 0 -.25rem; +} + +a.tag-addon { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag-addon:hover { + background: rgba(0, 0, 0, 0.16); + color: inherit; +} + +.tag-avatar { + width: 1.5rem; + height: 1.5rem; + border-radius: 0 3px 3px 0; + margin: 0 -.5rem 0 .5rem; +} + +.tag-blue { + background-color: #467fcf; + color: #fff; +} + +.tag-indigo { + background-color: #6574cd; + color: #fff; +} + +.tag-purple { + background-color: #a55eea; + color: #fff; +} + +.tag-pink { + background-color: #f66d9b; + color: #fff; +} + +.tag-red { + background-color: #cd201f; + color: #fff; +} + +.tag-orange { + background-color: #fd9644; + color: #fff; +} + +.tag-yellow { + background-color: #f1c40f; + color: #fff; +} + +.tag-green { + background-color: #5eba00; + color: #fff; +} + +.tag-teal { + background-color: #2bcbba; + color: #fff; +} + +.tag-cyan { + background-color: #17a2b8; + color: #fff; +} + +.tag-white { + background-color: #fff; + color: #fff; +} + +.tag-gray { + background-color: #868e96; + color: #fff; +} + +.tag-gray-dark { + background-color: #343a40; + color: #fff; +} + +.tag-azure { + background-color: #45aaf2; + color: #fff; +} + +.tag-lime { + background-color: #7bd235; + color: #fff; +} + +.tag-primary { + background-color: #467fcf; + color: #fff; +} + +.tag-secondary { + background-color: #868e96; + color: #fff; +} + +.tag-success { + background-color: #5eba00; + color: #fff; +} + +.tag-info { + background-color: #45aaf2; + color: #fff; +} + +.tag-warning { + background-color: #f1c40f; + color: #fff; +} + +.tag-danger { + background-color: #cd201f; + color: #fff; +} + +.tag-light { + background-color: #f8f9fa; + color: #fff; +} + +.tag-dark { + background-color: #343a40; + color: #fff; +} + +.tag-rounded { + border-radius: 50px; +} + +.tag-rounded .tag-avatar { + border-radius: 50px; +} + +.tags { + margin-bottom: -.5rem; + font-size: 0; +} + +.tags > .tag { + margin-bottom: .5rem; +} + +.tags > .tag:not(:last-child) { + margin-left: .5rem; +} + +.highlight .hll { + background-color: #ffc; +} + +.highlight .c { + color: #999; +} + +.highlight .k { + color: #069; +} + +.highlight .o { + color: #555; +} + +.highlight .cm { + color: #999; +} + +.highlight .cp { + color: #099; +} + +.highlight .c1 { + color: #999; +} + +.highlight .cs { + color: #999; +} + +.highlight .gd { + background-color: #fcc; + border: 1px solid #c00; +} + +.highlight .ge { + font-style: italic; +} + +.highlight .gr { + color: #f00; +} + +.highlight .gh { + color: #030; +} + +.highlight .gi { + background-color: #cfc; + border: 1px solid #0c0; +} + +.highlight .go { + color: #aaa; +} + +.highlight .gp { + color: #009; +} + +.highlight .gu { + color: #030; +} + +.highlight .gt { + color: #9c6; +} + +.highlight .kc { + color: #069; +} + +.highlight .kd { + color: #069; +} + +.highlight .kn { + color: #069; +} + +.highlight .kp { + color: #069; +} + +.highlight .kr { + color: #069; +} + +.highlight .kt { + color: #078; +} + +.highlight .m { + color: #f60; +} + +.highlight .s { + color: #d44950; +} + +.highlight .na { + color: #4f9fcf; +} + +.highlight .nb { + color: #366; +} + +.highlight .nc { + color: #0a8; +} + +.highlight .no { + color: #360; +} + +.highlight .nd { + color: #99f; +} + +.highlight .ni { + color: #999; +} + +.highlight .ne { + color: #c00; +} + +.highlight .nf { + color: #c0f; +} + +.highlight .nl { + color: #99f; +} + +.highlight .nn { + color: #0cf; +} + +.highlight .nt { + color: #2f6f9f; +} + +.highlight .nv { + color: #033; +} + +.highlight .ow { + color: #000; +} + +.highlight .w { + color: #bbb; +} + +.highlight .mf { + color: #f60; +} + +.highlight .mh { + color: #f60; +} + +.highlight .mi { + color: #f60; +} + +.highlight .mo { + color: #f60; +} + +.highlight .sb { + color: #c30; +} + +.highlight .sc { + color: #c30; +} + +.highlight .sd { + font-style: italic; + color: #c30; +} + +.highlight .s2 { + color: #c30; +} + +.highlight .se { + color: #c30; +} + +.highlight .sh { + color: #c30; +} + +.highlight .si { + color: #a00; +} + +.highlight .sx { + color: #c30; +} + +.highlight .sr { + color: #3aa; +} + +.highlight .s1 { + color: #c30; +} + +.highlight .ss { + color: #fc3; +} + +.highlight .bp { + color: #366; +} + +.highlight .vc { + color: #033; +} + +.highlight .vg { + color: #033; +} + +.highlight .vi { + color: #033; +} + +.highlight .il { + color: #f60; +} + +.highlight .css .o, +.highlight .css .o + .nt, +.highlight .css .nt + .nt { + color: #999; +} + +.highlight .language-bash::before, +.highlight .language-sh::before { + color: #009; + content: "$ "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.highlight .language-powershell::before { + color: #009; + content: "PM> "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.carousel-item-background { + content: ''; + background: rgba(0, 0, 0, 0.5); + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; +} + +.custom-range { + -ms-flex-align: center; + align-items: center; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + height: 100%; + min-height: 2.375rem; + overflow: hidden; + padding: 0; + border: 0; +} + +.custom-range:focus { + box-shadow: none; + outline: none; +} + +.custom-range:focus::-webkit-slider-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-moz-range-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-ms-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-runnable-track { + background: #467fcf; + content: ''; + height: 2px; + pointer-events: none; +} + +.custom-range::-webkit-slider-thumb { + width: 14px; + height: 14px; + -webkit-appearance: none; + appearance: none; + background: #fff; + border-radius: 50px; + box-shadow: -1px 0 0 -6px rgba(0, 50, 126, 0.12), -6px 0 0 -6px rgba(0, 50, 126, 0.12), -7px 0 0 -6px rgba(0, 50, 126, 0.12), -8px 0 0 -6px rgba(0, 50, 126, 0.12), -9px 0 0 -6px rgba(0, 50, 126, 0.12), -10px 0 0 -6px rgba(0, 50, 126, 0.12), -11px 0 0 -6px rgba(0, 50, 126, 0.12), -12px 0 0 -6px rgba(0, 50, 126, 0.12), -13px 0 0 -6px rgba(0, 50, 126, 0.12), -14px 0 0 -6px rgba(0, 50, 126, 0.12), -15px 0 0 -6px rgba(0, 50, 126, 0.12), -16px 0 0 -6px rgba(0, 50, 126, 0.12), -17px 0 0 -6px rgba(0, 50, 126, 0.12), -18px 0 0 -6px rgba(0, 50, 126, 0.12), -19px 0 0 -6px rgba(0, 50, 126, 0.12), -20px 0 0 -6px rgba(0, 50, 126, 0.12), -21px 0 0 -6px rgba(0, 50, 126, 0.12), -22px 0 0 -6px rgba(0, 50, 126, 0.12), -23px 0 0 -6px rgba(0, 50, 126, 0.12), -24px 0 0 -6px rgba(0, 50, 126, 0.12), -25px 0 0 -6px rgba(0, 50, 126, 0.12), -26px 0 0 -6px rgba(0, 50, 126, 0.12), -27px 0 0 -6px rgba(0, 50, 126, 0.12), -28px 0 0 -6px rgba(0, 50, 126, 0.12), -29px 0 0 -6px rgba(0, 50, 126, 0.12), -30px 0 0 -6px rgba(0, 50, 126, 0.12), -31px 0 0 -6px rgba(0, 50, 126, 0.12), -32px 0 0 -6px rgba(0, 50, 126, 0.12), -33px 0 0 -6px rgba(0, 50, 126, 0.12), -34px 0 0 -6px rgba(0, 50, 126, 0.12), -35px 0 0 -6px rgba(0, 50, 126, 0.12), -36px 0 0 -6px rgba(0, 50, 126, 0.12), -37px 0 0 -6px rgba(0, 50, 126, 0.12), -38px 0 0 -6px rgba(0, 50, 126, 0.12), -39px 0 0 -6px rgba(0, 50, 126, 0.12), -40px 0 0 -6px rgba(0, 50, 126, 0.12), -41px 0 0 -6px rgba(0, 50, 126, 0.12), -42px 0 0 -6px rgba(0, 50, 126, 0.12), -43px 0 0 -6px rgba(0, 50, 126, 0.12), -44px 0 0 -6px rgba(0, 50, 126, 0.12), -45px 0 0 -6px rgba(0, 50, 126, 0.12), -46px 0 0 -6px rgba(0, 50, 126, 0.12), -47px 0 0 -6px rgba(0, 50, 126, 0.12), -48px 0 0 -6px rgba(0, 50, 126, 0.12), -49px 0 0 -6px rgba(0, 50, 126, 0.12), -50px 0 0 -6px rgba(0, 50, 126, 0.12), -51px 0 0 -6px rgba(0, 50, 126, 0.12), -52px 0 0 -6px rgba(0, 50, 126, 0.12), -53px 0 0 -6px rgba(0, 50, 126, 0.12), -54px 0 0 -6px rgba(0, 50, 126, 0.12), -55px 0 0 -6px rgba(0, 50, 126, 0.12), -56px 0 0 -6px rgba(0, 50, 126, 0.12), -57px 0 0 -6px rgba(0, 50, 126, 0.12), -58px 0 0 -6px rgba(0, 50, 126, 0.12), -59px 0 0 -6px rgba(0, 50, 126, 0.12), -60px 0 0 -6px rgba(0, 50, 126, 0.12), -61px 0 0 -6px rgba(0, 50, 126, 0.12), -62px 0 0 -6px rgba(0, 50, 126, 0.12), -63px 0 0 -6px rgba(0, 50, 126, 0.12), -64px 0 0 -6px rgba(0, 50, 126, 0.12), -65px 0 0 -6px rgba(0, 50, 126, 0.12), -66px 0 0 -6px rgba(0, 50, 126, 0.12), -67px 0 0 -6px rgba(0, 50, 126, 0.12), -68px 0 0 -6px rgba(0, 50, 126, 0.12), -69px 0 0 -6px rgba(0, 50, 126, 0.12), -70px 0 0 -6px rgba(0, 50, 126, 0.12), -71px 0 0 -6px rgba(0, 50, 126, 0.12), -72px 0 0 -6px rgba(0, 50, 126, 0.12), -73px 0 0 -6px rgba(0, 50, 126, 0.12), -74px 0 0 -6px rgba(0, 50, 126, 0.12), -75px 0 0 -6px rgba(0, 50, 126, 0.12), -76px 0 0 -6px rgba(0, 50, 126, 0.12), -77px 0 0 -6px rgba(0, 50, 126, 0.12), -78px 0 0 -6px rgba(0, 50, 126, 0.12), -79px 0 0 -6px rgba(0, 50, 126, 0.12), -80px 0 0 -6px rgba(0, 50, 126, 0.12), -81px 0 0 -6px rgba(0, 50, 126, 0.12), -82px 0 0 -6px rgba(0, 50, 126, 0.12), -83px 0 0 -6px rgba(0, 50, 126, 0.12), -84px 0 0 -6px rgba(0, 50, 126, 0.12), -85px 0 0 -6px rgba(0, 50, 126, 0.12), -86px 0 0 -6px rgba(0, 50, 126, 0.12), -87px 0 0 -6px rgba(0, 50, 126, 0.12), -88px 0 0 -6px rgba(0, 50, 126, 0.12), -89px 0 0 -6px rgba(0, 50, 126, 0.12), -90px 0 0 -6px rgba(0, 50, 126, 0.12), -91px 0 0 -6px rgba(0, 50, 126, 0.12), -92px 0 0 -6px rgba(0, 50, 126, 0.12), -93px 0 0 -6px rgba(0, 50, 126, 0.12), -94px 0 0 -6px rgba(0, 50, 126, 0.12), -95px 0 0 -6px rgba(0, 50, 126, 0.12), -96px 0 0 -6px rgba(0, 50, 126, 0.12), -97px 0 0 -6px rgba(0, 50, 126, 0.12), -98px 0 0 -6px rgba(0, 50, 126, 0.12), -99px 0 0 -6px rgba(0, 50, 126, 0.12), -100px 0 0 -6px rgba(0, 50, 126, 0.12), -101px 0 0 -6px rgba(0, 50, 126, 0.12), -102px 0 0 -6px rgba(0, 50, 126, 0.12), -103px 0 0 -6px rgba(0, 50, 126, 0.12), -104px 0 0 -6px rgba(0, 50, 126, 0.12), -105px 0 0 -6px rgba(0, 50, 126, 0.12), -106px 0 0 -6px rgba(0, 50, 126, 0.12), -107px 0 0 -6px rgba(0, 50, 126, 0.12), -108px 0 0 -6px rgba(0, 50, 126, 0.12), -109px 0 0 -6px rgba(0, 50, 126, 0.12), -110px 0 0 -6px rgba(0, 50, 126, 0.12), -111px 0 0 -6px rgba(0, 50, 126, 0.12), -112px 0 0 -6px rgba(0, 50, 126, 0.12), -113px 0 0 -6px rgba(0, 50, 126, 0.12), -114px 0 0 -6px rgba(0, 50, 126, 0.12), -115px 0 0 -6px rgba(0, 50, 126, 0.12), -116px 0 0 -6px rgba(0, 50, 126, 0.12), -117px 0 0 -6px rgba(0, 50, 126, 0.12), -118px 0 0 -6px rgba(0, 50, 126, 0.12), -119px 0 0 -6px rgba(0, 50, 126, 0.12), -120px 0 0 -6px rgba(0, 50, 126, 0.12), -121px 0 0 -6px rgba(0, 50, 126, 0.12), -122px 0 0 -6px rgba(0, 50, 126, 0.12), -123px 0 0 -6px rgba(0, 50, 126, 0.12), -124px 0 0 -6px rgba(0, 50, 126, 0.12), -125px 0 0 -6px rgba(0, 50, 126, 0.12), -126px 0 0 -6px rgba(0, 50, 126, 0.12), -127px 0 0 -6px rgba(0, 50, 126, 0.12), -128px 0 0 -6px rgba(0, 50, 126, 0.12), -129px 0 0 -6px rgba(0, 50, 126, 0.12), -130px 0 0 -6px rgba(0, 50, 126, 0.12), -131px 0 0 -6px rgba(0, 50, 126, 0.12), -132px 0 0 -6px rgba(0, 50, 126, 0.12), -133px 0 0 -6px rgba(0, 50, 126, 0.12), -134px 0 0 -6px rgba(0, 50, 126, 0.12), -135px 0 0 -6px rgba(0, 50, 126, 0.12), -136px 0 0 -6px rgba(0, 50, 126, 0.12), -137px 0 0 -6px rgba(0, 50, 126, 0.12), -138px 0 0 -6px rgba(0, 50, 126, 0.12), -139px 0 0 -6px rgba(0, 50, 126, 0.12), -140px 0 0 -6px rgba(0, 50, 126, 0.12), -141px 0 0 -6px rgba(0, 50, 126, 0.12), -142px 0 0 -6px rgba(0, 50, 126, 0.12), -143px 0 0 -6px rgba(0, 50, 126, 0.12), -144px 0 0 -6px rgba(0, 50, 126, 0.12), -145px 0 0 -6px rgba(0, 50, 126, 0.12), -146px 0 0 -6px rgba(0, 50, 126, 0.12), -147px 0 0 -6px rgba(0, 50, 126, 0.12), -148px 0 0 -6px rgba(0, 50, 126, 0.12), -149px 0 0 -6px rgba(0, 50, 126, 0.12), -150px 0 0 -6px rgba(0, 50, 126, 0.12), -151px 0 0 -6px rgba(0, 50, 126, 0.12), -152px 0 0 -6px rgba(0, 50, 126, 0.12), -153px 0 0 -6px rgba(0, 50, 126, 0.12), -154px 0 0 -6px rgba(0, 50, 126, 0.12), -155px 0 0 -6px rgba(0, 50, 126, 0.12), -156px 0 0 -6px rgba(0, 50, 126, 0.12), -157px 0 0 -6px rgba(0, 50, 126, 0.12), -158px 0 0 -6px rgba(0, 50, 126, 0.12), -159px 0 0 -6px rgba(0, 50, 126, 0.12), -160px 0 0 -6px rgba(0, 50, 126, 0.12), -161px 0 0 -6px rgba(0, 50, 126, 0.12), -162px 0 0 -6px rgba(0, 50, 126, 0.12), -163px 0 0 -6px rgba(0, 50, 126, 0.12), -164px 0 0 -6px rgba(0, 50, 126, 0.12), -165px 0 0 -6px rgba(0, 50, 126, 0.12), -166px 0 0 -6px rgba(0, 50, 126, 0.12), -167px 0 0 -6px rgba(0, 50, 126, 0.12), -168px 0 0 -6px rgba(0, 50, 126, 0.12), -169px 0 0 -6px rgba(0, 50, 126, 0.12), -170px 0 0 -6px rgba(0, 50, 126, 0.12), -171px 0 0 -6px rgba(0, 50, 126, 0.12), -172px 0 0 -6px rgba(0, 50, 126, 0.12), -173px 0 0 -6px rgba(0, 50, 126, 0.12), -174px 0 0 -6px rgba(0, 50, 126, 0.12), -175px 0 0 -6px rgba(0, 50, 126, 0.12), -176px 0 0 -6px rgba(0, 50, 126, 0.12), -177px 0 0 -6px rgba(0, 50, 126, 0.12), -178px 0 0 -6px rgba(0, 50, 126, 0.12), -179px 0 0 -6px rgba(0, 50, 126, 0.12), -180px 0 0 -6px rgba(0, 50, 126, 0.12), -181px 0 0 -6px rgba(0, 50, 126, 0.12), -182px 0 0 -6px rgba(0, 50, 126, 0.12), -183px 0 0 -6px rgba(0, 50, 126, 0.12), -184px 0 0 -6px rgba(0, 50, 126, 0.12), -185px 0 0 -6px rgba(0, 50, 126, 0.12), -186px 0 0 -6px rgba(0, 50, 126, 0.12), -187px 0 0 -6px rgba(0, 50, 126, 0.12), -188px 0 0 -6px rgba(0, 50, 126, 0.12), -189px 0 0 -6px rgba(0, 50, 126, 0.12), -190px 0 0 -6px rgba(0, 50, 126, 0.12), -191px 0 0 -6px rgba(0, 50, 126, 0.12), -192px 0 0 -6px rgba(0, 50, 126, 0.12), -193px 0 0 -6px rgba(0, 50, 126, 0.12), -194px 0 0 -6px rgba(0, 50, 126, 0.12), -195px 0 0 -6px rgba(0, 50, 126, 0.12), -196px 0 0 -6px rgba(0, 50, 126, 0.12), -197px 0 0 -6px rgba(0, 50, 126, 0.12), -198px 0 0 -6px rgba(0, 50, 126, 0.12), -199px 0 0 -6px rgba(0, 50, 126, 0.12), -200px 0 0 -6px rgba(0, 50, 126, 0.12), -201px 0 0 -6px rgba(0, 50, 126, 0.12), -202px 0 0 -6px rgba(0, 50, 126, 0.12), -203px 0 0 -6px rgba(0, 50, 126, 0.12), -204px 0 0 -6px rgba(0, 50, 126, 0.12), -205px 0 0 -6px rgba(0, 50, 126, 0.12), -206px 0 0 -6px rgba(0, 50, 126, 0.12), -207px 0 0 -6px rgba(0, 50, 126, 0.12), -208px 0 0 -6px rgba(0, 50, 126, 0.12), -209px 0 0 -6px rgba(0, 50, 126, 0.12), -210px 0 0 -6px rgba(0, 50, 126, 0.12), -211px 0 0 -6px rgba(0, 50, 126, 0.12), -212px 0 0 -6px rgba(0, 50, 126, 0.12), -213px 0 0 -6px rgba(0, 50, 126, 0.12), -214px 0 0 -6px rgba(0, 50, 126, 0.12), -215px 0 0 -6px rgba(0, 50, 126, 0.12), -216px 0 0 -6px rgba(0, 50, 126, 0.12), -217px 0 0 -6px rgba(0, 50, 126, 0.12), -218px 0 0 -6px rgba(0, 50, 126, 0.12), -219px 0 0 -6px rgba(0, 50, 126, 0.12), -220px 0 0 -6px rgba(0, 50, 126, 0.12), -221px 0 0 -6px rgba(0, 50, 126, 0.12), -222px 0 0 -6px rgba(0, 50, 126, 0.12), -223px 0 0 -6px rgba(0, 50, 126, 0.12), -224px 0 0 -6px rgba(0, 50, 126, 0.12), -225px 0 0 -6px rgba(0, 50, 126, 0.12), -226px 0 0 -6px rgba(0, 50, 126, 0.12), -227px 0 0 -6px rgba(0, 50, 126, 0.12), -228px 0 0 -6px rgba(0, 50, 126, 0.12), -229px 0 0 -6px rgba(0, 50, 126, 0.12), -230px 0 0 -6px rgba(0, 50, 126, 0.12), -231px 0 0 -6px rgba(0, 50, 126, 0.12), -232px 0 0 -6px rgba(0, 50, 126, 0.12), -233px 0 0 -6px rgba(0, 50, 126, 0.12), -234px 0 0 -6px rgba(0, 50, 126, 0.12), -235px 0 0 -6px rgba(0, 50, 126, 0.12), -236px 0 0 -6px rgba(0, 50, 126, 0.12), -237px 0 0 -6px rgba(0, 50, 126, 0.12), -238px 0 0 -6px rgba(0, 50, 126, 0.12), -239px 0 0 -6px rgba(0, 50, 126, 0.12), -240px 0 0 -6px rgba(0, 50, 126, 0.12); + margin-top: -6px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-track { + width: 240px; + height: 2px; + background: rgba(0, 50, 126, 0.12); +} + +.custom-range::-moz-range-thumb { + width: 14px; + height: 14px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + position: relative; + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-progress { + height: 2px; + background: #467fcf; + border: 0; + margin-top: 0; +} + +.custom-range::-ms-track { + background: transparent; + border: 0; + border-color: transparent; + border-radius: 0; + border-width: 0; + color: transparent; + height: 2px; + margin-top: 10px; + width: 240px; +} + +.custom-range::-ms-thumb { + width: 240px; + height: 2px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-ms-fill-lower { + background: #467fcf; + border-radius: 0; +} + +.custom-range::-ms-fill-upper { + background: rgba(0, 50, 126, 0.12); + border-radius: 0; +} + +.custom-range::-ms-tooltip { + display: none; +} + +.selectgroup { + display: -ms-inline-flexbox; + display: inline-flex; +} + +.selectgroup-item { + -ms-flex-positive: 1; + flex-grow: 1; + position: relative; +} + +.selectgroup-item + .selectgroup-item { + margin-right: -1px; +} + +.selectgroup-item:not(:first-child) .selectgroup-button { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.selectgroup-item:not(:last-child) .selectgroup-button { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.selectgroup-input { + opacity: 0; + position: absolute; + z-index: -1; + top: 0; + right: 0; +} + +.selectgroup-button { + display: block; + border: 1px solid rgba(0, 40, 100, 0.12); + text-align: center; + padding: 0.375rem 1rem; + position: relative; + cursor: pointer; + border-radius: 3px; + color: #9aa0ac; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + font-size: 0.9375rem; + line-height: 1.5rem; + min-width: 2.375rem; +} + +.selectgroup-button-icon { + padding-right: .5rem; + padding-left: .5rem; + font-size: 1rem; +} + +.selectgroup-input:checked + .selectgroup-button { + border-color: #467fcf; + z-index: 1; + color: #467fcf; + background: #edf2fa; +} + +.selectgroup-input:focus + .selectgroup-button { + border-color: #467fcf; + z-index: 2; + color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectgroup-pills { + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: start; + align-items: flex-start; +} + +.selectgroup-pills .selectgroup-item { + margin-left: .5rem; + -ms-flex-positive: 0; + flex-grow: 0; +} + +.selectgroup-pills .selectgroup-button { + border-radius: 50px !important; +} + +.custom-switch { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: default; + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + margin: 0; +} + +.custom-switch-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-switches-stacked { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.custom-switches-stacked .custom-switch { + margin-bottom: .5rem; +} + +.custom-switch-indicator { + display: inline-block; + height: 1.25rem; + width: 2.25rem; + background: #e9ecef; + border-radius: 50px; + position: relative; + vertical-align: bottom; + border: 1px solid rgba(0, 40, 100, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-switch-indicator:before { + content: ''; + position: absolute; + height: calc(1.25rem - 4px); + width: calc(1.25rem - 4px); + top: 1px; + right: 1px; + background: #fff; + border-radius: 50%; + transition: .3s right; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); +} + +.custom-switch-input:checked ~ .custom-switch-indicator { + background: #467fcf; +} + +.custom-switch-input:checked ~ .custom-switch-indicator:before { + right: calc(1rem + 1px); +} + +.custom-switch-input:focus ~ .custom-switch-indicator { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); + border-color: #467fcf; +} + +.custom-switch-description { + margin-right: .5rem; + color: #6e7687; + transition: .3s color; +} + +.custom-switch-input:checked ~ .custom-switch-description { + color: #495057; +} + +.imagecheck { + margin: 0; + position: relative; + cursor: pointer; +} + +.imagecheck-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.imagecheck-figure { + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + margin: 0; + position: relative; +} + +.imagecheck-input:focus ~ .imagecheck-figure { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.imagecheck-input:checked ~ .imagecheck-figure { + border-color: rgba(0, 40, 100, 0.24); +} + +.imagecheck-figure:before { + content: ''; + position: absolute; + top: .25rem; + right: .25rem; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background: #467fcf url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; + color: #fff; + z-index: 1; + border-radius: 3px; + opacity: 0; + transition: .3s opacity; +} + +.imagecheck-input:checked ~ .imagecheck-figure:before { + opacity: 1; +} + +.imagecheck-image { + max-width: 100%; + opacity: .64; + transition: .3s opacity; +} + +.imagecheck-image:first-child { + border-top-right-radius: 2px; + border-top-left-radius: 2px; +} + +.imagecheck-image:last-child { + border-bottom-right-radius: 2px; + border-bottom-left-radius: 2px; +} + +.imagecheck:hover .imagecheck-image, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-image, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-image { + opacity: 1; +} + +.imagecheck-caption { + text-align: center; + padding: .25rem .25rem; + color: #9aa0ac; + font-size: 0.875rem; + transition: .3s color; +} + +.imagecheck:hover .imagecheck-caption, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-caption, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-caption { + color: #495057; +} + +.colorinput { + margin: 0; + position: relative; + cursor: pointer; +} + +.colorinput-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.colorinput-color { + display: inline-block; + width: 1.75rem; + height: 1.75rem; + border-radius: 3px; + border: 1px solid rgba(0, 40, 100, 0.12); + color: #fff; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); +} + +.colorinput-color:before { + content: ''; + opacity: 0; + position: absolute; + top: .25rem; + right: .25rem; + height: 1.25rem; + width: 1.25rem; + transition: .3s opacity; + background: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; +} + +.colorinput-input:checked ~ .colorinput-color:before { + opacity: 1; +} + +.colorinput-input:focus ~ .colorinput-color { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.timeline { + position: relative; + margin: 0 0 2rem; + padding: 0; + list-style: none; +} + +.timeline:before { + background-color: #e9ecef; + position: absolute; + display: block; + content: ''; + width: 1px; + height: 100%; + top: 0; + bottom: 0; + right: 4px; +} + +.timeline-item { + position: relative; + display: -ms-flexbox; + display: flex; + padding-right: 2rem; + margin: .5rem 0; +} + +.timeline-item:first-child:before, .timeline-item:last-child:before { + content: ''; + position: absolute; + background: #fff; + width: 1px; + right: .25rem; +} + +.timeline-item:first-child { + margin-top: 0; +} + +.timeline-item:first-child:before { + top: 0; + height: .5rem; +} + +.timeline-item:last-child { + margin-bottom: 0; +} + +.timeline-item:last-child:before { + top: .5rem; + bottom: 0; +} + +.timeline-badge { + position: absolute; + display: block; + width: 0.4375rem; + height: 0.4375rem; + right: 1px; + top: .5rem; + border-radius: 100%; + border: 1px solid #fff; + background: #adb5bd; +} + +.timeline-time { + white-space: nowrap; + margin-right: auto; + color: #9aa0ac; + font-size: 87.5%; +} + +.browser { + width: 1.25rem; + height: 1.25rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; +} + +.browser-android-browser { + background-image: url("../images/browsers/android-browser.svg"); +} + +.browser-aol-explorer { + background-image: url("../images/browsers/aol-explorer.svg"); +} + +.browser-blackberry { + background-image: url("../images/browsers/blackberry.svg"); +} + +.browser-camino { + background-image: url("../images/browsers/camino.svg"); +} + +.browser-chrome { + background-image: url("../images/browsers/chrome.svg"); +} + +.browser-chromium { + background-image: url("../images/browsers/chromium.svg"); +} + +.browser-dolphin { + background-image: url("../images/browsers/dolphin.svg"); +} + +.browser-edge { + background-image: url("../images/browsers/edge.svg"); +} + +.browser-firefox { + background-image: url("../images/browsers/firefox.svg"); +} + +.browser-ie { + background-image: url("../images/browsers/ie.svg"); +} + +.browser-maxthon { + background-image: url("../images/browsers/maxthon.svg"); +} + +.browser-mozilla { + background-image: url("../images/browsers/mozilla.svg"); +} + +.browser-netscape { + background-image: url("../images/browsers/netscape.svg"); +} + +.browser-opera { + background-image: url("../images/browsers/opera.svg"); +} + +.browser-safari { + background-image: url("../images/browsers/safari.svg"); +} + +.browser-sleipnir { + background-image: url("../images/browsers/sleipnir.svg"); +} + +.browser-uc-browser { + background-image: url("../images/browsers/uc-browser.svg"); +} + +.browser-vivaldi { + background-image: url("../images/browsers/vivaldi.svg"); +} + +.flag { + width: 1.6rem; + height: 1.2rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.flag-ad { + background-image: url("../images/flags/ad.svg"); +} + +.flag-ae { + background-image: url("../images/flags/ae.svg"); +} + +.flag-af { + background-image: url("../images/flags/af.svg"); +} + +.flag-ag { + background-image: url("../images/flags/ag.svg"); +} + +.flag-ai { + background-image: url("../images/flags/ai.svg"); +} + +.flag-al { + background-image: url("../images/flags/al.svg"); +} + +.flag-am { + background-image: url("../images/flags/am.svg"); +} + +.flag-ao { + background-image: url("../images/flags/ao.svg"); +} + +.flag-aq { + background-image: url("../images/flags/aq.svg"); +} + +.flag-ar { + background-image: url("../images/flags/ar.svg"); +} + +.flag-as { + background-image: url("../images/flags/as.svg"); +} + +.flag-at { + background-image: url("../images/flags/at.svg"); +} + +.flag-au { + background-image: url("../images/flags/au.svg"); +} + +.flag-aw { + background-image: url("../images/flags/aw.svg"); +} + +.flag-ax { + background-image: url("../images/flags/ax.svg"); +} + +.flag-az { + background-image: url("../images/flags/az.svg"); +} + +.flag-ba { + background-image: url("../images/flags/ba.svg"); +} + +.flag-bb { + background-image: url("../images/flags/bb.svg"); +} + +.flag-bd { + background-image: url("../images/flags/bd.svg"); +} + +.flag-be { + background-image: url("../images/flags/be.svg"); +} + +.flag-bf { + background-image: url("../images/flags/bf.svg"); +} + +.flag-bg { + background-image: url("../images/flags/bg.svg"); +} + +.flag-bh { + background-image: url("../images/flags/bh.svg"); +} + +.flag-bi { + background-image: url("../images/flags/bi.svg"); +} + +.flag-bj { + background-image: url("../images/flags/bj.svg"); +} + +.flag-bl { + background-image: url("../images/flags/bl.svg"); +} + +.flag-bm { + background-image: url("../images/flags/bm.svg"); +} + +.flag-bn { + background-image: url("../images/flags/bn.svg"); +} + +.flag-bo { + background-image: url("../images/flags/bo.svg"); +} + +.flag-bq { + background-image: url("../images/flags/bq.svg"); +} + +.flag-br { + background-image: url("../images/flags/br.svg"); +} + +.flag-bs { + background-image: url("../images/flags/bs.svg"); +} + +.flag-bt { + background-image: url("../images/flags/bt.svg"); +} + +.flag-bv { + background-image: url("../images/flags/bv.svg"); +} + +.flag-bw { + background-image: url("../images/flags/bw.svg"); +} + +.flag-by { + background-image: url("../images/flags/by.svg"); +} + +.flag-bz { + background-image: url("../images/flags/bz.svg"); +} + +.flag-ca { + background-image: url("../images/flags/ca.svg"); +} + +.flag-cc { + background-image: url("../images/flags/cc.svg"); +} + +.flag-cd { + background-image: url("../images/flags/cd.svg"); +} + +.flag-cf { + background-image: url("../images/flags/cf.svg"); +} + +.flag-cg { + background-image: url("../images/flags/cg.svg"); +} + +.flag-ch { + background-image: url("../images/flags/ch.svg"); +} + +.flag-ci { + background-image: url("../images/flags/ci.svg"); +} + +.flag-ck { + background-image: url("../images/flags/ck.svg"); +} + +.flag-cl { + background-image: url("../images/flags/cl.svg"); +} + +.flag-cm { + background-image: url("../images/flags/cm.svg"); +} + +.flag-cn { + background-image: url("../images/flags/cn.svg"); +} + +.flag-co { + background-image: url("../images/flags/co.svg"); +} + +.flag-cr { + background-image: url("../images/flags/cr.svg"); +} + +.flag-cu { + background-image: url("../images/flags/cu.svg"); +} + +.flag-cv { + background-image: url("../images/flags/cv.svg"); +} + +.flag-cw { + background-image: url("../images/flags/cw.svg"); +} + +.flag-cx { + background-image: url("../images/flags/cx.svg"); +} + +.flag-cy { + background-image: url("../images/flags/cy.svg"); +} + +.flag-cz { + background-image: url("../images/flags/cz.svg"); +} + +.flag-de { + background-image: url("../images/flags/de.svg"); +} + +.flag-dj { + background-image: url("../images/flags/dj.svg"); +} + +.flag-dk { + background-image: url("../images/flags/dk.svg"); +} + +.flag-dm { + background-image: url("../images/flags/dm.svg"); +} + +.flag-do { + background-image: url("../images/flags/do.svg"); +} + +.flag-dz { + background-image: url("../images/flags/dz.svg"); +} + +.flag-ec { + background-image: url("../images/flags/ec.svg"); +} + +.flag-ee { + background-image: url("../images/flags/ee.svg"); +} + +.flag-eg { + background-image: url("../images/flags/eg.svg"); +} + +.flag-eh { + background-image: url("../images/flags/eh.svg"); +} + +.flag-er { + background-image: url("../images/flags/er.svg"); +} + +.flag-es { + background-image: url("../images/flags/es.svg"); +} + +.flag-et { + background-image: url("../images/flags/et.svg"); +} + +.flag-eu { + background-image: url("../images/flags/eu.svg"); +} + +.flag-fi { + background-image: url("../images/flags/fi.svg"); +} + +.flag-fj { + background-image: url("../images/flags/fj.svg"); +} + +.flag-fk { + background-image: url("../images/flags/fk.svg"); +} + +.flag-fm { + background-image: url("../images/flags/fm.svg"); +} + +.flag-fo { + background-image: url("../images/flags/fo.svg"); +} + +.flag-fr { + background-image: url("../images/flags/fr.svg"); +} + +.flag-ga { + background-image: url("../images/flags/ga.svg"); +} + +.flag-gb-eng { + background-image: url("../images/flags/gb-eng.svg"); +} + +.flag-gb-nir { + background-image: url("../images/flags/gb-nir.svg"); +} + +.flag-gb-sct { + background-image: url("../images/flags/gb-sct.svg"); +} + +.flag-gb-wls { + background-image: url("../images/flags/gb-wls.svg"); +} + +.flag-gb { + background-image: url("../images/flags/gb.svg"); +} + +.flag-gd { + background-image: url("../images/flags/gd.svg"); +} + +.flag-ge { + background-image: url("../images/flags/ge.svg"); +} + +.flag-gf { + background-image: url("../images/flags/gf.svg"); +} + +.flag-gg { + background-image: url("../images/flags/gg.svg"); +} + +.flag-gh { + background-image: url("../images/flags/gh.svg"); +} + +.flag-gi { + background-image: url("../images/flags/gi.svg"); +} + +.flag-gl { + background-image: url("../images/flags/gl.svg"); +} + +.flag-gm { + background-image: url("../images/flags/gm.svg"); +} + +.flag-gn { + background-image: url("../images/flags/gn.svg"); +} + +.flag-gp { + background-image: url("../images/flags/gp.svg"); +} + +.flag-gq { + background-image: url("../images/flags/gq.svg"); +} + +.flag-gr { + background-image: url("../images/flags/gr.svg"); +} + +.flag-gs { + background-image: url("../images/flags/gs.svg"); +} + +.flag-gt { + background-image: url("../images/flags/gt.svg"); +} + +.flag-gu { + background-image: url("../images/flags/gu.svg"); +} + +.flag-gw { + background-image: url("../images/flags/gw.svg"); +} + +.flag-gy { + background-image: url("../images/flags/gy.svg"); +} + +.flag-hk { + background-image: url("../images/flags/hk.svg"); +} + +.flag-hm { + background-image: url("../images/flags/hm.svg"); +} + +.flag-hn { + background-image: url("../images/flags/hn.svg"); +} + +.flag-hr { + background-image: url("../images/flags/hr.svg"); +} + +.flag-ht { + background-image: url("../images/flags/ht.svg"); +} + +.flag-hu { + background-image: url("../images/flags/hu.svg"); +} + +.flag-id { + background-image: url("../images/flags/id.svg"); +} + +.flag-ie { + background-image: url("../images/flags/ie.svg"); +} + +.flag-il { + background-image: url("../images/flags/il.svg"); +} + +.flag-im { + background-image: url("../images/flags/im.svg"); +} + +.flag-in { + background-image: url("../images/flags/in.svg"); +} + +.flag-io { + background-image: url("../images/flags/io.svg"); +} + +.flag-iq { + background-image: url("../images/flags/iq.svg"); +} + +.flag-ir { + background-image: url("../images/flags/ir.svg"); +} + +.flag-is { + background-image: url("../images/flags/is.svg"); +} + +.flag-it { + background-image: url("../images/flags/it.svg"); +} + +.flag-je { + background-image: url("../images/flags/je.svg"); +} + +.flag-jm { + background-image: url("../images/flags/jm.svg"); +} + +.flag-jo { + background-image: url("../images/flags/jo.svg"); +} + +.flag-jp { + background-image: url("../images/flags/jp.svg"); +} + +.flag-ke { + background-image: url("../images/flags/ke.svg"); +} + +.flag-kg { + background-image: url("../images/flags/kg.svg"); +} + +.flag-kh { + background-image: url("../images/flags/kh.svg"); +} + +.flag-ki { + background-image: url("../images/flags/ki.svg"); +} + +.flag-km { + background-image: url("../images/flags/km.svg"); +} + +.flag-kn { + background-image: url("../images/flags/kn.svg"); +} + +.flag-kp { + background-image: url("../images/flags/kp.svg"); +} + +.flag-kr { + background-image: url("../images/flags/kr.svg"); +} + +.flag-kw { + background-image: url("../images/flags/kw.svg"); +} + +.flag-ky { + background-image: url("../images/flags/ky.svg"); +} + +.flag-kz { + background-image: url("../images/flags/kz.svg"); +} + +.flag-la { + background-image: url("../images/flags/la.svg"); +} + +.flag-lb { + background-image: url("../images/flags/lb.svg"); +} + +.flag-lc { + background-image: url("../images/flags/lc.svg"); +} + +.flag-li { + background-image: url("../images/flags/li.svg"); +} + +.flag-lk { + background-image: url("../images/flags/lk.svg"); +} + +.flag-lr { + background-image: url("../images/flags/lr.svg"); +} + +.flag-ls { + background-image: url("../images/flags/ls.svg"); +} + +.flag-lt { + background-image: url("../images/flags/lt.svg"); +} + +.flag-lu { + background-image: url("../images/flags/lu.svg"); +} + +.flag-lv { + background-image: url("../images/flags/lv.svg"); +} + +.flag-ly { + background-image: url("../images/flags/ly.svg"); +} + +.flag-ma { + background-image: url("../images/flags/ma.svg"); +} + +.flag-mc { + background-image: url("../images/flags/mc.svg"); +} + +.flag-md { + background-image: url("../images/flags/md.svg"); +} + +.flag-me { + background-image: url("../images/flags/me.svg"); +} + +.flag-mf { + background-image: url("../images/flags/mf.svg"); +} + +.flag-mg { + background-image: url("../images/flags/mg.svg"); +} + +.flag-mh { + background-image: url("../images/flags/mh.svg"); +} + +.flag-mk { + background-image: url("../images/flags/mk.svg"); +} + +.flag-ml { + background-image: url("../images/flags/ml.svg"); +} + +.flag-mm { + background-image: url("../images/flags/mm.svg"); +} + +.flag-mn { + background-image: url("../images/flags/mn.svg"); +} + +.flag-mo { + background-image: url("../images/flags/mo.svg"); +} + +.flag-mp { + background-image: url("../images/flags/mp.svg"); +} + +.flag-mq { + background-image: url("../images/flags/mq.svg"); +} + +.flag-mr { + background-image: url("../images/flags/mr.svg"); +} + +.flag-ms { + background-image: url("../images/flags/ms.svg"); +} + +.flag-mt { + background-image: url("../images/flags/mt.svg"); +} + +.flag-mu { + background-image: url("../images/flags/mu.svg"); +} + +.flag-mv { + background-image: url("../images/flags/mv.svg"); +} + +.flag-mw { + background-image: url("../images/flags/mw.svg"); +} + +.flag-mx { + background-image: url("../images/flags/mx.svg"); +} + +.flag-my { + background-image: url("../images/flags/my.svg"); +} + +.flag-mz { + background-image: url("../images/flags/mz.svg"); +} + +.flag-na { + background-image: url("../images/flags/na.svg"); +} + +.flag-nc { + background-image: url("../images/flags/nc.svg"); +} + +.flag-ne { + background-image: url("../images/flags/ne.svg"); +} + +.flag-nf { + background-image: url("../images/flags/nf.svg"); +} + +.flag-ng { + background-image: url("../images/flags/ng.svg"); +} + +.flag-ni { + background-image: url("../images/flags/ni.svg"); +} + +.flag-nl { + background-image: url("../images/flags/nl.svg"); +} + +.flag-no { + background-image: url("../images/flags/no.svg"); +} + +.flag-np { + background-image: url("../images/flags/np.svg"); +} + +.flag-nr { + background-image: url("../images/flags/nr.svg"); +} + +.flag-nu { + background-image: url("../images/flags/nu.svg"); +} + +.flag-nz { + background-image: url("../images/flags/nz.svg"); +} + +.flag-om { + background-image: url("../images/flags/om.svg"); +} + +.flag-pa { + background-image: url("../images/flags/pa.svg"); +} + +.flag-pe { + background-image: url("../images/flags/pe.svg"); +} + +.flag-pf { + background-image: url("../images/flags/pf.svg"); +} + +.flag-pg { + background-image: url("../images/flags/pg.svg"); +} + +.flag-ph { + background-image: url("../images/flags/ph.svg"); +} + +.flag-pk { + background-image: url("../images/flags/pk.svg"); +} + +.flag-pl { + background-image: url("../images/flags/pl.svg"); +} + +.flag-pm { + background-image: url("../images/flags/pm.svg"); +} + +.flag-pn { + background-image: url("../images/flags/pn.svg"); +} + +.flag-pr { + background-image: url("../images/flags/pr.svg"); +} + +.flag-ps { + background-image: url("../images/flags/ps.svg"); +} + +.flag-pt { + background-image: url("../images/flags/pt.svg"); +} + +.flag-pw { + background-image: url("../images/flags/pw.svg"); +} + +.flag-py { + background-image: url("../images/flags/py.svg"); +} + +.flag-qa { + background-image: url("../images/flags/qa.svg"); +} + +.flag-re { + background-image: url("../images/flags/re.svg"); +} + +.flag-ro { + background-image: url("../images/flags/ro.svg"); +} + +.flag-rs { + background-image: url("../images/flags/rs.svg"); +} + +.flag-ru { + background-image: url("../images/flags/ru.svg"); +} + +.flag-rw { + background-image: url("../images/flags/rw.svg"); +} + +.flag-sa { + background-image: url("../images/flags/sa.svg"); +} + +.flag-sb { + background-image: url("../images/flags/sb.svg"); +} + +.flag-sc { + background-image: url("../images/flags/sc.svg"); +} + +.flag-sd { + background-image: url("../images/flags/sd.svg"); +} + +.flag-se { + background-image: url("../images/flags/se.svg"); +} + +.flag-sg { + background-image: url("../images/flags/sg.svg"); +} + +.flag-sh { + background-image: url("../images/flags/sh.svg"); +} + +.flag-si { + background-image: url("../images/flags/si.svg"); +} + +.flag-sj { + background-image: url("../images/flags/sj.svg"); +} + +.flag-sk { + background-image: url("../images/flags/sk.svg"); +} + +.flag-sl { + background-image: url("../images/flags/sl.svg"); +} + +.flag-sm { + background-image: url("../images/flags/sm.svg"); +} + +.flag-sn { + background-image: url("../images/flags/sn.svg"); +} + +.flag-so { + background-image: url("../images/flags/so.svg"); +} + +.flag-sr { + background-image: url("../images/flags/sr.svg"); +} + +.flag-ss { + background-image: url("../images/flags/ss.svg"); +} + +.flag-st { + background-image: url("../images/flags/st.svg"); +} + +.flag-sv { + background-image: url("../images/flags/sv.svg"); +} + +.flag-sx { + background-image: url("../images/flags/sx.svg"); +} + +.flag-sy { + background-image: url("../images/flags/sy.svg"); +} + +.flag-sz { + background-image: url("../images/flags/sz.svg"); +} + +.flag-tc { + background-image: url("../images/flags/tc.svg"); +} + +.flag-td { + background-image: url("../images/flags/td.svg"); +} + +.flag-tf { + background-image: url("../images/flags/tf.svg"); +} + +.flag-tg { + background-image: url("../images/flags/tg.svg"); +} + +.flag-th { + background-image: url("../images/flags/th.svg"); +} + +.flag-tj { + background-image: url("../images/flags/tj.svg"); +} + +.flag-tk { + background-image: url("../images/flags/tk.svg"); +} + +.flag-tl { + background-image: url("../images/flags/tl.svg"); +} + +.flag-tm { + background-image: url("../images/flags/tm.svg"); +} + +.flag-tn { + background-image: url("../images/flags/tn.svg"); +} + +.flag-to { + background-image: url("../images/flags/to.svg"); +} + +.flag-tr { + background-image: url("../images/flags/tr.svg"); +} + +.flag-tt { + background-image: url("../images/flags/tt.svg"); +} + +.flag-tv { + background-image: url("../images/flags/tv.svg"); +} + +.flag-tw { + background-image: url("../images/flags/tw.svg"); +} + +.flag-tz { + background-image: url("../images/flags/tz.svg"); +} + +.flag-ua { + background-image: url("../images/flags/ua.svg"); +} + +.flag-ug { + background-image: url("../images/flags/ug.svg"); +} + +.flag-um { + background-image: url("../images/flags/um.svg"); +} + +.flag-un { + background-image: url("../images/flags/un.svg"); +} + +.flag-us { + background-image: url("../images/flags/us.svg"); +} + +.flag-uy { + background-image: url("../images/flags/uy.svg"); +} + +.flag-uz { + background-image: url("../images/flags/uz.svg"); +} + +.flag-va { + background-image: url("../images/flags/va.svg"); +} + +.flag-vc { + background-image: url("../images/flags/vc.svg"); +} + +.flag-ve { + background-image: url("../images/flags/ve.svg"); +} + +.flag-vg { + background-image: url("../images/flags/vg.svg"); +} + +.flag-vi { + background-image: url("../images/flags/vi.svg"); +} + +.flag-vn { + background-image: url("../images/flags/vn.svg"); +} + +.flag-vu { + background-image: url("../images/flags/vu.svg"); +} + +.flag-wf { + background-image: url("../images/flags/wf.svg"); +} + +.flag-ws { + background-image: url("../images/flags/ws.svg"); +} + +.flag-ye { + background-image: url("../images/flags/ye.svg"); +} + +.flag-yt { + background-image: url("../images/flags/yt.svg"); +} + +.flag-za { + background-image: url("../images/flags/za.svg"); +} + +.flag-zm { + background-image: url("../images/flags/zm.svg"); +} + +.flag-zw { + background-image: url("../images/flags/zw.svg"); +} + +.payment { + width: 2.5rem; + height: 1.5rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.payment-2checkout-dark { + background-image: url("../images/payments/2checkout-dark.svg"); +} + +.payment-2checkout { + background-image: url("../images/payments/2checkout.svg"); +} + +.payment-alipay-dark { + background-image: url("../images/payments/alipay-dark.svg"); +} + +.payment-alipay { + background-image: url("../images/payments/alipay.svg"); +} + +.payment-amazon-dark { + background-image: url("../images/payments/amazon-dark.svg"); +} + +.payment-amazon { + background-image: url("../images/payments/amazon.svg"); +} + +.payment-americanexpress-dark { + background-image: url("../images/payments/americanexpress-dark.svg"); +} + +.payment-americanexpress { + background-image: url("../images/payments/americanexpress.svg"); +} + +.payment-applepay-dark { + background-image: url("../images/payments/applepay-dark.svg"); +} + +.payment-applepay { + background-image: url("../images/payments/applepay.svg"); +} + +.payment-bancontact-dark { + background-image: url("../images/payments/bancontact-dark.svg"); +} + +.payment-bancontact { + background-image: url("../images/payments/bancontact.svg"); +} + +.payment-bitcoin-dark { + background-image: url("../images/payments/bitcoin-dark.svg"); +} + +.payment-bitcoin { + background-image: url("../images/payments/bitcoin.svg"); +} + +.payment-bitpay-dark { + background-image: url("../images/payments/bitpay-dark.svg"); +} + +.payment-bitpay { + background-image: url("../images/payments/bitpay.svg"); +} + +.payment-cirrus-dark { + background-image: url("../images/payments/cirrus-dark.svg"); +} + +.payment-cirrus { + background-image: url("../images/payments/cirrus.svg"); +} + +.payment-clickandbuy-dark { + background-image: url("../images/payments/clickandbuy-dark.svg"); +} + +.payment-clickandbuy { + background-image: url("../images/payments/clickandbuy.svg"); +} + +.payment-coinkite-dark { + background-image: url("../images/payments/coinkite-dark.svg"); +} + +.payment-coinkite { + background-image: url("../images/payments/coinkite.svg"); +} + +.payment-dinersclub-dark { + background-image: url("../images/payments/dinersclub-dark.svg"); +} + +.payment-dinersclub { + background-image: url("../images/payments/dinersclub.svg"); +} + +.payment-directdebit-dark { + background-image: url("../images/payments/directdebit-dark.svg"); +} + +.payment-directdebit { + background-image: url("../images/payments/directdebit.svg"); +} + +.payment-discover-dark { + background-image: url("../images/payments/discover-dark.svg"); +} + +.payment-discover { + background-image: url("../images/payments/discover.svg"); +} + +.payment-dwolla-dark { + background-image: url("../images/payments/dwolla-dark.svg"); +} + +.payment-dwolla { + background-image: url("../images/payments/dwolla.svg"); +} + +.payment-ebay-dark { + background-image: url("../images/payments/ebay-dark.svg"); +} + +.payment-ebay { + background-image: url("../images/payments/ebay.svg"); +} + +.payment-eway-dark { + background-image: url("../images/payments/eway-dark.svg"); +} + +.payment-eway { + background-image: url("../images/payments/eway.svg"); +} + +.payment-giropay-dark { + background-image: url("../images/payments/giropay-dark.svg"); +} + +.payment-giropay { + background-image: url("../images/payments/giropay.svg"); +} + +.payment-googlewallet-dark { + background-image: url("../images/payments/googlewallet-dark.svg"); +} + +.payment-googlewallet { + background-image: url("../images/payments/googlewallet.svg"); +} + +.payment-ingenico-dark { + background-image: url("../images/payments/ingenico-dark.svg"); +} + +.payment-ingenico { + background-image: url("../images/payments/ingenico.svg"); +} + +.payment-jcb-dark { + background-image: url("../images/payments/jcb-dark.svg"); +} + +.payment-jcb { + background-image: url("../images/payments/jcb.svg"); +} + +.payment-klarna-dark { + background-image: url("../images/payments/klarna-dark.svg"); +} + +.payment-klarna { + background-image: url("../images/payments/klarna.svg"); +} + +.payment-laser-dark { + background-image: url("../images/payments/laser-dark.svg"); +} + +.payment-laser { + background-image: url("../images/payments/laser.svg"); +} + +.payment-maestro-dark { + background-image: url("../images/payments/maestro-dark.svg"); +} + +.payment-maestro { + background-image: url("../images/payments/maestro.svg"); +} + +.payment-mastercard-dark { + background-image: url("../images/payments/mastercard-dark.svg"); +} + +.payment-mastercard { + background-image: url("../images/payments/mastercard.svg"); +} + +.payment-monero-dark { + background-image: url("../images/payments/monero-dark.svg"); +} + +.payment-monero { + background-image: url("../images/payments/monero.svg"); +} + +.payment-neteller-dark { + background-image: url("../images/payments/neteller-dark.svg"); +} + +.payment-neteller { + background-image: url("../images/payments/neteller.svg"); +} + +.payment-ogone-dark { + background-image: url("../images/payments/ogone-dark.svg"); +} + +.payment-ogone { + background-image: url("../images/payments/ogone.svg"); +} + +.payment-okpay-dark { + background-image: url("../images/payments/okpay-dark.svg"); +} + +.payment-okpay { + background-image: url("../images/payments/okpay.svg"); +} + +.payment-paybox-dark { + background-image: url("../images/payments/paybox-dark.svg"); +} + +.payment-paybox { + background-image: url("../images/payments/paybox.svg"); +} + +.payment-paymill-dark { + background-image: url("../images/payments/paymill-dark.svg"); +} + +.payment-paymill { + background-image: url("../images/payments/paymill.svg"); +} + +.payment-payone-dark { + background-image: url("../images/payments/payone-dark.svg"); +} + +.payment-payone { + background-image: url("../images/payments/payone.svg"); +} + +.payment-payoneer-dark { + background-image: url("../images/payments/payoneer-dark.svg"); +} + +.payment-payoneer { + background-image: url("../images/payments/payoneer.svg"); +} + +.payment-paypal-dark { + background-image: url("../images/payments/paypal-dark.svg"); +} + +.payment-paypal { + background-image: url("../images/payments/paypal.svg"); +} + +.payment-paysafecard-dark { + background-image: url("../images/payments/paysafecard-dark.svg"); +} + +.payment-paysafecard { + background-image: url("../images/payments/paysafecard.svg"); +} + +.payment-payu-dark { + background-image: url("../images/payments/payu-dark.svg"); +} + +.payment-payu { + background-image: url("../images/payments/payu.svg"); +} + +.payment-payza-dark { + background-image: url("../images/payments/payza-dark.svg"); +} + +.payment-payza { + background-image: url("../images/payments/payza.svg"); +} + +.payment-ripple-dark { + background-image: url("../images/payments/ripple-dark.svg"); +} + +.payment-ripple { + background-image: url("../images/payments/ripple.svg"); +} + +.payment-sage-dark { + background-image: url("../images/payments/sage-dark.svg"); +} + +.payment-sage { + background-image: url("../images/payments/sage.svg"); +} + +.payment-sepa-dark { + background-image: url("../images/payments/sepa-dark.svg"); +} + +.payment-sepa { + background-image: url("../images/payments/sepa.svg"); +} + +.payment-shopify-dark { + background-image: url("../images/payments/shopify-dark.svg"); +} + +.payment-shopify { + background-image: url("../images/payments/shopify.svg"); +} + +.payment-skrill-dark { + background-image: url("../images/payments/skrill-dark.svg"); +} + +.payment-skrill { + background-image: url("../images/payments/skrill.svg"); +} + +.payment-solo-dark { + background-image: url("../images/payments/solo-dark.svg"); +} + +.payment-solo { + background-image: url("../images/payments/solo.svg"); +} + +.payment-square-dark { + background-image: url("../images/payments/square-dark.svg"); +} + +.payment-square { + background-image: url("../images/payments/square.svg"); +} + +.payment-stripe-dark { + background-image: url("../images/payments/stripe-dark.svg"); +} + +.payment-stripe { + background-image: url("../images/payments/stripe.svg"); +} + +.payment-switch-dark { + background-image: url("../images/payments/switch-dark.svg"); +} + +.payment-switch { + background-image: url("../images/payments/switch.svg"); +} + +.payment-ukash-dark { + background-image: url("../images/payments/ukash-dark.svg"); +} + +.payment-ukash { + background-image: url("../images/payments/ukash.svg"); +} + +.payment-unionpay-dark { + background-image: url("../images/payments/unionpay-dark.svg"); +} + +.payment-unionpay { + background-image: url("../images/payments/unionpay.svg"); +} + +.payment-verifone-dark { + background-image: url("../images/payments/verifone-dark.svg"); +} + +.payment-verifone { + background-image: url("../images/payments/verifone.svg"); +} + +.payment-verisign-dark { + background-image: url("../images/payments/verisign-dark.svg"); +} + +.payment-verisign { + background-image: url("../images/payments/verisign.svg"); +} + +.payment-visa-dark { + background-image: url("../images/payments/visa-dark.svg"); +} + +.payment-visa { + background-image: url("../images/payments/visa.svg"); +} + +.payment-webmoney-dark { + background-image: url("../images/payments/webmoney-dark.svg"); +} + +.payment-webmoney { + background-image: url("../images/payments/webmoney.svg"); +} + +.payment-westernunion-dark { + background-image: url("../images/payments/westernunion-dark.svg"); +} + +.payment-westernunion { + background-image: url("../images/payments/westernunion.svg"); +} + +.payment-worldpay-dark { + background-image: url("../images/payments/worldpay-dark.svg"); +} + +.payment-worldpay { + background-image: url("../images/payments/worldpay.svg"); +} + +svg { + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-container { + width: 100%; + height: 100%; + position: relative; + overflow: hidden; + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-tip { + position: absolute; + display: none; + border-radius: 3px; + background: #212529; + color: white; + padding: 6px; + font-size: 11px; + line-height: 1; + font-weight: 700; +} + +.jvectormap-tip small { + font-size: inherit; + font-weight: 400; +} + +.jvectormap-zoomin, .jvectormap-zoomout, .jvectormap-goback { + position: absolute; + right: 10px; + border-radius: 3px; + background: #292929; + padding: 3px; + color: white; + cursor: pointer; + line-height: 10px; + text-align: center; + box-sizing: content-box; +} + +.jvectormap-zoomin, .jvectormap-zoomout { + width: 10px; + height: 10px; +} + +.jvectormap-zoomin { + top: 10px; +} + +.jvectormap-zoomout { + top: 30px; +} + +.jvectormap-goback { + bottom: 10px; + z-index: 1000; + padding: 6px; +} + +.jvectormap-spinner { + position: absolute; + right: 0; + top: 0; + left: 0; + bottom: 0; + background: center no-repeat url(data:image/gif;base64,R0lGODlhIAAgAPMAAP///wAAAMbGxoSEhLa2tpqamjY2NlZWVtjY2OTk5Ly8vB4eHgQEBAAAAAAAAAAAACH/C05FVFNDQVBFMi4wAwEAAAAh/hpDcmVhdGVkIHdpdGggYWpheGxvYWQuaW5mbwAh+QQJCgAAACwAAAAAIAAgAAAE5xDISWlhperN52JLhSSdRgwVo1ICQZRUsiwHpTJT4iowNS8vyW2icCF6k8HMMBkCEDskxTBDAZwuAkkqIfxIQyhBQBFvAQSDITM5VDW6XNE4KagNh6Bgwe60smQUB3d4Rz1ZBApnFASDd0hihh12BkE9kjAJVlycXIg7CQIFA6SlnJ87paqbSKiKoqusnbMdmDC2tXQlkUhziYtyWTxIfy6BE8WJt5YJvpJivxNaGmLHT0VnOgSYf0dZXS7APdpB309RnHOG5gDqXGLDaC457D1zZ/V/nmOM82XiHRLYKhKP1oZmADdEAAAh+QQJCgAAACwAAAAAIAAgAAAE6hDISWlZpOrNp1lGNRSdRpDUolIGw5RUYhhHukqFu8DsrEyqnWThGvAmhVlteBvojpTDDBUEIFwMFBRAmBkSgOrBFZogCASwBDEY/CZSg7GSE0gSCjQBMVG023xWBhklAnoEdhQEfyNqMIcKjhRsjEdnezB+A4k8gTwJhFuiW4dokXiloUepBAp5qaKpp6+Ho7aWW54wl7obvEe0kRuoplCGepwSx2jJvqHEmGt6whJpGpfJCHmOoNHKaHx61WiSR92E4lbFoq+B6QDtuetcaBPnW6+O7wDHpIiK9SaVK5GgV543tzjgGcghAgAh+QQJCgAAACwAAAAAIAAgAAAE7hDISSkxpOrN5zFHNWRdhSiVoVLHspRUMoyUakyEe8PTPCATW9A14E0UvuAKMNAZKYUZCiBMuBakSQKG8G2FzUWox2AUtAQFcBKlVQoLgQReZhQlCIJesQXI5B0CBnUMOxMCenoCfTCEWBsJColTMANldx15BGs8B5wlCZ9Po6OJkwmRpnqkqnuSrayqfKmqpLajoiW5HJq7FL1Gr2mMMcKUMIiJgIemy7xZtJsTmsM4xHiKv5KMCXqfyUCJEonXPN2rAOIAmsfB3uPoAK++G+w48edZPK+M6hLJpQg484enXIdQFSS1u6UhksENEQAAIfkECQoAAAAsAAAAACAAIAAABOcQyEmpGKLqzWcZRVUQnZYg1aBSh2GUVEIQ2aQOE+G+cD4ntpWkZQj1JIiZIogDFFyHI0UxQwFugMSOFIPJftfVAEoZLBbcLEFhlQiqGp1Vd140AUklUN3eCA51C1EWMzMCezCBBmkxVIVHBWd3HHl9JQOIJSdSnJ0TDKChCwUJjoWMPaGqDKannasMo6WnM562R5YluZRwur0wpgqZE7NKUm+FNRPIhjBJxKZteWuIBMN4zRMIVIhffcgojwCF117i4nlLnY5ztRLsnOk+aV+oJY7V7m76PdkS4trKcdg0Zc0tTcKkRAAAIfkECQoAAAAsAAAAACAAIAAABO4QyEkpKqjqzScpRaVkXZWQEximw1BSCUEIlDohrft6cpKCk5xid5MNJTaAIkekKGQkWyKHkvhKsR7ARmitkAYDYRIbUQRQjWBwJRzChi9CRlBcY1UN4g0/VNB0AlcvcAYHRyZPdEQFYV8ccwR5HWxEJ02YmRMLnJ1xCYp0Y5idpQuhopmmC2KgojKasUQDk5BNAwwMOh2RtRq5uQuPZKGIJQIGwAwGf6I0JXMpC8C7kXWDBINFMxS4DKMAWVWAGYsAdNqW5uaRxkSKJOZKaU3tPOBZ4DuK2LATgJhkPJMgTwKCdFjyPHEnKxFCDhEAACH5BAkKAAAALAAAAAAgACAAAATzEMhJaVKp6s2nIkolIJ2WkBShpkVRWqqQrhLSEu9MZJKK9y1ZrqYK9WiClmvoUaF8gIQSNeF1Er4MNFn4SRSDARWroAIETg1iVwuHjYB1kYc1mwruwXKC9gmsJXliGxc+XiUCby9ydh1sOSdMkpMTBpaXBzsfhoc5l58Gm5yToAaZhaOUqjkDgCWNHAULCwOLaTmzswadEqggQwgHuQsHIoZCHQMMQgQGubVEcxOPFAcMDAYUA85eWARmfSRQCdcMe0zeP1AAygwLlJtPNAAL19DARdPzBOWSm1brJBi45soRAWQAAkrQIykShQ9wVhHCwCQCACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiRMDjI0Fd30/iI2UA5GSS5UDj2l6NoqgOgN4gksEBgYFf0FDqKgHnyZ9OX8HrgYHdHpcHQULXAS2qKpENRg7eAMLC7kTBaixUYFkKAzWAAnLC7FLVxLWDBLKCwaKTULgEwbLA4hJtOkSBNqITT3xEgfLpBtzE/jiuL04RGEBgwWhShRgQExHBAAh+QQJCgAAACwAAAAAIAAgAAAE7xDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfZiCqGk5dTESJeaOAlClzsJsqwiJwiqnFrb2nS9kmIcgEsjQydLiIlHehhpejaIjzh9eomSjZR+ipslWIRLAgMDOR2DOqKogTB9pCUJBagDBXR6XB0EBkIIsaRsGGMMAxoDBgYHTKJiUYEGDAzHC9EACcUGkIgFzgwZ0QsSBcXHiQvOwgDdEwfFs0sDzt4S6BK4xYjkDOzn0unFeBzOBijIm1Dgmg5YFQwsCMjp1oJ8LyIAACH5BAkKAAAALAAAAAAgACAAAATwEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GGl6NoiPOH16iZKNlH6KmyWFOggHhEEvAwwMA0N9GBsEC6amhnVcEwavDAazGwIDaH1ipaYLBUTCGgQDA8NdHz0FpqgTBwsLqAbWAAnIA4FWKdMLGdYGEgraigbT0OITBcg5QwPT4xLrROZL6AuQAPUS7bxLpoWidY0JtxLHKhwwMJBTHgPKdEQAACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GAULDJCRiXo1CpGXDJOUjY+Yip9DhToJA4RBLwMLCwVDfRgbBAaqqoZ1XBMHswsHtxtFaH1iqaoGNgAIxRpbFAgfPQSqpbgGBqUD1wBXeCYp1AYZ19JJOYgH1KwA4UBvQwXUBxPqVD9L3sbp2BNk2xvvFPJd+MFCN6HAAIKgNggY0KtEBAAh+QQJCgAAACwAAAAAIAAgAAAE6BDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfYIDMaAFdTESJeaEDAIMxYFqrOUaNW4E4ObYcCXaiBVEgULe0NJaxxtYksjh2NLkZISgDgJhHthkpU4mW6blRiYmZOlh4JWkDqILwUGBnE6TYEbCgevr0N1gH4At7gHiRpFaLNrrq8HNgAJA70AWxQIH1+vsYMDAzZQPC9VCNkDWUhGkuE5PxJNwiUK4UfLzOlD4WvzAHaoG9nxPi5d+jYUqfAhhykOFwJWiAAAIfkECQoAAAAsAAAAACAAIAAABPAQyElpUqnqzaciSoVkXVUMFaFSwlpOCcMYlErAavhOMnNLNo8KsZsMZItJEIDIFSkLGQoQTNhIsFehRww2CQLKF0tYGKYSg+ygsZIuNqJksKgbfgIGepNo2cIUB3V1B3IvNiBYNQaDSTtfhhx0CwVPI0UJe0+bm4g5VgcGoqOcnjmjqDSdnhgEoamcsZuXO1aWQy8KAwOAuTYYGwi7w5h+Kr0SJ8MFihpNbx+4Erq7BYBuzsdiH1jCAzoSfl0rVirNbRXlBBlLX+BP0XJLAPGzTkAuAOqb0WT5AH7OcdCm5B8TgRwSRKIHQtaLCwg1RAAAOwAAAAAAAAAAAA==); +} + +.jvectormap-legend-title { + font-weight: bold; + font-size: 14px; + text-align: center; +} + +.jvectormap-legend-cnt { + position: absolute; +} + +.jvectormap-legend-cnt-h { + bottom: 0; + left: 0; +} + +.jvectormap-legend-cnt-v { + top: 0; + left: 0; +} + +.jvectormap-legend { + background: black; + color: white; + border-radius: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend { + float: right; + margin: 0 0 10px 10px; + padding: 3px 3px 1px 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend .jvectormap-legend-tick { + float: right; +} + +.jvectormap-legend-cnt-v .jvectormap-legend { + margin: 10px 0 0 10px; + padding: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick { + width: 40px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-sample { + height: 15px; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-sample { + height: 20px; + width: 20px; + display: inline-block; + vertical-align: middle; +} + +.jvectormap-legend-tick-text { + font-size: 12px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-text { + text-align: center; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-text { + display: inline-block; + vertical-align: middle; + line-height: 20px; + padding-right: 3px; +} + +/** + * selectize.css (v0.12.4) + * Copyright (c) 2013–2015 Brian Reavis & contributors + * + * Licensed under the Apache License, Version 2.0 (the "License"); you may not use this + * file except in compliance with the License. You may obtain a copy of the License at: + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under + * the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF + * ANY KIND, either express or implied. See the License for the specific language + * governing permissions and limitations under the License. + * + * @author Brian Reavis + */ +.selectize-control.plugin-drag_drop.multi > .selectize-input > div.ui-sortable-placeholder { + visibility: visible !important; + background: #f2f2f2 !important; + background: rgba(0, 0, 0, 0.06) !important; + border: 0 none !important; + box-shadow: inset 0 0 12px 4px #fff; +} + +.selectize-control.plugin-drag_drop .ui-sortable-placeholder::after { + content: '!'; + visibility: hidden; +} + +.selectize-control.plugin-drag_drop .ui-sortable-helper { + box-shadow: 0 2px 5px rgba(0, 0, 0, 0.2); +} + +.selectize-dropdown-header { + position: relative; + padding: 5px 8px; + border-bottom: 1px solid #d0d0d0; + background: #f8f8f8; + border-radius: 3px 3px 0 0; +} + +.selectize-dropdown-header-close { + position: absolute; + left: 8px; + top: 50%; + color: #495057; + opacity: 0.4; + margin-top: -12px; + line-height: 20px; + font-size: 20px !important; +} + +.selectize-dropdown-header-close:hover { + color: #000; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup { + border-left: 1px solid #f2f2f2; + border-top: 0 none; + float: right; + box-sizing: border-box; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:last-child { + border-left: 0 none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:before { + display: none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup-header { + border-top: 0 none; +} + +.selectize-control.plugin-remove_button [data-value] { + position: relative; + padding-left: 24px !important; +} + +.selectize-control.plugin-remove_button [data-value] .remove { + z-index: 1; + /* fixes ie bug (see #392) */ + position: absolute; + top: 0; + left: 0; + bottom: 0; + width: 17px; + text-align: center; + font-weight: bold; + font-size: 12px; + color: inherit; + text-decoration: none; + vertical-align: middle; + display: inline-block; + padding: 2px 0 0 0; + border-right: 1px solid #d0d0d0; + border-radius: 2px 0 0 2px; + box-sizing: border-box; +} + +.selectize-control.plugin-remove_button [data-value] .remove:hover { + background: rgba(0, 0, 0, 0.05); +} + +.selectize-control.plugin-remove_button [data-value].active .remove { + border-right-color: #cacaca; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove:hover { + background: none; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove { + border-right-color: #fff; +} + +.selectize-control.plugin-remove_button .remove-single { + position: absolute; + left: 28px; + top: 6px; + font-size: 23px; +} + +.selectize-control { + position: relative; + padding: 0; + border: 0; +} + +.selectize-dropdown, +.selectize-input, +.selectize-input input { + color: #495057; + font-family: inherit; + font-size: 15px; + line-height: 18px; + -webkit-font-smoothing: inherit; +} + +.selectize-input, +.selectize-control.single .selectize-input.input-active { + background: #fff; + cursor: text; + display: inline-block; +} + +.selectize-input { + border: 1px solid rgba(0, 40, 100, 0.12); + padding: 0.5625rem 0.75rem; + display: inline-block; + display: block; + width: 100%; + overflow: hidden; + position: relative; + z-index: 1; + box-sizing: border-box; + border-radius: 3px; + transition: .3s border-color, .3s box-shadow; +} + +.selectize-control.multi .selectize-input.has-items { + padding: 7px 7px 4px 0.75rem; +} + +.selectize-input.full { + background-color: #fff; +} + +.selectize-input.disabled, +.selectize-input.disabled * { + cursor: default !important; +} + +.selectize-input.focus { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectize-input.dropdown-active { + border-radius: 3px 3px 0 0; +} + +.selectize-input > * { + vertical-align: baseline; + display: -moz-inline-stack; + display: inline-block; + zoom: 1; + *display: inline; +} + +.selectize-control.multi .selectize-input > div { + cursor: pointer; + margin: 0 0 3px 3px; + padding: 2px 6px; + background: #e9ecef; + color: #495057; + font-size: 13px; + border: 0 solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-weight: 400; +} + +.selectize-control.multi .selectize-input > div.active { + background: #e8e8e8; + color: #303030; + border: 0 solid #cacaca; +} + +.selectize-control.multi .selectize-input.disabled > div, +.selectize-control.multi .selectize-input.disabled > div.active { + color: #7d7d7d; + background: #fff; + border: 0 solid #fff; +} + +.selectize-input > input { + display: inline-block !important; + padding: 0 !important; + min-height: 0 !important; + max-height: none !important; + max-width: 100% !important; + margin: 0 0 0 2px !important; + text-indent: 0 !important; + border: 0 none !important; + background: none !important; + line-height: inherit !important; + box-shadow: none !important; +} + +.selectize-input > input::-ms-clear { + display: none; +} + +.selectize-input > input:focus { + outline: none !important; +} + +.selectize-input::after { + content: ' '; + display: block; + clear: right; +} + +.selectize-input.dropdown-active::before { + content: ' '; + display: block; + position: absolute; + background: #f0f0f0; + height: 1px; + bottom: 0; + right: 0; + left: 0; +} + +.selectize-dropdown { + position: absolute; + z-index: 10; + border: 1px solid rgba(0, 40, 100, 0.12); + background: #fff; + margin: -1px 0 0 0; + border-top: 0 none; + box-sizing: border-box; + border-radius: 0 0 3px 3px; + height: auto; + padding: 0; +} + +.selectize-dropdown [data-selectable] { + cursor: pointer; + overflow: hidden; +} + +.selectize-dropdown [data-selectable] .highlight { + background: rgba(125, 168, 208, 0.2); + border-radius: 1px; +} + +.selectize-dropdown [data-selectable], +.selectize-dropdown .optgroup-header { + padding: 6px .75rem; +} + +.selectize-dropdown .optgroup:first-child .optgroup-header { + border-top: 0 none; +} + +.selectize-dropdown .optgroup-header { + color: #495057; + background: #fff; + cursor: default; +} + +.selectize-dropdown .active { + background-color: #F1F4F8; + color: #467fcf; +} + +.selectize-dropdown .active.create { + color: #495057; +} + +.selectize-dropdown .create { + color: rgba(48, 48, 48, 0.5); +} + +.selectize-dropdown-content { + overflow-y: auto; + overflow-x: hidden; + max-height: 200px; + -webkit-overflow-scrolling: touch; +} + +.selectize-control.single .selectize-input, +.selectize-control.single .selectize-input input { + cursor: pointer; +} + +.selectize-control.single .selectize-input.input-active, +.selectize-control.single .selectize-input.input-active input { + cursor: text; +} + +.selectize-control.single .selectize-input:after { + content: ''; + display: block; + position: absolute; + top: 13px; + left: 12px; + width: 8px; + height: 10px; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat center; + background-size: 8px 10px; + transition: .3s transform; +} + +.selectize-control.single .selectize-input.dropdown-active:after { + -webkit-transform: rotate(-180deg); + transform: rotate(-180deg); +} + +.selectize-control .selectize-input.disabled { + opacity: 0.5; + background-color: #fafafa; +} + +.selectize-dropdown .image, +.selectize-input .image { + width: 1.25rem; + height: 1.25rem; + background-size: contain; + margin: -1px -4px -1px .5rem; + line-height: 1.25rem; + float: right; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; +} + +.selectize-dropdown .image img, +.selectize-input .image img { + max-width: 100%; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); + border-radius: 2px; +} + +.selectize-input .image { + width: 1.5rem; + height: 1.5rem; + margin: -3px -5px -3px .75rem; +} + +@font-face { + font-family: "feather"; + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106"); + /* IE9*/ + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106#iefix") format("embedded-opentype"), url("../fonts/feather/feather-webfont.woff?t=1501841394106") format("woff"), url("../fonts/feather/feather-webfont.ttf?t=1501841394106") format("truetype"), url("../fonts/feather/feather-webfont.svg?t=1501841394106#feather") format("svg"); + /* iOS 4.1- */ +} + +.fe { + font-family: 'feather' !important; + speak: none; + font-style: normal; + font-weight: normal; + font-variant: normal; + text-transform: none; + line-height: 1; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +.fe-activity:before { + content: "\e900"; +} + +.fe-airplay:before { + content: "\e901"; +} + +.fe-alert-circle:before { + content: "\e902"; +} + +.fe-alert-octagon:before { + content: "\e903"; +} + +.fe-alert-triangle:before { + content: "\e904"; +} + +.fe-align-center:before { + content: "\e905"; +} + +.fe-align-justify:before { + content: "\e906"; +} + +.fe-align-left:before { + content: "\e907"; +} + +.fe-align-right:before { + content: "\e908"; +} + +.fe-anchor:before { + content: "\e909"; +} + +.fe-aperture:before { + content: "\e90a"; +} + +.fe-arrow-down:before { + content: "\e90b"; +} + +.fe-arrow-down-circle:before { + content: "\e90c"; +} + +.fe-arrow-down-left:before { + content: "\e90d"; +} + +.fe-arrow-down-right:before { + content: "\e90e"; +} + +.fe-arrow-left:before { + content: "\e90f"; +} + +.fe-arrow-left-circle:before { + content: "\e910"; +} + +.fe-arrow-right:before { + content: "\e911"; +} + +.fe-arrow-right-circle:before { + content: "\e912"; +} + +.fe-arrow-up:before { + content: "\e913"; +} + +.fe-arrow-up-circle:before { + content: "\e914"; +} + +.fe-arrow-up-left:before { + content: "\e915"; +} + +.fe-arrow-up-right:before { + content: "\e916"; +} + +.fe-at-sign:before { + content: "\e917"; +} + +.fe-award:before { + content: "\e918"; +} + +.fe-bar-chart:before { + content: "\e919"; +} + +.fe-bar-chart-2:before { + content: "\e91a"; +} + +.fe-battery:before { + content: "\e91b"; +} + +.fe-battery-charging:before { + content: "\e91c"; +} + +.fe-bell:before { + content: "\e91d"; +} + +.fe-bell-off:before { + content: "\e91e"; +} + +.fe-bluetooth:before { + content: "\e91f"; +} + +.fe-bold:before { + content: "\e920"; +} + +.fe-book:before { + content: "\e921"; +} + +.fe-book-open:before { + content: "\e922"; +} + +.fe-bookmark:before { + content: "\e923"; +} + +.fe-box:before { + content: "\e924"; +} + +.fe-briefcase:before { + content: "\e925"; +} + +.fe-calendar:before { + content: "\e926"; +} + +.fe-camera:before { + content: "\e927"; +} + +.fe-camera-off:before { + content: "\e928"; +} + +.fe-cast:before { + content: "\e929"; +} + +.fe-check:before { + content: "\e92a"; +} + +.fe-check-circle:before { + content: "\e92b"; +} + +.fe-check-square:before { + content: "\e92c"; +} + +.fe-chevron-down:before { + content: "\e92d"; +} + +.fe-chevron-left:before { + content: "\e92e"; +} + +.fe-chevron-right:before { + content: "\e92f"; +} + +.fe-chevron-up:before { + content: "\e930"; +} + +.fe-chevrons-down:before { + content: "\e931"; +} + +.fe-chevrons-left:before { + content: "\e932"; +} + +.fe-chevrons-right:before { + content: "\e933"; +} + +.fe-chevrons-up:before { + content: "\e934"; +} + +.fe-chrome:before { + content: "\e935"; +} + +.fe-circle:before { + content: "\e936"; +} + +.fe-clipboard:before { + content: "\e937"; +} + +.fe-clock:before { + content: "\e938"; +} + +.fe-cloud:before { + content: "\e939"; +} + +.fe-cloud-drizzle:before { + content: "\e93a"; +} + +.fe-cloud-lightning:before { + content: "\e93b"; +} + +.fe-cloud-off:before { + content: "\e93c"; +} + +.fe-cloud-rain:before { + content: "\e93d"; +} + +.fe-cloud-snow:before { + content: "\e93e"; +} + +.fe-code:before { + content: "\e93f"; +} + +.fe-codepen:before { + content: "\e940"; +} + +.fe-command:before { + content: "\e941"; +} + +.fe-compass:before { + content: "\e942"; +} + +.fe-copy:before { + content: "\e943"; +} + +.fe-corner-down-left:before { + content: "\e944"; +} + +.fe-corner-down-right:before { + content: "\e945"; +} + +.fe-corner-left-down:before { + content: "\e946"; +} + +.fe-corner-left-up:before { + content: "\e947"; +} + +.fe-corner-right-down:before { + content: "\e948"; +} + +.fe-corner-right-up:before { + content: "\e949"; +} + +.fe-corner-up-left:before { + content: "\e94a"; +} + +.fe-corner-up-right:before { + content: "\e94b"; +} + +.fe-cpu:before { + content: "\e94c"; +} + +.fe-credit-card:before { + content: "\e94d"; +} + +.fe-crop:before { + content: "\e94e"; +} + +.fe-crosshair:before { + content: "\e94f"; +} + +.fe-database:before { + content: "\e950"; +} + +.fe-delete:before { + content: "\e951"; +} + +.fe-disc:before { + content: "\e952"; +} + +.fe-dollar-sign:before { + content: "\e953"; +} + +.fe-download:before { + content: "\e954"; +} + +.fe-download-cloud:before { + content: "\e955"; +} + +.fe-droplet:before { + content: "\e956"; +} + +.fe-edit:before { + content: "\e957"; +} + +.fe-edit-2:before { + content: "\e958"; +} + +.fe-edit-3:before { + content: "\e959"; +} + +.fe-external-link:before { + content: "\e95a"; +} + +.fe-eye:before { + content: "\e95b"; +} + +.fe-eye-off:before { + content: "\e95c"; +} + +.fe-facebook:before { + content: "\e95d"; +} + +.fe-fast-forward:before { + content: "\e95e"; +} + +.fe-feather:before { + content: "\e95f"; +} + +.fe-file:before { + content: "\e960"; +} + +.fe-file-minus:before { + content: "\e961"; +} + +.fe-file-plus:before { + content: "\e962"; +} + +.fe-file-text:before { + content: "\e963"; +} + +.fe-film:before { + content: "\e964"; +} + +.fe-filter:before { + content: "\e965"; +} + +.fe-flag:before { + content: "\e966"; +} + +.fe-folder:before { + content: "\e967"; +} + +.fe-folder-minus:before { + content: "\e968"; +} + +.fe-folder-plus:before { + content: "\e969"; +} + +.fe-git-branch:before { + content: "\e96a"; +} + +.fe-git-commit:before { + content: "\e96b"; +} + +.fe-git-merge:before { + content: "\e96c"; +} + +.fe-git-pull-request:before { + content: "\e96d"; +} + +.fe-github:before { + content: "\e96e"; +} + +.fe-gitlab:before { + content: "\e96f"; +} + +.fe-globe:before { + content: "\e970"; +} + +.fe-grid:before { + content: "\e971"; +} + +.fe-hard-drive:before { + content: "\e972"; +} + +.fe-hash:before { + content: "\e973"; +} + +.fe-headphones:before { + content: "\e974"; +} + +.fe-heart:before { + content: "\e975"; +} + +.fe-help-circle:before { + content: "\e976"; +} + +.fe-home:before { + content: "\e977"; +} + +.fe-image:before { + content: "\e978"; +} + +.fe-inbox:before { + content: "\e979"; +} + +.fe-info:before { + content: "\e97a"; +} + +.fe-instagram:before { + content: "\e97b"; +} + +.fe-italic:before { + content: "\e97c"; +} + +.fe-layers:before { + content: "\e97d"; +} + +.fe-layout:before { + content: "\e97e"; +} + +.fe-life-buoy:before { + content: "\e97f"; +} + +.fe-link:before { + content: "\e980"; +} + +.fe-link-2:before { + content: "\e981"; +} + +.fe-linkedin:before { + content: "\e982"; +} + +.fe-list:before { + content: "\e983"; +} + +.fe-loader:before { + content: "\e984"; +} + +.fe-lock:before { + content: "\e985"; +} + +.fe-log-in:before { + content: "\e986"; +} + +.fe-log-out:before { + content: "\e987"; +} + +.fe-mail:before { + content: "\e988"; +} + +.fe-map:before { + content: "\e989"; +} + +.fe-map-pin:before { + content: "\e98a"; +} + +.fe-maximize:before { + content: "\e98b"; +} + +.fe-maximize-2:before { + content: "\e98c"; +} + +.fe-menu:before { + content: "\e98d"; +} + +.fe-message-circle:before { + content: "\e98e"; +} + +.fe-message-square:before { + content: "\e98f"; +} + +.fe-mic:before { + content: "\e990"; +} + +.fe-mic-off:before { + content: "\e991"; +} + +.fe-minimize:before { + content: "\e992"; +} + +.fe-minimize-2:before { + content: "\e993"; +} + +.fe-minus:before { + content: "\e994"; +} + +.fe-minus-circle:before { + content: "\e995"; +} + +.fe-minus-square:before { + content: "\e996"; +} + +.fe-monitor:before { + content: "\e997"; +} + +.fe-moon:before { + content: "\e998"; +} + +.fe-more-horizontal:before { + content: "\e999"; +} + +.fe-more-vertical:before { + content: "\e99a"; +} + +.fe-move:before { + content: "\e99b"; +} + +.fe-music:before { + content: "\e99c"; +} + +.fe-navigation:before { + content: "\e99d"; +} + +.fe-navigation-2:before { + content: "\e99e"; +} + +.fe-octagon:before { + content: "\e99f"; +} + +.fe-package:before { + content: "\e9a0"; +} + +.fe-paperclip:before { + content: "\e9a1"; +} + +.fe-pause:before { + content: "\e9a2"; +} + +.fe-pause-circle:before { + content: "\e9a3"; +} + +.fe-percent:before { + content: "\e9a4"; +} + +.fe-phone:before { + content: "\e9a5"; +} + +.fe-phone-call:before { + content: "\e9a6"; +} + +.fe-phone-forwarded:before { + content: "\e9a7"; +} + +.fe-phone-incoming:before { + content: "\e9a8"; +} + +.fe-phone-missed:before { + content: "\e9a9"; +} + +.fe-phone-off:before { + content: "\e9aa"; +} + +.fe-phone-outgoing:before { + content: "\e9ab"; +} + +.fe-pie-chart:before { + content: "\e9ac"; +} + +.fe-play:before { + content: "\e9ad"; +} + +.fe-play-circle:before { + content: "\e9ae"; +} + +.fe-plus:before { + content: "\e9af"; +} + +.fe-plus-circle:before { + content: "\e9b0"; +} + +.fe-plus-square:before { + content: "\e9b1"; +} + +.fe-pocket:before { + content: "\e9b2"; +} + +.fe-power:before { + content: "\e9b3"; +} + +.fe-printer:before { + content: "\e9b4"; +} + +.fe-radio:before { + content: "\e9b5"; +} + +.fe-refresh-ccw:before { + content: "\e9b6"; +} + +.fe-refresh-cw:before { + content: "\e9b7"; +} + +.fe-repeat:before { + content: "\e9b8"; +} + +.fe-rewind:before { + content: "\e9b9"; +} + +.fe-rotate-ccw:before { + content: "\e9ba"; +} + +.fe-rotate-cw:before { + content: "\e9bb"; +} + +.fe-rss:before { + content: "\e9bc"; +} + +.fe-save:before { + content: "\e9bd"; +} + +.fe-scissors:before { + content: "\e9be"; +} + +.fe-search:before { + content: "\e9bf"; +} + +.fe-send:before { + content: "\e9c0"; +} + +.fe-server:before { + content: "\e9c1"; +} + +.fe-settings:before { + content: "\e9c2"; +} + +.fe-share:before { + content: "\e9c3"; +} + +.fe-share-2:before { + content: "\e9c4"; +} + +.fe-shield:before { + content: "\e9c5"; +} + +.fe-shield-off:before { + content: "\e9c6"; +} + +.fe-shopping-bag:before { + content: "\e9c7"; +} + +.fe-shopping-cart:before { + content: "\e9c8"; +} + +.fe-shuffle:before { + content: "\e9c9"; +} + +.fe-sidebar:before { + content: "\e9ca"; +} + +.fe-skip-back:before { + content: "\e9cb"; +} + +.fe-skip-forward:before { + content: "\e9cc"; +} + +.fe-slack:before { + content: "\e9cd"; +} + +.fe-slash:before { + content: "\e9ce"; +} + +.fe-sliders:before { + content: "\e9cf"; +} + +.fe-smartphone:before { + content: "\e9d0"; +} + +.fe-speaker:before { + content: "\e9d1"; +} + +.fe-square:before { + content: "\e9d2"; +} + +.fe-star:before { + content: "\e9d3"; +} + +.fe-stop-circle:before { + content: "\e9d4"; +} + +.fe-sun:before { + content: "\e9d5"; +} + +.fe-sunrise:before { + content: "\e9d6"; +} + +.fe-sunset:before { + content: "\e9d7"; +} + +.fe-tablet:before { + content: "\e9d8"; +} + +.fe-tag:before { + content: "\e9d9"; +} + +.fe-target:before { + content: "\e9da"; +} + +.fe-terminal:before { + content: "\e9db"; +} + +.fe-thermometer:before { + content: "\e9dc"; +} + +.fe-thumbs-down:before { + content: "\e9dd"; +} + +.fe-thumbs-up:before { + content: "\e9de"; +} + +.fe-toggle-left:before { + content: "\e9df"; +} + +.fe-toggle-right:before { + content: "\e9e0"; +} + +.fe-trash:before { + content: "\e9e1"; +} + +.fe-trash-2:before { + content: "\e9e2"; +} + +.fe-trending-down:before { + content: "\e9e3"; +} + +.fe-trending-up:before { + content: "\e9e4"; +} + +.fe-triangle:before { + content: "\e9e5"; +} + +.fe-truck:before { + content: "\e9e6"; +} + +.fe-tv:before { + content: "\e9e7"; +} + +.fe-twitter:before { + content: "\e9e8"; +} + +.fe-type:before { + content: "\e9e9"; +} + +.fe-umbrella:before { + content: "\e9ea"; +} + +.fe-underline:before { + content: "\e9eb"; +} + +.fe-unlock:before { + content: "\e9ec"; +} + +.fe-upload:before { + content: "\e9ed"; +} + +.fe-upload-cloud:before { + content: "\e9ee"; +} + +.fe-user:before { + content: "\e9ef"; +} + +.fe-user-check:before { + content: "\e9f0"; +} + +.fe-user-minus:before { + content: "\e9f1"; +} + +.fe-user-plus:before { + content: "\e9f2"; +} + +.fe-user-x:before { + content: "\e9f3"; +} + +.fe-users:before { + content: "\e9f4"; +} + +.fe-video:before { + content: "\e9f5"; +} + +.fe-video-off:before { + content: "\e9f6"; +} + +.fe-voicemail:before { + content: "\e9f7"; +} + +.fe-volume:before { + content: "\e9f8"; +} + +.fe-volume-1:before { + content: "\e9f9"; +} + +.fe-volume-2:before { + content: "\e9fa"; +} + +.fe-volume-x:before { + content: "\e9fb"; +} + +.fe-watch:before { + content: "\e9fc"; +} + +.fe-wifi:before { + content: "\e9fd"; +} + +.fe-wifi-off:before { + content: "\e9fe"; +} + +.fe-wind:before { + content: "\e9ff"; +} + +.fe-x:before { + content: "\ea00"; +} + +.fe-x-circle:before { + content: "\ea01"; +} + +.fe-x-square:before { + content: "\ea02"; +} + +.fe-zap:before { + content: "\ea03"; +} + +.fe-zap-off:before { + content: "\ea04"; +} + +.fe-zoom-in:before { + content: "\ea05"; +} + +.fe-zoom-out:before { + content: "\ea06"; +} diff --git a/public/v2/assets/fonts/feather/feather-webfont.eot b/public/v2/assets/fonts/feather/feather-webfont.eot new file mode 100755 index 0000000000..8350e1615e Binary files /dev/null and b/public/v2/assets/fonts/feather/feather-webfont.eot differ diff --git a/public/v2/assets/fonts/feather/feather-webfont.svg b/public/v2/assets/fonts/feather/feather-webfont.svg new file mode 100755 index 0000000000..164c09c67a --- /dev/null +++ b/public/v2/assets/fonts/feather/feather-webfont.svg @@ -0,0 +1,1038 @@ + + + + +Created by FontForge 20170910 at Tue Jan 16 19:54:31 2018 + By jimmywarting + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/public/v2/assets/fonts/feather/feather-webfont.ttf b/public/v2/assets/fonts/feather/feather-webfont.ttf new file mode 100755 index 0000000000..f75018c80f Binary files /dev/null and b/public/v2/assets/fonts/feather/feather-webfont.ttf differ diff --git a/public/v2/assets/fonts/feather/feather-webfont.woff b/public/v2/assets/fonts/feather/feather-webfont.woff new file mode 100755 index 0000000000..8ce9004f79 Binary files /dev/null and b/public/v2/assets/fonts/feather/feather-webfont.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic-ext.woff new file mode 100644 index 0000000000..b72af4d82d Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic-ext.woff2 new file mode 100644 index 0000000000..1d07f2f3d7 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic.woff new file mode 100644 index 0000000000..120079b15d Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic.woff2 new file mode 100644 index 0000000000..19ae7a46ba Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek-ext.woff new file mode 100644 index 0000000000..2a9ed1ca56 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek-ext.woff2 new file mode 100644 index 0000000000..29b751404d Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek.woff new file mode 100644 index 0000000000..7beed8bed1 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek.woff2 new file mode 100644 index 0000000000..72883a4bd3 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin-ext.woff new file mode 100644 index 0000000000..c7bab33e6f Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin-ext.woff2 new file mode 100644 index 0000000000..6d8ce38f2e Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin.woff new file mode 100644 index 0000000000..9d77184ce6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin.woff2 new file mode 100644 index 0000000000..17bf4e4704 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-vietnamese.woff new file mode 100644 index 0000000000..e13ffdf8d7 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-vietnamese.woff2 new file mode 100644 index 0000000000..20f9569bc8 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Bold-vietnamese.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic-ext.woff new file mode 100644 index 0000000000..df807fe5e6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic-ext.woff2 new file mode 100644 index 0000000000..9165569335 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic.woff new file mode 100644 index 0000000000..df807fe5e6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic.woff2 new file mode 100644 index 0000000000..9165569335 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek-ext.woff new file mode 100644 index 0000000000..bdf5a8bdb5 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek-ext.woff2 new file mode 100644 index 0000000000..a8877a873e Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek.woff new file mode 100644 index 0000000000..bdf5a8bdb5 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek.woff2 new file mode 100644 index 0000000000..a8877a873e Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin-ext.woff new file mode 100644 index 0000000000..58bea39dc5 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin-ext.woff2 new file mode 100644 index 0000000000..66e003be18 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin.woff new file mode 100644 index 0000000000..df807fe5e6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin.woff2 new file mode 100644 index 0000000000..9165569335 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-vietnamese.woff new file mode 100644 index 0000000000..229d937042 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-vietnamese.woff2 new file mode 100644 index 0000000000..f5cbac4985 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-BoldItalic-vietnamese.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic-ext.woff new file mode 100644 index 0000000000..acd3f44f20 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic-ext.woff2 new file mode 100644 index 0000000000..a797d94366 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic.woff new file mode 100644 index 0000000000..acd3f44f20 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic.woff2 new file mode 100644 index 0000000000..a797d94366 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek-ext.woff new file mode 100644 index 0000000000..87bdb30e04 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek-ext.woff2 new file mode 100644 index 0000000000..a797d94366 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek.woff new file mode 100644 index 0000000000..87bdb30e04 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek.woff2 new file mode 100644 index 0000000000..1b48cc92db Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin-ext.woff new file mode 100644 index 0000000000..89d85e9906 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin-ext.woff2 new file mode 100644 index 0000000000..b27e2689a1 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin.woff new file mode 100644 index 0000000000..acd3f44f20 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin.woff2 new file mode 100644 index 0000000000..6e45d8a059 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-vietnamese.woff new file mode 100644 index 0000000000..7ab473380c Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-vietnamese.woff2 new file mode 100644 index 0000000000..f3d417afae Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Italic-vietnamese.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic-ext.woff new file mode 100644 index 0000000000..0ae46b8e75 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic-ext.woff2 new file mode 100644 index 0000000000..41df763e2a Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic.woff new file mode 100644 index 0000000000..5a771e709b Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic.woff2 new file mode 100644 index 0000000000..f3adea28e3 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek-ext.woff new file mode 100644 index 0000000000..0406b44079 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek-ext.woff2 new file mode 100644 index 0000000000..fb9176d5d6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek.woff new file mode 100644 index 0000000000..bce40897c6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek.woff2 new file mode 100644 index 0000000000..3faab6d8a6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin-ext.woff new file mode 100644 index 0000000000..1d56327323 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin-ext.woff2 new file mode 100644 index 0000000000..43a485084a Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin.woff new file mode 100644 index 0000000000..7ceadfc812 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin.woff2 new file mode 100644 index 0000000000..12dff7cc06 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-vietnamese.woff new file mode 100644 index 0000000000..c4c358b664 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-vietnamese.woff2 new file mode 100644 index 0000000000..16eec5b2a4 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Light-vietnamese.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic-ext.woff new file mode 100644 index 0000000000..aa69b60673 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic-ext.woff2 new file mode 100644 index 0000000000..21d8d27c87 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic.woff new file mode 100644 index 0000000000..aa69b60673 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic.woff2 new file mode 100644 index 0000000000..21d8d27c87 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek-ext.woff new file mode 100644 index 0000000000..d6444d6b4d Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek-ext.woff2 new file mode 100644 index 0000000000..21d8d27c87 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek.woff new file mode 100644 index 0000000000..d6444d6b4d Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek.woff2 new file mode 100644 index 0000000000..0de9903a0e Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin-ext.woff new file mode 100644 index 0000000000..235ba030c2 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin-ext.woff2 new file mode 100644 index 0000000000..085394b4f9 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin.woff new file mode 100644 index 0000000000..aa69b60673 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin.woff2 new file mode 100644 index 0000000000..7db9217a7b Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-vietnamese.woff new file mode 100644 index 0000000000..b4e1e3bfb6 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-vietnamese.woff2 new file mode 100644 index 0000000000..b55e3c6a76 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-LightItalic-vietnamese.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic-ext.woff new file mode 100644 index 0000000000..7208ac33bb Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic-ext.woff2 new file mode 100644 index 0000000000..df4cedd75e Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic.woff new file mode 100644 index 0000000000..968ab912a8 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic.woff2 new file mode 100644 index 0000000000..4128457fe4 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek-ext.woff new file mode 100644 index 0000000000..3bd3298563 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek-ext.woff2 new file mode 100644 index 0000000000..0d828520d7 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek.woff new file mode 100644 index 0000000000..8572b30c4c Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek.woff2 new file mode 100644 index 0000000000..87c63dce9e Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin-ext.woff new file mode 100644 index 0000000000..ba4a980274 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin-ext.woff2 new file mode 100644 index 0000000000..40428533a1 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin.woff new file mode 100644 index 0000000000..16f51fff18 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin.woff2 new file mode 100644 index 0000000000..a04559988d Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-vietnamese.woff new file mode 100644 index 0000000000..4e2a67d85b Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-vietnamese.woff2 new file mode 100644 index 0000000000..2ddc3bdc29 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-Regular-vietnamese.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic-ext.woff new file mode 100644 index 0000000000..33c1e69911 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic-ext.woff2 new file mode 100644 index 0000000000..daceb6907a Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic.woff new file mode 100644 index 0000000000..3fc34ef47a Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic.woff2 new file mode 100644 index 0000000000..5209480ddd Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek-ext.woff new file mode 100644 index 0000000000..2c6c1834c4 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek-ext.woff2 new file mode 100644 index 0000000000..ff38f57172 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek.woff new file mode 100644 index 0000000000..a592bbfbef Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek.woff2 new file mode 100644 index 0000000000..a4065b7db5 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin-ext.woff new file mode 100644 index 0000000000..1d7ccf5fea Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin-ext.woff2 new file mode 100644 index 0000000000..32fe4a26b5 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin.woff new file mode 100644 index 0000000000..3c6ce2ff36 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin.woff2 new file mode 100644 index 0000000000..3bfd9b463a Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-vietnamese.woff new file mode 100644 index 0000000000..575887febc Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-vietnamese.woff2 new file mode 100644 index 0000000000..18d19b438b Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBold-vietnamese.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff new file mode 100644 index 0000000000..04f36322b3 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff2 new file mode 100644 index 0000000000..8892f41219 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic.woff new file mode 100644 index 0000000000..04f36322b3 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic.woff2 new file mode 100644 index 0000000000..8892f41219 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-cyrillic.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek-ext.woff new file mode 100644 index 0000000000..5f97786279 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek-ext.woff2 new file mode 100644 index 0000000000..8892f41219 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek.woff new file mode 100644 index 0000000000..5f97786279 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek.woff2 new file mode 100644 index 0000000000..e5f524f8f1 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-greek.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin-ext.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin-ext.woff new file mode 100644 index 0000000000..8f35cfa9eb Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin-ext.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin-ext.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin-ext.woff2 new file mode 100644 index 0000000000..734dd40896 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin-ext.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin.woff new file mode 100644 index 0000000000..04f36322b3 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin.woff2 new file mode 100644 index 0000000000..c99d25dca9 Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-latin.woff2 differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-vietnamese.woff b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-vietnamese.woff new file mode 100644 index 0000000000..9f2f37f5cd Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-vietnamese.woff differ diff --git a/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-vietnamese.woff2 b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-vietnamese.woff2 new file mode 100644 index 0000000000..fd5c030edd Binary files /dev/null and b/public/v2/assets/fonts/source-sans-pro/SourceSansPro-SemiBoldItalic-vietnamese.woff2 differ diff --git a/public/v2/assets/images/browsers/android-browser.svg b/public/v2/assets/images/browsers/android-browser.svg new file mode 100755 index 0000000000..8065c1c303 --- /dev/null +++ b/public/v2/assets/images/browsers/android-browser.svg @@ -0,0 +1 @@ +android-browserCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/browsers/aol-explorer.svg b/public/v2/assets/images/browsers/aol-explorer.svg new file mode 100755 index 0000000000..77422f4346 --- /dev/null +++ b/public/v2/assets/images/browsers/aol-explorer.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/browsers/blackberry.svg b/public/v2/assets/images/browsers/blackberry.svg new file mode 100755 index 0000000000..ea1682cb40 --- /dev/null +++ b/public/v2/assets/images/browsers/blackberry.svg @@ -0,0 +1 @@ +blackberryCreated with Sketch.Layer 1 \ No newline at end of file diff --git a/public/v2/assets/images/browsers/camino.svg b/public/v2/assets/images/browsers/camino.svg new file mode 100755 index 0000000000..317a76d3ae --- /dev/null +++ b/public/v2/assets/images/browsers/camino.svg @@ -0,0 +1 @@ +caminoCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/browsers/chrome.svg b/public/v2/assets/images/browsers/chrome.svg new file mode 100755 index 0000000000..0a5c3a8b86 --- /dev/null +++ b/public/v2/assets/images/browsers/chrome.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/browsers/chromium.svg b/public/v2/assets/images/browsers/chromium.svg new file mode 100755 index 0000000000..19514f11b5 --- /dev/null +++ b/public/v2/assets/images/browsers/chromium.svg @@ -0,0 +1 @@ +image/svg+xml \ No newline at end of file diff --git a/public/v2/assets/images/browsers/dolphin.svg b/public/v2/assets/images/browsers/dolphin.svg new file mode 100755 index 0000000000..de753f5689 --- /dev/null +++ b/public/v2/assets/images/browsers/dolphin.svg @@ -0,0 +1 @@ +dolphinCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/browsers/edge.svg b/public/v2/assets/images/browsers/edge.svg new file mode 100755 index 0000000000..7626d767e7 --- /dev/null +++ b/public/v2/assets/images/browsers/edge.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/browsers/firefox.svg b/public/v2/assets/images/browsers/firefox.svg new file mode 100755 index 0000000000..6e0299b974 --- /dev/null +++ b/public/v2/assets/images/browsers/firefox.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/browsers/ie.svg b/public/v2/assets/images/browsers/ie.svg new file mode 100755 index 0000000000..015ab2d373 --- /dev/null +++ b/public/v2/assets/images/browsers/ie.svg @@ -0,0 +1 @@ +image/svg+xml \ No newline at end of file diff --git a/public/v2/assets/images/browsers/maxthon.svg b/public/v2/assets/images/browsers/maxthon.svg new file mode 100755 index 0000000000..f64fe8de9d --- /dev/null +++ b/public/v2/assets/images/browsers/maxthon.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/browsers/mozilla.svg b/public/v2/assets/images/browsers/mozilla.svg new file mode 100755 index 0000000000..d5774e80c7 --- /dev/null +++ b/public/v2/assets/images/browsers/mozilla.svg @@ -0,0 +1 @@ +mozillaCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/browsers/netscape.svg b/public/v2/assets/images/browsers/netscape.svg new file mode 100755 index 0000000000..201a165b87 --- /dev/null +++ b/public/v2/assets/images/browsers/netscape.svg @@ -0,0 +1 @@ +netscapeCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/browsers/opera.svg b/public/v2/assets/images/browsers/opera.svg new file mode 100755 index 0000000000..f761fcfcde --- /dev/null +++ b/public/v2/assets/images/browsers/opera.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/browsers/safari.svg b/public/v2/assets/images/browsers/safari.svg new file mode 100755 index 0000000000..3a5b5674f4 --- /dev/null +++ b/public/v2/assets/images/browsers/safari.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/browsers/sleipnir.svg b/public/v2/assets/images/browsers/sleipnir.svg new file mode 100755 index 0000000000..a940c5f2df --- /dev/null +++ b/public/v2/assets/images/browsers/sleipnir.svg @@ -0,0 +1 @@ +slepnir-mobileCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/browsers/uc-browser.svg b/public/v2/assets/images/browsers/uc-browser.svg new file mode 100755 index 0000000000..8041f873d3 --- /dev/null +++ b/public/v2/assets/images/browsers/uc-browser.svg @@ -0,0 +1 @@ +uc-browserCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/browsers/vivaldi.svg b/public/v2/assets/images/browsers/vivaldi.svg new file mode 100755 index 0000000000..d53054b365 --- /dev/null +++ b/public/v2/assets/images/browsers/vivaldi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/bitcoin.svg b/public/v2/assets/images/crypto-currencies/bitcoin.svg new file mode 100755 index 0000000000..cae4d6a313 --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/bitcoin.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/cardano.svg b/public/v2/assets/images/crypto-currencies/cardano.svg new file mode 100755 index 0000000000..b732eef6d0 --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/cardano.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/dash.svg b/public/v2/assets/images/crypto-currencies/dash.svg new file mode 100755 index 0000000000..73da05d961 --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/dash.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/eos.svg b/public/v2/assets/images/crypto-currencies/eos.svg new file mode 100755 index 0000000000..edf882ed4a --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/eos.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/ethereum.svg b/public/v2/assets/images/crypto-currencies/ethereum.svg new file mode 100755 index 0000000000..45b3820ca5 --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/ethereum.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/litecoin.svg b/public/v2/assets/images/crypto-currencies/litecoin.svg new file mode 100755 index 0000000000..109d98dec9 --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/litecoin.svg @@ -0,0 +1 @@ +Litecoin \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/nem.svg b/public/v2/assets/images/crypto-currencies/nem.svg new file mode 100755 index 0000000000..327bcab950 --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/nem.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/crypto-currencies/ripple.svg b/public/v2/assets/images/crypto-currencies/ripple.svg new file mode 100755 index 0000000000..56718617c5 --- /dev/null +++ b/public/v2/assets/images/crypto-currencies/ripple.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/firefly-iii-128.png b/public/v2/assets/images/firefly-iii-128.png new file mode 100644 index 0000000000..2c587a5ed7 Binary files /dev/null and b/public/v2/assets/images/firefly-iii-128.png differ diff --git a/public/v2/assets/images/firefly-iii-48.png b/public/v2/assets/images/firefly-iii-48.png new file mode 100644 index 0000000000..9a14b4c79f Binary files /dev/null and b/public/v2/assets/images/firefly-iii-48.png differ diff --git a/public/v2/assets/images/flags/ad.svg b/public/v2/assets/images/flags/ad.svg new file mode 100755 index 0000000000..b9ceae5cd9 --- /dev/null +++ b/public/v2/assets/images/flags/ad.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ae.svg b/public/v2/assets/images/flags/ae.svg new file mode 100755 index 0000000000..3b88fd0fe0 --- /dev/null +++ b/public/v2/assets/images/flags/ae.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/af.svg b/public/v2/assets/images/flags/af.svg new file mode 100755 index 0000000000..16184ee6ec --- /dev/null +++ b/public/v2/assets/images/flags/af.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ag.svg b/public/v2/assets/images/flags/ag.svg new file mode 100755 index 0000000000..7e71e4f40e --- /dev/null +++ b/public/v2/assets/images/flags/ag.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ai.svg b/public/v2/assets/images/flags/ai.svg new file mode 100755 index 0000000000..302f712273 --- /dev/null +++ b/public/v2/assets/images/flags/ai.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/al.svg b/public/v2/assets/images/flags/al.svg new file mode 100755 index 0000000000..381148e43d --- /dev/null +++ b/public/v2/assets/images/flags/al.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/am.svg b/public/v2/assets/images/flags/am.svg new file mode 100755 index 0000000000..fcd656d61e --- /dev/null +++ b/public/v2/assets/images/flags/am.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ao.svg b/public/v2/assets/images/flags/ao.svg new file mode 100755 index 0000000000..f9370f9436 --- /dev/null +++ b/public/v2/assets/images/flags/ao.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/aq.svg b/public/v2/assets/images/flags/aq.svg new file mode 100755 index 0000000000..c466788a08 --- /dev/null +++ b/public/v2/assets/images/flags/aq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ar.svg b/public/v2/assets/images/flags/ar.svg new file mode 100755 index 0000000000..5859716bdb --- /dev/null +++ b/public/v2/assets/images/flags/ar.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/as.svg b/public/v2/assets/images/flags/as.svg new file mode 100755 index 0000000000..8cdcfb9047 --- /dev/null +++ b/public/v2/assets/images/flags/as.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/at.svg b/public/v2/assets/images/flags/at.svg new file mode 100755 index 0000000000..87128f2233 --- /dev/null +++ b/public/v2/assets/images/flags/at.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/au.svg b/public/v2/assets/images/flags/au.svg new file mode 100755 index 0000000000..69bb9a4698 --- /dev/null +++ b/public/v2/assets/images/flags/au.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/aw.svg b/public/v2/assets/images/flags/aw.svg new file mode 100755 index 0000000000..13c1a70ac2 --- /dev/null +++ b/public/v2/assets/images/flags/aw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ax.svg b/public/v2/assets/images/flags/ax.svg new file mode 100755 index 0000000000..0707683037 --- /dev/null +++ b/public/v2/assets/images/flags/ax.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/az.svg b/public/v2/assets/images/flags/az.svg new file mode 100755 index 0000000000..3e446e7f4f --- /dev/null +++ b/public/v2/assets/images/flags/az.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ba.svg b/public/v2/assets/images/flags/ba.svg new file mode 100755 index 0000000000..94291a4819 --- /dev/null +++ b/public/v2/assets/images/flags/ba.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bb.svg b/public/v2/assets/images/flags/bb.svg new file mode 100755 index 0000000000..23f3a3363f --- /dev/null +++ b/public/v2/assets/images/flags/bb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bd.svg b/public/v2/assets/images/flags/bd.svg new file mode 100755 index 0000000000..2e07b68fc3 --- /dev/null +++ b/public/v2/assets/images/flags/bd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/be.svg b/public/v2/assets/images/flags/be.svg new file mode 100755 index 0000000000..907e4700bb --- /dev/null +++ b/public/v2/assets/images/flags/be.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bf.svg b/public/v2/assets/images/flags/bf.svg new file mode 100755 index 0000000000..3ea79912a6 --- /dev/null +++ b/public/v2/assets/images/flags/bf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bg.svg b/public/v2/assets/images/flags/bg.svg new file mode 100755 index 0000000000..3d76818bcb --- /dev/null +++ b/public/v2/assets/images/flags/bg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bh.svg b/public/v2/assets/images/flags/bh.svg new file mode 100755 index 0000000000..6da13f4424 --- /dev/null +++ b/public/v2/assets/images/flags/bh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bi.svg b/public/v2/assets/images/flags/bi.svg new file mode 100755 index 0000000000..498a27774a --- /dev/null +++ b/public/v2/assets/images/flags/bi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bj.svg b/public/v2/assets/images/flags/bj.svg new file mode 100755 index 0000000000..fef1eccd06 --- /dev/null +++ b/public/v2/assets/images/flags/bj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bl.svg b/public/v2/assets/images/flags/bl.svg new file mode 100755 index 0000000000..cd256c5fc5 --- /dev/null +++ b/public/v2/assets/images/flags/bl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bm.svg b/public/v2/assets/images/flags/bm.svg new file mode 100755 index 0000000000..3599e0fb74 --- /dev/null +++ b/public/v2/assets/images/flags/bm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bn.svg b/public/v2/assets/images/flags/bn.svg new file mode 100755 index 0000000000..4e3d0fe7a1 --- /dev/null +++ b/public/v2/assets/images/flags/bn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bo.svg b/public/v2/assets/images/flags/bo.svg new file mode 100755 index 0000000000..c208bde39b --- /dev/null +++ b/public/v2/assets/images/flags/bo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bq.svg b/public/v2/assets/images/flags/bq.svg new file mode 100755 index 0000000000..93446cfd4f --- /dev/null +++ b/public/v2/assets/images/flags/bq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/br.svg b/public/v2/assets/images/flags/br.svg new file mode 100755 index 0000000000..8561ea7b11 --- /dev/null +++ b/public/v2/assets/images/flags/br.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bs.svg b/public/v2/assets/images/flags/bs.svg new file mode 100755 index 0000000000..91dc2d7e99 --- /dev/null +++ b/public/v2/assets/images/flags/bs.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bt.svg b/public/v2/assets/images/flags/bt.svg new file mode 100755 index 0000000000..4d2c5f53e8 --- /dev/null +++ b/public/v2/assets/images/flags/bt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bv.svg b/public/v2/assets/images/flags/bv.svg new file mode 100755 index 0000000000..cda48ff69c --- /dev/null +++ b/public/v2/assets/images/flags/bv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bw.svg b/public/v2/assets/images/flags/bw.svg new file mode 100755 index 0000000000..cc154b9922 --- /dev/null +++ b/public/v2/assets/images/flags/bw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/by.svg b/public/v2/assets/images/flags/by.svg new file mode 100755 index 0000000000..1e7be25077 --- /dev/null +++ b/public/v2/assets/images/flags/by.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/bz.svg b/public/v2/assets/images/flags/bz.svg new file mode 100755 index 0000000000..0fec282b71 --- /dev/null +++ b/public/v2/assets/images/flags/bz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ca.svg b/public/v2/assets/images/flags/ca.svg new file mode 100755 index 0000000000..fb542b029f --- /dev/null +++ b/public/v2/assets/images/flags/ca.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/public/v2/assets/images/flags/cc.svg b/public/v2/assets/images/flags/cc.svg new file mode 100755 index 0000000000..09958459f1 --- /dev/null +++ b/public/v2/assets/images/flags/cc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cd.svg b/public/v2/assets/images/flags/cd.svg new file mode 100755 index 0000000000..a54f831a5e --- /dev/null +++ b/public/v2/assets/images/flags/cd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cf.svg b/public/v2/assets/images/flags/cf.svg new file mode 100755 index 0000000000..2c64d40f28 --- /dev/null +++ b/public/v2/assets/images/flags/cf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cg.svg b/public/v2/assets/images/flags/cg.svg new file mode 100755 index 0000000000..3b9a67324a --- /dev/null +++ b/public/v2/assets/images/flags/cg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ch.svg b/public/v2/assets/images/flags/ch.svg new file mode 100755 index 0000000000..11a20552d5 --- /dev/null +++ b/public/v2/assets/images/flags/ch.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ci.svg b/public/v2/assets/images/flags/ci.svg new file mode 100755 index 0000000000..9a82ef37ba --- /dev/null +++ b/public/v2/assets/images/flags/ci.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ck.svg b/public/v2/assets/images/flags/ck.svg new file mode 100755 index 0000000000..a404e2ff92 --- /dev/null +++ b/public/v2/assets/images/flags/ck.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cl.svg b/public/v2/assets/images/flags/cl.svg new file mode 100755 index 0000000000..60d316c26c --- /dev/null +++ b/public/v2/assets/images/flags/cl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cm.svg b/public/v2/assets/images/flags/cm.svg new file mode 100755 index 0000000000..f5ec52ae19 --- /dev/null +++ b/public/v2/assets/images/flags/cm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cn.svg b/public/v2/assets/images/flags/cn.svg new file mode 100755 index 0000000000..e9e74970c7 --- /dev/null +++ b/public/v2/assets/images/flags/cn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/co.svg b/public/v2/assets/images/flags/co.svg new file mode 100755 index 0000000000..926d620b43 --- /dev/null +++ b/public/v2/assets/images/flags/co.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cr.svg b/public/v2/assets/images/flags/cr.svg new file mode 100755 index 0000000000..e5a9cb98c6 --- /dev/null +++ b/public/v2/assets/images/flags/cr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cu.svg b/public/v2/assets/images/flags/cu.svg new file mode 100755 index 0000000000..a48cda4dba --- /dev/null +++ b/public/v2/assets/images/flags/cu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cv.svg b/public/v2/assets/images/flags/cv.svg new file mode 100755 index 0000000000..9004e89b80 --- /dev/null +++ b/public/v2/assets/images/flags/cv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cw.svg b/public/v2/assets/images/flags/cw.svg new file mode 100755 index 0000000000..974c2c0ba8 --- /dev/null +++ b/public/v2/assets/images/flags/cw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cx.svg b/public/v2/assets/images/flags/cx.svg new file mode 100755 index 0000000000..117abe2b2b --- /dev/null +++ b/public/v2/assets/images/flags/cx.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cy.svg b/public/v2/assets/images/flags/cy.svg new file mode 100755 index 0000000000..12ef15c38b --- /dev/null +++ b/public/v2/assets/images/flags/cy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/cz.svg b/public/v2/assets/images/flags/cz.svg new file mode 100755 index 0000000000..b5a58cc13a --- /dev/null +++ b/public/v2/assets/images/flags/cz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/de.svg b/public/v2/assets/images/flags/de.svg new file mode 100755 index 0000000000..d681fce85c --- /dev/null +++ b/public/v2/assets/images/flags/de.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/dj.svg b/public/v2/assets/images/flags/dj.svg new file mode 100755 index 0000000000..4e7114cd39 --- /dev/null +++ b/public/v2/assets/images/flags/dj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/dk.svg b/public/v2/assets/images/flags/dk.svg new file mode 100755 index 0000000000..af7775acf8 --- /dev/null +++ b/public/v2/assets/images/flags/dk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/dm.svg b/public/v2/assets/images/flags/dm.svg new file mode 100755 index 0000000000..7bf9a07fdb --- /dev/null +++ b/public/v2/assets/images/flags/dm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/do.svg b/public/v2/assets/images/flags/do.svg new file mode 100755 index 0000000000..5001b18e35 --- /dev/null +++ b/public/v2/assets/images/flags/do.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/dz.svg b/public/v2/assets/images/flags/dz.svg new file mode 100755 index 0000000000..aa0834c777 --- /dev/null +++ b/public/v2/assets/images/flags/dz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ec.svg b/public/v2/assets/images/flags/ec.svg new file mode 100755 index 0000000000..7da884fc7a --- /dev/null +++ b/public/v2/assets/images/flags/ec.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ee.svg b/public/v2/assets/images/flags/ee.svg new file mode 100755 index 0000000000..b0b67006bc --- /dev/null +++ b/public/v2/assets/images/flags/ee.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/eg.svg b/public/v2/assets/images/flags/eg.svg new file mode 100755 index 0000000000..55a7401c6c --- /dev/null +++ b/public/v2/assets/images/flags/eg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/eh.svg b/public/v2/assets/images/flags/eh.svg new file mode 100755 index 0000000000..3a2c1e6a2e --- /dev/null +++ b/public/v2/assets/images/flags/eh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/er.svg b/public/v2/assets/images/flags/er.svg new file mode 100755 index 0000000000..5470eb25b1 --- /dev/null +++ b/public/v2/assets/images/flags/er.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/es.svg b/public/v2/assets/images/flags/es.svg new file mode 100755 index 0000000000..dbc1578822 --- /dev/null +++ b/public/v2/assets/images/flags/es.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/et.svg b/public/v2/assets/images/flags/et.svg new file mode 100755 index 0000000000..6a4d0cf55b --- /dev/null +++ b/public/v2/assets/images/flags/et.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/eu.svg b/public/v2/assets/images/flags/eu.svg new file mode 100755 index 0000000000..dbd6971a7b --- /dev/null +++ b/public/v2/assets/images/flags/eu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/fi.svg b/public/v2/assets/images/flags/fi.svg new file mode 100755 index 0000000000..06d3048cfc --- /dev/null +++ b/public/v2/assets/images/flags/fi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/fj.svg b/public/v2/assets/images/flags/fj.svg new file mode 100755 index 0000000000..6aab0a7e70 --- /dev/null +++ b/public/v2/assets/images/flags/fj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/fk.svg b/public/v2/assets/images/flags/fk.svg new file mode 100755 index 0000000000..c80f01104d --- /dev/null +++ b/public/v2/assets/images/flags/fk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/fm.svg b/public/v2/assets/images/flags/fm.svg new file mode 100755 index 0000000000..6925a8f232 --- /dev/null +++ b/public/v2/assets/images/flags/fm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/fo.svg b/public/v2/assets/images/flags/fo.svg new file mode 100755 index 0000000000..7ec4a613d8 --- /dev/null +++ b/public/v2/assets/images/flags/fo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/fr.svg b/public/v2/assets/images/flags/fr.svg new file mode 100755 index 0000000000..33c456dd38 --- /dev/null +++ b/public/v2/assets/images/flags/fr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ga.svg b/public/v2/assets/images/flags/ga.svg new file mode 100755 index 0000000000..b8f264a85e --- /dev/null +++ b/public/v2/assets/images/flags/ga.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gb-eng.svg b/public/v2/assets/images/flags/gb-eng.svg new file mode 100755 index 0000000000..0f69383016 --- /dev/null +++ b/public/v2/assets/images/flags/gb-eng.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gb-nir.svg b/public/v2/assets/images/flags/gb-nir.svg new file mode 100755 index 0000000000..ac560251e8 --- /dev/null +++ b/public/v2/assets/images/flags/gb-nir.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gb-sct.svg b/public/v2/assets/images/flags/gb-sct.svg new file mode 100755 index 0000000000..859e49dbd8 --- /dev/null +++ b/public/v2/assets/images/flags/gb-sct.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gb-wls.svg b/public/v2/assets/images/flags/gb-wls.svg new file mode 100755 index 0000000000..bc5d42da1f --- /dev/null +++ b/public/v2/assets/images/flags/gb-wls.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gb.svg b/public/v2/assets/images/flags/gb.svg new file mode 100755 index 0000000000..001f884bcd --- /dev/null +++ b/public/v2/assets/images/flags/gb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gd.svg b/public/v2/assets/images/flags/gd.svg new file mode 100755 index 0000000000..502ee92861 --- /dev/null +++ b/public/v2/assets/images/flags/gd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ge.svg b/public/v2/assets/images/flags/ge.svg new file mode 100755 index 0000000000..1c994a7c32 --- /dev/null +++ b/public/v2/assets/images/flags/ge.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gf.svg b/public/v2/assets/images/flags/gf.svg new file mode 100755 index 0000000000..1bd8664ed3 --- /dev/null +++ b/public/v2/assets/images/flags/gf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gg.svg b/public/v2/assets/images/flags/gg.svg new file mode 100755 index 0000000000..de79b30c47 --- /dev/null +++ b/public/v2/assets/images/flags/gg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gh.svg b/public/v2/assets/images/flags/gh.svg new file mode 100755 index 0000000000..31cf2349f9 --- /dev/null +++ b/public/v2/assets/images/flags/gh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gi.svg b/public/v2/assets/images/flags/gi.svg new file mode 100755 index 0000000000..4e7711b1d0 --- /dev/null +++ b/public/v2/assets/images/flags/gi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gl.svg b/public/v2/assets/images/flags/gl.svg new file mode 100755 index 0000000000..2239044ab4 --- /dev/null +++ b/public/v2/assets/images/flags/gl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gm.svg b/public/v2/assets/images/flags/gm.svg new file mode 100755 index 0000000000..c4dd45b123 --- /dev/null +++ b/public/v2/assets/images/flags/gm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gn.svg b/public/v2/assets/images/flags/gn.svg new file mode 100755 index 0000000000..c56e03e42a --- /dev/null +++ b/public/v2/assets/images/flags/gn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gp.svg b/public/v2/assets/images/flags/gp.svg new file mode 100755 index 0000000000..33c456dd38 --- /dev/null +++ b/public/v2/assets/images/flags/gp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gq.svg b/public/v2/assets/images/flags/gq.svg new file mode 100755 index 0000000000..a723244326 --- /dev/null +++ b/public/v2/assets/images/flags/gq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gr.svg b/public/v2/assets/images/flags/gr.svg new file mode 100755 index 0000000000..10b87ef6ea --- /dev/null +++ b/public/v2/assets/images/flags/gr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gs.svg b/public/v2/assets/images/flags/gs.svg new file mode 100755 index 0000000000..8b69312416 --- /dev/null +++ b/public/v2/assets/images/flags/gs.svg @@ -0,0 +1 @@ +LEOTERRRRREOOAAAMPPPITTMG \ No newline at end of file diff --git a/public/v2/assets/images/flags/gt.svg b/public/v2/assets/images/flags/gt.svg new file mode 100755 index 0000000000..eef9fc9363 --- /dev/null +++ b/public/v2/assets/images/flags/gt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gu.svg b/public/v2/assets/images/flags/gu.svg new file mode 100755 index 0000000000..6993c523c0 --- /dev/null +++ b/public/v2/assets/images/flags/gu.svg @@ -0,0 +1 @@ +GUAMGUAM \ No newline at end of file diff --git a/public/v2/assets/images/flags/gw.svg b/public/v2/assets/images/flags/gw.svg new file mode 100755 index 0000000000..6ffb420294 --- /dev/null +++ b/public/v2/assets/images/flags/gw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/gy.svg b/public/v2/assets/images/flags/gy.svg new file mode 100755 index 0000000000..571d44c944 --- /dev/null +++ b/public/v2/assets/images/flags/gy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/hk.svg b/public/v2/assets/images/flags/hk.svg new file mode 100755 index 0000000000..f06e36fe1e --- /dev/null +++ b/public/v2/assets/images/flags/hk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/hm.svg b/public/v2/assets/images/flags/hm.svg new file mode 100755 index 0000000000..e94952ad64 --- /dev/null +++ b/public/v2/assets/images/flags/hm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/hn.svg b/public/v2/assets/images/flags/hn.svg new file mode 100755 index 0000000000..1bd8321f6b --- /dev/null +++ b/public/v2/assets/images/flags/hn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/hr.svg b/public/v2/assets/images/flags/hr.svg new file mode 100755 index 0000000000..2b737ee1c1 --- /dev/null +++ b/public/v2/assets/images/flags/hr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ht.svg b/public/v2/assets/images/flags/ht.svg new file mode 100755 index 0000000000..fbdff3aa50 --- /dev/null +++ b/public/v2/assets/images/flags/ht.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/hu.svg b/public/v2/assets/images/flags/hu.svg new file mode 100755 index 0000000000..c7e187678f --- /dev/null +++ b/public/v2/assets/images/flags/hu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/id.svg b/public/v2/assets/images/flags/id.svg new file mode 100755 index 0000000000..a0cb094a23 --- /dev/null +++ b/public/v2/assets/images/flags/id.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ie.svg b/public/v2/assets/images/flags/ie.svg new file mode 100755 index 0000000000..8ca940c9e9 --- /dev/null +++ b/public/v2/assets/images/flags/ie.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/il.svg b/public/v2/assets/images/flags/il.svg new file mode 100755 index 0000000000..8fffe6cf8c --- /dev/null +++ b/public/v2/assets/images/flags/il.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/im.svg b/public/v2/assets/images/flags/im.svg new file mode 100755 index 0000000000..9cb472646f --- /dev/null +++ b/public/v2/assets/images/flags/im.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/in.svg b/public/v2/assets/images/flags/in.svg new file mode 100755 index 0000000000..50defbf07a --- /dev/null +++ b/public/v2/assets/images/flags/in.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/io.svg b/public/v2/assets/images/flags/io.svg new file mode 100755 index 0000000000..baa770de00 --- /dev/null +++ b/public/v2/assets/images/flags/io.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/iq.svg b/public/v2/assets/images/flags/iq.svg new file mode 100755 index 0000000000..bdfe721310 --- /dev/null +++ b/public/v2/assets/images/flags/iq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ir.svg b/public/v2/assets/images/flags/ir.svg new file mode 100755 index 0000000000..22f97cf697 --- /dev/null +++ b/public/v2/assets/images/flags/ir.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/is.svg b/public/v2/assets/images/flags/is.svg new file mode 100755 index 0000000000..6545c56efa --- /dev/null +++ b/public/v2/assets/images/flags/is.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/it.svg b/public/v2/assets/images/flags/it.svg new file mode 100755 index 0000000000..721c0ce55e --- /dev/null +++ b/public/v2/assets/images/flags/it.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/je.svg b/public/v2/assets/images/flags/je.svg new file mode 100755 index 0000000000..22482efc4e --- /dev/null +++ b/public/v2/assets/images/flags/je.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/jm.svg b/public/v2/assets/images/flags/jm.svg new file mode 100755 index 0000000000..794ebff319 --- /dev/null +++ b/public/v2/assets/images/flags/jm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/jo.svg b/public/v2/assets/images/flags/jo.svg new file mode 100755 index 0000000000..e6e9246531 --- /dev/null +++ b/public/v2/assets/images/flags/jo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/jp.svg b/public/v2/assets/images/flags/jp.svg new file mode 100755 index 0000000000..5b8fef5598 --- /dev/null +++ b/public/v2/assets/images/flags/jp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ke.svg b/public/v2/assets/images/flags/ke.svg new file mode 100755 index 0000000000..7c03d523c8 --- /dev/null +++ b/public/v2/assets/images/flags/ke.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/kg.svg b/public/v2/assets/images/flags/kg.svg new file mode 100755 index 0000000000..bf79897e3e --- /dev/null +++ b/public/v2/assets/images/flags/kg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/kh.svg b/public/v2/assets/images/flags/kh.svg new file mode 100755 index 0000000000..e4192905e6 --- /dev/null +++ b/public/v2/assets/images/flags/kh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ki.svg b/public/v2/assets/images/flags/ki.svg new file mode 100755 index 0000000000..f7f76eba8e --- /dev/null +++ b/public/v2/assets/images/flags/ki.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/km.svg b/public/v2/assets/images/flags/km.svg new file mode 100755 index 0000000000..02cade428c --- /dev/null +++ b/public/v2/assets/images/flags/km.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/kn.svg b/public/v2/assets/images/flags/kn.svg new file mode 100755 index 0000000000..802da76ef5 --- /dev/null +++ b/public/v2/assets/images/flags/kn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/kp.svg b/public/v2/assets/images/flags/kp.svg new file mode 100755 index 0000000000..5a78b5261e --- /dev/null +++ b/public/v2/assets/images/flags/kp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/kr.svg b/public/v2/assets/images/flags/kr.svg new file mode 100755 index 0000000000..3ba5e92cdc --- /dev/null +++ b/public/v2/assets/images/flags/kr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/kw.svg b/public/v2/assets/images/flags/kw.svg new file mode 100755 index 0000000000..24e3a108a0 --- /dev/null +++ b/public/v2/assets/images/flags/kw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ky.svg b/public/v2/assets/images/flags/ky.svg new file mode 100755 index 0000000000..bbbc4cd52a --- /dev/null +++ b/public/v2/assets/images/flags/ky.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/kz.svg b/public/v2/assets/images/flags/kz.svg new file mode 100755 index 0000000000..d9af6f83d9 --- /dev/null +++ b/public/v2/assets/images/flags/kz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/la.svg b/public/v2/assets/images/flags/la.svg new file mode 100755 index 0000000000..0fcec31eb4 --- /dev/null +++ b/public/v2/assets/images/flags/la.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/lb.svg b/public/v2/assets/images/flags/lb.svg new file mode 100755 index 0000000000..e2f6f2b626 --- /dev/null +++ b/public/v2/assets/images/flags/lb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/lc.svg b/public/v2/assets/images/flags/lc.svg new file mode 100755 index 0000000000..d44ffca104 --- /dev/null +++ b/public/v2/assets/images/flags/lc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/li.svg b/public/v2/assets/images/flags/li.svg new file mode 100755 index 0000000000..245b721e6a --- /dev/null +++ b/public/v2/assets/images/flags/li.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/lk.svg b/public/v2/assets/images/flags/lk.svg new file mode 100755 index 0000000000..d3b5e8206e --- /dev/null +++ b/public/v2/assets/images/flags/lk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/lr.svg b/public/v2/assets/images/flags/lr.svg new file mode 100755 index 0000000000..3386c26aa8 --- /dev/null +++ b/public/v2/assets/images/flags/lr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ls.svg b/public/v2/assets/images/flags/ls.svg new file mode 100755 index 0000000000..17bbf6cd0a --- /dev/null +++ b/public/v2/assets/images/flags/ls.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/lt.svg b/public/v2/assets/images/flags/lt.svg new file mode 100755 index 0000000000..6a103ff5a4 --- /dev/null +++ b/public/v2/assets/images/flags/lt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/lu.svg b/public/v2/assets/images/flags/lu.svg new file mode 100755 index 0000000000..3e657e9617 --- /dev/null +++ b/public/v2/assets/images/flags/lu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/lv.svg b/public/v2/assets/images/flags/lv.svg new file mode 100755 index 0000000000..e6200ea438 --- /dev/null +++ b/public/v2/assets/images/flags/lv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ly.svg b/public/v2/assets/images/flags/ly.svg new file mode 100755 index 0000000000..0ac041467b --- /dev/null +++ b/public/v2/assets/images/flags/ly.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ma.svg b/public/v2/assets/images/flags/ma.svg new file mode 100755 index 0000000000..4795e6c614 --- /dev/null +++ b/public/v2/assets/images/flags/ma.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mc.svg b/public/v2/assets/images/flags/mc.svg new file mode 100755 index 0000000000..53ea91ddde --- /dev/null +++ b/public/v2/assets/images/flags/mc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/md.svg b/public/v2/assets/images/flags/md.svg new file mode 100755 index 0000000000..b18b495729 --- /dev/null +++ b/public/v2/assets/images/flags/md.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/me.svg b/public/v2/assets/images/flags/me.svg new file mode 100755 index 0000000000..6624c272b9 --- /dev/null +++ b/public/v2/assets/images/flags/me.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mf.svg b/public/v2/assets/images/flags/mf.svg new file mode 100755 index 0000000000..33c456dd38 --- /dev/null +++ b/public/v2/assets/images/flags/mf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mg.svg b/public/v2/assets/images/flags/mg.svg new file mode 100755 index 0000000000..157d074ed6 --- /dev/null +++ b/public/v2/assets/images/flags/mg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mh.svg b/public/v2/assets/images/flags/mh.svg new file mode 100755 index 0000000000..22703ab583 --- /dev/null +++ b/public/v2/assets/images/flags/mh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mk.svg b/public/v2/assets/images/flags/mk.svg new file mode 100755 index 0000000000..a77d5e8b64 --- /dev/null +++ b/public/v2/assets/images/flags/mk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ml.svg b/public/v2/assets/images/flags/ml.svg new file mode 100755 index 0000000000..648eede198 --- /dev/null +++ b/public/v2/assets/images/flags/ml.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mm.svg b/public/v2/assets/images/flags/mm.svg new file mode 100755 index 0000000000..eca1371b63 --- /dev/null +++ b/public/v2/assets/images/flags/mm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mn.svg b/public/v2/assets/images/flags/mn.svg new file mode 100755 index 0000000000..ef0d3ee9e5 --- /dev/null +++ b/public/v2/assets/images/flags/mn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mo.svg b/public/v2/assets/images/flags/mo.svg new file mode 100755 index 0000000000..14b80bd6ff --- /dev/null +++ b/public/v2/assets/images/flags/mo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mp.svg b/public/v2/assets/images/flags/mp.svg new file mode 100755 index 0000000000..38f1009cb4 --- /dev/null +++ b/public/v2/assets/images/flags/mp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mq.svg b/public/v2/assets/images/flags/mq.svg new file mode 100755 index 0000000000..711b045628 --- /dev/null +++ b/public/v2/assets/images/flags/mq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mr.svg b/public/v2/assets/images/flags/mr.svg new file mode 100755 index 0000000000..d823a938d0 --- /dev/null +++ b/public/v2/assets/images/flags/mr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ms.svg b/public/v2/assets/images/flags/ms.svg new file mode 100755 index 0000000000..2a5951b03b --- /dev/null +++ b/public/v2/assets/images/flags/ms.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mt.svg b/public/v2/assets/images/flags/mt.svg new file mode 100755 index 0000000000..2777777c15 --- /dev/null +++ b/public/v2/assets/images/flags/mt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mu.svg b/public/v2/assets/images/flags/mu.svg new file mode 100755 index 0000000000..dcc048cac8 --- /dev/null +++ b/public/v2/assets/images/flags/mu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mv.svg b/public/v2/assets/images/flags/mv.svg new file mode 100755 index 0000000000..52938d23e1 --- /dev/null +++ b/public/v2/assets/images/flags/mv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mw.svg b/public/v2/assets/images/flags/mw.svg new file mode 100755 index 0000000000..3dc4e80ebd --- /dev/null +++ b/public/v2/assets/images/flags/mw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mx.svg b/public/v2/assets/images/flags/mx.svg new file mode 100755 index 0000000000..61d9aa9d80 --- /dev/null +++ b/public/v2/assets/images/flags/mx.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/my.svg b/public/v2/assets/images/flags/my.svg new file mode 100755 index 0000000000..534a4be00a --- /dev/null +++ b/public/v2/assets/images/flags/my.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/mz.svg b/public/v2/assets/images/flags/mz.svg new file mode 100755 index 0000000000..ce9e8a8046 --- /dev/null +++ b/public/v2/assets/images/flags/mz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/na.svg b/public/v2/assets/images/flags/na.svg new file mode 100755 index 0000000000..60caec25a9 --- /dev/null +++ b/public/v2/assets/images/flags/na.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/nc.svg b/public/v2/assets/images/flags/nc.svg new file mode 100755 index 0000000000..6c95ad541f --- /dev/null +++ b/public/v2/assets/images/flags/nc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ne.svg b/public/v2/assets/images/flags/ne.svg new file mode 100755 index 0000000000..a38708666b --- /dev/null +++ b/public/v2/assets/images/flags/ne.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/nf.svg b/public/v2/assets/images/flags/nf.svg new file mode 100755 index 0000000000..de845bc914 --- /dev/null +++ b/public/v2/assets/images/flags/nf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ng.svg b/public/v2/assets/images/flags/ng.svg new file mode 100755 index 0000000000..9a2e663ac5 --- /dev/null +++ b/public/v2/assets/images/flags/ng.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ni.svg b/public/v2/assets/images/flags/ni.svg new file mode 100755 index 0000000000..91f312405a --- /dev/null +++ b/public/v2/assets/images/flags/ni.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/nl.svg b/public/v2/assets/images/flags/nl.svg new file mode 100755 index 0000000000..37c6390083 --- /dev/null +++ b/public/v2/assets/images/flags/nl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/no.svg b/public/v2/assets/images/flags/no.svg new file mode 100755 index 0000000000..5739ea091a --- /dev/null +++ b/public/v2/assets/images/flags/no.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/np.svg b/public/v2/assets/images/flags/np.svg new file mode 100755 index 0000000000..85cb38dc7c --- /dev/null +++ b/public/v2/assets/images/flags/np.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/nr.svg b/public/v2/assets/images/flags/nr.svg new file mode 100755 index 0000000000..f33ab737a6 --- /dev/null +++ b/public/v2/assets/images/flags/nr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/nu.svg b/public/v2/assets/images/flags/nu.svg new file mode 100755 index 0000000000..4834fe8c82 --- /dev/null +++ b/public/v2/assets/images/flags/nu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/nz.svg b/public/v2/assets/images/flags/nz.svg new file mode 100755 index 0000000000..ddcd5027fc --- /dev/null +++ b/public/v2/assets/images/flags/nz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/om.svg b/public/v2/assets/images/flags/om.svg new file mode 100755 index 0000000000..c5851cbf54 --- /dev/null +++ b/public/v2/assets/images/flags/om.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pa.svg b/public/v2/assets/images/flags/pa.svg new file mode 100755 index 0000000000..8b6900f6eb --- /dev/null +++ b/public/v2/assets/images/flags/pa.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pe.svg b/public/v2/assets/images/flags/pe.svg new file mode 100755 index 0000000000..da10e7df66 --- /dev/null +++ b/public/v2/assets/images/flags/pe.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pf.svg b/public/v2/assets/images/flags/pf.svg new file mode 100755 index 0000000000..264217fd3e --- /dev/null +++ b/public/v2/assets/images/flags/pf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pg.svg b/public/v2/assets/images/flags/pg.svg new file mode 100755 index 0000000000..38d0679112 --- /dev/null +++ b/public/v2/assets/images/flags/pg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ph.svg b/public/v2/assets/images/flags/ph.svg new file mode 100755 index 0000000000..f49c92ac48 --- /dev/null +++ b/public/v2/assets/images/flags/ph.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pk.svg b/public/v2/assets/images/flags/pk.svg new file mode 100755 index 0000000000..0478f54a9d --- /dev/null +++ b/public/v2/assets/images/flags/pk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pl.svg b/public/v2/assets/images/flags/pl.svg new file mode 100755 index 0000000000..53ec758f5d --- /dev/null +++ b/public/v2/assets/images/flags/pl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pm.svg b/public/v2/assets/images/flags/pm.svg new file mode 100755 index 0000000000..6c95ad541f --- /dev/null +++ b/public/v2/assets/images/flags/pm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pn.svg b/public/v2/assets/images/flags/pn.svg new file mode 100755 index 0000000000..e9b37f9ddf --- /dev/null +++ b/public/v2/assets/images/flags/pn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pr.svg b/public/v2/assets/images/flags/pr.svg new file mode 100755 index 0000000000..58e2613f6a --- /dev/null +++ b/public/v2/assets/images/flags/pr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ps.svg b/public/v2/assets/images/flags/ps.svg new file mode 100755 index 0000000000..77ac5981fd --- /dev/null +++ b/public/v2/assets/images/flags/ps.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pt.svg b/public/v2/assets/images/flags/pt.svg new file mode 100755 index 0000000000..3b8f934bbe --- /dev/null +++ b/public/v2/assets/images/flags/pt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/pw.svg b/public/v2/assets/images/flags/pw.svg new file mode 100755 index 0000000000..91620ba4e2 --- /dev/null +++ b/public/v2/assets/images/flags/pw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/py.svg b/public/v2/assets/images/flags/py.svg new file mode 100755 index 0000000000..93800948eb --- /dev/null +++ b/public/v2/assets/images/flags/py.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/qa.svg b/public/v2/assets/images/flags/qa.svg new file mode 100755 index 0000000000..c98d489924 --- /dev/null +++ b/public/v2/assets/images/flags/qa.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/re.svg b/public/v2/assets/images/flags/re.svg new file mode 100755 index 0000000000..6c95ad541f --- /dev/null +++ b/public/v2/assets/images/flags/re.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ro.svg b/public/v2/assets/images/flags/ro.svg new file mode 100755 index 0000000000..dce850ab2e --- /dev/null +++ b/public/v2/assets/images/flags/ro.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/rs.svg b/public/v2/assets/images/flags/rs.svg new file mode 100755 index 0000000000..d6a04b350a --- /dev/null +++ b/public/v2/assets/images/flags/rs.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ru.svg b/public/v2/assets/images/flags/ru.svg new file mode 100755 index 0000000000..273d9bed45 --- /dev/null +++ b/public/v2/assets/images/flags/ru.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/rw.svg b/public/v2/assets/images/flags/rw.svg new file mode 100755 index 0000000000..990b51c136 --- /dev/null +++ b/public/v2/assets/images/flags/rw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sa.svg b/public/v2/assets/images/flags/sa.svg new file mode 100755 index 0000000000..a518058126 --- /dev/null +++ b/public/v2/assets/images/flags/sa.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sb.svg b/public/v2/assets/images/flags/sb.svg new file mode 100755 index 0000000000..a4cb3e686a --- /dev/null +++ b/public/v2/assets/images/flags/sb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sc.svg b/public/v2/assets/images/flags/sc.svg new file mode 100755 index 0000000000..480f4bafb3 --- /dev/null +++ b/public/v2/assets/images/flags/sc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sd.svg b/public/v2/assets/images/flags/sd.svg new file mode 100755 index 0000000000..b59f65fb83 --- /dev/null +++ b/public/v2/assets/images/flags/sd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/se.svg b/public/v2/assets/images/flags/se.svg new file mode 100755 index 0000000000..a1a818fbad --- /dev/null +++ b/public/v2/assets/images/flags/se.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sg.svg b/public/v2/assets/images/flags/sg.svg new file mode 100755 index 0000000000..ea670f9b43 --- /dev/null +++ b/public/v2/assets/images/flags/sg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sh.svg b/public/v2/assets/images/flags/sh.svg new file mode 100755 index 0000000000..f5ce3d9e6c --- /dev/null +++ b/public/v2/assets/images/flags/sh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/si.svg b/public/v2/assets/images/flags/si.svg new file mode 100755 index 0000000000..0b3ee205ca --- /dev/null +++ b/public/v2/assets/images/flags/si.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sj.svg b/public/v2/assets/images/flags/sj.svg new file mode 100755 index 0000000000..5739ea091a --- /dev/null +++ b/public/v2/assets/images/flags/sj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sk.svg b/public/v2/assets/images/flags/sk.svg new file mode 100755 index 0000000000..3577634110 --- /dev/null +++ b/public/v2/assets/images/flags/sk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sl.svg b/public/v2/assets/images/flags/sl.svg new file mode 100755 index 0000000000..42e0d6210d --- /dev/null +++ b/public/v2/assets/images/flags/sl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sm.svg b/public/v2/assets/images/flags/sm.svg new file mode 100755 index 0000000000..133ae34cf0 --- /dev/null +++ b/public/v2/assets/images/flags/sm.svg @@ -0,0 +1 @@ +LIBERTAS \ No newline at end of file diff --git a/public/v2/assets/images/flags/sn.svg b/public/v2/assets/images/flags/sn.svg new file mode 100755 index 0000000000..28a1e7fd22 --- /dev/null +++ b/public/v2/assets/images/flags/sn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/so.svg b/public/v2/assets/images/flags/so.svg new file mode 100755 index 0000000000..651cfee922 --- /dev/null +++ b/public/v2/assets/images/flags/so.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sr.svg b/public/v2/assets/images/flags/sr.svg new file mode 100755 index 0000000000..d968261e2a --- /dev/null +++ b/public/v2/assets/images/flags/sr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ss.svg b/public/v2/assets/images/flags/ss.svg new file mode 100755 index 0000000000..c5458ee21f --- /dev/null +++ b/public/v2/assets/images/flags/ss.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/st.svg b/public/v2/assets/images/flags/st.svg new file mode 100755 index 0000000000..b48da60eb5 --- /dev/null +++ b/public/v2/assets/images/flags/st.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sv.svg b/public/v2/assets/images/flags/sv.svg new file mode 100755 index 0000000000..dec1600c9b --- /dev/null +++ b/public/v2/assets/images/flags/sv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sx.svg b/public/v2/assets/images/flags/sx.svg new file mode 100755 index 0000000000..cea8d7f603 --- /dev/null +++ b/public/v2/assets/images/flags/sx.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sy.svg b/public/v2/assets/images/flags/sy.svg new file mode 100755 index 0000000000..3ab1b13430 --- /dev/null +++ b/public/v2/assets/images/flags/sy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/sz.svg b/public/v2/assets/images/flags/sz.svg new file mode 100755 index 0000000000..0b05d5c81c --- /dev/null +++ b/public/v2/assets/images/flags/sz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tc.svg b/public/v2/assets/images/flags/tc.svg new file mode 100755 index 0000000000..e30c4196c0 --- /dev/null +++ b/public/v2/assets/images/flags/tc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/td.svg b/public/v2/assets/images/flags/td.svg new file mode 100755 index 0000000000..b0aeeeca5c --- /dev/null +++ b/public/v2/assets/images/flags/td.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tf.svg b/public/v2/assets/images/flags/tf.svg new file mode 100755 index 0000000000..effb5adb41 --- /dev/null +++ b/public/v2/assets/images/flags/tf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tg.svg b/public/v2/assets/images/flags/tg.svg new file mode 100755 index 0000000000..40d569d0fc --- /dev/null +++ b/public/v2/assets/images/flags/tg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/th.svg b/public/v2/assets/images/flags/th.svg new file mode 100755 index 0000000000..753a2cedcf --- /dev/null +++ b/public/v2/assets/images/flags/th.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tj.svg b/public/v2/assets/images/flags/tj.svg new file mode 100755 index 0000000000..b605fe7a86 --- /dev/null +++ b/public/v2/assets/images/flags/tj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tk.svg b/public/v2/assets/images/flags/tk.svg new file mode 100755 index 0000000000..570f08e733 --- /dev/null +++ b/public/v2/assets/images/flags/tk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tl.svg b/public/v2/assets/images/flags/tl.svg new file mode 100755 index 0000000000..745064c422 --- /dev/null +++ b/public/v2/assets/images/flags/tl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tm.svg b/public/v2/assets/images/flags/tm.svg new file mode 100755 index 0000000000..368d8ea87c --- /dev/null +++ b/public/v2/assets/images/flags/tm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tn.svg b/public/v2/assets/images/flags/tn.svg new file mode 100755 index 0000000000..e3190c9f15 --- /dev/null +++ b/public/v2/assets/images/flags/tn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/to.svg b/public/v2/assets/images/flags/to.svg new file mode 100755 index 0000000000..ce7f3cf987 --- /dev/null +++ b/public/v2/assets/images/flags/to.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tr.svg b/public/v2/assets/images/flags/tr.svg new file mode 100755 index 0000000000..db16e185c0 --- /dev/null +++ b/public/v2/assets/images/flags/tr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tt.svg b/public/v2/assets/images/flags/tt.svg new file mode 100755 index 0000000000..6c71f86fd2 --- /dev/null +++ b/public/v2/assets/images/flags/tt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tv.svg b/public/v2/assets/images/flags/tv.svg new file mode 100755 index 0000000000..54ca302a70 --- /dev/null +++ b/public/v2/assets/images/flags/tv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tw.svg b/public/v2/assets/images/flags/tw.svg new file mode 100755 index 0000000000..d11ddfca14 --- /dev/null +++ b/public/v2/assets/images/flags/tw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/tz.svg b/public/v2/assets/images/flags/tz.svg new file mode 100755 index 0000000000..b2f7141fc6 --- /dev/null +++ b/public/v2/assets/images/flags/tz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ua.svg b/public/v2/assets/images/flags/ua.svg new file mode 100755 index 0000000000..1186209573 --- /dev/null +++ b/public/v2/assets/images/flags/ua.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ug.svg b/public/v2/assets/images/flags/ug.svg new file mode 100755 index 0000000000..e0ed3c68c7 --- /dev/null +++ b/public/v2/assets/images/flags/ug.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/um.svg b/public/v2/assets/images/flags/um.svg new file mode 100755 index 0000000000..370cd29e9f --- /dev/null +++ b/public/v2/assets/images/flags/um.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/un.svg b/public/v2/assets/images/flags/un.svg new file mode 100755 index 0000000000..e95206b54d --- /dev/null +++ b/public/v2/assets/images/flags/un.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/us.svg b/public/v2/assets/images/flags/us.svg new file mode 100755 index 0000000000..95e707b410 --- /dev/null +++ b/public/v2/assets/images/flags/us.svg @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/public/v2/assets/images/flags/uy.svg b/public/v2/assets/images/flags/uy.svg new file mode 100755 index 0000000000..81fc1f16c3 --- /dev/null +++ b/public/v2/assets/images/flags/uy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/uz.svg b/public/v2/assets/images/flags/uz.svg new file mode 100755 index 0000000000..b63fdbf5d7 --- /dev/null +++ b/public/v2/assets/images/flags/uz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/va.svg b/public/v2/assets/images/flags/va.svg new file mode 100755 index 0000000000..00c9eea4c4 --- /dev/null +++ b/public/v2/assets/images/flags/va.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/vc.svg b/public/v2/assets/images/flags/vc.svg new file mode 100755 index 0000000000..1142809911 --- /dev/null +++ b/public/v2/assets/images/flags/vc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ve.svg b/public/v2/assets/images/flags/ve.svg new file mode 100755 index 0000000000..839a6ccc05 --- /dev/null +++ b/public/v2/assets/images/flags/ve.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/vg.svg b/public/v2/assets/images/flags/vg.svg new file mode 100755 index 0000000000..b46659b3aa --- /dev/null +++ b/public/v2/assets/images/flags/vg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/vi.svg b/public/v2/assets/images/flags/vi.svg new file mode 100755 index 0000000000..e292e17f73 --- /dev/null +++ b/public/v2/assets/images/flags/vi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/vn.svg b/public/v2/assets/images/flags/vn.svg new file mode 100755 index 0000000000..1b546a2947 --- /dev/null +++ b/public/v2/assets/images/flags/vn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/vu.svg b/public/v2/assets/images/flags/vu.svg new file mode 100755 index 0000000000..f9dbd67f12 --- /dev/null +++ b/public/v2/assets/images/flags/vu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/wf.svg b/public/v2/assets/images/flags/wf.svg new file mode 100755 index 0000000000..8a3ced1eb5 --- /dev/null +++ b/public/v2/assets/images/flags/wf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ws.svg b/public/v2/assets/images/flags/ws.svg new file mode 100755 index 0000000000..94f42a09c0 --- /dev/null +++ b/public/v2/assets/images/flags/ws.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/ye.svg b/public/v2/assets/images/flags/ye.svg new file mode 100755 index 0000000000..00e3500ab4 --- /dev/null +++ b/public/v2/assets/images/flags/ye.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/yt.svg b/public/v2/assets/images/flags/yt.svg new file mode 100755 index 0000000000..6c95ad541f --- /dev/null +++ b/public/v2/assets/images/flags/yt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/za.svg b/public/v2/assets/images/flags/za.svg new file mode 100755 index 0000000000..273f48f182 --- /dev/null +++ b/public/v2/assets/images/flags/za.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/zm.svg b/public/v2/assets/images/flags/zm.svg new file mode 100755 index 0000000000..6bb037344a --- /dev/null +++ b/public/v2/assets/images/flags/zm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/flags/zw.svg b/public/v2/assets/images/flags/zw.svg new file mode 100755 index 0000000000..138c53582c --- /dev/null +++ b/public/v2/assets/images/flags/zw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/v2/assets/images/payments/2checkout-dark.svg b/public/v2/assets/images/payments/2checkout-dark.svg new file mode 100755 index 0000000000..c61fb14076 --- /dev/null +++ b/public/v2/assets/images/payments/2checkout-dark.svg @@ -0,0 +1 @@ +2checkout-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/2checkout.svg b/public/v2/assets/images/payments/2checkout.svg new file mode 100755 index 0000000000..6dd6537d43 --- /dev/null +++ b/public/v2/assets/images/payments/2checkout.svg @@ -0,0 +1 @@ +2checkout-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/alipay-dark.svg b/public/v2/assets/images/payments/alipay-dark.svg new file mode 100755 index 0000000000..0959682f80 --- /dev/null +++ b/public/v2/assets/images/payments/alipay-dark.svg @@ -0,0 +1 @@ +AliPay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/alipay.svg b/public/v2/assets/images/payments/alipay.svg new file mode 100755 index 0000000000..8ac60edad6 --- /dev/null +++ b/public/v2/assets/images/payments/alipay.svg @@ -0,0 +1 @@ +AliPay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/amazon-dark.svg b/public/v2/assets/images/payments/amazon-dark.svg new file mode 100755 index 0000000000..1a57e5e8f9 --- /dev/null +++ b/public/v2/assets/images/payments/amazon-dark.svg @@ -0,0 +1 @@ +Amazon-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/amazon.svg b/public/v2/assets/images/payments/amazon.svg new file mode 100755 index 0000000000..9c103a950c --- /dev/null +++ b/public/v2/assets/images/payments/amazon.svg @@ -0,0 +1 @@ +Amazon-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/americanexpress-dark.svg b/public/v2/assets/images/payments/americanexpress-dark.svg new file mode 100755 index 0000000000..574c958300 --- /dev/null +++ b/public/v2/assets/images/payments/americanexpress-dark.svg @@ -0,0 +1 @@ +AmericanExpress-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/americanexpress.svg b/public/v2/assets/images/payments/americanexpress.svg new file mode 100755 index 0000000000..c300f96d78 --- /dev/null +++ b/public/v2/assets/images/payments/americanexpress.svg @@ -0,0 +1 @@ +AmericanExpress-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/applepay-dark.svg b/public/v2/assets/images/payments/applepay-dark.svg new file mode 100755 index 0000000000..9f752f6b98 --- /dev/null +++ b/public/v2/assets/images/payments/applepay-dark.svg @@ -0,0 +1 @@ +ApplePay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/applepay.svg b/public/v2/assets/images/payments/applepay.svg new file mode 100755 index 0000000000..a3bc1c4918 --- /dev/null +++ b/public/v2/assets/images/payments/applepay.svg @@ -0,0 +1 @@ +ApplePay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/bancontact-dark.svg b/public/v2/assets/images/payments/bancontact-dark.svg new file mode 100755 index 0000000000..6b84177a27 --- /dev/null +++ b/public/v2/assets/images/payments/bancontact-dark.svg @@ -0,0 +1 @@ +Bancontact-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/bancontact.svg b/public/v2/assets/images/payments/bancontact.svg new file mode 100755 index 0000000000..4f74650ccc --- /dev/null +++ b/public/v2/assets/images/payments/bancontact.svg @@ -0,0 +1 @@ +Bancontact-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/bitcoin-dark.svg b/public/v2/assets/images/payments/bitcoin-dark.svg new file mode 100755 index 0000000000..5a871ee098 --- /dev/null +++ b/public/v2/assets/images/payments/bitcoin-dark.svg @@ -0,0 +1 @@ +Bitcoin-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/bitcoin.svg b/public/v2/assets/images/payments/bitcoin.svg new file mode 100755 index 0000000000..e0c065614d --- /dev/null +++ b/public/v2/assets/images/payments/bitcoin.svg @@ -0,0 +1 @@ +Bitcoin-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/bitpay-dark.svg b/public/v2/assets/images/payments/bitpay-dark.svg new file mode 100755 index 0000000000..5954891f64 --- /dev/null +++ b/public/v2/assets/images/payments/bitpay-dark.svg @@ -0,0 +1 @@ +Bitpay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/bitpay.svg b/public/v2/assets/images/payments/bitpay.svg new file mode 100755 index 0000000000..965363089d --- /dev/null +++ b/public/v2/assets/images/payments/bitpay.svg @@ -0,0 +1 @@ +Bitpay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/cirrus-dark.svg b/public/v2/assets/images/payments/cirrus-dark.svg new file mode 100755 index 0000000000..28af2a4d48 --- /dev/null +++ b/public/v2/assets/images/payments/cirrus-dark.svg @@ -0,0 +1 @@ +Cirrus-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/cirrus.svg b/public/v2/assets/images/payments/cirrus.svg new file mode 100755 index 0000000000..56160ef86e --- /dev/null +++ b/public/v2/assets/images/payments/cirrus.svg @@ -0,0 +1 @@ +Cirrus-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/clickandbuy-dark.svg b/public/v2/assets/images/payments/clickandbuy-dark.svg new file mode 100755 index 0000000000..6e1473502e --- /dev/null +++ b/public/v2/assets/images/payments/clickandbuy-dark.svg @@ -0,0 +1 @@ +Clickandbuy-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/clickandbuy.svg b/public/v2/assets/images/payments/clickandbuy.svg new file mode 100755 index 0000000000..719fd88224 --- /dev/null +++ b/public/v2/assets/images/payments/clickandbuy.svg @@ -0,0 +1 @@ +Clickandbuy-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/coinkite-dark.svg b/public/v2/assets/images/payments/coinkite-dark.svg new file mode 100755 index 0000000000..019f934e91 --- /dev/null +++ b/public/v2/assets/images/payments/coinkite-dark.svg @@ -0,0 +1 @@ +CoinKite-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/coinkite.svg b/public/v2/assets/images/payments/coinkite.svg new file mode 100755 index 0000000000..b31a1bc42d --- /dev/null +++ b/public/v2/assets/images/payments/coinkite.svg @@ -0,0 +1 @@ +Coinkite-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/dinersclub-dark.svg b/public/v2/assets/images/payments/dinersclub-dark.svg new file mode 100755 index 0000000000..4b15a21079 --- /dev/null +++ b/public/v2/assets/images/payments/dinersclub-dark.svg @@ -0,0 +1 @@ +DinersClub-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/dinersclub.svg b/public/v2/assets/images/payments/dinersclub.svg new file mode 100755 index 0000000000..c907b0d210 --- /dev/null +++ b/public/v2/assets/images/payments/dinersclub.svg @@ -0,0 +1 @@ +DinersClub-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/directdebit-dark.svg b/public/v2/assets/images/payments/directdebit-dark.svg new file mode 100755 index 0000000000..4fcacfa1de --- /dev/null +++ b/public/v2/assets/images/payments/directdebit-dark.svg @@ -0,0 +1 @@ +DirectDebit-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/directdebit.svg b/public/v2/assets/images/payments/directdebit.svg new file mode 100755 index 0000000000..37ad454c56 --- /dev/null +++ b/public/v2/assets/images/payments/directdebit.svg @@ -0,0 +1 @@ +DirectDebit-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/discover-dark.svg b/public/v2/assets/images/payments/discover-dark.svg new file mode 100755 index 0000000000..bb3ca4cbd7 --- /dev/null +++ b/public/v2/assets/images/payments/discover-dark.svg @@ -0,0 +1 @@ +Discover-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/discover.svg b/public/v2/assets/images/payments/discover.svg new file mode 100755 index 0000000000..6e89ad8b4b --- /dev/null +++ b/public/v2/assets/images/payments/discover.svg @@ -0,0 +1 @@ +Discover-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/dwolla-dark.svg b/public/v2/assets/images/payments/dwolla-dark.svg new file mode 100755 index 0000000000..abfbe8e0ec --- /dev/null +++ b/public/v2/assets/images/payments/dwolla-dark.svg @@ -0,0 +1 @@ +Dwolla-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/dwolla.svg b/public/v2/assets/images/payments/dwolla.svg new file mode 100755 index 0000000000..772c084723 --- /dev/null +++ b/public/v2/assets/images/payments/dwolla.svg @@ -0,0 +1 @@ +Dwolla-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ebay-dark.svg b/public/v2/assets/images/payments/ebay-dark.svg new file mode 100755 index 0000000000..19f5fbc1a2 --- /dev/null +++ b/public/v2/assets/images/payments/ebay-dark.svg @@ -0,0 +1 @@ +Ebay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ebay.svg b/public/v2/assets/images/payments/ebay.svg new file mode 100755 index 0000000000..a50f1d131d --- /dev/null +++ b/public/v2/assets/images/payments/ebay.svg @@ -0,0 +1 @@ +Ebay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/eway-dark.svg b/public/v2/assets/images/payments/eway-dark.svg new file mode 100755 index 0000000000..9efc3ab29a --- /dev/null +++ b/public/v2/assets/images/payments/eway-dark.svg @@ -0,0 +1 @@ +Eway-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/eway.svg b/public/v2/assets/images/payments/eway.svg new file mode 100755 index 0000000000..248503bc00 --- /dev/null +++ b/public/v2/assets/images/payments/eway.svg @@ -0,0 +1 @@ +Eway-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/giropay-dark.svg b/public/v2/assets/images/payments/giropay-dark.svg new file mode 100755 index 0000000000..2e074168e1 --- /dev/null +++ b/public/v2/assets/images/payments/giropay-dark.svg @@ -0,0 +1 @@ +GiroPay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/giropay.svg b/public/v2/assets/images/payments/giropay.svg new file mode 100755 index 0000000000..f1da29ce3e --- /dev/null +++ b/public/v2/assets/images/payments/giropay.svg @@ -0,0 +1 @@ +GiroPay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/googlewallet-dark.svg b/public/v2/assets/images/payments/googlewallet-dark.svg new file mode 100755 index 0000000000..49c32a4b8c --- /dev/null +++ b/public/v2/assets/images/payments/googlewallet-dark.svg @@ -0,0 +1 @@ +GoogleWallet-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/googlewallet.svg b/public/v2/assets/images/payments/googlewallet.svg new file mode 100755 index 0000000000..4423d94949 --- /dev/null +++ b/public/v2/assets/images/payments/googlewallet.svg @@ -0,0 +1 @@ +GoogleWallet-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ingenico-dark.svg b/public/v2/assets/images/payments/ingenico-dark.svg new file mode 100755 index 0000000000..ef252951f4 --- /dev/null +++ b/public/v2/assets/images/payments/ingenico-dark.svg @@ -0,0 +1 @@ +Ingenico-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ingenico.svg b/public/v2/assets/images/payments/ingenico.svg new file mode 100755 index 0000000000..03f64bf3d6 --- /dev/null +++ b/public/v2/assets/images/payments/ingenico.svg @@ -0,0 +1 @@ +Ingenico-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/jcb-dark.svg b/public/v2/assets/images/payments/jcb-dark.svg new file mode 100755 index 0000000000..8fcdd6c01d --- /dev/null +++ b/public/v2/assets/images/payments/jcb-dark.svg @@ -0,0 +1 @@ +JCB-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/jcb.svg b/public/v2/assets/images/payments/jcb.svg new file mode 100755 index 0000000000..3ecc08430f --- /dev/null +++ b/public/v2/assets/images/payments/jcb.svg @@ -0,0 +1 @@ +JCB-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/klarna-dark.svg b/public/v2/assets/images/payments/klarna-dark.svg new file mode 100755 index 0000000000..772558a1cd --- /dev/null +++ b/public/v2/assets/images/payments/klarna-dark.svg @@ -0,0 +1 @@ +Klarna-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/klarna.svg b/public/v2/assets/images/payments/klarna.svg new file mode 100755 index 0000000000..47359a383c --- /dev/null +++ b/public/v2/assets/images/payments/klarna.svg @@ -0,0 +1 @@ +Klarna-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/laser-dark.svg b/public/v2/assets/images/payments/laser-dark.svg new file mode 100755 index 0000000000..682534ccb6 --- /dev/null +++ b/public/v2/assets/images/payments/laser-dark.svg @@ -0,0 +1 @@ +Laser-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/laser.svg b/public/v2/assets/images/payments/laser.svg new file mode 100755 index 0000000000..f5754eaa9b --- /dev/null +++ b/public/v2/assets/images/payments/laser.svg @@ -0,0 +1 @@ +Laser-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/maestro-dark.svg b/public/v2/assets/images/payments/maestro-dark.svg new file mode 100755 index 0000000000..2464d396cb --- /dev/null +++ b/public/v2/assets/images/payments/maestro-dark.svg @@ -0,0 +1 @@ +Maestro-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/maestro.svg b/public/v2/assets/images/payments/maestro.svg new file mode 100755 index 0000000000..b18b89e790 --- /dev/null +++ b/public/v2/assets/images/payments/maestro.svg @@ -0,0 +1 @@ +Maestro-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/mastercard-dark.svg b/public/v2/assets/images/payments/mastercard-dark.svg new file mode 100755 index 0000000000..c5062ebcb3 --- /dev/null +++ b/public/v2/assets/images/payments/mastercard-dark.svg @@ -0,0 +1 @@ +MasterCard-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/mastercard.svg b/public/v2/assets/images/payments/mastercard.svg new file mode 100755 index 0000000000..f70f2572ed --- /dev/null +++ b/public/v2/assets/images/payments/mastercard.svg @@ -0,0 +1 @@ +MasterCard-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/monero-dark.svg b/public/v2/assets/images/payments/monero-dark.svg new file mode 100755 index 0000000000..497dd60134 --- /dev/null +++ b/public/v2/assets/images/payments/monero-dark.svg @@ -0,0 +1 @@ +Monero-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/monero.svg b/public/v2/assets/images/payments/monero.svg new file mode 100755 index 0000000000..2a1d434178 --- /dev/null +++ b/public/v2/assets/images/payments/monero.svg @@ -0,0 +1 @@ +Monero-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/neteller-dark.svg b/public/v2/assets/images/payments/neteller-dark.svg new file mode 100755 index 0000000000..f6c76c14c9 --- /dev/null +++ b/public/v2/assets/images/payments/neteller-dark.svg @@ -0,0 +1 @@ +Neteller-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/neteller.svg b/public/v2/assets/images/payments/neteller.svg new file mode 100755 index 0000000000..433e3a1827 --- /dev/null +++ b/public/v2/assets/images/payments/neteller.svg @@ -0,0 +1 @@ +Neteller-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ogone-dark.svg b/public/v2/assets/images/payments/ogone-dark.svg new file mode 100755 index 0000000000..5847469fe1 --- /dev/null +++ b/public/v2/assets/images/payments/ogone-dark.svg @@ -0,0 +1 @@ +Ogone-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ogone.svg b/public/v2/assets/images/payments/ogone.svg new file mode 100755 index 0000000000..dd0e5157ca --- /dev/null +++ b/public/v2/assets/images/payments/ogone.svg @@ -0,0 +1 @@ +Ogone-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/okpay-dark.svg b/public/v2/assets/images/payments/okpay-dark.svg new file mode 100755 index 0000000000..50a22c35e2 --- /dev/null +++ b/public/v2/assets/images/payments/okpay-dark.svg @@ -0,0 +1 @@ +OkPay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/okpay.svg b/public/v2/assets/images/payments/okpay.svg new file mode 100755 index 0000000000..1166728208 --- /dev/null +++ b/public/v2/assets/images/payments/okpay.svg @@ -0,0 +1 @@ +OkPay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paybox-dark.svg b/public/v2/assets/images/payments/paybox-dark.svg new file mode 100755 index 0000000000..464ba31a2f --- /dev/null +++ b/public/v2/assets/images/payments/paybox-dark.svg @@ -0,0 +1 @@ +Paybox-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paybox.svg b/public/v2/assets/images/payments/paybox.svg new file mode 100755 index 0000000000..8ea00796f7 --- /dev/null +++ b/public/v2/assets/images/payments/paybox.svg @@ -0,0 +1 @@ +Paybox-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paymill-dark.svg b/public/v2/assets/images/payments/paymill-dark.svg new file mode 100755 index 0000000000..4c5db48f8e --- /dev/null +++ b/public/v2/assets/images/payments/paymill-dark.svg @@ -0,0 +1 @@ +Paymill-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paymill.svg b/public/v2/assets/images/payments/paymill.svg new file mode 100755 index 0000000000..fc748735cf --- /dev/null +++ b/public/v2/assets/images/payments/paymill.svg @@ -0,0 +1 @@ +Paymill-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payone-dark.svg b/public/v2/assets/images/payments/payone-dark.svg new file mode 100755 index 0000000000..7d65a78b3b --- /dev/null +++ b/public/v2/assets/images/payments/payone-dark.svg @@ -0,0 +1 @@ +Payone-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payone.svg b/public/v2/assets/images/payments/payone.svg new file mode 100755 index 0000000000..a0c70b702d --- /dev/null +++ b/public/v2/assets/images/payments/payone.svg @@ -0,0 +1 @@ +Payone-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payoneer-dark.svg b/public/v2/assets/images/payments/payoneer-dark.svg new file mode 100755 index 0000000000..36b371c264 --- /dev/null +++ b/public/v2/assets/images/payments/payoneer-dark.svg @@ -0,0 +1 @@ +Payoneer-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payoneer.svg b/public/v2/assets/images/payments/payoneer.svg new file mode 100755 index 0000000000..357d0755fa --- /dev/null +++ b/public/v2/assets/images/payments/payoneer.svg @@ -0,0 +1 @@ +Payoneer-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paypal-dark.svg b/public/v2/assets/images/payments/paypal-dark.svg new file mode 100755 index 0000000000..3d613c51b2 --- /dev/null +++ b/public/v2/assets/images/payments/paypal-dark.svg @@ -0,0 +1 @@ +Paypal-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paypal.svg b/public/v2/assets/images/payments/paypal.svg new file mode 100755 index 0000000000..36df6e9550 --- /dev/null +++ b/public/v2/assets/images/payments/paypal.svg @@ -0,0 +1 @@ +Paypal-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paysafecard-dark.svg b/public/v2/assets/images/payments/paysafecard-dark.svg new file mode 100755 index 0000000000..897b7909b3 --- /dev/null +++ b/public/v2/assets/images/payments/paysafecard-dark.svg @@ -0,0 +1 @@ +PaysafeCard-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/paysafecard.svg b/public/v2/assets/images/payments/paysafecard.svg new file mode 100755 index 0000000000..f8ad324dc0 --- /dev/null +++ b/public/v2/assets/images/payments/paysafecard.svg @@ -0,0 +1 @@ +PaysafeCard-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payu-dark.svg b/public/v2/assets/images/payments/payu-dark.svg new file mode 100755 index 0000000000..aef45df2fd --- /dev/null +++ b/public/v2/assets/images/payments/payu-dark.svg @@ -0,0 +1 @@ +PayU-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payu.svg b/public/v2/assets/images/payments/payu.svg new file mode 100755 index 0000000000..9366437578 --- /dev/null +++ b/public/v2/assets/images/payments/payu.svg @@ -0,0 +1 @@ +PayU-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payza-dark.svg b/public/v2/assets/images/payments/payza-dark.svg new file mode 100755 index 0000000000..419fd550b5 --- /dev/null +++ b/public/v2/assets/images/payments/payza-dark.svg @@ -0,0 +1 @@ +Payza-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/payza.svg b/public/v2/assets/images/payments/payza.svg new file mode 100755 index 0000000000..7625243165 --- /dev/null +++ b/public/v2/assets/images/payments/payza.svg @@ -0,0 +1 @@ +Payza-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ripple-dark.svg b/public/v2/assets/images/payments/ripple-dark.svg new file mode 100755 index 0000000000..5fecdd71d4 --- /dev/null +++ b/public/v2/assets/images/payments/ripple-dark.svg @@ -0,0 +1 @@ +Ripple-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ripple.svg b/public/v2/assets/images/payments/ripple.svg new file mode 100755 index 0000000000..62c0b588fc --- /dev/null +++ b/public/v2/assets/images/payments/ripple.svg @@ -0,0 +1 @@ +Ripple-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/sage-dark.svg b/public/v2/assets/images/payments/sage-dark.svg new file mode 100755 index 0000000000..84cff147b3 --- /dev/null +++ b/public/v2/assets/images/payments/sage-dark.svg @@ -0,0 +1 @@ +Sage-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/sage.svg b/public/v2/assets/images/payments/sage.svg new file mode 100755 index 0000000000..11623bdf78 --- /dev/null +++ b/public/v2/assets/images/payments/sage.svg @@ -0,0 +1 @@ +Sage-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/sepa-dark.svg b/public/v2/assets/images/payments/sepa-dark.svg new file mode 100755 index 0000000000..5db63235a4 --- /dev/null +++ b/public/v2/assets/images/payments/sepa-dark.svg @@ -0,0 +1 @@ +Sepa-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/sepa.svg b/public/v2/assets/images/payments/sepa.svg new file mode 100755 index 0000000000..845952a222 --- /dev/null +++ b/public/v2/assets/images/payments/sepa.svg @@ -0,0 +1 @@ +Sepa-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/shopify-dark.svg b/public/v2/assets/images/payments/shopify-dark.svg new file mode 100755 index 0000000000..c0265cd1da --- /dev/null +++ b/public/v2/assets/images/payments/shopify-dark.svg @@ -0,0 +1 @@ +Shopify-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/shopify.svg b/public/v2/assets/images/payments/shopify.svg new file mode 100755 index 0000000000..084fbed860 --- /dev/null +++ b/public/v2/assets/images/payments/shopify.svg @@ -0,0 +1 @@ +Shopify-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/skrill-dark.svg b/public/v2/assets/images/payments/skrill-dark.svg new file mode 100755 index 0000000000..e1008353a4 --- /dev/null +++ b/public/v2/assets/images/payments/skrill-dark.svg @@ -0,0 +1 @@ +Skrill-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/skrill.svg b/public/v2/assets/images/payments/skrill.svg new file mode 100755 index 0000000000..5ad3300b0a --- /dev/null +++ b/public/v2/assets/images/payments/skrill.svg @@ -0,0 +1 @@ +Skrill-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/solo-dark.svg b/public/v2/assets/images/payments/solo-dark.svg new file mode 100755 index 0000000000..bbe6e3b66e --- /dev/null +++ b/public/v2/assets/images/payments/solo-dark.svg @@ -0,0 +1 @@ +Solo-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/solo.svg b/public/v2/assets/images/payments/solo.svg new file mode 100755 index 0000000000..344c23b9f8 --- /dev/null +++ b/public/v2/assets/images/payments/solo.svg @@ -0,0 +1 @@ +Solo-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/square-dark.svg b/public/v2/assets/images/payments/square-dark.svg new file mode 100755 index 0000000000..acfbca9014 --- /dev/null +++ b/public/v2/assets/images/payments/square-dark.svg @@ -0,0 +1 @@ +Square-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/square.svg b/public/v2/assets/images/payments/square.svg new file mode 100755 index 0000000000..e775d86306 --- /dev/null +++ b/public/v2/assets/images/payments/square.svg @@ -0,0 +1 @@ +Square-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/stripe-dark.svg b/public/v2/assets/images/payments/stripe-dark.svg new file mode 100755 index 0000000000..466fd87da1 --- /dev/null +++ b/public/v2/assets/images/payments/stripe-dark.svg @@ -0,0 +1 @@ +Stripe-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/stripe.svg b/public/v2/assets/images/payments/stripe.svg new file mode 100755 index 0000000000..4bafa86cf8 --- /dev/null +++ b/public/v2/assets/images/payments/stripe.svg @@ -0,0 +1 @@ +Stripe-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/switch-dark.svg b/public/v2/assets/images/payments/switch-dark.svg new file mode 100755 index 0000000000..4e8787978b --- /dev/null +++ b/public/v2/assets/images/payments/switch-dark.svg @@ -0,0 +1 @@ +Switch-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/switch.svg b/public/v2/assets/images/payments/switch.svg new file mode 100755 index 0000000000..e4a8e5b088 --- /dev/null +++ b/public/v2/assets/images/payments/switch.svg @@ -0,0 +1 @@ +Switch-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ukash-dark.svg b/public/v2/assets/images/payments/ukash-dark.svg new file mode 100755 index 0000000000..f48a474de1 --- /dev/null +++ b/public/v2/assets/images/payments/ukash-dark.svg @@ -0,0 +1 @@ +Ukash-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/ukash.svg b/public/v2/assets/images/payments/ukash.svg new file mode 100755 index 0000000000..fd22ed2de0 --- /dev/null +++ b/public/v2/assets/images/payments/ukash.svg @@ -0,0 +1 @@ +Ukash-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/unionpay-dark.svg b/public/v2/assets/images/payments/unionpay-dark.svg new file mode 100755 index 0000000000..4665ee938b --- /dev/null +++ b/public/v2/assets/images/payments/unionpay-dark.svg @@ -0,0 +1 @@ +UnionPay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/unionpay.svg b/public/v2/assets/images/payments/unionpay.svg new file mode 100755 index 0000000000..90bdea517b --- /dev/null +++ b/public/v2/assets/images/payments/unionpay.svg @@ -0,0 +1 @@ +UnionPay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/verifone-dark.svg b/public/v2/assets/images/payments/verifone-dark.svg new file mode 100755 index 0000000000..9215cc6df6 --- /dev/null +++ b/public/v2/assets/images/payments/verifone-dark.svg @@ -0,0 +1 @@ +Verifone-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/verifone.svg b/public/v2/assets/images/payments/verifone.svg new file mode 100755 index 0000000000..f7ffab8606 --- /dev/null +++ b/public/v2/assets/images/payments/verifone.svg @@ -0,0 +1 @@ +Verifone-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/verisign-dark.svg b/public/v2/assets/images/payments/verisign-dark.svg new file mode 100755 index 0000000000..2f47d3a3ab --- /dev/null +++ b/public/v2/assets/images/payments/verisign-dark.svg @@ -0,0 +1 @@ +VeriSign-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/verisign.svg b/public/v2/assets/images/payments/verisign.svg new file mode 100755 index 0000000000..a557a0dd4e --- /dev/null +++ b/public/v2/assets/images/payments/verisign.svg @@ -0,0 +1 @@ +VeriSign-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/visa-dark.svg b/public/v2/assets/images/payments/visa-dark.svg new file mode 100755 index 0000000000..95619ac380 --- /dev/null +++ b/public/v2/assets/images/payments/visa-dark.svg @@ -0,0 +1 @@ +Visa-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/visa.svg b/public/v2/assets/images/payments/visa.svg new file mode 100755 index 0000000000..f8d981353e --- /dev/null +++ b/public/v2/assets/images/payments/visa.svg @@ -0,0 +1 @@ +Visa-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/webmoney-dark.svg b/public/v2/assets/images/payments/webmoney-dark.svg new file mode 100755 index 0000000000..ab37c57ab7 --- /dev/null +++ b/public/v2/assets/images/payments/webmoney-dark.svg @@ -0,0 +1 @@ +WebMoney-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/webmoney.svg b/public/v2/assets/images/payments/webmoney.svg new file mode 100755 index 0000000000..c745bffde5 --- /dev/null +++ b/public/v2/assets/images/payments/webmoney.svg @@ -0,0 +1 @@ +WebMoney-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/westernunion-dark.svg b/public/v2/assets/images/payments/westernunion-dark.svg new file mode 100755 index 0000000000..a1826ff69e --- /dev/null +++ b/public/v2/assets/images/payments/westernunion-dark.svg @@ -0,0 +1 @@ +WesternUnion-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/westernunion.svg b/public/v2/assets/images/payments/westernunion.svg new file mode 100755 index 0000000000..5c55f7122e --- /dev/null +++ b/public/v2/assets/images/payments/westernunion.svg @@ -0,0 +1 @@ +WesternUnion-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/worldpay-dark.svg b/public/v2/assets/images/payments/worldpay-dark.svg new file mode 100755 index 0000000000..a1dc42d5da --- /dev/null +++ b/public/v2/assets/images/payments/worldpay-dark.svg @@ -0,0 +1 @@ +WorldPay-darkCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/images/payments/worldpay.svg b/public/v2/assets/images/payments/worldpay.svg new file mode 100755 index 0000000000..d48408b2ee --- /dev/null +++ b/public/v2/assets/images/payments/worldpay.svg @@ -0,0 +1 @@ +WorldPay-lightCreated with Sketch. \ No newline at end of file diff --git a/public/v2/assets/js/core.js b/public/v2/assets/js/core.js new file mode 100755 index 0000000000..6333a12aa7 --- /dev/null +++ b/public/v2/assets/js/core.js @@ -0,0 +1,107 @@ +/** + * + */ +let hexToRgba = function(hex, opacity) { + let result = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i.exec(hex); + let rgb = result ? { + r: parseInt(result[1], 16), + g: parseInt(result[2], 16), + b: parseInt(result[3], 16) + } : null; + + return 'rgba(' + rgb.r + ', ' + rgb.g + ', ' + rgb.b + ', ' + opacity + ')'; +}; + +/** + * + */ +$(document).ready(function() { + /** Constant div card */ + const DIV_CARD = 'div.card'; + + /** Initialize tooltips */ + $('[data-toggle="tooltip"]').tooltip(); + + /** Initialize popovers */ + $('[data-toggle="popover"]').popover({ + html: true + }); + + /** Function for remove card */ + $('[data-toggle="card-remove"]').on('click', function(e) { + let $card = $(this).closest(DIV_CARD); + + $card.remove(); + + e.preventDefault(); + return false; + }); + + /** Function for collapse card */ + $('[data-toggle="card-collapse"]').on('click', function(e) { + let $card = $(this).closest(DIV_CARD); + + $card.toggleClass('card-collapsed'); + + e.preventDefault(); + return false; + }); + + /** Function for fullscreen card */ + $('[data-toggle="card-fullscreen"]').on('click', function(e) { + let $card = $(this).closest(DIV_CARD); + + $card.toggleClass('card-fullscreen').removeClass('card-collapsed'); + + e.preventDefault(); + return false; + }); + + /** */ + if ($('[data-sparkline]').length) { + let generateSparkline = function($elem, data, params) { + $elem.sparkline(data, { + type: $elem.attr('data-sparkline-type'), + height: '100%', + barColor: params.color, + lineColor: params.color, + fillColor: 'transparent', + spotColor: params.color, + spotRadius: 0, + lineWidth: 2, + highlightColor: hexToRgba(params.color, .6), + highlightLineColor: '#666', + defaultPixelsPerValue: 5 + }); + }; + + require(['sparkline'], function() { + $('[data-sparkline]').each(function() { + let $chart = $(this); + + generateSparkline($chart, JSON.parse($chart.attr('data-sparkline')), { + color: $chart.attr('data-sparkline-color') + }); + }); + }); + } + + /** */ + if ($('.chart-circle').length) { + require(['circle-progress'], function() { + $('.chart-circle').each(function() { + let $this = $(this); + + $this.circleProgress({ + fill: { + color: tabler.colors[$this.attr('data-color')] || tabler.colors.blue + }, + size: $this.height(), + startAngle: -Math.PI / 4 * 2, + emptyFill: '#F4F4F4', + lineCap: 'round' + }); + }); + }); + } +}); \ No newline at end of file diff --git a/public/v2/assets/js/dashboard.js b/public/v2/assets/js/dashboard.js new file mode 100755 index 0000000000..32bf37853f --- /dev/null +++ b/public/v2/assets/js/dashboard.js @@ -0,0 +1,126 @@ +require.config({ +shim: { +'bootstrap': ['jquery'], +'sparkline': ['jquery'], +'tablesorter': ['jquery'], +'vector-map': ['jquery'], +'vector-map-de': ['vector-map', 'jquery'], +'vector-map-world': ['vector-map', 'jquery'], +'core': ['bootstrap', 'jquery'], +}, +paths: { +'core': 'assets/js/core', +'jquery': 'assets/js/vendors/jquery-3.2.1.min', +'bootstrap': 'assets/js/vendors/bootstrap.bundle.min', +'sparkline': 'assets/js/vendors/jquery.sparkline.min', +'selectize': 'assets/js/vendors/selectize.min', +'tablesorter': 'assets/js/vendors/jquery.tablesorter.min', +'vector-map': 'assets/js/vendors/jquery-jvectormap-2.0.3.min', +'vector-map-de': 'assets/js/vendors/jquery-jvectormap-de-merc', +'vector-map-world': 'assets/js/vendors/jquery-jvectormap-world-mill', +'circle-progress': 'assets/js/vendors/circle-progress.min', +} +}); +window.tabler = { +colors: { +'blue': '#467fcf', +'blue-darkest': '#0e1929', +'blue-darker': '#1c3353', +'blue-dark': '#3866a6', +'blue-light': '#7ea5dd', +'blue-lighter': '#c8d9f1', +'blue-lightest': '#edf2fa', +'azure': '#45aaf2', +'azure-darkest': '#0e2230', +'azure-darker': '#1c4461', +'azure-dark': '#3788c2', +'azure-light': '#7dc4f6', +'azure-lighter': '#c7e6fb', +'azure-lightest': '#ecf7fe', +'indigo': '#6574cd', +'indigo-darkest': '#141729', +'indigo-darker': '#282e52', +'indigo-dark': '#515da4', +'indigo-light': '#939edc', +'indigo-lighter': '#d1d5f0', +'indigo-lightest': '#f0f1fa', +'purple': '#a55eea', +'purple-darkest': '#21132f', +'purple-darker': '#42265e', +'purple-dark': '#844bbb', +'purple-light': '#c08ef0', +'purple-lighter': '#e4cff9', +'purple-lightest': '#f6effd', +'pink': '#f66d9b', +'pink-darkest': '#31161f', +'pink-darker': '#622c3e', +'pink-dark': '#c5577c', +'pink-light': '#f999b9', +'pink-lighter': '#fcd3e1', +'pink-lightest': '#fef0f5', +'red': '#e74c3c', +'red-darkest': '#2e0f0c', +'red-darker': '#5c1e18', +'red-dark': '#b93d30', +'red-light': '#ee8277', +'red-lighter': '#f8c9c5', +'red-lightest': '#fdedec', +'orange': '#fd9644', +'orange-darkest': '#331e0e', +'orange-darker': '#653c1b', +'orange-dark': '#ca7836', +'orange-light': '#feb67c', +'orange-lighter': '#fee0c7', +'orange-lightest': '#fff5ec', +'yellow': '#f1c40f', +'yellow-darkest': '#302703', +'yellow-darker': '#604e06', +'yellow-dark': '#c19d0c', +'yellow-light': '#f5d657', +'yellow-lighter': '#fbedb7', +'yellow-lightest': '#fef9e7', +'lime': '#7bd235', +'lime-darkest': '#192a0b', +'lime-darker': '#315415', +'lime-dark': '#62a82a', +'lime-light': '#a3e072', +'lime-lighter': '#d7f2c2', +'lime-lightest': '#f2fbeb', +'green': '#5eba00', +'green-darkest': '#132500', +'green-darker': '#264a00', +'green-dark': '#4b9500', +'green-light': '#8ecf4d', +'green-lighter': '#cfeab3', +'green-lightest': '#eff8e6', +'teal': '#2bcbba', +'teal-darkest': '#092925', +'teal-darker': '#11514a', +'teal-dark': '#22a295', +'teal-light': '#6bdbcf', +'teal-lighter': '#bfefea', +'teal-lightest': '#eafaf8', +'cyan': '#17a2b8', +'cyan-darkest': '#052025', +'cyan-darker': '#09414a', +'cyan-dark': '#128293', +'cyan-light': '#5dbecd', +'cyan-lighter': '#b9e3ea', +'cyan-lightest': '#e8f6f8', +'gray': '#868e96', +'gray-darkest': '#1b1c1e', +'gray-darker': '#36393c', +'gray-dark': '#6b7278', +'gray-light': '#aab0b6', +'gray-lighter': '#dbdde0', +'gray-lightest': '#f3f4f5', +'gray-dark': '#343a40', +'gray-dark-darkest': '#0a0c0d', +'gray-dark-darker': '#15171a', +'gray-dark-dark': '#2a2e33', +'gray-dark-light': '#717579', +'gray-dark-lighter': '#c2c4c6', +'gray-dark-lightest': '#ebebec' +} +}; +require(['core']); \ No newline at end of file diff --git a/public/v2/assets/js/require.min.js b/public/v2/assets/js/require.min.js new file mode 100755 index 0000000000..a3ca583b90 --- /dev/null +++ b/public/v2/assets/js/require.min.js @@ -0,0 +1,5 @@ +/** vim: et:ts=4:sw=4:sts=4 + * @license RequireJS 2.3.5 Copyright jQuery Foundation and other contributors. + * Released under MIT license, https://github.com/requirejs/requirejs/blob/master/LICENSE + */ +var requirejs,require,define;!function(global,setTimeout){function commentReplace(e,t){return t||""}function isFunction(e){return"[object Function]"===ostring.call(e)}function isArray(e){return"[object Array]"===ostring.call(e)}function each(e,t){if(e){var i;for(i=0;i-1&&(!e[i]||!t(e[i],i,e));i-=1);}}function hasProp(e,t){return hasOwn.call(e,t)}function getOwn(e,t){return hasProp(e,t)&&e[t]}function eachProp(e,t){var i;for(i in e)if(hasProp(e,i)&&t(e[i],i))break}function mixin(e,t,i,r){return t&&eachProp(t,function(t,n){!i&&hasProp(e,n)||(!r||"object"!=typeof t||!t||isArray(t)||isFunction(t)||t instanceof RegExp?e[n]=t:(e[n]||(e[n]={}),mixin(e[n],t,i,r)))}),e}function bind(e,t){return function(){return t.apply(e,arguments)}}function scripts(){return document.getElementsByTagName("script")}function defaultOnError(e){throw e}function getGlobal(e){if(!e)return e;var t=global;return each(e.split("."),function(e){t=t[e]}),t}function makeError(e,t,i,r){var n=new Error(t+"\nhttp://requirejs.org/docs/errors.html#"+e);return n.requireType=e,n.requireModules=r,i&&(n.originalError=i),n}function newContext(e){function t(e){var t,i;for(t=0;t0&&(e.splice(t-1,2),t-=2)}}function i(e,i,r){var n,o,a,s,u,c,d,p,f,l,h=i&&i.split("/"),m=y.map,g=m&&m["*"];if(e&&(c=(e=e.split("/")).length-1,y.nodeIdCompat&&jsSuffixRegExp.test(e[c])&&(e[c]=e[c].replace(jsSuffixRegExp,"")),"."===e[0].charAt(0)&&h&&(e=h.slice(0,h.length-1).concat(e)),t(e),e=e.join("/")),r&&m&&(h||g)){e:for(a=(o=e.split("/")).length;a>0;a-=1){if(u=o.slice(0,a).join("/"),h)for(s=h.length;s>0;s-=1)if((n=getOwn(m,h.slice(0,s).join("/")))&&(n=getOwn(n,u))){d=n,p=a;break e}!f&&g&&getOwn(g,u)&&(f=getOwn(g,u),l=a)}!d&&f&&(d=f,p=l),d&&(o.splice(0,p,d),e=o.join("/"))}return getOwn(y.pkgs,e)||e}function r(e){isBrowser&&each(scripts(),function(t){if(t.getAttribute("data-requiremodule")===e&&t.getAttribute("data-requirecontext")===q.contextName)return t.parentNode.removeChild(t),!0})}function n(e){var t=getOwn(y.paths,e);if(t&&isArray(t)&&t.length>1)return t.shift(),q.require.undef(e),q.makeRequire(null,{skipMap:!0})([e]),!0}function o(e){var t,i=e?e.indexOf("!"):-1;return i>-1&&(t=e.substring(0,i),e=e.substring(i+1,e.length)),[t,e]}function a(e,t,r,n){var a,s,u,c,d=null,p=t?t.name:null,f=e,l=!0,h="";return e||(l=!1,e="_@r"+(T+=1)),c=o(e),d=c[0],e=c[1],d&&(d=i(d,p,n),s=getOwn(j,d)),e&&(d?h=r?e:s&&s.normalize?s.normalize(e,function(e){return i(e,p,n)}):-1===e.indexOf("!")?i(e,p,n):e:(d=(c=o(h=i(e,p,n)))[0],h=c[1],r=!0,a=q.nameToUrl(h))),u=!d||s||r?"":"_unnormalized"+(A+=1),{prefix:d,name:h,parentMap:t,unnormalized:!!u,url:a,originalName:f,isDefine:l,id:(d?d+"!"+h:h)+u}}function s(e){var t=e.id,i=getOwn(S,t);return i||(i=S[t]=new q.Module(e)),i}function u(e,t,i){var r=e.id,n=getOwn(S,r);!hasProp(j,r)||n&&!n.defineEmitComplete?(n=s(e)).error&&"error"===t?i(n.error):n.on(t,i):"defined"===t&&i(j[r])}function c(e,t){var i=e.requireModules,r=!1;t?t(e):(each(i,function(t){var i=getOwn(S,t);i&&(i.error=e,i.events.error&&(r=!0,i.emit("error",e)))}),r||req.onError(e))}function d(){globalDefQueue.length&&(each(globalDefQueue,function(e){var t=e[0];"string"==typeof t&&(q.defQueueMap[t]=!0),O.push(e)}),globalDefQueue=[])}function p(e){delete S[e],delete k[e]}function f(e,t,i){var r=e.map.id;e.error?e.emit("error",e.error):(t[r]=!0,each(e.depMaps,function(r,n){var o=r.id,a=getOwn(S,o);!a||e.depMatched[n]||i[o]||(getOwn(t,o)?(e.defineDep(n,j[o]),e.check()):f(a,t,i))}),i[r]=!0)}function l(){var e,t,i=1e3*y.waitSeconds,o=i&&q.startTime+i<(new Date).getTime(),a=[],s=[],u=!1,d=!0;if(!x){if(x=!0,eachProp(k,function(e){var i=e.map,c=i.id;if(e.enabled&&(i.isDefine||s.push(e),!e.error))if(!e.inited&&o)n(c)?(t=!0,u=!0):(a.push(c),r(c));else if(!e.inited&&e.fetched&&i.isDefine&&(u=!0,!i.prefix))return d=!1}),o&&a.length)return e=makeError("timeout","Load timeout for modules: "+a,null,a),e.contextName=q.contextName,c(e);d&&each(s,function(e){f(e,{},{})}),o&&!t||!u||!isBrowser&&!isWebWorker||w||(w=setTimeout(function(){w=0,l()},50)),x=!1}}function h(e){hasProp(j,e[0])||s(a(e[0],null,!0)).init(e[1],e[2])}function m(e,t,i,r){e.detachEvent&&!isOpera?r&&e.detachEvent(r,t):e.removeEventListener(i,t,!1)}function g(e){var t=e.currentTarget||e.srcElement;return m(t,q.onScriptLoad,"load","onreadystatechange"),m(t,q.onScriptError,"error"),{node:t,id:t&&t.getAttribute("data-requiremodule")}}function v(){var e;for(d();O.length;){if(null===(e=O.shift())[0])return c(makeError("mismatch","Mismatched anonymous define() module: "+e[e.length-1]));h(e)}q.defQueueMap={}}var x,b,q,E,w,y={waitSeconds:7,baseUrl:"./",paths:{},bundles:{},pkgs:{},shim:{},config:{}},S={},k={},M={},O=[],j={},P={},R={},T=1,A=1;return E={require:function(e){return e.require?e.require:e.require=q.makeRequire(e.map)},exports:function(e){if(e.usingExports=!0,e.map.isDefine)return e.exports?j[e.map.id]=e.exports:e.exports=j[e.map.id]={}},module:function(e){return e.module?e.module:e.module={id:e.map.id,uri:e.map.url,config:function(){return getOwn(y.config,e.map.id)||{}},exports:e.exports||(e.exports={})}}},b=function(e){this.events=getOwn(M,e.id)||{},this.map=e,this.shim=getOwn(y.shim,e.id),this.depExports=[],this.depMaps=[],this.depMatched=[],this.pluginMaps={},this.depCount=0},b.prototype={init:function(e,t,i,r){r=r||{},this.inited||(this.factory=t,i?this.on("error",i):this.events.error&&(i=bind(this,function(e){this.emit("error",e)})),this.depMaps=e&&e.slice(0),this.errback=i,this.inited=!0,this.ignore=r.ignore,r.enabled||this.enabled?this.enable():this.check())},defineDep:function(e,t){this.depMatched[e]||(this.depMatched[e]=!0,this.depCount-=1,this.depExports[e]=t)},fetch:function(){if(!this.fetched){this.fetched=!0,q.startTime=(new Date).getTime();var e=this.map;if(!this.shim)return e.prefix?this.callPlugin():this.load();q.makeRequire(this.map,{enableBuildCallback:!0})(this.shim.deps||[],bind(this,function(){return e.prefix?this.callPlugin():this.load()}))}},load:function(){var e=this.map.url;P[e]||(P[e]=!0,q.load(this.map.id,e))},check:function(){if(this.enabled&&!this.enabling){var e,t,i=this.map.id,r=this.depExports,n=this.exports,o=this.factory;if(this.inited){if(this.error)this.emit("error",this.error);else if(!this.defining){if(this.defining=!0,this.depCount<1&&!this.defined){if(isFunction(o)){if(this.events.error&&this.map.isDefine||req.onError!==defaultOnError)try{n=q.execCb(i,o,r,n)}catch(t){e=t}else n=q.execCb(i,o,r,n);if(this.map.isDefine&&void 0===n&&((t=this.module)?n=t.exports:this.usingExports&&(n=this.exports)),e)return e.requireMap=this.map,e.requireModules=this.map.isDefine?[this.map.id]:null,e.requireType=this.map.isDefine?"define":"require",c(this.error=e)}else n=o;if(this.exports=n,this.map.isDefine&&!this.ignore&&(j[i]=n,req.onResourceLoad)){var a=[];each(this.depMaps,function(e){a.push(e.normalizedMap||e)}),req.onResourceLoad(q,this.map,a)}p(i),this.defined=!0}this.defining=!1,this.defined&&!this.defineEmitted&&(this.defineEmitted=!0,this.emit("defined",this.exports),this.defineEmitComplete=!0)}}else hasProp(q.defQueueMap,i)||this.fetch()}},callPlugin:function(){var e=this.map,t=e.id,r=a(e.prefix);this.depMaps.push(r),u(r,"defined",bind(this,function(r){var n,o,d,f=getOwn(R,this.map.id),l=this.map.name,h=this.map.parentMap?this.map.parentMap.name:null,m=q.makeRequire(e.parentMap,{enableBuildCallback:!0});return this.map.unnormalized?(r.normalize&&(l=r.normalize(l,function(e){return i(e,h,!0)})||""),o=a(e.prefix+"!"+l,this.map.parentMap,!0),u(o,"defined",bind(this,function(e){this.map.normalizedMap=o,this.init([],function(){return e},null,{enabled:!0,ignore:!0})})),void((d=getOwn(S,o.id))&&(this.depMaps.push(o),this.events.error&&d.on("error",bind(this,function(e){this.emit("error",e)})),d.enable()))):f?(this.map.url=q.nameToUrl(f),void this.load()):((n=bind(this,function(e){this.init([],function(){return e},null,{enabled:!0})})).error=bind(this,function(e){this.inited=!0,this.error=e,e.requireModules=[t],eachProp(S,function(e){0===e.map.id.indexOf(t+"_unnormalized")&&p(e.map.id)}),c(e)}),n.fromText=bind(this,function(i,r){var o=e.name,u=a(o),d=useInteractive;r&&(i=r),d&&(useInteractive=!1),s(u),hasProp(y.config,t)&&(y.config[o]=y.config[t]);try{req.exec(i)}catch(e){return c(makeError("fromtexteval","fromText eval for "+t+" failed: "+e,e,[t]))}d&&(useInteractive=!0),this.depMaps.push(u),q.completeLoad(o),m([o],n)}),void r.load(e.name,m,n,y))})),q.enable(r,this),this.pluginMaps[r.id]=r},enable:function(){k[this.map.id]=this,this.enabled=!0,this.enabling=!0,each(this.depMaps,bind(this,function(e,t){var i,r,n;if("string"==typeof e){if(e=a(e,this.map.isDefine?this.map:this.map.parentMap,!1,!this.skipMap),this.depMaps[t]=e,n=getOwn(E,e.id))return void(this.depExports[t]=n(this));this.depCount+=1,u(e,"defined",bind(this,function(e){this.undefed||(this.defineDep(t,e),this.check())})),this.errback?u(e,"error",bind(this,this.errback)):this.events.error&&u(e,"error",bind(this,function(e){this.emit("error",e)}))}i=e.id,r=S[i],hasProp(E,i)||!r||r.enabled||q.enable(e,this)})),eachProp(this.pluginMaps,bind(this,function(e){var t=getOwn(S,e.id);t&&!t.enabled&&q.enable(e,this)})),this.enabling=!1,this.check()},on:function(e,t){var i=this.events[e];i||(i=this.events[e]=[]),i.push(t)},emit:function(e,t){each(this.events[e],function(e){e(t)}),"error"===e&&delete this.events[e]}},q={config:y,contextName:e,registry:S,defined:j,urlFetched:P,defQueue:O,defQueueMap:{},Module:b,makeModuleMap:a,nextTick:req.nextTick,onError:c,configure:function(e){if(e.baseUrl&&"/"!==e.baseUrl.charAt(e.baseUrl.length-1)&&(e.baseUrl+="/"),"string"==typeof e.urlArgs){var t=e.urlArgs;e.urlArgs=function(e,i){return(-1===i.indexOf("?")?"?":"&")+t}}var i=y.shim,r={paths:!0,bundles:!0,config:!0,map:!0};eachProp(e,function(e,t){r[t]?(y[t]||(y[t]={}),mixin(y[t],e,!0,!0)):y[t]=e}),e.bundles&&eachProp(e.bundles,function(e,t){each(e,function(e){e!==t&&(R[e]=t)})}),e.shim&&(eachProp(e.shim,function(e,t){isArray(e)&&(e={deps:e}),!e.exports&&!e.init||e.exportsFn||(e.exportsFn=q.makeShimExports(e)),i[t]=e}),y.shim=i),e.packages&&each(e.packages,function(e){var t;t=(e="string"==typeof e?{name:e}:e).name,e.location&&(y.paths[t]=e.location),y.pkgs[t]=e.name+"/"+(e.main||"main").replace(currDirRegExp,"").replace(jsSuffixRegExp,"")}),eachProp(S,function(e,t){e.inited||e.map.unnormalized||(e.map=a(t,null,!0))}),(e.deps||e.callback)&&q.require(e.deps||[],e.callback)},makeShimExports:function(e){return function(){var t;return e.init&&(t=e.init.apply(global,arguments)),t||e.exports&&getGlobal(e.exports)}},makeRequire:function(t,n){function o(i,r,u){var d,p,f;return n.enableBuildCallback&&r&&isFunction(r)&&(r.__requireJsBuild=!0),"string"==typeof i?isFunction(r)?c(makeError("requireargs","Invalid require call"),u):t&&hasProp(E,i)?E[i](S[t.id]):req.get?req.get(q,i,t,o):(p=a(i,t,!1,!0),d=p.id,hasProp(j,d)?j[d]:c(makeError("notloaded",'Module name "'+d+'" has not been loaded yet for context: '+e+(t?"":". Use require([])")))):(v(),q.nextTick(function(){v(),(f=s(a(null,t))).skipMap=n.skipMap,f.init(i,r,u,{enabled:!0}),l()}),o)}return n=n||{},mixin(o,{isBrowser:isBrowser,toUrl:function(e){var r,n=e.lastIndexOf("."),o=e.split("/")[0],a="."===o||".."===o;return-1!==n&&(!a||n>1)&&(r=e.substring(n,e.length),e=e.substring(0,n)),q.nameToUrl(i(e,t&&t.id,!0),r,!0)},defined:function(e){return hasProp(j,a(e,t,!1,!0).id)},specified:function(e){return e=a(e,t,!1,!0).id,hasProp(j,e)||hasProp(S,e)}}),t||(o.undef=function(e){d();var i=a(e,t,!0),n=getOwn(S,e);n.undefed=!0,r(e),delete j[e],delete P[i.url],delete M[e],eachReverse(O,function(t,i){t[0]===e&&O.splice(i,1)}),delete q.defQueueMap[e],n&&(n.events.defined&&(M[e]=n.events),p(e))}),o},enable:function(e){getOwn(S,e.id)&&s(e).enable()},completeLoad:function(e){var t,i,r,o=getOwn(y.shim,e)||{},a=o.exports;for(d();O.length;){if(null===(i=O.shift())[0]){if(i[0]=e,t)break;t=!0}else i[0]===e&&(t=!0);h(i)}if(q.defQueueMap={},r=getOwn(S,e),!t&&!hasProp(j,e)&&r&&!r.inited){if(!(!y.enforceDefine||a&&getGlobal(a)))return n(e)?void 0:c(makeError("nodefine","No define call for "+e,null,[e]));h([e,o.deps||[],o.exportsFn])}l()},nameToUrl:function(e,t,i){var r,n,o,a,s,u,c,d=getOwn(y.pkgs,e);if(d&&(e=d),c=getOwn(R,e))return q.nameToUrl(c,t,i);if(req.jsExtRegExp.test(e))s=e+(t||"");else{for(r=y.paths,o=(n=e.split("/")).length;o>0;o-=1)if(a=n.slice(0,o).join("/"),u=getOwn(r,a)){isArray(u)&&(u=u[0]),n.splice(0,o,u);break}s=n.join("/"),s=("/"===(s+=t||(/^data\:|^blob\:|\?/.test(s)||i?"":".js")).charAt(0)||s.match(/^[\w\+\.\-]+:/)?"":y.baseUrl)+s}return y.urlArgs&&!/^blob\:/.test(s)?s+y.urlArgs(e,s):s},load:function(e,t){req.load(q,e,t)},execCb:function(e,t,i,r){return t.apply(r,i)},onScriptLoad:function(e){if("load"===e.type||readyRegExp.test((e.currentTarget||e.srcElement).readyState)){interactiveScript=null;var t=g(e);q.completeLoad(t.id)}},onScriptError:function(e){var t=g(e);if(!n(t.id)){var i=[];return eachProp(S,function(e,r){0!==r.indexOf("_@r")&&each(e.depMaps,function(e){if(e.id===t.id)return i.push(r),!0})}),c(makeError("scripterror",'Script error for "'+t.id+(i.length?'", needed by: '+i.join(", "):'"'),e,[t.id]))}}},q.require=q.makeRequire(),q}function getInteractiveScript(){return interactiveScript&&"interactive"===interactiveScript.readyState?interactiveScript:(eachReverse(scripts(),function(e){if("interactive"===e.readyState)return interactiveScript=e}),interactiveScript)}var req,s,head,baseElement,dataMain,src,interactiveScript,currentlyAddingScript,mainScript,subPath,version="2.3.5",commentRegExp=/\/\*[\s\S]*?\*\/|([^:"'=]|^)\/\/.*$/gm,cjsRequireRegExp=/[^.]\s*require\s*\(\s*["']([^'"\s]+)["']\s*\)/g,jsSuffixRegExp=/\.js$/,currDirRegExp=/^\.\//,op=Object.prototype,ostring=op.toString,hasOwn=op.hasOwnProperty,isBrowser=!("undefined"==typeof window||"undefined"==typeof navigator||!window.document),isWebWorker=!isBrowser&&"undefined"!=typeof importScripts,readyRegExp=isBrowser&&"PLAYSTATION 3"===navigator.platform?/^complete$/:/^(complete|loaded)$/,defContextName="_",isOpera="undefined"!=typeof opera&&"[object Opera]"===opera.toString(),contexts={},cfg={},globalDefQueue=[],useInteractive=!1;if(void 0===define){if(void 0!==requirejs){if(isFunction(requirejs))return;cfg=requirejs,requirejs=void 0}void 0===require||isFunction(require)||(cfg=require,require=void 0),req=requirejs=function(e,t,i,r){var n,o,a=defContextName;return isArray(e)||"string"==typeof e||(o=e,isArray(t)?(e=t,t=i,i=r):e=[]),o&&o.context&&(a=o.context),(n=getOwn(contexts,a))||(n=contexts[a]=req.s.newContext(a)),o&&n.configure(o),n.require(e,t,i)},req.config=function(e){return req(e)},req.nextTick=void 0!==setTimeout?function(e){setTimeout(e,4)}:function(e){e()},require||(require=req),req.version=version,req.jsExtRegExp=/^\/|:|\?|\.js$/,req.isBrowser=isBrowser,s=req.s={contexts:contexts,newContext:newContext},req({}),each(["toUrl","undef","defined","specified"],function(e){req[e]=function(){var t=contexts[defContextName];return t.require[e].apply(t,arguments)}}),isBrowser&&(head=s.head=document.getElementsByTagName("head")[0],(baseElement=document.getElementsByTagName("base")[0])&&(head=s.head=baseElement.parentNode)),req.onError=defaultOnError,req.createNode=function(e,t,i){var r=e.xhtml?document.createElementNS("http://www.w3.org/1999/xhtml","html:script"):document.createElement("script");return r.type=e.scriptType||"text/javascript",r.charset="utf-8",r.async=!0,r},req.load=function(e,t,i){var r,n=e&&e.config||{};if(isBrowser)return(r=req.createNode(n,t,i)).setAttribute("data-requirecontext",e.contextName),r.setAttribute("data-requiremodule",t),!r.attachEvent||r.attachEvent.toString&&r.attachEvent.toString().indexOf("[native code")<0||isOpera?(r.addEventListener("load",e.onScriptLoad,!1),r.addEventListener("error",e.onScriptError,!1)):(useInteractive=!0,r.attachEvent("onreadystatechange",e.onScriptLoad)),r.src=i,n.onNodeCreated&&n.onNodeCreated(r,n,t,i),currentlyAddingScript=r,baseElement?head.insertBefore(r,baseElement):head.appendChild(r),currentlyAddingScript=null,r;if(isWebWorker)try{setTimeout(function(){},0),importScripts(i),e.completeLoad(t)}catch(r){e.onError(makeError("importscripts","importScripts failed for "+t+" at "+i,r,[t]))}},isBrowser&&!cfg.skipDataMain&&eachReverse(scripts(),function(e){if(head||(head=e.parentNode),dataMain=e.getAttribute("data-main"))return mainScript=dataMain,cfg.baseUrl||-1!==mainScript.indexOf("!")||(src=mainScript.split("/"),mainScript=src.pop(),subPath=src.length?src.join("/")+"/":"./",cfg.baseUrl=subPath),mainScript=mainScript.replace(jsSuffixRegExp,""),req.jsExtRegExp.test(mainScript)&&(mainScript=dataMain),cfg.deps=cfg.deps?cfg.deps.concat(mainScript):[mainScript],!0}),define=function(e,t,i){var r,n;"string"!=typeof e&&(i=t,t=e,e=null),isArray(t)||(i=t,t=null),!t&&isFunction(i)&&(t=[],i.length&&(i.toString().replace(commentRegExp,commentReplace).replace(cjsRequireRegExp,function(e,i){t.push(i)}),t=(1===i.length?["require"]:["require","exports","module"]).concat(t))),useInteractive&&(r=currentlyAddingScript||getInteractiveScript())&&(e||(e=r.getAttribute("data-requiremodule")),n=contexts[r.getAttribute("data-requirecontext")]),n?(n.defQueue.push([e,t,i]),n.defQueueMap[e]=!0):globalDefQueue.push([e,t,i])},define.amd={jQuery:!0},req.exec=function(text){return eval(text)},req(cfg)}}(this,"undefined"==typeof setTimeout?void 0:setTimeout); \ No newline at end of file diff --git a/public/v2/assets/js/vendors/bootstrap.bundle.min.js b/public/v2/assets/js/vendors/bootstrap.bundle.min.js new file mode 100755 index 0000000000..be7336ad37 --- /dev/null +++ b/public/v2/assets/js/vendors/bootstrap.bundle.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v4.0.0 (https://getbootstrap.com) + * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function n(t,e){for(var n=0;n0?n:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var r in n)if(Object.prototype.hasOwnProperty.call(n,r)){var o=n[r],s=e[r],a=s&&i.isElement(s)?"element":(l=s,{}.toString.call(l).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(t.toUpperCase()+': Option "'+r+'" provided type "'+a+'" but expected type "'+o+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e=e&&e.hasOwnProperty("default")?e.default:e),mt=(s="alert",l="."+(a="bs.alert"),c=(o=e).fn[s],h={CLOSE:"close"+l,CLOSED:"closed"+l,CLICK_DATA_API:"click"+l+".data-api"},f="alert",u="fade",d="show",p=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,a),this._element=null},e._getRootElement=function(t){var e=gt.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(h.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(d),gt.supportsTransitionEnd()&&o(t).hasClass(u)?o(t).one(gt.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(h.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(a);i||(i=new t(this),n.data(a,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),o.fn[s]=p._jQueryInterface,o.fn[s].Constructor=p,o.fn[s].noConflict=function(){return o.fn[s]=c,p._jQueryInterface},p),_t=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",C="focus",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',A="input",D=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:"focus"+v+E+" blur"+v+E},N=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(A)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(D)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},e.dispose=function(){g.removeData(this._element,_),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=g(this).data(_);n||(n=new t(this),g(this).data(_,n)),"toggle"===e&&n[e]()})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)||(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),vt=(L="carousel",x="."+(P="bs.carousel"),R=".data-api",j=(k=e).fn[L],H={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},M={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},W="next",U="prev",F="left",B="right",K={SLIDE:"slide"+x,SLID:"slid"+x,KEYDOWN:"keydown"+x,MOUSEENTER:"mouseenter"+x,MOUSELEAVE:"mouseleave"+x,TOUCHEND:"touchend"+x,LOAD_DATA_API:"load"+x+R,CLICK_DATA_API:"click"+x+R},V="carousel",Q="active",Y="slide",G="carousel-item-right",q="carousel-item-left",z="carousel-item-next",X="carousel-item-prev",J={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},Z=function(){function t(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(e),this._element=k(t)[0],this._indicatorsElement=k(this._element).find(J.INDICATORS)[0],this._transitionDuration=this._getTransitionDuration(),this._addEventListeners()}var e=t.prototype;return e.next=function(){this._isSliding||this._slide(W)},e.nextWhenVisible=function(){!document.hidden&&k(this._element).is(":visible")&&"hidden"!==k(this._element).css("visibility")&&this.next()},e.prev=function(){this._isSliding||this._slide(U)},e.pause=function(t){t||(this._isPaused=!0),k(this._element).find(J.NEXT_PREV)[0]&>.supportsTransitionEnd()&&(gt.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},e.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},e.to=function(t){var e=this;this._activeElement=k(this._element).find(J.ACTIVE_ITEM)[0];var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1||t<0))if(this._isSliding)k(this._element).one(K.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=t>n?W:U;this._slide(i,this._items[t])}},e.dispose=function(){k(this._element).off(x),k.removeData(this._element,P),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},e._getConfig=function(t){return t=r({},H,t),gt.typeCheckConfig(L,t,M),t},e._getTransitionDuration=function(){var t=k(this._element).find(J.ITEM).css("transition-duration");return t?(t=t.split(",")[0]).indexOf("ms")>-1?parseFloat(t):1e3*parseFloat(t):0},e._addEventListeners=function(){var t=this;this._config.keyboard&&k(this._element).on(K.KEYDOWN,function(e){return t._keydown(e)}),"hover"===this._config.pause&&(k(this._element).on(K.MOUSEENTER,function(e){return t.pause(e)}).on(K.MOUSELEAVE,function(e){return t.cycle(e)}),"ontouchstart"in document.documentElement&&k(this._element).on(K.TOUCHEND,function(){t.pause(),t.touchTimeout&&clearTimeout(t.touchTimeout),t.touchTimeout=setTimeout(function(e){return t.cycle(e)},500+t._config.interval)}))},e._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},e._getItemIndex=function(t){return this._items=k.makeArray(k(t).parent().find(J.ITEM)),this._items.indexOf(t)},e._getItemByDirection=function(t,e){var n=t===W,i=t===U,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===U?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},e._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(k(this._element).find(J.ACTIVE_ITEM)[0]),r=k.Event(K.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return k(this._element).trigger(r),r},e._setActiveIndicatorElement=function(t){if(this._indicatorsElement){k(this._indicatorsElement).find(J.ACTIVE).removeClass(Q);var e=this._indicatorsElement.children[this._getItemIndex(t)];e&&k(e).addClass(Q)}},e._slide=function(t,e){var n,i,r,o=this,s=k(this._element).find(J.ACTIVE_ITEM)[0],a=this._getItemIndex(s),l=e||s&&this._getItemByDirection(t,s),c=this._getItemIndex(l),h=Boolean(this._interval);if(t===W?(n=q,i=z,r=F):(n=G,i=X,r=B),l&&k(l).hasClass(Q))this._isSliding=!1;else if(!this._triggerSlideEvent(l,r).isDefaultPrevented()&&s&&l){this._isSliding=!0,h&&this.pause(),this._setActiveIndicatorElement(l);var f=k.Event(K.SLID,{relatedTarget:l,direction:r,from:a,to:c});gt.supportsTransitionEnd()&&k(this._element).hasClass(Y)?(k(l).addClass(i),gt.reflow(l),k(s).addClass(n),k(l).addClass(n),k(s).one(gt.TRANSITION_END,function(){k(l).removeClass(n+" "+i).addClass(Q),k(s).removeClass(Q+" "+i+" "+n),o._isSliding=!1,setTimeout(function(){return k(o._element).trigger(f)},0)}).emulateTransitionEnd(this._transitionDuration)):(k(s).removeClass(Q),k(l).addClass(Q),this._isSliding=!1,k(this._element).trigger(f)),h&&this.cycle()}},t._jQueryInterface=function(e){return this.each(function(){var n=k(this).data(P),i=r({},H,k(this).data());"object"==typeof e&&(i=r({},i,e));var o="string"==typeof e?e:i.slide;if(n||(n=new t(this,i),k(this).data(P,n)),"number"==typeof e)n.to(e);else if("string"==typeof o){if("undefined"==typeof n[o])throw new TypeError('No method named "'+o+'"');n[o]()}else i.interval&&(n.pause(),n.cycle())})},t._dataApiClickHandler=function(e){var n=gt.getSelectorFromElement(this);if(n){var i=k(n)[0];if(i&&k(i).hasClass(V)){var o=r({},k(i).data(),k(this).data()),s=this.getAttribute("data-slide-to");s&&(o.interval=!1),t._jQueryInterface.call(k(i),o),s&&k(i).data(P).to(s),e.preventDefault()}}},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return H}}]),t}(),k(document).on(K.CLICK_DATA_API,J.DATA_SLIDE,Z._dataApiClickHandler),k(window).on(K.LOAD_DATA_API,function(){k(J.DATA_RIDE).each(function(){var t=k(this);Z._jQueryInterface.call(t,t.data())})}),k.fn[L]=Z._jQueryInterface,k.fn[L].Constructor=Z,k.fn[L].noConflict=function(){return k.fn[L]=j,Z._jQueryInterface},Z),Et=(tt="collapse",nt="."+(et="bs.collapse"),it=($=e).fn[tt],rt={toggle:!0,parent:""},ot={toggle:"boolean",parent:"(string|element)"},st={SHOW:"show"+nt,SHOWN:"shown"+nt,HIDE:"hide"+nt,HIDDEN:"hidden"+nt,CLICK_DATA_API:"click"+nt+".data-api"},at="show",lt="collapse",ct="collapsing",ht="collapsed",ft="width",ut="height",dt={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},pt=function(){function t(t,e){this._isTransitioning=!1,this._element=t,this._config=this._getConfig(e),this._triggerArray=$.makeArray($('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'));for(var n=$(dt.DATA_TOGGLE),i=0;i0&&(this._selector=o,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var e=t.prototype;return e.toggle=function(){$(this._element).hasClass(at)?this.hide():this.show()},e.show=function(){var e,n,i=this;if(!this._isTransitioning&&!$(this._element).hasClass(at)&&(this._parent&&0===(e=$.makeArray($(this._parent).find(dt.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(n=$(e).not(this._selector).data(et))&&n._isTransitioning))){var r=$.Event(st.SHOW);if($(this._element).trigger(r),!r.isDefaultPrevented()){e&&(t._jQueryInterface.call($(e).not(this._selector),"hide"),n||$(e).data(et,null));var o=this._getDimension();$(this._element).removeClass(lt).addClass(ct),this._element.style[o]=0,this._triggerArray.length>0&&$(this._triggerArray).removeClass(ht).attr("aria-expanded",!0),this.setTransitioning(!0);var s=function(){$(i._element).removeClass(ct).addClass(lt).addClass(at),i._element.style[o]="",i.setTransitioning(!1),$(i._element).trigger(st.SHOWN)};if(gt.supportsTransitionEnd()){var a="scroll"+(o[0].toUpperCase()+o.slice(1));$(this._element).one(gt.TRANSITION_END,s).emulateTransitionEnd(600),this._element.style[o]=this._element[a]+"px"}else s()}}},e.hide=function(){var t=this;if(!this._isTransitioning&&$(this._element).hasClass(at)){var e=$.Event(st.HIDE);if($(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();if(this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",gt.reflow(this._element),$(this._element).addClass(ct).removeClass(lt).removeClass(at),this._triggerArray.length>0)for(var i=0;i0&&$(e).toggleClass(ht,!n).attr("aria-expanded",n)}},t._getTargetFromElement=function(t){var e=gt.getSelectorFromElement(t);return e?$(e)[0]:null},t._jQueryInterface=function(e){return this.each(function(){var n=$(this),i=n.data(et),o=r({},rt,n.data(),"object"==typeof e&&e);if(!i&&o.toggle&&/show|hide/.test(e)&&(o.toggle=!1),i||(i=new t(this,o),n.data(et,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return rt}}]),t}(),$(document).on(st.CLICK_DATA_API,dt.DATA_TOGGLE,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var e=$(this),n=gt.getSelectorFromElement(this);$(n).each(function(){var t=$(this),n=t.data(et)?"toggle":e.data();pt._jQueryInterface.call(t,n)})}),$.fn[tt]=pt._jQueryInterface,$.fn[tt].Constructor=pt,$.fn[tt].noConflict=function(){return $.fn[tt]=it,pt._jQueryInterface},pt),yt="undefined"!=typeof window&&"undefined"!=typeof document,bt=["Edge","Trident","Firefox"],Tt=0,Ct=0;Ct=0){Tt=1;break}var wt=yt&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},Tt))}};function It(t){return t&&"[object Function]"==={}.toString.call(t)}function At(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function Dt(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function St(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=At(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto|scroll)/.test(n+r+i)?t:St(Dt(t))}function Ot(t){var e=t&&t.offsetParent,n=e&&e.nodeName;return n&&"BODY"!==n&&"HTML"!==n?-1!==["TD","TABLE"].indexOf(e.nodeName)&&"static"===At(e,"position")?Ot(e):e:t?t.ownerDocument.documentElement:document.documentElement}function Nt(t){return null!==t.parentNode?Nt(t.parentNode):t}function kt(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&Ot(s.firstElementChild)!==s?Ot(l):l;var c=Nt(t);return c.host?kt(c.host,e):kt(t,Nt(e).host)}function Lt(t){var e="top"===(arguments.length>1&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n||"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}return t[e]}function Pt(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}var xt=void 0,Rt=function(){return void 0===xt&&(xt=-1!==navigator.appVersion.indexOf("MSIE 10")),xt};function jt(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Rt()?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function Ht(){var t=document.body,e=document.documentElement,n=Rt()&&getComputedStyle(e);return{height:jt("Height",t,e,n),width:jt("Width",t,e,n)}}var Mt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},Wt=function(){function t(t,e){for(var n=0;n2&&void 0!==arguments[2]&&arguments[2],i=Lt(e,"top"),r=Lt(e,"left"),o=n?-1:1;return t.top+=i*o,t.bottom+=i*o,t.left+=r*o,t.right+=r*o,t}(h,e)),h}function Qt(t,e,n,i){var r,o,s,a,l,c,h,f={top:0,left:0},u=kt(t,e);if("viewport"===i)o=(r=u).ownerDocument.documentElement,s=Vt(r,o),a=Math.max(o.clientWidth,window.innerWidth||0),l=Math.max(o.clientHeight,window.innerHeight||0),c=Lt(o),h=Lt(o,"left"),f=Bt({top:c-s.top+s.marginTop,left:h-s.left+s.marginLeft,width:a,height:l});else{var d=void 0;"scrollParent"===i?"BODY"===(d=St(Dt(e))).nodeName&&(d=t.ownerDocument.documentElement):d="window"===i?t.ownerDocument.documentElement:i;var p=Vt(d,u);if("HTML"!==d.nodeName||function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===At(e,"position")||t(Dt(e)))}(u))f=p;else{var g=Ht(),m=g.height,_=g.width;f.top+=p.top-p.marginTop,f.bottom=m+p.top,f.left+=p.left-p.marginLeft,f.right=_+p.left}}return f.left+=n,f.top+=n,f.right-=n,f.bottom-=n,f}function Yt(t,e,n,i,r){var o=arguments.length>5&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=Qt(n,i,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return Ft({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,i=t.height;return e>=n.clientWidth&&i>=n.clientHeight}),h=c.length>0?c[0].key:l[0].key,f=t.split("-")[1];return h+(f?"-"+f:"")}function Gt(t,e,n){return Vt(n,kt(e,n))}function qt(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function zt(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function Xt(t,e,n){n=n.split("-")[0];var i=qt(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[zt(a)],r}function Jt(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function Zt(t,e,n){return(void 0===n?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=Jt(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",n))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var n=t.function||t.fn;t.enabled&&It(n)&&(e.offsets.popper=Bt(e.offsets.popper),e.offsets.reference=Bt(e.offsets.reference),e=n(e,t))}),e}function $t(t,e){return t.some(function(t){var n=t.name;return t.enabled&&n===e})}function te(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i1&&void 0!==arguments[1]&&arguments[1],n=le.indexOf(t),i=le.slice(n+1).concat(le.slice(0,n));return e?i.reverse():i}var he={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function fe(t,e,n,i){var r=[0,0],o=-1!==["right","left"].indexOf(i),s=t.split(/(\+|\-)/).map(function(t){return t.trim()}),a=s.indexOf(Jt(s,function(t){return-1!==t.search(/,|\s/)}));s[a]&&-1===s[a].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==a?[s.slice(0,a).concat([s[a].split(l)[0]]),[s[a].split(l)[1]].concat(s.slice(a+1))]:[s];return(c=c.map(function(t,i){var r=(1===i?!o:o)?"height":"width",s=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,s=!0,t):s?(t[t.length-1]+=e,s=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return Bt(a)[e]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(t,r,e,n)})})).forEach(function(t,e){t.forEach(function(n,i){re(n)&&(r[e]+=n*("-"===t[i-1]?-1:1))})}),r}var ue={placement:"bottom",eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:Ut({},l,o[l]),end:Ut({},l,o[l]+o[c]-s[c])};t.offsets.popper=Ft({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=re(+n)?[+n,0]:fe(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,e){var n=e.boundariesElement||Ot(t.instance.popper);t.instance.reference===n&&(n=Ot(n));var i=Qt(t.instance.popper,t.instance.reference,e.padding,n);e.boundaries=i;var r=e.priority,o=t.offsets.popper,s={primary:function(t){var n=o[t];return o[t]i[t]&&!e.escapeWithReference&&(r=Math.min(o[n],i[t]-("right"===t?o.width:o.height))),Ut({},n,r)}};return r.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";o=Ft({},o,s[e](t))}),t.offsets.popper=o,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!se(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",h=l?"Top":"Left",f=h.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=qt(i)[c];a[d]-ps[d]&&(t.offsets.popper[f]+=a[f]+p-s[d]),t.offsets.popper=Bt(t.offsets.popper);var g=a[f]+a[c]/2-p/2,m=At(t.instance.popper),_=parseFloat(m["margin"+h],10),v=parseFloat(m["border"+h+"Width"],10),E=g-t.offsets.popper[f]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(Ut(n={},f,Math.round(E)),Ut(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(t,e){if($t(t.instance.modifiers,"inner"))return t;if(t.flipped&&t.placement===t.originalPlacement)return t;var n=Qt(t.instance.popper,t.instance.reference,e.padding,e.boundariesElement),i=t.placement.split("-")[0],r=zt(i),o=t.placement.split("-")[1]||"",s=[];switch(e.behavior){case he.FLIP:s=[i,r];break;case he.CLOCKWISE:s=ce(i);break;case he.COUNTERCLOCKWISE:s=ce(i,!0);break;default:s=e.behavior}return s.forEach(function(a,l){if(i!==a||s.length===l+1)return t;i=t.placement.split("-")[0],r=zt(i);var c,h=t.offsets.popper,f=t.offsets.reference,u=Math.floor,d="left"===i&&u(h.right)>u(f.left)||"right"===i&&u(h.left)u(f.top)||"bottom"===i&&u(h.top)u(n.right),m=u(h.top)u(n.bottom),v="left"===i&&p||"right"===i&&g||"top"===i&&m||"bottom"===i&&_,E=-1!==["top","bottom"].indexOf(i),y=!!e.flipVariations&&(E&&"start"===o&&p||E&&"end"===o&&g||!E&&"start"===o&&m||!E&&"end"===o&&_);(d||v||y)&&(t.flipped=!0,(d||v)&&(i=s[l+1]),y&&(o="end"===(c=o)?"start":"start"===c?"end":c),t.placement=i+(o?"-"+o:""),t.offsets.popper=Ft({},t.offsets.popper,Xt(t.instance.popper,t.offsets.reference,t.placement)),t=Zt(t.instance.modifiers,t,"flip"))}),t},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=zt(e),t.offsets.popper=Bt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!se(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=Jt(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottomn.right||e.top>n.bottom||e.right2&&void 0!==arguments[2]?arguments[2]:{};Mt(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(i.update)},this.update=wt(this.update.bind(this)),this.options=Ft({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(Ft({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){i.options.modifiers[e]=Ft({},t.Defaults.modifiers[e]||{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return Ft({name:t},i.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&It(t.onLoad)&&t.onLoad(i.reference,i.popper,i.options,t,i.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return Wt(t,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=Gt(this.state,this.popper,this.reference),t.placement=Yt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.offsets.popper=Xt(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position="absolute",t=Zt(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,$t(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.left="",this.popper.style.position="",this.popper.style.top="",this.popper.style[te("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=ne(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return ie.call(this)}}]),t}();de.Utils=("undefined"!=typeof window?window:global).PopperUtils,de.placements=ae,de.Defaults=ue;var pe,ge,me,_e,ve,Ee,ye,be,Te,Ce,we,Ie,Ae,De,Se,Oe,Ne,ke,Le,Pe,xe,Re,je,He,Me,We,Ue,Fe,Be,Ke,Ve,Qe,Ye,Ge,qe,ze,Xe,Je,Ze,$e,tn,en,nn,rn,on,sn,an,ln,cn,hn,fn,un,dn,pn,gn,mn,_n,vn,En,yn,bn,Tn,Cn,wn,In,An,Dn,Sn,On,Nn,kn,Ln,Pn,xn,Rn,jn,Hn,Mn,Wn,Un,Fn,Bn,Kn,Vn,Qn,Yn,Gn,qn,zn,Xn,Jn,Zn,$n,ti,ei,ni,ii,ri,oi,si,ai,li,ci,hi,fi,ui,di,pi,gi,mi,_i,vi,Ei,yi=(ge="dropdown",_e="."+(me="bs.dropdown"),ve=".data-api",Ee=(pe=e).fn[ge],ye=new RegExp("38|40|27"),be={HIDE:"hide"+_e,HIDDEN:"hidden"+_e,SHOW:"show"+_e,SHOWN:"shown"+_e,CLICK:"click"+_e,CLICK_DATA_API:"click"+_e+ve,KEYDOWN_DATA_API:"keydown"+_e+ve,KEYUP_DATA_API:"keyup"+_e+ve},Te="disabled",Ce="show",we="dropup",Ie="dropright",Ae="dropleft",De="dropdown-menu-right",Se="position-static",Oe='[data-toggle="dropdown"]',Ne=".dropdown form",ke=".dropdown-menu",Le=".navbar-nav",Pe=".dropdown-menu .dropdown-item:not(.disabled)",xe="top-start",Re="top-end",je="bottom-start",He="bottom-end",Me="right-start",We="left-start",Ue={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Fe={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Be=function(){function t(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var e=t.prototype;return e.toggle=function(){if(!this._element.disabled&&!pe(this._element).hasClass(Te)){var e=t._getParentFromElement(this._element),n=pe(this._menu).hasClass(Ce);if(t._clearMenus(),!n){var i={relatedTarget:this._element},r=pe.Event(be.SHOW,i);if(pe(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof de)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;"parent"===this._config.reference?o=e:gt.isElement(this._config.reference)&&(o=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(o=this._config.reference[0])),"scrollParent"!==this._config.boundary&&pe(e).addClass(Se),this._popper=new de(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===pe(e).closest(Le).length&&pe(document.body).children().on("mouseover",null,pe.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),pe(this._menu).toggleClass(Ce),pe(e).toggleClass(Ce).trigger(pe.Event(be.SHOWN,i))}}}},e.dispose=function(){pe.removeData(this._element,me),pe(this._element).off(_e),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},e.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},e._addEventListeners=function(){var t=this;pe(this._element).on(be.CLICK,function(e){e.preventDefault(),e.stopPropagation(),t.toggle()})},e._getConfig=function(t){return t=r({},this.constructor.Default,pe(this._element).data(),t),gt.typeCheckConfig(ge,t,this.constructor.DefaultType),t},e._getMenuElement=function(){if(!this._menu){var e=t._getParentFromElement(this._element);this._menu=pe(e).find(ke)[0]}return this._menu},e._getPlacement=function(){var t=pe(this._element).parent(),e=je;return t.hasClass(we)?(e=xe,pe(this._menu).hasClass(De)&&(e=Re)):t.hasClass(Ie)?e=Me:t.hasClass(Ae)?e=We:pe(this._menu).hasClass(De)&&(e=He),e},e._detectNavbar=function(){return pe(this._element).closest(".navbar").length>0},e._getPopperConfig=function(){var t=this,e={};"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},t._jQueryInterface=function(e){return this.each(function(){var n=pe(this).data(me);if(n||(n=new t(this,"object"==typeof e?e:null),pe(this).data(me,n)),"string"==typeof e){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},t._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var n=pe.makeArray(pe(Oe)),i=0;i0&&o--,40===e.which&&odocument.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},e._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},e._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right
',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},gn="show",mn="out",_n={HIDE:"hide"+ln,HIDDEN:"hidden"+ln,SHOW:"show"+ln,SHOWN:"shown"+ln,INSERTED:"inserted"+ln,CLICK:"click"+ln,FOCUSIN:"focusin"+ln,FOCUSOUT:"focusout"+ln,MOUSEENTER:"mouseenter"+ln,MOUSELEAVE:"mouseleave"+ln},vn="fade",En="show",yn=".tooltip-inner",bn=".arrow",Tn="hover",Cn="focus",wn="click",In="manual",An=function(){function t(t,e){if("undefined"==typeof de)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var e=t.prototype;return e.enable=function(){this._isEnabled=!0},e.disable=function(){this._isEnabled=!1},e.toggleEnabled=function(){this._isEnabled=!this._isEnabled},e.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=on(t.currentTarget).data(e);n||(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),on(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(on(this.getTipElement()).hasClass(En))return void this._leave(null,this);this._enter(null,this)}},e.dispose=function(){clearTimeout(this._timeout),on.removeData(this.element,this.constructor.DATA_KEY),on(this.element).off(this.constructor.EVENT_KEY),on(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&on(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},e.show=function(){var e=this;if("none"===on(this.element).css("display"))throw new Error("Please use show on visible elements");var n=on.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){on(this.element).trigger(n);var i=on.contains(this.element.ownerDocument.documentElement,this.element);if(n.isDefaultPrevented()||!i)return;var r=this.getTipElement(),o=gt.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&on(r).addClass(vn);var s="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,a=this._getAttachment(s);this.addAttachmentClass(a);var l=!1===this.config.container?document.body:on(this.config.container);on(r).data(this.constructor.DATA_KEY,this),on.contains(this.element.ownerDocument.documentElement,this.tip)||on(r).appendTo(l),on(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new de(this.element,r,{placement:a,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:bn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),on(r).addClass(En),"ontouchstart"in document.documentElement&&on(document.body).children().on("mouseover",null,on.noop);var c=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,on(e.element).trigger(e.constructor.Event.SHOWN),t===mn&&e._leave(null,e)};gt.supportsTransitionEnd()&&on(this.tip).hasClass(vn)?on(this.tip).one(gt.TRANSITION_END,c).emulateTransitionEnd(t._TRANSITION_DURATION):c()}},e.hide=function(t){var e=this,n=this.getTipElement(),i=on.Event(this.constructor.Event.HIDE),r=function(){e._hoverState!==gn&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),on(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};on(this.element).trigger(i),i.isDefaultPrevented()||(on(n).removeClass(En),"ontouchstart"in document.documentElement&&on(document.body).children().off("mouseover",null,on.noop),this._activeTrigger[wn]=!1,this._activeTrigger[Cn]=!1,this._activeTrigger[Tn]=!1,gt.supportsTransitionEnd()&&on(this.tip).hasClass(vn)?on(n).one(gt.TRANSITION_END,r).emulateTransitionEnd(150):r(),this._hoverState="")},e.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},e.isWithContent=function(){return Boolean(this.getTitle())},e.addAttachmentClass=function(t){on(this.getTipElement()).addClass(hn+"-"+t)},e.getTipElement=function(){return this.tip=this.tip||on(this.config.template)[0],this.tip},e.setContent=function(){var t=on(this.getTipElement());this.setElementContent(t.find(yn),this.getTitle()),t.removeClass(vn+" "+En)},e.setElementContent=function(t,e){var n=this.config.html;"object"==typeof e&&(e.nodeType||e.jquery)?n?on(e).parent().is(t)||t.empty().append(e):t.text(on(e).text()):t[n?"html":"text"](e)},e.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},e._getAttachment=function(t){return dn[t.toUpperCase()]},e._setListeners=function(){var t=this;this.config.trigger.split(" ").forEach(function(e){if("click"===e)on(t.element).on(t.constructor.Event.CLICK,t.config.selector,function(e){return t.toggle(e)});else if(e!==In){var n=e===Tn?t.constructor.Event.MOUSEENTER:t.constructor.Event.FOCUSIN,i=e===Tn?t.constructor.Event.MOUSELEAVE:t.constructor.Event.FOCUSOUT;on(t.element).on(n,t.config.selector,function(e){return t._enter(e)}).on(i,t.config.selector,function(e){return t._leave(e)})}on(t.element).closest(".modal").on("hide.bs.modal",function(){return t.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},e._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},e._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e||on(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),on(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?Cn:Tn]=!0),on(e.getTipElement()).hasClass(En)||e._hoverState===gn?e._hoverState=gn:(clearTimeout(e._timeout),e._hoverState=gn,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===gn&&e.show()},e.config.delay.show):e.show())},e._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e||on(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),on(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?Cn:Tn]=!1),e._isWithActiveTrigger()||(clearTimeout(e._timeout),e._hoverState=mn,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===mn&&e.hide()},e.config.delay.hide):e.hide())},e._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},e._getConfig=function(t){return"number"==typeof(t=r({},this.constructor.Default,on(this.element).data(),t)).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),gt.typeCheckConfig(sn,t,this.constructor.DefaultType),t},e._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},e._cleanTipClass=function(){var t=on(this.getTipElement()),e=t.attr("class").match(fn);null!==e&&e.length>0&&t.removeClass(e.join(""))},e._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},e._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(on(t).removeClass(vn),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},t._jQueryInterface=function(e){return this.each(function(){var n=on(this).data(an),i="object"==typeof e&&e;if((n||!/dispose|hide/.test(e))&&(n||(n=new t(this,i),on(this).data(an,n)),"string"==typeof e)){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return pn}},{key:"NAME",get:function(){return sn}},{key:"DATA_KEY",get:function(){return an}},{key:"Event",get:function(){return _n}},{key:"EVENT_KEY",get:function(){return ln}},{key:"DefaultType",get:function(){return un}}]),t}(),on.fn[sn]=An._jQueryInterface,on.fn[sn].Constructor=An,on.fn[sn].noConflict=function(){return on.fn[sn]=cn,An._jQueryInterface},An),Ci=(Sn="popover",Nn="."+(On="bs.popover"),kn=(Dn=e).fn[Sn],Ln="bs-popover",Pn=new RegExp("(^|\\s)"+Ln+"\\S+","g"),xn=r({},Ti.Default,{placement:"right",trigger:"click",content:"",template:''}),Rn=r({},Ti.DefaultType,{content:"(string|element|function)"}),jn="fade",Hn="show",Mn=".popover-header",Wn=".popover-body",Un={HIDE:"hide"+Nn,HIDDEN:"hidden"+Nn,SHOW:"show"+Nn,SHOWN:"shown"+Nn,INSERTED:"inserted"+Nn,CLICK:"click"+Nn,FOCUSIN:"focusin"+Nn,FOCUSOUT:"focusout"+Nn,MOUSEENTER:"mouseenter"+Nn,MOUSELEAVE:"mouseleave"+Nn},Fn=function(t){var e,n;function r(){return t.apply(this,arguments)||this}n=t,(e=r).prototype=Object.create(n.prototype),e.prototype.constructor=e,e.__proto__=n;var o=r.prototype;return o.isWithContent=function(){return this.getTitle()||this._getContent()},o.addAttachmentClass=function(t){Dn(this.getTipElement()).addClass(Ln+"-"+t)},o.getTipElement=function(){return this.tip=this.tip||Dn(this.config.template)[0],this.tip},o.setContent=function(){var t=Dn(this.getTipElement());this.setElementContent(t.find(Mn),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(Wn),e),t.removeClass(jn+" "+Hn)},o._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},o._cleanTipClass=function(){var t=Dn(this.getTipElement()),e=t.attr("class").match(Pn);null!==e&&e.length>0&&t.removeClass(e.join(""))},r._jQueryInterface=function(t){return this.each(function(){var e=Dn(this).data(On),n="object"==typeof t?t:null;if((e||!/destroy|hide/.test(t))&&(e||(e=new r(this,n),Dn(this).data(On,e)),"string"==typeof t)){if("undefined"==typeof e[t])throw new TypeError('No method named "'+t+'"');e[t]()}})},i(r,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return xn}},{key:"NAME",get:function(){return Sn}},{key:"DATA_KEY",get:function(){return On}},{key:"Event",get:function(){return Un}},{key:"EVENT_KEY",get:function(){return Nn}},{key:"DefaultType",get:function(){return Rn}}]),r}(Ti),Dn.fn[Sn]=Fn._jQueryInterface,Dn.fn[Sn].Constructor=Fn,Dn.fn[Sn].noConflict=function(){return Dn.fn[Sn]=kn,Fn._jQueryInterface},Fn),wi=(Kn="scrollspy",Qn="."+(Vn="bs.scrollspy"),Yn=(Bn=e).fn[Kn],Gn={offset:10,method:"auto",target:""},qn={offset:"number",method:"string",target:"(string|element)"},zn={ACTIVATE:"activate"+Qn,SCROLL:"scroll"+Qn,LOAD_DATA_API:"load"+Qn+".data-api"},Xn="dropdown-item",Jn="active",Zn={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},$n="offset",ti="position",ei=function(){function t(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+Zn.NAV_LINKS+","+this._config.target+" "+Zn.LIST_ITEMS+","+this._config.target+" "+Zn.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,Bn(this._scrollElement).on(zn.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var e=t.prototype;return e.refresh=function(){var t=this,e=this._scrollElement===this._scrollElement.window?$n:ti,n="auto"===this._config.method?e:this._config.method,i=n===ti?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),Bn.makeArray(Bn(this._selector)).map(function(t){var e,r=gt.getSelectorFromElement(t);if(r&&(e=Bn(r)[0]),e){var o=e.getBoundingClientRect();if(o.width||o.height)return[Bn(e)[n]().top+i,r]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(e){t._offsets.push(e[0]),t._targets.push(e[1])})},e.dispose=function(){Bn.removeData(this._element,Vn),Bn(this._scrollElement).off(Qn),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},e._getConfig=function(t){if("string"!=typeof(t=r({},Gn,t)).target){var e=Bn(t.target).attr("id");e||(e=gt.getUID(Kn),Bn(t.target).attr("id",e)),t.target="#"+e}return gt.typeCheckConfig(Kn,t,qn),t},e._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},e._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},e._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},e._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t0)return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=gt,t.Alert=mt,t.Button=_t,t.Carousel=vt,t.Collapse=Et,t.Dropdown=yi,t.Modal=bi,t.Popover=Ci,t.Scrollspy=wi,t.Tab=Ii,t.Tooltip=Ti,Object.defineProperty(t,"__esModule",{value:!0})}); +//# sourceMappingURL=bootstrap.bundle.min.js.map \ No newline at end of file diff --git a/public/v2/assets/js/vendors/chart.bundle.min.js b/public/v2/assets/js/vendors/chart.bundle.min.js new file mode 100755 index 0000000000..efb0b2a97c --- /dev/null +++ b/public/v2/assets/js/vendors/chart.bundle.min.js @@ -0,0 +1,10 @@ +/*! + * Chart.js + * http://chartjs.org/ + * Version: 2.7.0 + * + * Copyright 2017 Nick Downie + * Released under the MIT license + * https://github.com/chartjs/Chart.js/blob/master/LICENSE.md + */ +!function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{("undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:this).Chart=t()}}(function(){return function t(e,n,i){function a(o,s){if(!n[o]){if(!e[o]){var l="function"==typeof require&&require;if(!s&&l)return l(o,!0);if(r)return r(o,!0);var u=new Error("Cannot find module '"+o+"'");throw u.code="MODULE_NOT_FOUND",u}var d=n[o]={exports:{}};e[o][0].call(d.exports,function(t){var n=e[o][1][t];return a(n||t)},d,d.exports,t,e,n,i)}return n[o].exports}for(var r="function"==typeof require&&require,o=0;on?(e+.05)/(n+.05):(n+.05)/(e+.05)},level:function(t){var e=this.contrast(t);return e>=7.1?"AAA":e>=4.5?"AA":""},dark:function(){var t=this.values.rgb;return(299*t[0]+587*t[1]+114*t[2])/1e3<128},light:function(){return!this.dark()},negate:function(){for(var t=[],e=0;e<3;e++)t[e]=255-this.values.rgb[e];return this.setValues("rgb",t),this},lighten:function(t){var e=this.values.hsl;return e[2]+=e[2]*t,this.setValues("hsl",e),this},darken:function(t){var e=this.values.hsl;return e[2]-=e[2]*t,this.setValues("hsl",e),this},saturate:function(t){var e=this.values.hsl;return e[1]+=e[1]*t,this.setValues("hsl",e),this},desaturate:function(t){var e=this.values.hsl;return e[1]-=e[1]*t,this.setValues("hsl",e),this},whiten:function(t){var e=this.values.hwb;return e[1]+=e[1]*t,this.setValues("hwb",e),this},blacken:function(t){var e=this.values.hwb;return e[2]+=e[2]*t,this.setValues("hwb",e),this},greyscale:function(){var t=this.values.rgb,e=.3*t[0]+.59*t[1]+.11*t[2];return this.setValues("rgb",[e,e,e]),this},clearer:function(t){var e=this.values.alpha;return this.setValues("alpha",e-e*t),this},opaquer:function(t){var e=this.values.alpha;return this.setValues("alpha",e+e*t),this},rotate:function(t){var e=this.values.hsl,n=(e[0]+t)%360;return e[0]=n<0?360+n:n,this.setValues("hsl",e),this},mix:function(t,e){var n=this,i=t,a=void 0===e?.5:e,r=2*a-1,o=n.alpha()-i.alpha(),s=((r*o==-1?r:(r+o)/(1+r*o))+1)/2,l=1-s;return this.rgb(s*n.red()+l*i.red(),s*n.green()+l*i.green(),s*n.blue()+l*i.blue()).alpha(n.alpha()*a+i.alpha()*(1-a))},toJSON:function(){return this.rgb()},clone:function(){var t,e,n=new r,i=this.values,a=n.values;for(var o in i)i.hasOwnProperty(o)&&(t=i[o],"[object Array]"===(e={}.toString.call(t))?a[o]=t.slice(0):"[object Number]"===e?a[o]=t:console.error("unexpected color value:",t));return n}},r.prototype.spaces={rgb:["red","green","blue"],hsl:["hue","saturation","lightness"],hsv:["hue","saturation","value"],hwb:["hue","whiteness","blackness"],cmyk:["cyan","magenta","yellow","black"]},r.prototype.maxes={rgb:[255,255,255],hsl:[360,100,100],hsv:[360,100,100],hwb:[360,100,100],cmyk:[100,100,100,100]},r.prototype.getValues=function(t){for(var e=this.values,n={},i=0;i.04045?Math.pow((e+.055)/1.055,2.4):e/12.92)+.3576*(n=n>.04045?Math.pow((n+.055)/1.055,2.4):n/12.92)+.1805*(i=i>.04045?Math.pow((i+.055)/1.055,2.4):i/12.92)),100*(.2126*e+.7152*n+.0722*i),100*(.0193*e+.1192*n+.9505*i)]}function d(t){var e,n,i,a=u(t),r=a[0],o=a[1],s=a[2];return r/=95.047,o/=100,s/=108.883,r=r>.008856?Math.pow(r,1/3):7.787*r+16/116,o=o>.008856?Math.pow(o,1/3):7.787*o+16/116,s=s>.008856?Math.pow(s,1/3):7.787*s+16/116,e=116*o-16,n=500*(r-o),i=200*(o-s),[e,n,i]}function c(t){var e,n,i,a,r,o=t[0]/360,s=t[1]/100,l=t[2]/100;if(0==s)return r=255*l,[r,r,r];e=2*l-(n=l<.5?l*(1+s):l+s-l*s),a=[0,0,0];for(var u=0;u<3;u++)(i=o+1/3*-(u-1))<0&&i++,i>1&&i--,r=6*i<1?e+6*(n-e)*i:2*i<1?n:3*i<2?e+(n-e)*(2/3-i)*6:e,a[u]=255*r;return a}function h(t){var e=t[0]/60,n=t[1]/100,i=t[2]/100,a=Math.floor(e)%6,r=e-Math.floor(e),o=255*i*(1-n),s=255*i*(1-n*r),l=255*i*(1-n*(1-r)),i=255*i;switch(a){case 0:return[i,l,o];case 1:return[s,i,o];case 2:return[o,i,l];case 3:return[o,s,i];case 4:return[l,o,i];case 5:return[i,o,s]}}function f(t){var e,n,i,a,o=t[0]/360,s=t[1]/100,l=t[2]/100,u=s+l;switch(u>1&&(s/=u,l/=u),e=Math.floor(6*o),n=1-l,i=6*o-e,0!=(1&e)&&(i=1-i),a=s+i*(n-s),e){default:case 6:case 0:r=n,g=a,b=s;break;case 1:r=a,g=n,b=s;break;case 2:r=s,g=n,b=a;break;case 3:r=s,g=a,b=n;break;case 4:r=a,g=s,b=n;break;case 5:r=n,g=s,b=a}return[255*r,255*g,255*b]}function m(t){var e,n,i,a=t[0]/100,r=t[1]/100,o=t[2]/100,s=t[3]/100;return e=1-Math.min(1,a*(1-s)+s),n=1-Math.min(1,r*(1-s)+s),i=1-Math.min(1,o*(1-s)+s),[255*e,255*n,255*i]}function p(t){var e,n,i,a=t[0]/100,r=t[1]/100,o=t[2]/100;return e=3.2406*a+-1.5372*r+-.4986*o,n=-.9689*a+1.8758*r+.0415*o,i=.0557*a+-.204*r+1.057*o,e=e>.0031308?1.055*Math.pow(e,1/2.4)-.055:e*=12.92,n=n>.0031308?1.055*Math.pow(n,1/2.4)-.055:n*=12.92,i=i>.0031308?1.055*Math.pow(i,1/2.4)-.055:i*=12.92,e=Math.min(Math.max(0,e),1),n=Math.min(Math.max(0,n),1),i=Math.min(Math.max(0,i),1),[255*e,255*n,255*i]}function v(t){var e,n,i,a=t[0],r=t[1],o=t[2];return a/=95.047,r/=100,o/=108.883,a=a>.008856?Math.pow(a,1/3):7.787*a+16/116,r=r>.008856?Math.pow(r,1/3):7.787*r+16/116,o=o>.008856?Math.pow(o,1/3):7.787*o+16/116,e=116*r-16,n=500*(a-r),i=200*(r-o),[e,n,i]}function y(t){var e,n,i,a,r=t[0],o=t[1],s=t[2];return r<=8?a=(n=100*r/903.3)/100*7.787+16/116:(n=100*Math.pow((r+16)/116,3),a=Math.pow(n/100,1/3)),e=e/95.047<=.008856?e=95.047*(o/500+a-16/116)/7.787:95.047*Math.pow(o/500+a,3),i=i/108.883<=.008859?i=108.883*(a-s/200-16/116)/7.787:108.883*Math.pow(a-s/200,3),[e,n,i]}function x(t){var e,n,i,a=t[0],r=t[1],o=t[2];return e=Math.atan2(o,r),(n=360*e/2/Math.PI)<0&&(n+=360),i=Math.sqrt(r*r+o*o),[a,i,n]}function _(t){return p(y(t))}function k(t){var e,n,i,a=t[0],r=t[1];return i=t[2]/360*2*Math.PI,e=r*Math.cos(i),n=r*Math.sin(i),[a,e,n]}function w(t){return M[t]}e.exports={rgb2hsl:i,rgb2hsv:a,rgb2hwb:o,rgb2cmyk:s,rgb2keyword:l,rgb2xyz:u,rgb2lab:d,rgb2lch:function(t){return x(d(t))},hsl2rgb:c,hsl2hsv:function(t){var e,n,i=t[0],a=t[1]/100,r=t[2]/100;return 0===r?[0,0,0]:(r*=2,a*=r<=1?r:2-r,n=(r+a)/2,e=2*a/(r+a),[i,100*e,100*n])},hsl2hwb:function(t){return o(c(t))},hsl2cmyk:function(t){return s(c(t))},hsl2keyword:function(t){return l(c(t))},hsv2rgb:h,hsv2hsl:function(t){var e,n,i=t[0],a=t[1]/100,r=t[2]/100;return n=(2-a)*r,e=a*r,e/=n<=1?n:2-n,e=e||0,n/=2,[i,100*e,100*n]},hsv2hwb:function(t){return o(h(t))},hsv2cmyk:function(t){return s(h(t))},hsv2keyword:function(t){return l(h(t))},hwb2rgb:f,hwb2hsl:function(t){return i(f(t))},hwb2hsv:function(t){return a(f(t))},hwb2cmyk:function(t){return s(f(t))},hwb2keyword:function(t){return l(f(t))},cmyk2rgb:m,cmyk2hsl:function(t){return i(m(t))},cmyk2hsv:function(t){return a(m(t))},cmyk2hwb:function(t){return o(m(t))},cmyk2keyword:function(t){return l(m(t))},keyword2rgb:w,keyword2hsl:function(t){return i(w(t))},keyword2hsv:function(t){return a(w(t))},keyword2hwb:function(t){return o(w(t))},keyword2cmyk:function(t){return s(w(t))},keyword2lab:function(t){return d(w(t))},keyword2xyz:function(t){return u(w(t))},xyz2rgb:p,xyz2lab:v,xyz2lch:function(t){return x(v(t))},lab2xyz:y,lab2rgb:_,lab2lch:x,lch2lab:k,lch2xyz:function(t){return y(k(t))},lch2rgb:function(t){return _(k(t))}};var M={aliceblue:[240,248,255],antiquewhite:[250,235,215],aqua:[0,255,255],aquamarine:[127,255,212],azure:[240,255,255],beige:[245,245,220],bisque:[255,228,196],black:[0,0,0],blanchedalmond:[255,235,205],blue:[0,0,255],blueviolet:[138,43,226],brown:[165,42,42],burlywood:[222,184,135],cadetblue:[95,158,160],chartreuse:[127,255,0],chocolate:[210,105,30],coral:[255,127,80],cornflowerblue:[100,149,237],cornsilk:[255,248,220],crimson:[220,20,60],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgoldenrod:[184,134,11],darkgray:[169,169,169],darkgreen:[0,100,0],darkgrey:[169,169,169],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkseagreen:[143,188,143],darkslateblue:[72,61,139],darkslategray:[47,79,79],darkslategrey:[47,79,79],darkturquoise:[0,206,209],darkviolet:[148,0,211],deeppink:[255,20,147],deepskyblue:[0,191,255],dimgray:[105,105,105],dimgrey:[105,105,105],dodgerblue:[30,144,255],firebrick:[178,34,34],floralwhite:[255,250,240],forestgreen:[34,139,34],fuchsia:[255,0,255],gainsboro:[220,220,220],ghostwhite:[248,248,255],gold:[255,215,0],goldenrod:[218,165,32],gray:[128,128,128],green:[0,128,0],greenyellow:[173,255,47],grey:[128,128,128],honeydew:[240,255,240],hotpink:[255,105,180],indianred:[205,92,92],indigo:[75,0,130],ivory:[255,255,240],khaki:[240,230,140],lavender:[230,230,250],lavenderblush:[255,240,245],lawngreen:[124,252,0],lemonchiffon:[255,250,205],lightblue:[173,216,230],lightcoral:[240,128,128],lightcyan:[224,255,255],lightgoldenrodyellow:[250,250,210],lightgray:[211,211,211],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightsalmon:[255,160,122],lightseagreen:[32,178,170],lightskyblue:[135,206,250],lightslategray:[119,136,153],lightslategrey:[119,136,153],lightsteelblue:[176,196,222],lightyellow:[255,255,224],lime:[0,255,0],limegreen:[50,205,50],linen:[250,240,230],magenta:[255,0,255],maroon:[128,0,0],mediumaquamarine:[102,205,170],mediumblue:[0,0,205],mediumorchid:[186,85,211],mediumpurple:[147,112,219],mediumseagreen:[60,179,113],mediumslateblue:[123,104,238],mediumspringgreen:[0,250,154],mediumturquoise:[72,209,204],mediumvioletred:[199,21,133],midnightblue:[25,25,112],mintcream:[245,255,250],mistyrose:[255,228,225],moccasin:[255,228,181],navajowhite:[255,222,173],navy:[0,0,128],oldlace:[253,245,230],olive:[128,128,0],olivedrab:[107,142,35],orange:[255,165,0],orangered:[255,69,0],orchid:[218,112,214],palegoldenrod:[238,232,170],palegreen:[152,251,152],paleturquoise:[175,238,238],palevioletred:[219,112,147],papayawhip:[255,239,213],peachpuff:[255,218,185],peru:[205,133,63],pink:[255,192,203],plum:[221,160,221],powderblue:[176,224,230],purple:[128,0,128],rebeccapurple:[102,51,153],red:[255,0,0],rosybrown:[188,143,143],royalblue:[65,105,225],saddlebrown:[139,69,19],salmon:[250,128,114],sandybrown:[244,164,96],seagreen:[46,139,87],seashell:[255,245,238],sienna:[160,82,45],silver:[192,192,192],skyblue:[135,206,235],slateblue:[106,90,205],slategray:[112,128,144],slategrey:[112,128,144],snow:[255,250,250],springgreen:[0,255,127],steelblue:[70,130,180],tan:[210,180,140],teal:[0,128,128],thistle:[216,191,216],tomato:[255,99,71],turquoise:[64,224,208],violet:[238,130,238],wheat:[245,222,179],white:[255,255,255],whitesmoke:[245,245,245],yellow:[255,255,0],yellowgreen:[154,205,50]},S={};for(var D in M)S[JSON.stringify(M[D])]=D},{}],4:[function(t,e,n){var i=t(3),a=function(){return new u};for(var r in i){a[r+"Raw"]=function(t){return function(e){return"number"==typeof e&&(e=Array.prototype.slice.call(arguments)),i[t](e)}}(r);var o=/(\w+)2(\w+)/.exec(r),s=o[1],l=o[2];(a[s]=a[s]||{})[l]=a[r]=function(t){return function(e){"number"==typeof e&&(e=Array.prototype.slice.call(arguments));var n=i[t](e);if("string"==typeof n||void 0===n)return n;for(var a=0;a0)for(n=0;n=0?n?"+":"":"-")+Math.pow(10,Math.max(0,a)).toString().substr(1)+i}function N(t,e,n,i){var a=i;"string"==typeof i&&(a=function(){return this[i]()}),t&&(Ne[t]=a),e&&(Ne[e[0]]=function(){return Y(a.apply(this,arguments),e[1],e[2])}),n&&(Ne[n]=function(){return this.localeData().ordinal(a.apply(this,arguments),t)})}function z(t){return t.match(/\[[\s\S]/)?t.replace(/^\[|\]$/g,""):t.replace(/\\/g,"")}function B(t){var e,n,i=t.match(Le);for(e=0,n=i.length;e=0&&We.test(t);)t=t.replace(We,function(t){return e.longDateFormat(t)||t}),We.lastIndex=0,n-=1;return t}function E(t,e,n){nn[t]=D(e)?e:function(t,i){return t&&n?n:e}}function j(t,e){return d(nn,t)?nn[t](e._strict,e._locale):new RegExp(U(t))}function U(t){return q(t.replace("\\","").replace(/\\(\[)|\\(\])|\[([^\]\[]*)\]|\\(.)/g,function(t,e,n,i,a){return e||n||i||a}))}function q(t){return t.replace(/[-\/\\^$*+?.()|[\]{}]/g,"\\$&")}function G(t,e){var n,i=e;for("string"==typeof t&&(t=[t]),s(e)&&(i=function(t,n){n[e]=_(t)}),n=0;n=0&&isFinite(s.getFullYear())&&s.setFullYear(t),s}function at(t){var e=new Date(Date.UTC.apply(null,arguments));return t<100&&t>=0&&isFinite(e.getUTCFullYear())&&e.setUTCFullYear(t),e}function rt(t,e,n){var i=7+e-n;return-((7+at(t,0,i).getUTCDay()-e)%7)+i-1}function ot(t,e,n,i,a){var r,o,s=1+7*(e-1)+(7+n-i)%7+rt(t,i,a);return s<=0?o=et(r=t-1)+s:s>et(t)?(r=t+1,o=s-et(t)):(r=t,o=s),{year:r,dayOfYear:o}}function st(t,e,n){var i,a,r=rt(t.year(),e,n),o=Math.floor((t.dayOfYear()-r-1)/7)+1;return o<1?i=o+lt(a=t.year()-1,e,n):o>lt(t.year(),e,n)?(i=o-lt(t.year(),e,n),a=t.year()+1):(a=t.year(),i=o),{week:i,year:a}}function lt(t,e,n){var i=rt(t,e,n),a=rt(t+1,e,n);return(et(t)-i+a)/7}function ut(t,e){return"string"!=typeof t?t:isNaN(t)?"number"==typeof(t=e.weekdaysParse(t))?t:null:parseInt(t,10)}function dt(t,e){return"string"==typeof t?e.weekdaysParse(t)%7||7:isNaN(t)?null:t}function ct(t,e,n){var i,a,r,o=t.toLocaleLowerCase();if(!this._weekdaysParse)for(this._weekdaysParse=[],this._shortWeekdaysParse=[],this._minWeekdaysParse=[],i=0;i<7;++i)r=h([2e3,1]).day(i),this._minWeekdaysParse[i]=this.weekdaysMin(r,"").toLocaleLowerCase(),this._shortWeekdaysParse[i]=this.weekdaysShort(r,"").toLocaleLowerCase(),this._weekdaysParse[i]=this.weekdays(r,"").toLocaleLowerCase();return n?"dddd"===e?-1!==(a=gn.call(this._weekdaysParse,o))?a:null:"ddd"===e?-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:null:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:null:"dddd"===e?-1!==(a=gn.call(this._weekdaysParse,o))?a:-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:null:"ddd"===e?-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:-1!==(a=gn.call(this._weekdaysParse,o))?a:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:null:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:-1!==(a=gn.call(this._weekdaysParse,o))?a:-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:null}function ht(){function t(t,e){return e.length-t.length}var e,n,i,a,r,o=[],s=[],l=[],u=[];for(e=0;e<7;e++)n=h([2e3,1]).day(e),i=this.weekdaysMin(n,""),a=this.weekdaysShort(n,""),r=this.weekdays(n,""),o.push(i),s.push(a),l.push(r),u.push(i),u.push(a),u.push(r);for(o.sort(t),s.sort(t),l.sort(t),u.sort(t),e=0;e<7;e++)s[e]=q(s[e]),l[e]=q(l[e]),u[e]=q(u[e]);this._weekdaysRegex=new RegExp("^("+u.join("|")+")","i"),this._weekdaysShortRegex=this._weekdaysRegex,this._weekdaysMinRegex=this._weekdaysRegex,this._weekdaysStrictRegex=new RegExp("^("+l.join("|")+")","i"),this._weekdaysShortStrictRegex=new RegExp("^("+s.join("|")+")","i"),this._weekdaysMinStrictRegex=new RegExp("^("+o.join("|")+")","i")}function ft(){return this.hours()%12||12}function gt(t,e){N(t,0,0,function(){return this.localeData().meridiem(this.hours(),this.minutes(),e)})}function mt(t,e){return e._meridiemParse}function pt(t){return t?t.toLowerCase().replace("_","-"):t}function vt(t){for(var e,n,i,a,r=0;r0;){if(i=yt(a.slice(0,e).join("-")))return i;if(n&&n.length>=e&&k(a,n,!0)>=e-1)break;e--}r++}return null}function yt(n){var i=null;if(!On[n]&&void 0!==e&&e&&e.exports)try{i=Pn._abbr,t("./locale/"+n),bt(i)}catch(t){}return On[n]}function bt(t,e){var n;return t&&(n=o(e)?_t(t):xt(t,e))&&(Pn=n),Pn._abbr}function xt(t,e){if(null!==e){var n=An;if(e.abbr=t,null!=On[t])S("defineLocaleOverride","use moment.updateLocale(localeName, config) to change an existing locale. moment.defineLocale(localeName, config) should only be used for creating a new locale See http://momentjs.com/guides/#/warnings/define-locale/ for more info."),n=On[t]._config;else if(null!=e.parentLocale){if(null==On[e.parentLocale])return Fn[e.parentLocale]||(Fn[e.parentLocale]=[]),Fn[e.parentLocale].push({name:t,config:e}),null;n=On[e.parentLocale]._config}return On[t]=new P(C(n,e)),Fn[t]&&Fn[t].forEach(function(t){xt(t.name,t.config)}),bt(t),On[t]}return delete On[t],null}function _t(t){var e;if(t&&t._locale&&t._locale._abbr&&(t=t._locale._abbr),!t)return Pn;if(!i(t)){if(e=yt(t))return e;t=[t]}return vt(t)}function kt(t){var e,n=t._a;return n&&-2===g(t).overflow&&(e=n[on]<0||n[on]>11?on:n[sn]<1||n[sn]>J(n[rn],n[on])?sn:n[ln]<0||n[ln]>24||24===n[ln]&&(0!==n[un]||0!==n[dn]||0!==n[cn])?ln:n[un]<0||n[un]>59?un:n[dn]<0||n[dn]>59?dn:n[cn]<0||n[cn]>999?cn:-1,g(t)._overflowDayOfYear&&(esn)&&(e=sn),g(t)._overflowWeeks&&-1===e&&(e=hn),g(t)._overflowWeekday&&-1===e&&(e=fn),g(t).overflow=e),t}function wt(t){var e,n,i,a,r,o,s=t._i,l=Rn.exec(s)||Ln.exec(s);if(l){for(g(t).iso=!0,e=0,n=Yn.length;e10?"YYYY ":"YY "),r="HH:mm"+(n[4]?":ss":""),n[1]){var d=["Sun","Mon","Tue","Wed","Thu","Fri","Sat"][new Date(n[2]).getDay()];if(n[1].substr(0,3)!==d)return g(t).weekdayMismatch=!0,void(t._isValid=!1)}switch(n[5].length){case 2:s=0===l?" +0000":((l="YXWVUTSRQPONZABCDEFGHIKLM".indexOf(n[5][1].toUpperCase())-12)<0?" -":" +")+(""+l).replace(/^-?/,"0").match(/..$/)[0]+"00";break;case 4:s=u[n[5]];break;default:s=u[" GMT"]}n[5]=s,t._i=n.splice(1).join(""),o=" ZZ",t._f=i+a+r+o,It(t),g(t).rfc2822=!0}else t._isValid=!1}function St(t){var e=zn.exec(t._i);null===e?(wt(t),!1===t._isValid&&(delete t._isValid,Mt(t),!1===t._isValid&&(delete t._isValid,n.createFromInputFallback(t)))):t._d=new Date(+e[1])}function Dt(t,e,n){return null!=t?t:null!=e?e:n}function Ct(t){var e=new Date(n.now());return t._useUTC?[e.getUTCFullYear(),e.getUTCMonth(),e.getUTCDate()]:[e.getFullYear(),e.getMonth(),e.getDate()]}function Pt(t){var e,n,i,a,r=[];if(!t._d){for(i=Ct(t),t._w&&null==t._a[sn]&&null==t._a[on]&&Tt(t),null!=t._dayOfYear&&(a=Dt(t._a[rn],i[rn]),(t._dayOfYear>et(a)||0===t._dayOfYear)&&(g(t)._overflowDayOfYear=!0),n=at(a,0,t._dayOfYear),t._a[on]=n.getUTCMonth(),t._a[sn]=n.getUTCDate()),e=0;e<3&&null==t._a[e];++e)t._a[e]=r[e]=i[e];for(;e<7;e++)t._a[e]=r[e]=null==t._a[e]?2===e?1:0:t._a[e];24===t._a[ln]&&0===t._a[un]&&0===t._a[dn]&&0===t._a[cn]&&(t._nextDay=!0,t._a[ln]=0),t._d=(t._useUTC?at:it).apply(null,r),null!=t._tzm&&t._d.setUTCMinutes(t._d.getUTCMinutes()-t._tzm),t._nextDay&&(t._a[ln]=24)}}function Tt(t){var e,n,i,a,r,o,s,l;if(null!=(e=t._w).GG||null!=e.W||null!=e.E)r=1,o=4,n=Dt(e.GG,t._a[rn],st(Nt(),1,4).year),i=Dt(e.W,1),((a=Dt(e.E,1))<1||a>7)&&(l=!0);else{r=t._locale._week.dow,o=t._locale._week.doy;var u=st(Nt(),r,o);n=Dt(e.gg,t._a[rn],u.year),i=Dt(e.w,u.week),null!=e.d?((a=e.d)<0||a>6)&&(l=!0):null!=e.e?(a=e.e+r,(e.e<0||e.e>6)&&(l=!0)):a=r}i<1||i>lt(n,r,o)?g(t)._overflowWeeks=!0:null!=l?g(t)._overflowWeekday=!0:(s=ot(n,i,a,r,o),t._a[rn]=s.year,t._dayOfYear=s.dayOfYear)}function It(t){if(t._f!==n.ISO_8601)if(t._f!==n.RFC_2822){t._a=[],g(t).empty=!0;var e,i,a,r,o,s=""+t._i,l=s.length,u=0;for(a=H(t._f,t._locale).match(Le)||[],e=0;e0&&g(t).unusedInput.push(o),s=s.slice(s.indexOf(i)+i.length),u+=i.length),Ne[r]?(i?g(t).empty=!1:g(t).unusedTokens.push(r),X(r,i,t)):t._strict&&!i&&g(t).unusedTokens.push(r);g(t).charsLeftOver=l-u,s.length>0&&g(t).unusedInput.push(s),t._a[ln]<=12&&!0===g(t).bigHour&&t._a[ln]>0&&(g(t).bigHour=void 0),g(t).parsedDateParts=t._a.slice(0),g(t).meridiem=t._meridiem,t._a[ln]=At(t._locale,t._a[ln],t._meridiem),Pt(t),kt(t)}else Mt(t);else wt(t)}function At(t,e,n){var i;return null==n?e:null!=t.meridiemHour?t.meridiemHour(e,n):null!=t.isPM?((i=t.isPM(n))&&e<12&&(e+=12),i||12!==e||(e=0),e):e}function Ot(t){var e,n,i,a,r;if(0===t._f.length)return g(t).invalidFormat=!0,void(t._d=new Date(NaN));for(a=0;ar&&(e=r),oe.call(this,t,e,n,i,a))}function oe(t,e,n,i,a){var r=ot(t,e,n,i,a),o=at(r.year,0,r.dayOfYear);return this.year(o.getUTCFullYear()),this.month(o.getUTCMonth()),this.date(o.getUTCDate()),this}function se(t){return t}function le(t,e,n,i){var a=_t(),r=h().set(i,e);return a[n](r,t)}function ue(t,e,n){if(s(t)&&(e=t,t=void 0),t=t||"",null!=e)return le(t,e,n,"month");var i,a=[];for(i=0;i<12;i++)a[i]=le(t,i,n,"month");return a}function de(t,e,n,i){"boolean"==typeof t?(s(e)&&(n=e,e=void 0),e=e||""):(n=e=t,t=!1,s(e)&&(n=e,e=void 0),e=e||"");var a=_t(),r=t?a._week.dow:0;if(null!=n)return le(e,(n+r)%7,i,"day");var o,l=[];for(o=0;o<7;o++)l[o]=le(e,(o+r)%7,i,"day");return l}function ce(t,e,n,i){var a=Xt(e,n);return t._milliseconds+=i*a._milliseconds,t._days+=i*a._days,t._months+=i*a._months,t._bubble()}function he(t){return t<0?Math.floor(t):Math.ceil(t)}function fe(t){return 4800*t/146097}function ge(t){return 146097*t/4800}function me(t){return function(){return this.as(t)}}function pe(t){return function(){return this.isValid()?this._data[t]:NaN}}function ve(t,e,n,i,a){return a.relativeTime(e||1,!!n,t,i)}function ye(t,e,n){var i=Xt(t).abs(),a=bi(i.as("s")),r=bi(i.as("m")),o=bi(i.as("h")),s=bi(i.as("d")),l=bi(i.as("M")),u=bi(i.as("y")),d=a<=xi.ss&&["s",a]||a0,d[4]=n,ve.apply(null,d)}function be(){if(!this.isValid())return this.localeData().invalidDate();var t,e,n,i=_i(this._milliseconds)/1e3,a=_i(this._days),r=_i(this._months);e=x((t=x(i/60))/60),i%=60,t%=60;var o=n=x(r/12),s=r%=12,l=a,u=e,d=t,c=i,h=this.asSeconds();return h?(h<0?"-":"")+"P"+(o?o+"Y":"")+(s?s+"M":"")+(l?l+"D":"")+(u||d||c?"T":"")+(u?u+"H":"")+(d?d+"M":"")+(c?c+"S":""):"P0D"}var xe,_e,ke=_e=Array.prototype.some?Array.prototype.some:function(t){for(var e=Object(this),n=e.length>>>0,i=0;i68?1900:2e3)};var xn=R("FullYear",!0);N("w",["ww",2],"wo","week"),N("W",["WW",2],"Wo","isoWeek"),T("week","w"),T("isoWeek","W"),O("week",5),O("isoWeek",5),E("w",je),E("ww",je,Be),E("W",je),E("WW",je,Be),Z(["w","ww","W","WW"],function(t,e,n,i){e[i.substr(0,1)]=_(t)});var _n={dow:0,doy:6};N("d",0,"do","day"),N("dd",0,0,function(t){return this.localeData().weekdaysMin(this,t)}),N("ddd",0,0,function(t){return this.localeData().weekdaysShort(this,t)}),N("dddd",0,0,function(t){return this.localeData().weekdays(this,t)}),N("e",0,0,"weekday"),N("E",0,0,"isoWeekday"),T("day","d"),T("weekday","e"),T("isoWeekday","E"),O("day",11),O("weekday",11),O("isoWeekday",11),E("d",je),E("e",je),E("E",je),E("dd",function(t,e){return e.weekdaysMinRegex(t)}),E("ddd",function(t,e){return e.weekdaysShortRegex(t)}),E("dddd",function(t,e){return e.weekdaysRegex(t)}),Z(["dd","ddd","dddd"],function(t,e,n,i){var a=n._locale.weekdaysParse(t,i,n._strict);null!=a?e.d=a:g(n).invalidWeekday=t}),Z(["d","e","E"],function(t,e,n,i){e[i]=_(t)});var kn="Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),wn="Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"),Mn="Su_Mo_Tu_We_Th_Fr_Sa".split("_"),Sn=en,Dn=en,Cn=en;N("H",["HH",2],0,"hour"),N("h",["hh",2],0,ft),N("k",["kk",2],0,function(){return this.hours()||24}),N("hmm",0,0,function(){return""+ft.apply(this)+Y(this.minutes(),2)}),N("hmmss",0,0,function(){return""+ft.apply(this)+Y(this.minutes(),2)+Y(this.seconds(),2)}),N("Hmm",0,0,function(){return""+this.hours()+Y(this.minutes(),2)}),N("Hmmss",0,0,function(){return""+this.hours()+Y(this.minutes(),2)+Y(this.seconds(),2)}),gt("a",!0),gt("A",!1),T("hour","h"),O("hour",13),E("a",mt),E("A",mt),E("H",je),E("h",je),E("k",je),E("HH",je,Be),E("hh",je,Be),E("kk",je,Be),E("hmm",Ue),E("hmmss",qe),E("Hmm",Ue),E("Hmmss",qe),G(["H","HH"],ln),G(["k","kk"],function(t,e,n){var i=_(t);e[ln]=24===i?0:i}),G(["a","A"],function(t,e,n){n._isPm=n._locale.isPM(t),n._meridiem=t}),G(["h","hh"],function(t,e,n){e[ln]=_(t),g(n).bigHour=!0}),G("hmm",function(t,e,n){var i=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i)),g(n).bigHour=!0}),G("hmmss",function(t,e,n){var i=t.length-4,a=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i,2)),e[dn]=_(t.substr(a)),g(n).bigHour=!0}),G("Hmm",function(t,e,n){var i=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i))}),G("Hmmss",function(t,e,n){var i=t.length-4,a=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i,2)),e[dn]=_(t.substr(a))});var Pn,Tn=/[ap]\.?m?\.?/i,In=R("Hours",!0),An={calendar:Te,longDateFormat:Ie,invalidDate:"Invalid date",ordinal:"%d",dayOfMonthOrdinalParse:Ae,relativeTime:Oe,months:pn,monthsShort:vn,week:_n,weekdays:kn,weekdaysMin:Mn,weekdaysShort:wn,meridiemParse:Tn},On={},Fn={},Rn=/^\s*((?:[+-]\d{6}|\d{4})-(?:\d\d-\d\d|W\d\d-\d|W\d\d|\d\d\d|\d\d))(?:(T| )(\d\d(?::\d\d(?::\d\d(?:[.,]\d+)?)?)?)([\+\-]\d\d(?::?\d\d)?|\s*Z)?)?$/,Ln=/^\s*((?:[+-]\d{6}|\d{4})(?:\d\d\d\d|W\d\d\d|W\d\d|\d\d\d|\d\d))(?:(T| )(\d\d(?:\d\d(?:\d\d(?:[.,]\d+)?)?)?)([\+\-]\d\d(?::?\d\d)?|\s*Z)?)?$/,Wn=/Z|[+-]\d\d(?::?\d\d)?/,Yn=[["YYYYYY-MM-DD",/[+-]\d{6}-\d\d-\d\d/],["YYYY-MM-DD",/\d{4}-\d\d-\d\d/],["GGGG-[W]WW-E",/\d{4}-W\d\d-\d/],["GGGG-[W]WW",/\d{4}-W\d\d/,!1],["YYYY-DDD",/\d{4}-\d{3}/],["YYYY-MM",/\d{4}-\d\d/,!1],["YYYYYYMMDD",/[+-]\d{10}/],["YYYYMMDD",/\d{8}/],["GGGG[W]WWE",/\d{4}W\d{3}/],["GGGG[W]WW",/\d{4}W\d{2}/,!1],["YYYYDDD",/\d{7}/]],Nn=[["HH:mm:ss.SSSS",/\d\d:\d\d:\d\d\.\d+/],["HH:mm:ss,SSSS",/\d\d:\d\d:\d\d,\d+/],["HH:mm:ss",/\d\d:\d\d:\d\d/],["HH:mm",/\d\d:\d\d/],["HHmmss.SSSS",/\d\d\d\d\d\d\.\d+/],["HHmmss,SSSS",/\d\d\d\d\d\d,\d+/],["HHmmss",/\d\d\d\d\d\d/],["HHmm",/\d\d\d\d/],["HH",/\d\d/]],zn=/^\/?Date\((\-?\d+)/i,Bn=/^((?:Mon|Tue|Wed|Thu|Fri|Sat|Sun),?\s)?(\d?\d\s(?:Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)\s(?:\d\d)?\d\d\s)(\d\d:\d\d)(\:\d\d)?(\s(?:UT|GMT|[ECMP][SD]T|[A-IK-Za-ik-z]|[+-]\d{4}))$/;n.createFromInputFallback=M("value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are discouraged and will be removed in an upcoming major release. Please refer to http://momentjs.com/guides/#/warnings/js-date/ for more info.",function(t){t._d=new Date(t._i+(t._useUTC?" UTC":""))}),n.ISO_8601=function(){},n.RFC_2822=function(){};var Vn=M("moment().min is deprecated, use moment.max instead. http://momentjs.com/guides/#/warnings/min-max/",function(){var t=Nt.apply(null,arguments);return this.isValid()&&t.isValid()?tthis?this:t:p()}),En=["year","quarter","month","week","day","hour","minute","second","millisecond"];jt("Z",":"),jt("ZZ",""),E("Z",$e),E("ZZ",$e),G(["Z","ZZ"],function(t,e,n){n._useUTC=!0,n._tzm=Ut($e,t)});var jn=/([\+\-]|\d\d)/gi;n.updateOffset=function(){};var Un=/^(\-)?(?:(\d*)[. ])?(\d+)\:(\d+)(?:\:(\d+)(\.\d*)?)?$/,qn=/^(-)?P(?:(-?[0-9,.]*)Y)?(?:(-?[0-9,.]*)M)?(?:(-?[0-9,.]*)W)?(?:(-?[0-9,.]*)D)?(?:T(?:(-?[0-9,.]*)H)?(?:(-?[0-9,.]*)M)?(?:(-?[0-9,.]*)S)?)?$/;Xt.fn=Vt.prototype,Xt.invalid=function(){return Xt(NaN)};var Gn=$t(1,"add"),Zn=$t(-1,"subtract");n.defaultFormat="YYYY-MM-DDTHH:mm:ssZ",n.defaultFormatUtc="YYYY-MM-DDTHH:mm:ss[Z]";var Xn=M("moment().lang() is deprecated. Instead, use moment().localeData() to get the language configuration. Use moment().locale() to change languages.",function(t){return void 0===t?this.localeData():this.locale(t)});N(0,["gg",2],0,function(){return this.weekYear()%100}),N(0,["GG",2],0,function(){return this.isoWeekYear()%100}),ae("gggg","weekYear"),ae("ggggg","weekYear"),ae("GGGG","isoWeekYear"),ae("GGGGG","isoWeekYear"),T("weekYear","gg"),T("isoWeekYear","GG"),O("weekYear",1),O("isoWeekYear",1),E("G",Ke),E("g",Ke),E("GG",je,Be),E("gg",je,Be),E("GGGG",Ze,He),E("gggg",Ze,He),E("GGGGG",Xe,Ee),E("ggggg",Xe,Ee),Z(["gggg","ggggg","GGGG","GGGGG"],function(t,e,n,i){e[i.substr(0,2)]=_(t)}),Z(["gg","GG"],function(t,e,i,a){e[a]=n.parseTwoDigitYear(t)}),N("Q",0,"Qo","quarter"),T("quarter","Q"),O("quarter",7),E("Q",ze),G("Q",function(t,e){e[on]=3*(_(t)-1)}),N("D",["DD",2],"Do","date"),T("date","D"),O("date",9),E("D",je),E("DD",je,Be),E("Do",function(t,e){return t?e._dayOfMonthOrdinalParse||e._ordinalParse:e._dayOfMonthOrdinalParseLenient}),G(["D","DD"],sn),G("Do",function(t,e){e[sn]=_(t.match(je)[0],10)});var Jn=R("Date",!0);N("DDD",["DDDD",3],"DDDo","dayOfYear"),T("dayOfYear","DDD"),O("dayOfYear",4),E("DDD",Ge),E("DDDD",Ve),G(["DDD","DDDD"],function(t,e,n){n._dayOfYear=_(t)}),N("m",["mm",2],0,"minute"),T("minute","m"),O("minute",14),E("m",je),E("mm",je,Be),G(["m","mm"],un);var Kn=R("Minutes",!1);N("s",["ss",2],0,"second"),T("second","s"),O("second",15),E("s",je),E("ss",je,Be),G(["s","ss"],dn);var Qn=R("Seconds",!1);N("S",0,0,function(){return~~(this.millisecond()/100)}),N(0,["SS",2],0,function(){return~~(this.millisecond()/10)}),N(0,["SSS",3],0,"millisecond"),N(0,["SSSS",4],0,function(){return 10*this.millisecond()}),N(0,["SSSSS",5],0,function(){return 100*this.millisecond()}),N(0,["SSSSSS",6],0,function(){return 1e3*this.millisecond()}),N(0,["SSSSSSS",7],0,function(){return 1e4*this.millisecond()}),N(0,["SSSSSSSS",8],0,function(){return 1e5*this.millisecond()}),N(0,["SSSSSSSSS",9],0,function(){return 1e6*this.millisecond()}),T("millisecond","ms"),O("millisecond",16),E("S",Ge,ze),E("SS",Ge,Be),E("SSS",Ge,Ve);var $n;for($n="SSSS";$n.length<=9;$n+="S")E($n,Je);for($n="S";$n.length<=9;$n+="S")G($n,function(t,e){e[cn]=_(1e3*("0."+t))});var ti=R("Milliseconds",!1);N("z",0,0,"zoneAbbr"),N("zz",0,0,"zoneName");var ei=y.prototype;ei.add=Gn,ei.calendar=function(t,e){var i=t||Nt(),a=qt(i,this).startOf("day"),r=n.calendarFormat(this,a)||"sameElse",o=e&&(D(e[r])?e[r].call(this,i):e[r]);return this.format(o||this.localeData().calendar(r,this,Nt(i)))},ei.clone=function(){return new y(this)},ei.diff=function(t,e,n){var i,a,r,o;return this.isValid()&&(i=qt(t,this)).isValid()?(a=6e4*(i.utcOffset()-this.utcOffset()),"year"===(e=I(e))||"month"===e||"quarter"===e?(o=ee(this,i),"quarter"===e?o/=3:"year"===e&&(o/=12)):(r=this-i,o="second"===e?r/1e3:"minute"===e?r/6e4:"hour"===e?r/36e5:"day"===e?(r-a)/864e5:"week"===e?(r-a)/6048e5:r),n?o:x(o)):NaN},ei.endOf=function(t){return void 0===(t=I(t))||"millisecond"===t?this:("date"===t&&(t="day"),this.startOf(t).add(1,"isoWeek"===t?"week":t).subtract(1,"ms"))},ei.format=function(t){t||(t=this.isUtc()?n.defaultFormatUtc:n.defaultFormat);var e=V(this,t);return this.localeData().postformat(e)},ei.from=function(t,e){return this.isValid()&&(b(t)&&t.isValid()||Nt(t).isValid())?Xt({to:this,from:t}).locale(this.locale()).humanize(!e):this.localeData().invalidDate()},ei.fromNow=function(t){return this.from(Nt(),t)},ei.to=function(t,e){return this.isValid()&&(b(t)&&t.isValid()||Nt(t).isValid())?Xt({from:this,to:t}).locale(this.locale()).humanize(!e):this.localeData().invalidDate()},ei.toNow=function(t){return this.to(Nt(),t)},ei.get=function(t){return t=I(t),D(this[t])?this[t]():this},ei.invalidAt=function(){return g(this).overflow},ei.isAfter=function(t,e){var n=b(t)?t:Nt(t);return!(!this.isValid()||!n.isValid())&&("millisecond"===(e=I(o(e)?"millisecond":e))?this.valueOf()>n.valueOf():n.valueOf()9999?V(t,"YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]"):D(Date.prototype.toISOString)?this.toDate().toISOString():V(t,"YYYY-MM-DD[T]HH:mm:ss.SSS[Z]")},ei.inspect=function(){if(!this.isValid())return"moment.invalid(/* "+this._i+" */)";var t="moment",e="";this.isLocal()||(t=0===this.utcOffset()?"moment.utc":"moment.parseZone",e="Z");var n="["+t+'("]',i=0<=this.year()&&this.year()<=9999?"YYYY":"YYYYYY",a=e+'[")]';return this.format(n+i+"-MM-DD[T]HH:mm:ss.SSS"+a)},ei.toJSON=function(){return this.isValid()?this.toISOString():null},ei.toString=function(){return this.clone().locale("en").format("ddd MMM DD YYYY HH:mm:ss [GMT]ZZ")},ei.unix=function(){return Math.floor(this.valueOf()/1e3)},ei.valueOf=function(){return this._d.valueOf()-6e4*(this._offset||0)},ei.creationData=function(){return{input:this._i,format:this._f,locale:this._locale,isUTC:this._isUTC,strict:this._strict}},ei.year=xn,ei.isLeapYear=function(){return nt(this.year())},ei.weekYear=function(t){return re.call(this,t,this.week(),this.weekday(),this.localeData()._week.dow,this.localeData()._week.doy)},ei.isoWeekYear=function(t){return re.call(this,t,this.isoWeek(),this.isoWeekday(),1,4)},ei.quarter=ei.quarters=function(t){return null==t?Math.ceil((this.month()+1)/3):this.month(3*(t-1)+this.month()%3)},ei.month=$,ei.daysInMonth=function(){return J(this.year(),this.month())},ei.week=ei.weeks=function(t){var e=this.localeData().week(this);return null==t?e:this.add(7*(t-e),"d")},ei.isoWeek=ei.isoWeeks=function(t){var e=st(this,1,4).week;return null==t?e:this.add(7*(t-e),"d")},ei.weeksInYear=function(){var t=this.localeData()._week;return lt(this.year(),t.dow,t.doy)},ei.isoWeeksInYear=function(){return lt(this.year(),1,4)},ei.date=Jn,ei.day=ei.days=function(t){if(!this.isValid())return null!=t?this:NaN;var e=this._isUTC?this._d.getUTCDay():this._d.getDay();return null!=t?(t=ut(t,this.localeData()),this.add(t-e,"d")):e},ei.weekday=function(t){if(!this.isValid())return null!=t?this:NaN;var e=(this.day()+7-this.localeData()._week.dow)%7;return null==t?e:this.add(t-e,"d")},ei.isoWeekday=function(t){if(!this.isValid())return null!=t?this:NaN;if(null!=t){var e=dt(t,this.localeData());return this.day(this.day()%7?e:e-7)}return this.day()||7},ei.dayOfYear=function(t){var e=Math.round((this.clone().startOf("day")-this.clone().startOf("year"))/864e5)+1;return null==t?e:this.add(t-e,"d")},ei.hour=ei.hours=In,ei.minute=ei.minutes=Kn,ei.second=ei.seconds=Qn,ei.millisecond=ei.milliseconds=ti,ei.utcOffset=function(t,e,i){var a,r=this._offset||0;if(!this.isValid())return null!=t?this:NaN;if(null!=t){if("string"==typeof t){if(null===(t=Ut($e,t)))return this}else Math.abs(t)<16&&!i&&(t*=60);return!this._isUTC&&e&&(a=Gt(this)),this._offset=t,this._isUTC=!0,null!=a&&this.add(a,"m"),r!==t&&(!e||this._changeInProgress?te(this,Xt(t-r,"m"),1,!1):this._changeInProgress||(this._changeInProgress=!0,n.updateOffset(this,!0),this._changeInProgress=null)),this}return this._isUTC?r:Gt(this)},ei.utc=function(t){return this.utcOffset(0,t)},ei.local=function(t){return this._isUTC&&(this.utcOffset(0,t),this._isUTC=!1,t&&this.subtract(Gt(this),"m")),this},ei.parseZone=function(){if(null!=this._tzm)this.utcOffset(this._tzm,!1,!0);else if("string"==typeof this._i){var t=Ut(Qe,this._i);null!=t?this.utcOffset(t):this.utcOffset(0,!0)}return this},ei.hasAlignedHourOffset=function(t){return!!this.isValid()&&(t=t?Nt(t).utcOffset():0,(this.utcOffset()-t)%60==0)},ei.isDST=function(){return this.utcOffset()>this.clone().month(0).utcOffset()||this.utcOffset()>this.clone().month(5).utcOffset()},ei.isLocal=function(){return!!this.isValid()&&!this._isUTC},ei.isUtcOffset=function(){return!!this.isValid()&&this._isUTC},ei.isUtc=Zt,ei.isUTC=Zt,ei.zoneAbbr=function(){return this._isUTC?"UTC":""},ei.zoneName=function(){return this._isUTC?"Coordinated Universal Time":""},ei.dates=M("dates accessor is deprecated. Use date instead.",Jn),ei.months=M("months accessor is deprecated. Use month instead",$),ei.years=M("years accessor is deprecated. Use year instead",xn),ei.zone=M("moment().zone is deprecated, use moment().utcOffset instead. http://momentjs.com/guides/#/warnings/zone/",function(t,e){return null!=t?("string"!=typeof t&&(t=-t),this.utcOffset(t,e),this):-this.utcOffset()}),ei.isDSTShifted=M("isDSTShifted is deprecated. See http://momentjs.com/guides/#/warnings/dst-shifted/ for more information",function(){if(!o(this._isDSTShifted))return this._isDSTShifted;var t={};if(v(t,this),(t=Lt(t))._a){var e=t._isUTC?h(t._a):Nt(t._a);this._isDSTShifted=this.isValid()&&k(t._a,e.toArray())>0}else this._isDSTShifted=!1;return this._isDSTShifted});var ni=P.prototype;ni.calendar=function(t,e,n){var i=this._calendar[t]||this._calendar.sameElse;return D(i)?i.call(e,n):i},ni.longDateFormat=function(t){var e=this._longDateFormat[t],n=this._longDateFormat[t.toUpperCase()];return e||!n?e:(this._longDateFormat[t]=n.replace(/MMMM|MM|DD|dddd/g,function(t){return t.slice(1)}),this._longDateFormat[t])},ni.invalidDate=function(){return this._invalidDate},ni.ordinal=function(t){return this._ordinal.replace("%d",t)},ni.preparse=se,ni.postformat=se,ni.relativeTime=function(t,e,n,i){var a=this._relativeTime[n];return D(a)?a(t,e,n,i):a.replace(/%d/i,t)},ni.pastFuture=function(t,e){var n=this._relativeTime[t>0?"future":"past"];return D(n)?n(e):n.replace(/%s/i,e)},ni.set=function(t){var e,n;for(n in t)D(e=t[n])?this[n]=e:this["_"+n]=e;this._config=t,this._dayOfMonthOrdinalParseLenient=new RegExp((this._dayOfMonthOrdinalParse.source||this._ordinalParse.source)+"|"+/\d{1,2}/.source)},ni.months=function(t,e){return t?i(this._months)?this._months[t.month()]:this._months[(this._months.isFormat||mn).test(e)?"format":"standalone"][t.month()]:i(this._months)?this._months:this._months.standalone},ni.monthsShort=function(t,e){return t?i(this._monthsShort)?this._monthsShort[t.month()]:this._monthsShort[mn.test(e)?"format":"standalone"][t.month()]:i(this._monthsShort)?this._monthsShort:this._monthsShort.standalone},ni.monthsParse=function(t,e,n){var i,a,r;if(this._monthsParseExact)return K.call(this,t,e,n);for(this._monthsParse||(this._monthsParse=[],this._longMonthsParse=[],this._shortMonthsParse=[]),i=0;i<12;i++){if(a=h([2e3,i]),n&&!this._longMonthsParse[i]&&(this._longMonthsParse[i]=new RegExp("^"+this.months(a,"").replace(".","")+"$","i"),this._shortMonthsParse[i]=new RegExp("^"+this.monthsShort(a,"").replace(".","")+"$","i")),n||this._monthsParse[i]||(r="^"+this.months(a,"")+"|^"+this.monthsShort(a,""),this._monthsParse[i]=new RegExp(r.replace(".",""),"i")),n&&"MMMM"===e&&this._longMonthsParse[i].test(t))return i;if(n&&"MMM"===e&&this._shortMonthsParse[i].test(t))return i;if(!n&&this._monthsParse[i].test(t))return i}},ni.monthsRegex=function(t){return this._monthsParseExact?(d(this,"_monthsRegex")||tt.call(this),t?this._monthsStrictRegex:this._monthsRegex):(d(this,"_monthsRegex")||(this._monthsRegex=bn),this._monthsStrictRegex&&t?this._monthsStrictRegex:this._monthsRegex)},ni.monthsShortRegex=function(t){return this._monthsParseExact?(d(this,"_monthsRegex")||tt.call(this),t?this._monthsShortStrictRegex:this._monthsShortRegex):(d(this,"_monthsShortRegex")||(this._monthsShortRegex=yn),this._monthsShortStrictRegex&&t?this._monthsShortStrictRegex:this._monthsShortRegex)},ni.week=function(t){return st(t,this._week.dow,this._week.doy).week},ni.firstDayOfYear=function(){return this._week.doy},ni.firstDayOfWeek=function(){return this._week.dow},ni.weekdays=function(t,e){return t?i(this._weekdays)?this._weekdays[t.day()]:this._weekdays[this._weekdays.isFormat.test(e)?"format":"standalone"][t.day()]:i(this._weekdays)?this._weekdays:this._weekdays.standalone},ni.weekdaysMin=function(t){return t?this._weekdaysMin[t.day()]:this._weekdaysMin},ni.weekdaysShort=function(t){return t?this._weekdaysShort[t.day()]:this._weekdaysShort},ni.weekdaysParse=function(t,e,n){var i,a,r;if(this._weekdaysParseExact)return ct.call(this,t,e,n);for(this._weekdaysParse||(this._weekdaysParse=[],this._minWeekdaysParse=[],this._shortWeekdaysParse=[],this._fullWeekdaysParse=[]),i=0;i<7;i++){if(a=h([2e3,1]).day(i),n&&!this._fullWeekdaysParse[i]&&(this._fullWeekdaysParse[i]=new RegExp("^"+this.weekdays(a,"").replace(".",".?")+"$","i"),this._shortWeekdaysParse[i]=new RegExp("^"+this.weekdaysShort(a,"").replace(".",".?")+"$","i"),this._minWeekdaysParse[i]=new RegExp("^"+this.weekdaysMin(a,"").replace(".",".?")+"$","i")),this._weekdaysParse[i]||(r="^"+this.weekdays(a,"")+"|^"+this.weekdaysShort(a,"")+"|^"+this.weekdaysMin(a,""),this._weekdaysParse[i]=new RegExp(r.replace(".",""),"i")),n&&"dddd"===e&&this._fullWeekdaysParse[i].test(t))return i;if(n&&"ddd"===e&&this._shortWeekdaysParse[i].test(t))return i;if(n&&"dd"===e&&this._minWeekdaysParse[i].test(t))return i;if(!n&&this._weekdaysParse[i].test(t))return i}},ni.weekdaysRegex=function(t){return this._weekdaysParseExact?(d(this,"_weekdaysRegex")||ht.call(this),t?this._weekdaysStrictRegex:this._weekdaysRegex):(d(this,"_weekdaysRegex")||(this._weekdaysRegex=Sn),this._weekdaysStrictRegex&&t?this._weekdaysStrictRegex:this._weekdaysRegex)},ni.weekdaysShortRegex=function(t){return this._weekdaysParseExact?(d(this,"_weekdaysRegex")||ht.call(this),t?this._weekdaysShortStrictRegex:this._weekdaysShortRegex):(d(this,"_weekdaysShortRegex")||(this._weekdaysShortRegex=Dn),this._weekdaysShortStrictRegex&&t?this._weekdaysShortStrictRegex:this._weekdaysShortRegex)},ni.weekdaysMinRegex=function(t){return this._weekdaysParseExact?(d(this,"_weekdaysRegex")||ht.call(this),t?this._weekdaysMinStrictRegex:this._weekdaysMinRegex):(d(this,"_weekdaysMinRegex")||(this._weekdaysMinRegex=Cn),this._weekdaysMinStrictRegex&&t?this._weekdaysMinStrictRegex:this._weekdaysMinRegex)},ni.isPM=function(t){return"p"===(t+"").toLowerCase().charAt(0)},ni.meridiem=function(t,e,n){return t>11?n?"pm":"PM":n?"am":"AM"},bt("en",{dayOfMonthOrdinalParse:/\d{1,2}(th|st|nd|rd)/,ordinal:function(t){var e=t%10;return t+(1===_(t%100/10)?"th":1===e?"st":2===e?"nd":3===e?"rd":"th")}}),n.lang=M("moment.lang is deprecated. Use moment.locale instead.",bt),n.langData=M("moment.langData is deprecated. Use moment.localeData instead.",_t);var ii=Math.abs,ai=me("ms"),ri=me("s"),oi=me("m"),si=me("h"),li=me("d"),ui=me("w"),di=me("M"),ci=me("y"),hi=pe("milliseconds"),fi=pe("seconds"),gi=pe("minutes"),mi=pe("hours"),pi=pe("days"),vi=pe("months"),yi=pe("years"),bi=Math.round,xi={ss:44,s:45,m:45,h:22,d:26,M:11},_i=Math.abs,ki=Vt.prototype;return ki.isValid=function(){return this._isValid},ki.abs=function(){var t=this._data;return this._milliseconds=ii(this._milliseconds),this._days=ii(this._days),this._months=ii(this._months),t.milliseconds=ii(t.milliseconds),t.seconds=ii(t.seconds),t.minutes=ii(t.minutes),t.hours=ii(t.hours),t.months=ii(t.months),t.years=ii(t.years),this},ki.add=function(t,e){return ce(this,t,e,1)},ki.subtract=function(t,e){return ce(this,t,e,-1)},ki.as=function(t){if(!this.isValid())return NaN;var e,n,i=this._milliseconds;if("month"===(t=I(t))||"year"===t)return e=this._days+i/864e5,n=this._months+fe(e),"month"===t?n:n/12;switch(e=this._days+Math.round(ge(this._months)),t){case"week":return e/7+i/6048e5;case"day":return e+i/864e5;case"hour":return 24*e+i/36e5;case"minute":return 1440*e+i/6e4;case"second":return 86400*e+i/1e3;case"millisecond":return Math.floor(864e5*e)+i;default:throw new Error("Unknown unit "+t)}},ki.asMilliseconds=ai,ki.asSeconds=ri,ki.asMinutes=oi,ki.asHours=si,ki.asDays=li,ki.asWeeks=ui,ki.asMonths=di,ki.asYears=ci,ki.valueOf=function(){return this.isValid()?this._milliseconds+864e5*this._days+this._months%12*2592e6+31536e6*_(this._months/12):NaN},ki._bubble=function(){var t,e,n,i,a,r=this._milliseconds,o=this._days,s=this._months,l=this._data;return r>=0&&o>=0&&s>=0||r<=0&&o<=0&&s<=0||(r+=864e5*he(ge(s)+o),o=0,s=0),l.milliseconds=r%1e3,t=x(r/1e3),l.seconds=t%60,e=x(t/60),l.minutes=e%60,n=x(e/60),l.hours=n%24,o+=x(n/24),a=x(fe(o)),s+=a,o-=he(ge(a)),i=x(s/12),s%=12,l.days=o,l.months=s,l.years=i,this},ki.get=function(t){return t=I(t),this.isValid()?this[t+"s"]():NaN},ki.milliseconds=hi,ki.seconds=fi,ki.minutes=gi,ki.hours=mi,ki.days=pi,ki.weeks=function(){return x(this.days()/7)},ki.months=vi,ki.years=yi,ki.humanize=function(t){if(!this.isValid())return this.localeData().invalidDate();var e=this.localeData(),n=ye(this,!t,e);return t&&(n=e.pastFuture(+this,n)),e.postformat(n)},ki.toISOString=be,ki.toString=be,ki.toJSON=be,ki.locale=ne,ki.localeData=ie,ki.toIsoString=M("toIsoString() is deprecated. Please use toISOString() instead (notice the capitals)",be),ki.lang=Xn,N("X",0,0,"unix"),N("x",0,0,"valueOf"),E("x",Ke),E("X",tn),G("X",function(t,e,n){n._d=new Date(1e3*parseFloat(t,10))}),G("x",function(t,e,n){n._d=new Date(_(t))}),n.version="2.18.1",function(t){xe=t}(Nt),n.fn=ei,n.min=function(){return zt("isBefore",[].slice.call(arguments,0))},n.max=function(){return zt("isAfter",[].slice.call(arguments,0))},n.now=function(){return Date.now?Date.now():+new Date},n.utc=h,n.unix=function(t){return Nt(1e3*t)},n.months=function(t,e){return ue(t,e,"months")},n.isDate=l,n.locale=bt,n.invalid=p,n.duration=Xt,n.isMoment=b,n.weekdays=function(t,e,n){return de(t,e,n,"weekdays")},n.parseZone=function(){return Nt.apply(null,arguments).parseZone()},n.localeData=_t,n.isDuration=Ht,n.monthsShort=function(t,e){return ue(t,e,"monthsShort")},n.weekdaysMin=function(t,e,n){return de(t,e,n,"weekdaysMin")},n.defineLocale=xt,n.updateLocale=function(t,e){if(null!=e){var n,i=An;null!=On[t]&&(i=On[t]._config),(n=new P(e=C(i,e))).parentLocale=On[t],On[t]=n,bt(t)}else null!=On[t]&&(null!=On[t].parentLocale?On[t]=On[t].parentLocale:null!=On[t]&&delete On[t]);return On[t]},n.locales=function(){return Pe(On)},n.weekdaysShort=function(t,e,n){return de(t,e,n,"weekdaysShort")},n.normalizeUnits=I,n.relativeTimeRounding=function(t){return void 0===t?bi:"function"==typeof t&&(bi=t,!0)},n.relativeTimeThreshold=function(t,e){return void 0!==xi[t]&&(void 0===e?xi[t]:(xi[t]=e,"s"===t&&(xi.ss=e-1),!0))},n.calendarFormat=function(t,e){var n=t.diff(e,"days",!0);return n<-6?"sameElse":n<-1?"lastWeek":n<0?"lastDay":n<1?"sameDay":n<2?"nextDay":n<7?"nextWeek":"sameElse"},n.prototype=ei,n})},{}],7:[function(t,e,n){var i=t(29)();i.helpers=t(45),t(27)(i),i.defaults=t(25),i.Element=t(26),i.elements=t(40),i.Interaction=t(28),i.platform=t(48),t(31)(i),t(22)(i),t(23)(i),t(24)(i),t(30)(i),t(33)(i),t(32)(i),t(35)(i),t(54)(i),t(52)(i),t(53)(i),t(55)(i),t(56)(i),t(57)(i),t(15)(i),t(16)(i),t(17)(i),t(18)(i),t(19)(i),t(20)(i),t(21)(i),t(8)(i),t(9)(i),t(10)(i),t(11)(i),t(12)(i),t(13)(i),t(14)(i);var a=[];a.push(t(49)(i),t(50)(i),t(51)(i)),i.plugins.register(a),i.platform.initialize(),e.exports=i,"undefined"!=typeof window&&(window.Chart=i),i.canvasHelpers=i.helpers.canvas},{10:10,11:11,12:12,13:13,14:14,15:15,16:16,17:17,18:18,19:19,20:20,21:21,22:22,23:23,24:24,25:25,26:26,27:27,28:28,29:29,30:30,31:31,32:32,33:33,35:35,40:40,45:45,48:48,49:49,50:50,51:51,52:52,53:53,54:54,55:55,56:56,57:57,8:8,9:9}],8:[function(t,e,n){"use strict";e.exports=function(t){t.Bar=function(e,n){return n.type="bar",new t(e,n)}}},{}],9:[function(t,e,n){"use strict";e.exports=function(t){t.Bubble=function(e,n){return n.type="bubble",new t(e,n)}}},{}],10:[function(t,e,n){"use strict";e.exports=function(t){t.Doughnut=function(e,n){return n.type="doughnut",new t(e,n)}}},{}],11:[function(t,e,n){"use strict";e.exports=function(t){t.Line=function(e,n){return n.type="line",new t(e,n)}}},{}],12:[function(t,e,n){"use strict";e.exports=function(t){t.PolarArea=function(e,n){return n.type="polarArea",new t(e,n)}}},{}],13:[function(t,e,n){"use strict";e.exports=function(t){t.Radar=function(e,n){return n.type="radar",new t(e,n)}}},{}],14:[function(t,e,n){"use strict";e.exports=function(t){t.Scatter=function(e,n){return n.type="scatter",new t(e,n)}}},{}],15:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("bar",{hover:{mode:"label"},scales:{xAxes:[{type:"category",categoryPercentage:.8,barPercentage:.9,offset:!0,gridLines:{offsetGridLines:!0}}],yAxes:[{type:"linear"}]}}),i._set("horizontalBar",{hover:{mode:"index",axis:"y"},scales:{xAxes:[{type:"linear",position:"bottom"}],yAxes:[{position:"left",type:"category",categoryPercentage:.8,barPercentage:.9,offset:!0,gridLines:{offsetGridLines:!0}}]},elements:{rectangle:{borderSkipped:"left"}},tooltips:{callbacks:{title:function(t,e){var n="";return t.length>0&&(t[0].yLabel?n=t[0].yLabel:e.labels.length>0&&t[0].index=0&&a>0)&&(p+=a));return r=c.getPixelForValue(p),o=c.getPixelForValue(p+f),s=(o-r)/2,{size:s,base:r,head:o,center:o+s/2}},calculateBarIndexPixels:function(t,e,n){var i,a,o,s,l,u,d=this,c=n.scale.options,h=d.getStackIndex(t),f=n.pixels,g=f[e],m=f.length,p=n.start,v=n.end;return 1===m?(i=g>p?g-p:v-g,a=g0&&(i=(g-f[e-1])/2,e===m-1&&(a=i)),e');var n=t.data,i=n.datasets,a=n.labels;if(i.length)for(var r=0;r'),a[r]&&e.push(a[r]),e.push("");return e.push(""),e.join("")},legend:{labels:{generateLabels:function(t){var e=t.data;return e.labels.length&&e.datasets.length?e.labels.map(function(n,i){var a=t.getDatasetMeta(0),o=e.datasets[0],s=a.data[i],l=s&&s.custom||{},u=r.valueAtIndexOrDefault,d=t.options.elements.arc;return{text:n,fillStyle:l.backgroundColor?l.backgroundColor:u(o.backgroundColor,i,d.backgroundColor),strokeStyle:l.borderColor?l.borderColor:u(o.borderColor,i,d.borderColor),lineWidth:l.borderWidth?l.borderWidth:u(o.borderWidth,i,d.borderWidth),hidden:isNaN(o.data[i])||a.data[i].hidden,index:i}}):[]}},onClick:function(t,e){var n,i,a,r=e.index,o=this.chart;for(n=0,i=(o.data.datasets||[]).length;n=Math.PI?-1:g<-Math.PI?1:0))+f,p={x:Math.cos(g),y:Math.sin(g)},v={x:Math.cos(m),y:Math.sin(m)},y=g<=0&&m>=0||g<=2*Math.PI&&2*Math.PI<=m,b=g<=.5*Math.PI&&.5*Math.PI<=m||g<=2.5*Math.PI&&2.5*Math.PI<=m,x=g<=-Math.PI&&-Math.PI<=m||g<=Math.PI&&Math.PI<=m,_=g<=.5*-Math.PI&&.5*-Math.PI<=m||g<=1.5*Math.PI&&1.5*Math.PI<=m,k=h/100,w={x:x?-1:Math.min(p.x*(p.x<0?1:k),v.x*(v.x<0?1:k)),y:_?-1:Math.min(p.y*(p.y<0?1:k),v.y*(v.y<0?1:k))},M={x:y?1:Math.max(p.x*(p.x>0?1:k),v.x*(v.x>0?1:k)),y:b?1:Math.max(p.y*(p.y>0?1:k),v.y*(v.y>0?1:k))},S={width:.5*(M.x-w.x),height:.5*(M.y-w.y)};u=Math.min(s/S.width,l/S.height),d={x:-.5*(M.x+w.x),y:-.5*(M.y+w.y)}}n.borderWidth=e.getMaxBorderWidth(c.data),n.outerRadius=Math.max((u-n.borderWidth)/2,0),n.innerRadius=Math.max(h?n.outerRadius/100*h:0,0),n.radiusLength=(n.outerRadius-n.innerRadius)/n.getVisibleDatasetCount(),n.offsetX=d.x*n.outerRadius,n.offsetY=d.y*n.outerRadius,c.total=e.calculateTotal(),e.outerRadius=n.outerRadius-n.radiusLength*e.getRingIndex(e.index),e.innerRadius=Math.max(e.outerRadius-n.radiusLength,0),r.each(c.data,function(n,i){e.updateElement(n,i,t)})},updateElement:function(t,e,n){var i=this,a=i.chart,o=a.chartArea,s=a.options,l=s.animation,u=(o.left+o.right)/2,d=(o.top+o.bottom)/2,c=s.rotation,h=s.rotation,f=i.getDataset(),g=n&&l.animateRotate?0:t.hidden?0:i.calculateCircumference(f.data[e])*(s.circumference/(2*Math.PI)),m=n&&l.animateScale?0:i.innerRadius,p=n&&l.animateScale?0:i.outerRadius,v=r.valueAtIndexOrDefault;r.extend(t,{_datasetIndex:i.index,_index:e,_model:{x:u+a.offsetX,y:d+a.offsetY,startAngle:c,endAngle:h,circumference:g,outerRadius:p,innerRadius:m,label:v(f.label,e,a.data.labels[e])}});var y=t._model;this.removeHoverStyle(t),n&&l.animateRotate||(y.startAngle=0===e?s.rotation:i.getMeta().data[e-1]._model.endAngle,y.endAngle=y.startAngle+y.circumference),t.pivot()},removeHoverStyle:function(e){t.DatasetController.prototype.removeHoverStyle.call(this,e,this.chart.options.elements.arc)},calculateTotal:function(){var t,e=this.getDataset(),n=this.getMeta(),i=0;return r.each(n.data,function(n,a){t=e.data[a],isNaN(t)||n.hidden||(i+=Math.abs(t))}),i},calculateCircumference:function(t){var e=this.getMeta().total;return e>0&&!isNaN(t)?2*Math.PI*(t/e):0},getMaxBorderWidth:function(t){for(var e,n,i=0,a=this.index,r=t.length,o=0;o(i=e>i?e:i)?n:i;return i}})}},{25:25,40:40,45:45}],18:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("line",{showLines:!0,spanGaps:!1,hover:{mode:"label"},scales:{xAxes:[{type:"category",id:"x-axis-0"}],yAxes:[{type:"linear",id:"y-axis-0"}]}}),e.exports=function(t){function e(t,e){return r.valueOrDefault(t.showLine,e.showLines)}t.controllers.line=t.DatasetController.extend({datasetElementType:a.Line,dataElementType:a.Point,update:function(t){var n,i,a,o=this,s=o.getMeta(),l=s.dataset,u=s.data||[],d=o.chart.options,c=d.elements.line,h=o.getScaleForId(s.yAxisID),f=o.getDataset(),g=e(f,d);for(g&&(a=l.custom||{},void 0!==f.tension&&void 0===f.lineTension&&(f.lineTension=f.tension),l._scale=h,l._datasetIndex=o.index,l._children=u,l._model={spanGaps:f.spanGaps?f.spanGaps:d.spanGaps,tension:a.tension?a.tension:r.valueOrDefault(f.lineTension,c.tension),backgroundColor:a.backgroundColor?a.backgroundColor:f.backgroundColor||c.backgroundColor,borderWidth:a.borderWidth?a.borderWidth:f.borderWidth||c.borderWidth,borderColor:a.borderColor?a.borderColor:f.borderColor||c.borderColor,borderCapStyle:a.borderCapStyle?a.borderCapStyle:f.borderCapStyle||c.borderCapStyle,borderDash:a.borderDash?a.borderDash:f.borderDash||c.borderDash,borderDashOffset:a.borderDashOffset?a.borderDashOffset:f.borderDashOffset||c.borderDashOffset,borderJoinStyle:a.borderJoinStyle?a.borderJoinStyle:f.borderJoinStyle||c.borderJoinStyle,fill:a.fill?a.fill:void 0!==f.fill?f.fill:c.fill,steppedLine:a.steppedLine?a.steppedLine:r.valueOrDefault(f.steppedLine,c.stepped),cubicInterpolationMode:a.cubicInterpolationMode?a.cubicInterpolationMode:r.valueOrDefault(f.cubicInterpolationMode,c.cubicInterpolationMode)},l.pivot()),n=0,i=u.length;n');var n=t.data,i=n.datasets,a=n.labels;if(i.length)for(var r=0;r'),a[r]&&e.push(a[r]),e.push("");return e.push(""),e.join("")},legend:{labels:{generateLabels:function(t){var e=t.data;return e.labels.length&&e.datasets.length?e.labels.map(function(n,i){var a=t.getDatasetMeta(0),o=e.datasets[0],s=a.data[i].custom||{},l=r.valueAtIndexOrDefault,u=t.options.elements.arc;return{text:n,fillStyle:s.backgroundColor?s.backgroundColor:l(o.backgroundColor,i,u.backgroundColor),strokeStyle:s.borderColor?s.borderColor:l(o.borderColor,i,u.borderColor),lineWidth:s.borderWidth?s.borderWidth:l(o.borderWidth,i,u.borderWidth),hidden:isNaN(o.data[i])||a.data[i].hidden,index:i}}):[]}},onClick:function(t,e){var n,i,a,r=e.index,o=this.chart;for(n=0,i=(o.data.datasets||[]).length;n0&&!isNaN(t)?2*Math.PI/e:0}})}},{25:25,40:40,45:45}],20:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("radar",{scale:{type:"radialLinear"},elements:{line:{tension:0}}}),e.exports=function(t){t.controllers.radar=t.DatasetController.extend({datasetElementType:a.Line,dataElementType:a.Point,linkScales:r.noop,update:function(t){var e=this,n=e.getMeta(),i=n.dataset,a=n.data,o=i.custom||{},s=e.getDataset(),l=e.chart.options.elements.line,u=e.chart.scale;void 0!==s.tension&&void 0===s.lineTension&&(s.lineTension=s.tension),r.extend(n.dataset,{_datasetIndex:e.index,_scale:u,_children:a,_loop:!0,_model:{tension:o.tension?o.tension:r.valueOrDefault(s.lineTension,l.tension),backgroundColor:o.backgroundColor?o.backgroundColor:s.backgroundColor||l.backgroundColor,borderWidth:o.borderWidth?o.borderWidth:s.borderWidth||l.borderWidth,borderColor:o.borderColor?o.borderColor:s.borderColor||l.borderColor,fill:o.fill?o.fill:void 0!==s.fill?s.fill:l.fill,borderCapStyle:o.borderCapStyle?o.borderCapStyle:s.borderCapStyle||l.borderCapStyle,borderDash:o.borderDash?o.borderDash:s.borderDash||l.borderDash,borderDashOffset:o.borderDashOffset?o.borderDashOffset:s.borderDashOffset||l.borderDashOffset,borderJoinStyle:o.borderJoinStyle?o.borderJoinStyle:s.borderJoinStyle||l.borderJoinStyle}}),n.dataset.pivot(),r.each(a,function(n,i){e.updateElement(n,i,t)},e),e.updateBezierControlPoints()},updateElement:function(t,e,n){var i=this,a=t.custom||{},o=i.getDataset(),s=i.chart.scale,l=i.chart.options.elements.point,u=s.getPointPositionForValue(e,o.data[e]);void 0!==o.radius&&void 0===o.pointRadius&&(o.pointRadius=o.radius),void 0!==o.hitRadius&&void 0===o.pointHitRadius&&(o.pointHitRadius=o.hitRadius),r.extend(t,{_datasetIndex:i.index,_index:e,_scale:s,_model:{x:n?s.xCenter:u.x,y:n?s.yCenter:u.y,tension:a.tension?a.tension:r.valueOrDefault(o.lineTension,i.chart.options.elements.line.tension),radius:a.radius?a.radius:r.valueAtIndexOrDefault(o.pointRadius,e,l.radius),backgroundColor:a.backgroundColor?a.backgroundColor:r.valueAtIndexOrDefault(o.pointBackgroundColor,e,l.backgroundColor),borderColor:a.borderColor?a.borderColor:r.valueAtIndexOrDefault(o.pointBorderColor,e,l.borderColor),borderWidth:a.borderWidth?a.borderWidth:r.valueAtIndexOrDefault(o.pointBorderWidth,e,l.borderWidth),pointStyle:a.pointStyle?a.pointStyle:r.valueAtIndexOrDefault(o.pointStyle,e,l.pointStyle),hitRadius:a.hitRadius?a.hitRadius:r.valueAtIndexOrDefault(o.pointHitRadius,e,l.hitRadius)}}),t._model.skip=a.skip?a.skip:isNaN(t._model.x)||isNaN(t._model.y)},updateBezierControlPoints:function(){var t=this.chart.chartArea,e=this.getMeta();r.each(e.data,function(n,i){var a=n._model,o=r.splineCurve(r.previousItem(e.data,i,!0)._model,a,r.nextItem(e.data,i,!0)._model,a.tension);a.controlPointPreviousX=Math.max(Math.min(o.previous.x,t.right),t.left),a.controlPointPreviousY=Math.max(Math.min(o.previous.y,t.bottom),t.top),a.controlPointNextX=Math.max(Math.min(o.next.x,t.right),t.left),a.controlPointNextY=Math.max(Math.min(o.next.y,t.bottom),t.top),n.pivot()})},setHoverStyle:function(t){var e=this.chart.data.datasets[t._datasetIndex],n=t.custom||{},i=t._index,a=t._model;a.radius=n.hoverRadius?n.hoverRadius:r.valueAtIndexOrDefault(e.pointHoverRadius,i,this.chart.options.elements.point.hoverRadius),a.backgroundColor=n.hoverBackgroundColor?n.hoverBackgroundColor:r.valueAtIndexOrDefault(e.pointHoverBackgroundColor,i,r.getHoverColor(a.backgroundColor)),a.borderColor=n.hoverBorderColor?n.hoverBorderColor:r.valueAtIndexOrDefault(e.pointHoverBorderColor,i,r.getHoverColor(a.borderColor)),a.borderWidth=n.hoverBorderWidth?n.hoverBorderWidth:r.valueAtIndexOrDefault(e.pointHoverBorderWidth,i,a.borderWidth)},removeHoverStyle:function(t){var e=this.chart.data.datasets[t._datasetIndex],n=t.custom||{},i=t._index,a=t._model,o=this.chart.options.elements.point;a.radius=n.radius?n.radius:r.valueAtIndexOrDefault(e.pointRadius,i,o.radius),a.backgroundColor=n.backgroundColor?n.backgroundColor:r.valueAtIndexOrDefault(e.pointBackgroundColor,i,o.backgroundColor),a.borderColor=n.borderColor?n.borderColor:r.valueAtIndexOrDefault(e.pointBorderColor,i,o.borderColor),a.borderWidth=n.borderWidth?n.borderWidth:r.valueAtIndexOrDefault(e.pointBorderWidth,i,o.borderWidth)}})}},{25:25,40:40,45:45}],21:[function(t,e,n){"use strict";t(25)._set("scatter",{hover:{mode:"single"},scales:{xAxes:[{id:"x-axis-1",type:"linear",position:"bottom"}],yAxes:[{id:"y-axis-1",type:"linear",position:"left"}]},showLines:!1,tooltips:{callbacks:{title:function(){return""},label:function(t){return"("+t.xLabel+", "+t.yLabel+")"}}}}),e.exports=function(t){t.controllers.scatter=t.controllers.line}},{25:25}],22:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45);i._set("global",{animation:{duration:1e3,easing:"easeOutQuart",onProgress:r.noop,onComplete:r.noop}}),e.exports=function(t){t.Animation=a.extend({chart:null,currentStep:0,numSteps:60,easing:"",render:null,onAnimationProgress:null,onAnimationComplete:null}),t.animationService={frameDuration:17,animations:[],dropFrames:0,request:null,addAnimation:function(t,e,n,i){var a,r,o=this.animations;for(e.chart=t,i||(t.animating=!0),a=0,r=o.length;a1&&(n=Math.floor(t.dropFrames),t.dropFrames=t.dropFrames%1),t.advance(1+n);var i=Date.now();t.dropFrames+=(i-e)/t.frameDuration,t.animations.length>0&&t.requestAnimationFrame()},advance:function(t){for(var e,n,i=this.animations,a=0;a=e.numSteps?(r.callback(e.onAnimationComplete,[e],n),n.animating=!1,i.splice(a,1)):++a}},Object.defineProperty(t.Animation.prototype,"animationObject",{get:function(){return this}}),Object.defineProperty(t.Animation.prototype,"chartInstance",{get:function(){return this.chart},set:function(t){this.chart=t}})}},{25:25,26:26,45:45}],23:[function(t,e,n){"use strict";var i=t(25),a=t(45),r=t(28),o=t(48);e.exports=function(t){function e(t){var e=(t=t||{}).data=t.data||{};return e.datasets=e.datasets||[],e.labels=e.labels||[],t.options=a.configMerge(i.global,i[t.type],t.options||{}),t}function n(t){var e=t.options;e.scale?t.scale.options=e.scale:e.scales&&e.scales.xAxes.concat(e.scales.yAxes).forEach(function(e){t.scales[e.id].options=e}),t.tooltip._options=e.tooltips}function s(t){return"top"===t||"bottom"===t}var l=t.plugins;t.types={},t.instances={},t.controllers={},a.extend(t.prototype,{construct:function(n,i){var r=this;i=e(i);var s=o.acquireContext(n,i),l=s&&s.canvas,u=l&&l.height,d=l&&l.width;r.id=a.uid(),r.ctx=s,r.canvas=l,r.config=i,r.width=d,r.height=u,r.aspectRatio=u?d/u:null,r.options=i.options,r._bufferedRender=!1,r.chart=r,r.controller=r,t.instances[r.id]=r,Object.defineProperty(r,"data",{get:function(){return r.config.data},set:function(t){r.config.data=t}}),s&&l?(r.initialize(),r.update()):console.error("Failed to create chart: can't acquire context from the given item")},initialize:function(){var t=this;return l.notify(t,"beforeInit"),a.retinaScale(t,t.options.devicePixelRatio),t.bindEvents(),t.options.responsive&&t.resize(!0),t.ensureScalesHaveIDs(),t.buildScales(),t.initToolTip(),l.notify(t,"afterInit"),t},clear:function(){return a.canvas.clear(this),this},stop:function(){return t.animationService.cancelAnimation(this),this},resize:function(t){var e=this,n=e.options,i=e.canvas,r=n.maintainAspectRatio&&e.aspectRatio||null,o=Math.max(0,Math.floor(a.getMaximumWidth(i))),s=Math.max(0,Math.floor(r?o/r:a.getMaximumHeight(i)));if((e.width!==o||e.height!==s)&&(i.width=e.width=o,i.height=e.height=s,i.style.width=o+"px",i.style.height=s+"px",a.retinaScale(e,n.devicePixelRatio),!t)){var u={width:o,height:s};l.notify(e,"resize",[u]),e.options.onResize&&e.options.onResize(e,u),e.stop(),e.update(e.options.responsiveAnimationDuration)}},ensureScalesHaveIDs:function(){var t=this.options,e=t.scales||{},n=t.scale;a.each(e.xAxes,function(t,e){t.id=t.id||"x-axis-"+e}),a.each(e.yAxes,function(t,e){t.id=t.id||"y-axis-"+e}),n&&(n.id=n.id||"scale")},buildScales:function(){var e=this,n=e.options,i=e.scales={},r=[];n.scales&&(r=r.concat((n.scales.xAxes||[]).map(function(t){return{options:t,dtype:"category",dposition:"bottom"}}),(n.scales.yAxes||[]).map(function(t){return{options:t,dtype:"linear",dposition:"left"}}))),n.scale&&r.push({options:n.scale,dtype:"radialLinear",isDefault:!0,dposition:"chartArea"}),a.each(r,function(n){var r=n.options,o=a.valueOrDefault(r.type,n.dtype),l=t.scaleService.getScaleConstructor(o);if(l){s(r.position)!==s(n.dposition)&&(r.position=n.dposition);var u=new l({id:r.id,options:r,ctx:e.ctx,chart:e});i[u.id]=u,u.mergeTicksOptions(),n.isDefault&&(e.scale=u)}}),t.scaleService.addScalesToLayout(this)},buildOrUpdateControllers:function(){var e=this,n=[],i=[];return a.each(e.data.datasets,function(a,r){var o=e.getDatasetMeta(r),s=a.type||e.config.type;if(o.type&&o.type!==s&&(e.destroyDatasetMeta(r),o=e.getDatasetMeta(r)),o.type=s,n.push(o.type),o.controller)o.controller.updateIndex(r);else{var l=t.controllers[o.type];if(void 0===l)throw new Error('"'+o.type+'" is not a chart type.');o.controller=new l(e,r),i.push(o.controller)}},e),i},resetElements:function(){var t=this;a.each(t.data.datasets,function(e,n){t.getDatasetMeta(n).controller.reset()},t)},reset:function(){this.resetElements(),this.tooltip.initialize()},update:function(t){var e=this;if(t&&"object"==typeof t||(t={duration:t,lazy:arguments[1]}),n(e),!1!==l.notify(e,"beforeUpdate")){e.tooltip._data=e.data;var i=e.buildOrUpdateControllers();a.each(e.data.datasets,function(t,n){e.getDatasetMeta(n).controller.buildOrUpdateElements()},e),e.updateLayout(),a.each(i,function(t){t.reset()}),e.updateDatasets(),l.notify(e,"afterUpdate"),e._bufferedRender?e._bufferedRequest={duration:t.duration,easing:t.easing,lazy:t.lazy}:e.render(t)}},updateLayout:function(){var e=this;!1!==l.notify(e,"beforeLayout")&&(t.layoutService.update(this,this.width,this.height),l.notify(e,"afterScaleUpdate"),l.notify(e,"afterLayout"))},updateDatasets:function(){var t=this;if(!1!==l.notify(t,"beforeDatasetsUpdate")){for(var e=0,n=t.data.datasets.length;e=0;--n)e.isDatasetVisible(n)&&e.drawDataset(n,t);l.notify(e,"afterDatasetsDraw",[t])}},drawDataset:function(t,e){var n=this,i=n.getDatasetMeta(t),a={meta:i,index:t,easingValue:e};!1!==l.notify(n,"beforeDatasetDraw",[a])&&(i.controller.draw(e),l.notify(n,"afterDatasetDraw",[a]))},getElementAtEvent:function(t){return r.modes.single(this,t)},getElementsAtEvent:function(t){return r.modes.label(this,t,{intersect:!0})},getElementsAtXAxis:function(t){return r.modes["x-axis"](this,t,{intersect:!0})},getElementsAtEventForMode:function(t,e,n){var i=r.modes[e];return"function"==typeof i?i(this,t,n):[]},getDatasetAtEvent:function(t){return r.modes.dataset(this,t,{intersect:!0})},getDatasetMeta:function(t){var e=this,n=e.data.datasets[t];n._meta||(n._meta={});var i=n._meta[e.id];return i||(i=n._meta[e.id]={type:null,data:[],dataset:null,controller:null,hidden:null,xAxisID:null,yAxisID:null}),i},getVisibleDatasetCount:function(){for(var t=0,e=0,n=this.data.datasets.length;e0||(a.forEach(function(e){delete t[e]}),delete t._chartjs)}}var a=["push","pop","shift","splice","unshift"];t.DatasetController=function(t,e){this.initialize(t,e)},i.extend(t.DatasetController.prototype,{datasetElementType:null,dataElementType:null,initialize:function(t,e){var n=this;n.chart=t,n.index=e,n.linkScales(),n.addElements()},updateIndex:function(t){this.index=t},linkScales:function(){var t=this,e=t.getMeta(),n=t.getDataset();null===e.xAxisID&&(e.xAxisID=n.xAxisID||t.chart.options.scales.xAxes[0].id),null===e.yAxisID&&(e.yAxisID=n.yAxisID||t.chart.options.scales.yAxes[0].id)},getDataset:function(){return this.chart.data.datasets[this.index]},getMeta:function(){return this.chart.getDatasetMeta(this.index)},getScaleForId:function(t){return this.chart.scales[t]},reset:function(){this.update(!0)},destroy:function(){this._data&&n(this._data,this)},createMetaDataset:function(){var t=this,e=t.datasetElementType;return e&&new e({_chart:t.chart,_datasetIndex:t.index})},createMetaData:function(t){var e=this,n=e.dataElementType;return n&&new n({_chart:e.chart,_datasetIndex:e.index,_index:t})},addElements:function(){var t,e,n=this,i=n.getMeta(),a=n.getDataset().data||[],r=i.data;for(t=0,e=a.length;ti&&t.insertElements(i,a-i)},insertElements:function(t,e){for(var n=0;n=n[e].length&&n[e].push({}),!n[e][o].type||l.type&&l.type!==n[e][o].type?r.merge(n[e][o],[t.scaleService.getScaleDefaults(s),l]):r.merge(n[e][o],l)}else r._merger(e,n,i,a)}})},r.where=function(t,e){if(r.isArray(t)&&Array.prototype.filter)return t.filter(e);var n=[];return r.each(t,function(t){e(t)&&n.push(t)}),n},r.findIndex=Array.prototype.findIndex?function(t,e,n){return t.findIndex(e,n)}:function(t,e,n){n=void 0===n?t:n;for(var i=0,a=t.length;i=0;i--){var a=t[i];if(e(a))return a}},r.inherits=function(t){var e=this,n=t&&t.hasOwnProperty("constructor")?t.constructor:function(){return e.apply(this,arguments)},i=function(){this.constructor=n};return i.prototype=e.prototype,n.prototype=new i,n.extend=r.inherits,t&&r.extend(n.prototype,t),n.__super__=e.prototype,n},r.isNumber=function(t){return!isNaN(parseFloat(t))&&isFinite(t)},r.almostEquals=function(t,e,n){return Math.abs(t-e)t},r.max=function(t){return t.reduce(function(t,e){return isNaN(e)?t:Math.max(t,e)},Number.NEGATIVE_INFINITY)},r.min=function(t){return t.reduce(function(t,e){return isNaN(e)?t:Math.min(t,e)},Number.POSITIVE_INFINITY)},r.sign=Math.sign?function(t){return Math.sign(t)}:function(t){return 0==(t=+t)||isNaN(t)?t:t>0?1:-1},r.log10=Math.log10?function(t){return Math.log10(t)}:function(t){return Math.log(t)/Math.LN10},r.toRadians=function(t){return t*(Math.PI/180)},r.toDegrees=function(t){return t*(180/Math.PI)},r.getAngleFromPoint=function(t,e){var n=e.x-t.x,i=e.y-t.y,a=Math.sqrt(n*n+i*i),r=Math.atan2(i,n);return r<-.5*Math.PI&&(r+=2*Math.PI),{angle:r,distance:a}},r.distanceBetweenPoints=function(t,e){return Math.sqrt(Math.pow(e.x-t.x,2)+Math.pow(e.y-t.y,2))},r.aliasPixel=function(t){return t%2==0?0:.5},r.splineCurve=function(t,e,n,i){var a=t.skip?e:t,r=e,o=n.skip?e:n,s=Math.sqrt(Math.pow(r.x-a.x,2)+Math.pow(r.y-a.y,2)),l=Math.sqrt(Math.pow(o.x-r.x,2)+Math.pow(o.y-r.y,2)),u=s/(s+l),d=l/(s+l),c=i*(u=isNaN(u)?0:u),h=i*(d=isNaN(d)?0:d);return{previous:{x:r.x-c*(o.x-a.x),y:r.y-c*(o.y-a.y)},next:{x:r.x+h*(o.x-a.x),y:r.y+h*(o.y-a.y)}}},r.EPSILON=Number.EPSILON||1e-14,r.splineCurveMonotone=function(t){var e,n,i,a,o=(t||[]).map(function(t){return{model:t._model,deltaK:0,mK:0}}),s=o.length;for(e=0;e0?o[e-1]:null,(a=e0?o[e-1]:null,a=e=t.length-1?t[0]:t[e+1]:e>=t.length-1?t[t.length-1]:t[e+1]},r.previousItem=function(t,e,n){return n?e<=0?t[t.length-1]:t[e-1]:e<=0?t[0]:t[e-1]},r.niceNum=function(t,e){var n=Math.floor(r.log10(t)),i=t/Math.pow(10,n);return(e?i<1.5?1:i<3?2:i<7?5:10:i<=1?1:i<=2?2:i<=5?5:10)*Math.pow(10,n)},r.requestAnimFrame="undefined"==typeof window?function(t){t()}:window.requestAnimationFrame||window.webkitRequestAnimationFrame||window.mozRequestAnimationFrame||window.oRequestAnimationFrame||window.msRequestAnimationFrame||function(t){return window.setTimeout(t,1e3/60)},r.getRelativePosition=function(t,e){var n,i,a=t.originalEvent||t,o=t.currentTarget||t.srcElement,s=o.getBoundingClientRect(),l=a.touches;l&&l.length>0?(n=l[0].clientX,i=l[0].clientY):(n=a.clientX,i=a.clientY);var u=parseFloat(r.getStyle(o,"padding-left")),d=parseFloat(r.getStyle(o,"padding-top")),c=parseFloat(r.getStyle(o,"padding-right")),h=parseFloat(r.getStyle(o,"padding-bottom")),f=s.right-s.left-u-c,g=s.bottom-s.top-d-h;return n=Math.round((n-s.left-u)/f*o.width/e.currentDevicePixelRatio),i=Math.round((i-s.top-d)/g*o.height/e.currentDevicePixelRatio),{x:n,y:i}},r.getConstraintWidth=function(t){return o(t,"max-width","clientWidth")},r.getConstraintHeight=function(t){return o(t,"max-height","clientHeight")},r.getMaximumWidth=function(t){var e=t.parentNode;if(!e)return t.clientWidth;var n=parseInt(r.getStyle(e,"padding-left"),10),i=parseInt(r.getStyle(e,"padding-right"),10),a=e.clientWidth-n-i,o=r.getConstraintWidth(t);return isNaN(o)?a:Math.min(a,o)},r.getMaximumHeight=function(t){var e=t.parentNode;if(!e)return t.clientHeight;var n=parseInt(r.getStyle(e,"padding-top"),10),i=parseInt(r.getStyle(e,"padding-bottom"),10),a=e.clientHeight-n-i,o=r.getConstraintHeight(t);return isNaN(o)?a:Math.min(a,o)},r.getStyle=function(t,e){return t.currentStyle?t.currentStyle[e]:document.defaultView.getComputedStyle(t,null).getPropertyValue(e)},r.retinaScale=function(t,e){var n=t.currentDevicePixelRatio=e||window.devicePixelRatio||1;if(1!==n){var i=t.canvas,a=t.height,r=t.width;i.height=a*n,i.width=r*n,t.ctx.scale(n,n),i.style.height=a+"px",i.style.width=r+"px"}},r.fontString=function(t,e,n){return e+" "+t+"px "+n},r.longestText=function(t,e,n,i){var a=(i=i||{}).data=i.data||{},o=i.garbageCollect=i.garbageCollect||[];i.font!==e&&(a=i.data={},o=i.garbageCollect=[],i.font=e),t.font=e;var s=0;r.each(n,function(e){void 0!==e&&null!==e&&!0!==r.isArray(e)?s=r.measureText(t,a,o,s,e):r.isArray(e)&&r.each(e,function(e){void 0===e||null===e||r.isArray(e)||(s=r.measureText(t,a,o,s,e))})});var l=o.length/2;if(l>n.length){for(var u=0;ui&&(i=r),i},r.numberOfLabelLines=function(t){var e=1;return r.each(t,function(t){r.isArray(t)&&t.length>e&&(e=t.length)}),e},r.color=i?function(t){return t instanceof CanvasGradient&&(t=a.global.defaultColor),i(t)}:function(t){return console.error("Color.js not found!"),t},r.getHoverColor=function(t){return t instanceof CanvasPattern?t:r.color(t).saturate(.5).darken(.1).rgbString()}}},{2:2,25:25,45:45}],28:[function(t,e,n){"use strict";function i(t,e){return t.native?{x:t.x,y:t.y}:u.getRelativePosition(t,e)}function a(t,e){var n,i,a,r,o;for(i=0,r=t.data.datasets.length;i0&&(u=t.getDatasetMeta(u[0]._datasetIndex).data),u},"x-axis":function(t,e){return l(t,e,{intersect:!0})},point:function(t,e){return r(t,i(e,t))},nearest:function(t,e,n){var a=i(e,t);n.axis=n.axis||"xy";var r=s(n.axis),l=o(t,a,n.intersect,r);return l.length>1&&l.sort(function(t,e){var n=t.getArea()-e.getArea();return 0===n&&(n=t._datasetIndex-e._datasetIndex),n}),l.slice(0,1)},x:function(t,e,n){var r=i(e,t),o=[],s=!1;return a(t,function(t){t.inXRange(r.x)&&o.push(t),t.inRange(r.x,r.y)&&(s=!0)}),n.intersect&&!s&&(o=[]),o},y:function(t,e,n){var r=i(e,t),o=[],s=!1;return a(t,function(t){t.inYRange(r.y)&&o.push(t),t.inRange(r.x,r.y)&&(s=!0)}),n.intersect&&!s&&(o=[]),o}}}},{45:45}],29:[function(t,e,n){"use strict";t(25)._set("global",{responsive:!0,responsiveAnimationDuration:0,maintainAspectRatio:!0,events:["mousemove","mouseout","click","touchstart","touchmove"],hover:{onHover:null,mode:"nearest",intersect:!0,animationDuration:400},onClick:null,defaultColor:"rgba(0,0,0,0.1)",defaultFontColor:"#666",defaultFontFamily:"'Helvetica Neue', 'Helvetica', 'Arial', sans-serif",defaultFontSize:12,defaultFontStyle:"normal",showLines:!0,elements:{},layout:{padding:{top:0,right:0,bottom:0,left:0}}}),e.exports=function(){var t=function(t,e){return this.construct(t,e),this};return t.Chart=t,t}},{25:25}],30:[function(t,e,n){"use strict";var i=t(45);e.exports=function(t){function e(t,e){return i.where(t,function(t){return t.position===e})}function n(t,e){t.forEach(function(t,e){return t._tmpIndex_=e,t}),t.sort(function(t,n){var i=e?n:t,a=e?t:n;return i.weight===a.weight?i._tmpIndex_-a._tmpIndex_:i.weight-a.weight}),t.forEach(function(t){delete t._tmpIndex_})}t.layoutService={defaults:{},addBox:function(t,e){t.boxes||(t.boxes=[]),e.fullWidth=e.fullWidth||!1,e.position=e.position||"top",e.weight=e.weight||0,t.boxes.push(e)},removeBox:function(t,e){var n=t.boxes?t.boxes.indexOf(e):-1;-1!==n&&t.boxes.splice(n,1)},configure:function(t,e,n){for(var i,a=["fullWidth","position","weight"],r=a.length,o=0;oh&&lt.maxHeight){l--;break}l++,c=u*d}t.labelRotation=l},afterCalculateTickRotation:function(){s.callback(this.options.afterCalculateTickRotation,[this])},beforeFit:function(){s.callback(this.options.beforeFit,[this])},fit:function(){var t=this,a=t.minSize={width:0,height:0},r=i(t._ticks),o=t.options,u=o.ticks,d=o.scaleLabel,c=o.gridLines,h=o.display,f=t.isHorizontal(),g=n(u),m=o.gridLines.tickMarkLength;if(a.width=f?t.isFullWidth()?t.maxWidth-t.margins.left-t.margins.right:t.maxWidth:h&&c.drawTicks?m:0,a.height=f?h&&c.drawTicks?m:0:t.maxHeight,d.display&&h){var p=l(d)+s.options.toPadding(d.padding).height;f?a.height+=p:a.width+=p}if(u.display&&h){var v=s.longestText(t.ctx,g.font,r,t.longestTextCache),y=s.numberOfLabelLines(r),b=.5*g.size,x=t.options.ticks.padding;if(f){t.longestLabelWidth=v;var _=s.toRadians(t.labelRotation),k=Math.cos(_),w=Math.sin(_)*v+g.size*y+b*(y-1)+b;a.height=Math.min(t.maxHeight,a.height+w+x),t.ctx.font=g.font;var M=e(t.ctx,r[0],g.font),S=e(t.ctx,r[r.length-1],g.font);0!==t.labelRotation?(t.paddingLeft="bottom"===o.position?k*M+3:k*b+3,t.paddingRight="bottom"===o.position?k*b+3:k*S+3):(t.paddingLeft=M/2+3,t.paddingRight=S/2+3)}else u.mirror?v=0:v+=x+b,a.width=Math.min(t.maxWidth,a.width+v),t.paddingTop=g.size/2,t.paddingBottom=g.size/2}t.handleMargins(),t.width=a.width,t.height=a.height},handleMargins:function(){var t=this;t.margins&&(t.paddingLeft=Math.max(t.paddingLeft-t.margins.left,0),t.paddingTop=Math.max(t.paddingTop-t.margins.top,0),t.paddingRight=Math.max(t.paddingRight-t.margins.right,0),t.paddingBottom=Math.max(t.paddingBottom-t.margins.bottom,0))},afterFit:function(){s.callback(this.options.afterFit,[this])},isHorizontal:function(){return"top"===this.options.position||"bottom"===this.options.position},isFullWidth:function(){return this.options.fullWidth},getRightValue:function(t){if(s.isNullOrUndef(t))return NaN;if("number"==typeof t&&!isFinite(t))return NaN;if(t)if(this.isHorizontal()){if(void 0!==t.x)return this.getRightValue(t.x)}else if(void 0!==t.y)return this.getRightValue(t.y);return t},getLabelForIndex:s.noop,getPixelForValue:s.noop,getValueForPixel:s.noop,getPixelForTick:function(t){var e=this,n=e.options.offset;if(e.isHorizontal()){var i=(e.width-(e.paddingLeft+e.paddingRight))/Math.max(e._ticks.length-(n?0:1),1),a=i*t+e.paddingLeft;n&&(a+=i/2);var r=e.left+Math.round(a);return r+=e.isFullWidth()?e.margins.left:0}var o=e.height-(e.paddingTop+e.paddingBottom);return e.top+t*(o/(e._ticks.length-1))},getPixelForDecimal:function(t){var e=this;if(e.isHorizontal()){var n=(e.width-(e.paddingLeft+e.paddingRight))*t+e.paddingLeft,i=e.left+Math.round(n);return i+=e.isFullWidth()?e.margins.left:0}return e.top+t*e.height},getBasePixel:function(){return this.getPixelForValue(this.getBaseValue())},getBaseValue:function(){var t=this,e=t.min,n=t.max;return t.beginAtZero?0:e<0&&n<0?n:e>0&&n>0?e:0},_autoSkip:function(t){var e,n,i,a,r=this,o=r.isHorizontal(),l=r.options.ticks.minor,u=t.length,d=s.toRadians(r.labelRotation),c=Math.cos(d),h=r.longestLabelWidth*c,f=[];for(l.maxTicksLimit&&(a=l.maxTicksLimit),o&&(e=!1,(h+l.autoSkipPadding)*u>r.width-(r.paddingLeft+r.paddingRight)&&(e=1+Math.floor((h+l.autoSkipPadding)*u/(r.width-(r.paddingLeft+r.paddingRight)))),a&&u>a&&(e=Math.max(e,Math.floor(u/a)))),n=0;n1&&n%e>0||n%e==0&&n+e>=u)&&n!==u-1||s.isNullOrUndef(i.label))&&delete i.label,f.push(i);return f},draw:function(t){var e=this,i=e.options;if(i.display){var o=e.ctx,u=r.global,d=i.ticks.minor,c=i.ticks.major||d,h=i.gridLines,f=i.scaleLabel,g=0!==e.labelRotation,m=e.isHorizontal(),p=d.autoSkip?e._autoSkip(e.getTicks()):e.getTicks(),v=s.valueOrDefault(d.fontColor,u.defaultFontColor),y=n(d),b=s.valueOrDefault(c.fontColor,u.defaultFontColor),x=n(c),_=h.drawTicks?h.tickMarkLength:0,k=s.valueOrDefault(f.fontColor,u.defaultFontColor),w=n(f),M=s.options.toPadding(f.padding),S=s.toRadians(e.labelRotation),D=[],C="right"===i.position?e.left:e.right-_,P="right"===i.position?e.left+_:e.right,T="bottom"===i.position?e.top:e.bottom-_,I="bottom"===i.position?e.top+_:e.bottom;if(s.each(p,function(n,r){if(void 0!==n.label){var o,l,c,f,v=n.label;r===e.zeroLineIndex&&i.offset===h.offsetGridLines?(o=h.zeroLineWidth,l=h.zeroLineColor,c=h.zeroLineBorderDash,f=h.zeroLineBorderDashOffset):(o=s.valueAtIndexOrDefault(h.lineWidth,r),l=s.valueAtIndexOrDefault(h.color,r),c=s.valueOrDefault(h.borderDash,u.borderDash),f=s.valueOrDefault(h.borderDashOffset,u.borderDashOffset));var y,b,x,k,w,M,A,O,F,R,L="middle",W="middle",Y=d.padding;if(m){var N=_+Y;"bottom"===i.position?(W=g?"middle":"top",L=g?"right":"center",R=e.top+N):(W=g?"middle":"bottom",L=g?"left":"center",R=e.bottom-N);var z=a(e,r,h.offsetGridLines&&p.length>1);z1);H0)n=t.stepSize;else{var r=i.niceNum(e.max-e.min,!1);n=i.niceNum(r/(t.maxTicks-1),!0)}var o=Math.floor(e.min/n)*n,s=Math.ceil(e.max/n)*n;t.min&&t.max&&t.stepSize&&i.almostWhole((t.max-t.min)/t.stepSize,n/1e3)&&(o=t.min,s=t.max);var l=(s-o)/n;l=i.almostEquals(l,Math.round(l),n/1e3)?Math.round(l):Math.ceil(l),a.push(void 0!==t.min?t.min:o);for(var u=1;u3?n[2]-n[1]:n[1]-n[0];Math.abs(a)>1&&t!==Math.floor(t)&&(a=t-Math.floor(t));var r=i.log10(Math.abs(a)),o="";if(0!==t){var s=-1*Math.floor(r);s=Math.max(Math.min(s,20),0),o=t.toFixed(s)}else o="0";return o},logarithmic:function(t,e,n){var a=t/Math.pow(10,Math.floor(i.log10(t)));return 0===t?"0":1===a||2===a||5===a||0===e||e===n.length-1?t.toExponential():""}}}},{45:45}],35:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45);i._set("global",{tooltips:{enabled:!0,custom:null,mode:"nearest",position:"average",intersect:!0,backgroundColor:"rgba(0,0,0,0.8)",titleFontStyle:"bold",titleSpacing:2,titleMarginBottom:6,titleFontColor:"#fff",titleAlign:"left",bodySpacing:2,bodyFontColor:"#fff",bodyAlign:"left",footerFontStyle:"bold",footerSpacing:2,footerMarginTop:6,footerFontColor:"#fff",footerAlign:"left",yPadding:6,xPadding:6,caretPadding:2,caretSize:5,cornerRadius:6,multiKeyBackground:"#fff",displayColors:!0,borderColor:"rgba(0,0,0,0)",borderWidth:0,callbacks:{beforeTitle:r.noop,title:function(t,e){var n="",i=e.labels,a=i?i.length:0;if(t.length>0){var r=t[0];r.xLabel?n=r.xLabel:a>0&&r.indexi.height-e.height&&(o="bottom");var s,l,u,d,c,h=(a.left+a.right)/2,f=(a.top+a.bottom)/2;"center"===o?(s=function(t){return t<=h},l=function(t){return t>h}):(s=function(t){return t<=e.width/2},l=function(t){return t>=i.width-e.width/2}),u=function(t){return t+e.width>i.width},d=function(t){return t-e.width<0},c=function(t){return t<=f?"top":"bottom"},s(n.x)?(r="left",u(n.x)&&(r="center",o=c(n.y))):l(n.x)&&(r="right",d(n.x)&&(r="center",o=c(n.y)));var g=t._options;return{xAlign:g.xAlign?g.xAlign:r,yAlign:g.yAlign?g.yAlign:o}}function d(t,e,n){var i=t.x,a=t.y,r=t.caretSize,o=t.caretPadding,s=t.cornerRadius,l=n.xAlign,u=n.yAlign,d=r+o,c=s+o;return"right"===l?i-=e.width:"center"===l&&(i-=e.width/2),"top"===u?a+=d:a-="bottom"===u?e.height+d:e.height/2,"center"===u?"left"===l?i+=d:"right"===l&&(i-=d):"left"===l?i-=c:"right"===l&&(i+=c),{x:i,y:a}}t.Tooltip=a.extend({initialize:function(){this._model=s(this._options)},getTitle:function(){var t=this,e=t._options.callbacks,i=e.beforeTitle.apply(t,arguments),a=e.title.apply(t,arguments),r=e.afterTitle.apply(t,arguments),o=[];return o=n(o,i),o=n(o,a),o=n(o,r)},getBeforeBody:function(){var t=this._options.callbacks.beforeBody.apply(this,arguments);return r.isArray(t)?t:void 0!==t?[t]:[]},getBody:function(t,e){var i=this,a=i._options.callbacks,o=[];return r.each(t,function(t){var r={before:[],lines:[],after:[]};n(r.before,a.beforeLabel.call(i,t,e)),n(r.lines,a.label.call(i,t,e)),n(r.after,a.afterLabel.call(i,t,e)),o.push(r)}),o},getAfterBody:function(){var t=this._options.callbacks.afterBody.apply(this,arguments);return r.isArray(t)?t:void 0!==t?[t]:[]},getFooter:function(){var t=this,e=t._options.callbacks,i=e.beforeFooter.apply(t,arguments),a=e.footer.apply(t,arguments),r=e.afterFooter.apply(t,arguments),o=[];return o=n(o,i),o=n(o,a),o=n(o,r)},update:function(e){var n,i,a=this,c=a._options,h=a._model,f=a._model=s(c),g=a._active,m=a._data,p={xAlign:h.xAlign,yAlign:h.yAlign},v={x:h.x,y:h.y},y={width:h.width,height:h.height},b={x:h.caretX,y:h.caretY};if(g.length){f.opacity=1;var x=[],_=[];b=t.Tooltip.positioners[c.position](g,a._eventPosition);var k=[];for(n=0,i=g.length;n0&&i.stroke()},draw:function(){var t=this._chart.ctx,e=this._view;if(0!==e.opacity){var n={width:e.width,height:e.height},i={x:e.x,y:e.y},a=Math.abs(e.opacity<.001)?0:e.opacity,r=e.title.length||e.beforeBody.length||e.body.length||e.afterBody.length||e.footer.length;this._options.enabled&&r&&(this.drawBackground(i,e,t,n,a),i.x+=e.xPadding,i.y+=e.yPadding,this.drawTitle(i,e,t,a),this.drawBody(i,e,t,a),this.drawFooter(i,e,t,a))}},handleEvent:function(t){var e=this,n=e._options,i=!1;if(e._lastActive=e._lastActive||[],"mouseout"===t.type?e._active=[]:e._active=e._chart.getElementsAtEventForMode(t,n.mode,n),!(i=!r.arrayEquals(e._active,e._lastActive)))return!1;if(e._lastActive=e._active,n.enabled||n.custom){e._eventPosition={x:t.x,y:t.y};var a=e._model;e.update(!0),e.pivot(),i|=a.x!==e._model.x||a.y!==e._model.y}return i}}),t.Tooltip.positioners={average:function(t){if(!t.length)return!1;var e,n,i=0,a=0,r=0;for(e=0,n=t.length;el;)a-=2*Math.PI;for(;a=s&&a<=l,d=o>=n.innerRadius&&o<=n.outerRadius;return u&&d}return!1},getCenterPoint:function(){var t=this._view,e=(t.startAngle+t.endAngle)/2,n=(t.innerRadius+t.outerRadius)/2;return{x:t.x+Math.cos(e)*n,y:t.y+Math.sin(e)*n}},getArea:function(){var t=this._view;return Math.PI*((t.endAngle-t.startAngle)/(2*Math.PI))*(Math.pow(t.outerRadius,2)-Math.pow(t.innerRadius,2))},tooltipPosition:function(){var t=this._view,e=t.startAngle+(t.endAngle-t.startAngle)/2,n=(t.outerRadius-t.innerRadius)/2+t.innerRadius;return{x:t.x+Math.cos(e)*n,y:t.y+Math.sin(e)*n}},draw:function(){var t=this._chart.ctx,e=this._view,n=e.startAngle,i=e.endAngle;t.beginPath(),t.arc(e.x,e.y,e.outerRadius,n,i),t.arc(e.x,e.y,e.innerRadius,i,n,!0),t.closePath(),t.strokeStyle=e.borderColor,t.lineWidth=e.borderWidth,t.fillStyle=e.backgroundColor,t.fill(),t.lineJoin="bevel",e.borderWidth&&t.stroke()}})},{25:25,26:26,45:45}],37:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45),o=i.global;i._set("global",{elements:{line:{tension:.4,backgroundColor:o.defaultColor,borderWidth:3,borderColor:o.defaultColor,borderCapStyle:"butt",borderDash:[],borderDashOffset:0,borderJoinStyle:"miter",capBezierPoints:!0,fill:!0}}}),e.exports=a.extend({draw:function(){var t,e,n,i,a=this,s=a._view,l=a._chart.ctx,u=s.spanGaps,d=a._children.slice(),c=o.elements.line,h=-1;for(a._loop&&d.length&&d.push(d[0]),l.save(),l.lineCap=s.borderCapStyle||c.borderCapStyle,l.setLineDash&&l.setLineDash(s.borderDash||c.borderDash),l.lineDashOffset=s.borderDashOffset||c.borderDashOffset,l.lineJoin=s.borderJoinStyle||c.borderJoinStyle,l.lineWidth=s.borderWidth||c.borderWidth,l.strokeStyle=s.borderColor||o.defaultColor,l.beginPath(),h=-1,t=0;te?1:-1,o=1,s=u.borderSkipped||"left"):(e=u.x-u.width/2,n=u.x+u.width/2,i=u.y,r=1,o=(a=u.base)>i?1:-1,s=u.borderSkipped||"bottom"),d){var c=Math.min(Math.abs(e-n),Math.abs(i-a)),h=(d=d>c?c:d)/2,f=e+("left"!==s?h*r:0),g=n+("right"!==s?-h*r:0),m=i+("top"!==s?h*o:0),p=a+("bottom"!==s?-h*o:0);f!==g&&(i=m,a=p),m!==p&&(e=f,n=g)}l.beginPath(),l.fillStyle=u.backgroundColor,l.strokeStyle=u.borderColor,l.lineWidth=d;var v=[[e,a],[e,i],[n,i],[n,a]],y=["bottom","left","top","right"].indexOf(s,0);-1===y&&(y=0);var b=t(0);l.moveTo(b[0],b[1]);for(var x=1;x<4;x++)b=t(x),l.lineTo(b[0],b[1]);l.fill(),d&&l.stroke()},height:function(){var t=this._view;return t.base-t.y},inRange:function(t,e){var n=!1;if(this._view){var i=a(this);n=t>=i.left&&t<=i.right&&e>=i.top&&e<=i.bottom}return n},inLabelRange:function(t,e){var n=this;if(!n._view)return!1;var r=a(n);return i(n)?t>=r.left&&t<=r.right:e>=r.top&&e<=r.bottom},inXRange:function(t){var e=a(this);return t>=e.left&&t<=e.right},inYRange:function(t){var e=a(this);return t>=e.top&&t<=e.bottom},getCenterPoint:function(){var t,e,n=this._view;return i(this)?(t=n.x,e=(n.y+n.base)/2):(t=(n.x+n.base)/2,e=n.y),{x:t,y:e}},getArea:function(){var t=this._view;return t.width*Math.abs(t.y-t.base)},tooltipPosition:function(){var t=this._view;return{x:t.x,y:t.y}}})},{25:25,26:26}],40:[function(t,e,n){"use strict";e.exports={},e.exports.Arc=t(36),e.exports.Line=t(37),e.exports.Point=t(38),e.exports.Rectangle=t(39)},{36:36,37:37,38:38,39:39}],41:[function(t,e,n){"use strict";var i=t(42),n=e.exports={clear:function(t){t.ctx.clearRect(0,0,t.width,t.height)},roundedRect:function(t,e,n,i,a,r){if(r){var o=Math.min(r,i/2),s=Math.min(r,a/2);t.moveTo(e+o,n),t.lineTo(e+i-o,n),t.quadraticCurveTo(e+i,n,e+i,n+s),t.lineTo(e+i,n+a-s),t.quadraticCurveTo(e+i,n+a,e+i-o,n+a),t.lineTo(e+o,n+a),t.quadraticCurveTo(e,n+a,e,n+a-s),t.lineTo(e,n+s),t.quadraticCurveTo(e,n,e+o,n)}else t.rect(e,n,i,a)},drawPoint:function(t,e,n,i,a){var r,o,s,l,u,d;if("object"!=typeof e||"[object HTMLImageElement]"!==(r=e.toString())&&"[object HTMLCanvasElement]"!==r){if(!(isNaN(n)||n<=0)){switch(e){default:t.beginPath(),t.arc(i,a,n,0,2*Math.PI),t.closePath(),t.fill();break;case"triangle":t.beginPath(),u=(o=3*n/Math.sqrt(3))*Math.sqrt(3)/2,t.moveTo(i-o/2,a+u/3),t.lineTo(i+o/2,a+u/3),t.lineTo(i,a-2*u/3),t.closePath(),t.fill();break;case"rect":d=1/Math.SQRT2*n,t.beginPath(),t.fillRect(i-d,a-d,2*d,2*d),t.strokeRect(i-d,a-d,2*d,2*d);break;case"rectRounded":var c=n/Math.SQRT2,h=i-c,f=a-c,g=Math.SQRT2*n;t.beginPath(),this.roundedRect(t,h,f,g,g,n/2),t.closePath(),t.fill();break;case"rectRot":d=1/Math.SQRT2*n,t.beginPath(),t.moveTo(i-d,a),t.lineTo(i,a+d),t.lineTo(i+d,a),t.lineTo(i,a-d),t.closePath(),t.fill();break;case"cross":t.beginPath(),t.moveTo(i,a+n),t.lineTo(i,a-n),t.moveTo(i-n,a),t.lineTo(i+n,a),t.closePath();break;case"crossRot":t.beginPath(),s=Math.cos(Math.PI/4)*n,l=Math.sin(Math.PI/4)*n,t.moveTo(i-s,a-l),t.lineTo(i+s,a+l),t.moveTo(i-s,a+l),t.lineTo(i+s,a-l),t.closePath();break;case"star":t.beginPath(),t.moveTo(i,a+n),t.lineTo(i,a-n),t.moveTo(i-n,a),t.lineTo(i+n,a),s=Math.cos(Math.PI/4)*n,l=Math.sin(Math.PI/4)*n,t.moveTo(i-s,a-l),t.lineTo(i+s,a+l),t.moveTo(i-s,a+l),t.lineTo(i+s,a-l),t.closePath();break;case"line":t.beginPath(),t.moveTo(i-n,a),t.lineTo(i+n,a),t.closePath();break;case"dash":t.beginPath(),t.moveTo(i,a),t.lineTo(i+n,a),t.closePath()}t.stroke()}}else t.drawImage(e,i-e.width/2,a-e.height/2,e.width,e.height)},clipArea:function(t,e){t.save(),t.beginPath(),t.rect(e.left,e.top,e.right-e.left,e.bottom-e.top),t.clip()},unclipArea:function(t){t.restore()},lineTo:function(t,e,n,i){if(n.steppedLine)return"after"===n.steppedLine&&!i||"after"!==n.steppedLine&&i?t.lineTo(e.x,n.y):t.lineTo(n.x,e.y),void t.lineTo(n.x,n.y);n.tension?t.bezierCurveTo(i?e.controlPointPreviousX:e.controlPointNextX,i?e.controlPointPreviousY:e.controlPointNextY,i?n.controlPointNextX:n.controlPointPreviousX,i?n.controlPointNextY:n.controlPointPreviousY,n.x,n.y):t.lineTo(n.x,n.y)}};i.clear=n.clear,i.drawRoundedRectangle=function(t){t.beginPath(),n.roundedRect.apply(n,arguments),t.closePath()}},{42:42}],42:[function(t,e,n){"use strict";var i={noop:function(){},uid:function(){var t=0;return function(){return t++}}(),isNullOrUndef:function(t){return null===t||void 0===t},isArray:Array.isArray?Array.isArray:function(t){return"[object Array]"===Object.prototype.toString.call(t)},isObject:function(t){return null!==t&&"[object Object]"===Object.prototype.toString.call(t)},valueOrDefault:function(t,e){return void 0===t?e:t},valueAtIndexOrDefault:function(t,e,n){return i.valueOrDefault(i.isArray(t)?t[e]:t,n)},callback:function(t,e,n){if(t&&"function"==typeof t.call)return t.apply(n,e)},each:function(t,e,n,a){var r,o,s;if(i.isArray(t))if(o=t.length,a)for(r=o-1;r>=0;r--)e.call(n,t[r],r);else for(r=0;r=1?t:-(Math.sqrt(1-t*t)-1)},easeOutCirc:function(t){return Math.sqrt(1-(t-=1)*t)},easeInOutCirc:function(t){return(t/=.5)<1?-.5*(Math.sqrt(1-t*t)-1):.5*(Math.sqrt(1-(t-=2)*t)+1)},easeInElastic:function(t){var e=1.70158,n=0,i=1;return 0===t?0:1===t?1:(n||(n=.3),i<1?(i=1,e=n/4):e=n/(2*Math.PI)*Math.asin(1/i),-i*Math.pow(2,10*(t-=1))*Math.sin((t-e)*(2*Math.PI)/n))},easeOutElastic:function(t){var e=1.70158,n=0,i=1;return 0===t?0:1===t?1:(n||(n=.3),i<1?(i=1,e=n/4):e=n/(2*Math.PI)*Math.asin(1/i),i*Math.pow(2,-10*t)*Math.sin((t-e)*(2*Math.PI)/n)+1)},easeInOutElastic:function(t){var e=1.70158,n=0,i=1;return 0===t?0:2==(t/=.5)?1:(n||(n=.45),i<1?(i=1,e=n/4):e=n/(2*Math.PI)*Math.asin(1/i),t<1?i*Math.pow(2,10*(t-=1))*Math.sin((t-e)*(2*Math.PI)/n)*-.5:i*Math.pow(2,-10*(t-=1))*Math.sin((t-e)*(2*Math.PI)/n)*.5+1)},easeInBack:function(t){var e=1.70158;return t*t*((e+1)*t-e)},easeOutBack:function(t){var e=1.70158;return(t-=1)*t*((e+1)*t+e)+1},easeInOutBack:function(t){var e=1.70158;return(t/=.5)<1?t*t*((1+(e*=1.525))*t-e)*.5:.5*((t-=2)*t*((1+(e*=1.525))*t+e)+2)},easeInBounce:function(t){return 1-a.easeOutBounce(1-t)},easeOutBounce:function(t){return t<1/2.75?7.5625*t*t:t<2/2.75?7.5625*(t-=1.5/2.75)*t+.75:t<2.5/2.75?7.5625*(t-=2.25/2.75)*t+.9375:7.5625*(t-=2.625/2.75)*t+.984375},easeInOutBounce:function(t){return t<.5?.5*a.easeInBounce(2*t):.5*a.easeOutBounce(2*t-1)+.5}};e.exports={effects:a},i.easingEffects=a},{42:42}],44:[function(t,e,n){"use strict";var i=t(42);e.exports={toLineHeight:function(t,e){var n=(""+t).match(/^(normal|(\d+(?:\.\d+)?)(px|em|%)?)$/);if(!n||"normal"===n[1])return 1.2*e;switch(t=+n[2],n[3]){case"px":return t;case"%":t/=100}return e*t},toPadding:function(t){var e,n,a,r;return i.isObject(t)?(e=+t.top||0,n=+t.right||0,a=+t.bottom||0,r=+t.left||0):e=n=a=r=+t||0,{top:e,right:n,bottom:a,left:r,height:e+a,width:r+n}},resolve:function(t,e,n){var a,r,o;for(a=0,r=t.length;a
';var a=e.childNodes[0],o=e.childNodes[1];e._reset=function(){a.scrollLeft=1e6,a.scrollTop=1e6,o.scrollLeft=1e6,o.scrollTop=1e6};var s=function(){e._reset(),t()};return r(a,"scroll",s.bind(a,"expand")),r(o,"scroll",s.bind(o,"shrink")),e}function c(t,e){var n=(t[v]||(t[v]={})).renderProxy=function(t){t.animationName===x&&e()};p.each(_,function(e){r(t,e,n)}),t.classList.add(b)}function h(t){var e=t[v]||{},n=e.renderProxy;n&&(p.each(_,function(e){o(t,e,n)}),delete e.renderProxy),t.classList.remove(b)}function f(t,e,n){var i=t[v]||(t[v]={}),a=i.resizer=d(u(function(){if(i.resizer)return e(s("resize",n))}));c(t,function(){if(i.resizer){var e=t.parentNode;e&&e!==a.parentNode&&e.insertBefore(a,e.firstChild),a._reset()}})}function g(t){var e=t[v]||{},n=e.resizer;delete e.resizer,h(t),n&&n.parentNode&&n.parentNode.removeChild(n)}function m(t,e){var n=t._style||document.createElement("style");t._style||(t._style=n,e="/* Chart.js */\n"+e,n.setAttribute("type","text/css"),document.getElementsByTagName("head")[0].appendChild(n)),n.appendChild(document.createTextNode(e))}var p=t(45),v="$chartjs",y="chartjs-",b=y+"render-monitor",x=y+"render-animation",_=["animationstart","webkitAnimationStart"],k={touchstart:"mousedown",touchmove:"mousemove",touchend:"mouseup",pointerenter:"mouseenter",pointerdown:"mousedown",pointermove:"mousemove",pointerup:"mouseup",pointerleave:"mouseout",pointerout:"mouseout"},w=!!function(){var t=!1;try{var e=Object.defineProperty({},"passive",{get:function(){t=!0}});window.addEventListener("e",null,e)}catch(t){}return t}()&&{passive:!0};e.exports={_enabled:"undefined"!=typeof window&&"undefined"!=typeof document,initialize:function(){var t="from{opacity:0.99}to{opacity:1}";m(this,"@-webkit-keyframes "+x+"{"+t+"}@keyframes "+x+"{"+t+"}."+b+"{-webkit-animation:"+x+" 0.001s;animation:"+x+" 0.001s;}")},acquireContext:function(t,e){"string"==typeof t?t=document.getElementById(t):t.length&&(t=t[0]),t&&t.canvas&&(t=t.canvas);var n=t&&t.getContext&&t.getContext("2d");return n&&n.canvas===t?(a(t,e),n):null},releaseContext:function(t){var e=t.canvas;if(e[v]){var n=e[v].initial;["height","width"].forEach(function(t){var i=n[t];p.isNullOrUndef(i)?e.removeAttribute(t):e.setAttribute(t,i)}),p.each(n.style||{},function(t,n){e.style[n]=t}),e.width=e.width,delete e[v]}},addEventListener:function(t,e,n){var i=t.canvas;if("resize"!==e){var a=n[v]||(n[v]={});r(i,e,(a.proxies||(a.proxies={}))[t.id+"_"+e]=function(e){n(l(e,t))})}else f(i,n,t)},removeEventListener:function(t,e,n){var i=t.canvas;if("resize"!==e){var a=((n[v]||{}).proxies||{})[t.id+"_"+e];a&&o(i,e,a)}else g(i)}},p.addEvent=r,p.removeEvent=o},{45:45}],48:[function(t,e,n){"use strict";var i=t(45),a=t(46),r=t(47),o=r._enabled?r:a;e.exports=i.extend({initialize:function(){},acquireContext:function(){},releaseContext:function(){},addEventListener:function(){},removeEventListener:function(){}},o)},{45:45,46:46,47:47}],49:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("global",{plugins:{filler:{propagate:!0}}}),e.exports=function(){function t(t,e,n){var i,a=t._model||{},r=a.fill;if(void 0===r&&(r=!!a.backgroundColor),!1===r||null===r)return!1;if(!0===r)return"origin";if(i=parseFloat(r,10),isFinite(i)&&Math.floor(i)===i)return"-"!==r[0]&&"+"!==r[0]||(i=e+i),!(i===e||i<0||i>=n)&&i;switch(r){case"bottom":return"start";case"top":return"end";case"zero":return"origin";case"origin":case"start":case"end":return r;default:return!1}}function e(t){var e,n=t.el._model||{},i=t.el._scale||{},a=t.fill,r=null;if(isFinite(a))return null;if("start"===a?r=void 0===n.scaleBottom?i.bottom:n.scaleBottom:"end"===a?r=void 0===n.scaleTop?i.top:n.scaleTop:void 0!==n.scaleZero?r=n.scaleZero:i.getBasePosition?r=i.getBasePosition():i.getBasePixel&&(r=i.getBasePixel()),void 0!==r&&null!==r){if(void 0!==r.x&&void 0!==r.y)return r;if("number"==typeof r&&isFinite(r))return e=i.isHorizontal(),{x:e?r:null,y:e?null:r}}return null}function n(t,e,n){var i,a=t[e].fill,r=[e];if(!n)return a;for(;!1!==a&&-1===r.indexOf(a);){if(!isFinite(a))return a;if(!(i=t[a]))return!1;if(i.visible)return a;r.push(a),a=i.fill}return!1}function o(t){var e=t.fill,n="dataset";return!1===e?null:(isFinite(e)||(n="boundary"),d[n](t))}function s(t){return t&&!t.skip}function l(t,e,n,i,a){var o;if(i&&a){for(t.moveTo(e[0].x,e[0].y),o=1;o0;--o)r.canvas.lineTo(t,n[o],n[o-1],!0)}}function u(t,e,n,i,a,r){var o,u,d,c,h,f,g,m=e.length,p=i.spanGaps,v=[],y=[],b=0,x=0;for(t.beginPath(),o=0,u=m+!!r;o');for(var n=0;n'),t.data.datasets[n].label&&e.push(t.data.datasets[n].label),e.push("");return e.push(""),e.join("")}}),e.exports=function(t){function e(t,e){return t.usePointStyle?e*Math.SQRT2:t.boxWidth}function n(e,n){var i=new t.Legend({ctx:e.ctx,options:n,chart:e});o.configure(e,i,n),o.addBox(e,i),e.legend=i}var o=t.layoutService,s=r.noop;return t.Legend=a.extend({initialize:function(t){r.extend(this,t),this.legendHitBoxes=[],this.doughnutMode=!1},beforeUpdate:s,update:function(t,e,n){var i=this;return i.beforeUpdate(),i.maxWidth=t,i.maxHeight=e,i.margins=n,i.beforeSetDimensions(),i.setDimensions(),i.afterSetDimensions(),i.beforeBuildLabels(),i.buildLabels(),i.afterBuildLabels(),i.beforeFit(),i.fit(),i.afterFit(),i.afterUpdate(),i.minSize},afterUpdate:s,beforeSetDimensions:s,setDimensions:function(){var t=this;t.isHorizontal()?(t.width=t.maxWidth,t.left=0,t.right=t.width):(t.height=t.maxHeight,t.top=0,t.bottom=t.height),t.paddingLeft=0,t.paddingTop=0,t.paddingRight=0,t.paddingBottom=0,t.minSize={width:0,height:0}},afterSetDimensions:s,beforeBuildLabels:s,buildLabels:function(){var t=this,e=t.options.labels||{},n=r.callback(e.generateLabels,[t.chart],t)||[];e.filter&&(n=n.filter(function(n){return e.filter(n,t.chart.data)})),t.options.reverse&&n.reverse(),t.legendItems=n},afterBuildLabels:s,beforeFit:s,fit:function(){var t=this,n=t.options,a=n.labels,o=n.display,s=t.ctx,l=i.global,u=r.valueOrDefault,d=u(a.fontSize,l.defaultFontSize),c=u(a.fontStyle,l.defaultFontStyle),h=u(a.fontFamily,l.defaultFontFamily),f=r.fontString(d,c,h),g=t.legendHitBoxes=[],m=t.minSize,p=t.isHorizontal();if(p?(m.width=t.maxWidth,m.height=o?10:0):(m.width=o?10:0,m.height=t.maxHeight),o)if(s.font=f,p){var v=t.lineWidths=[0],y=t.legendItems.length?d+a.padding:0;s.textAlign="left",s.textBaseline="top",r.each(t.legendItems,function(n,i){var r=e(a,d)+d/2+s.measureText(n.text).width;v[v.length-1]+r+a.padding>=t.width&&(y+=d+a.padding,v[v.length]=t.left),g[i]={left:0,top:0,width:r,height:d},v[v.length-1]+=r+a.padding}),m.height+=y}else{var b=a.padding,x=t.columnWidths=[],_=a.padding,k=0,w=0,M=d+b;r.each(t.legendItems,function(t,n){var i=e(a,d)+d/2+s.measureText(t.text).width;w+M>m.height&&(_+=k+a.padding,x.push(k),k=0,w=0),k=Math.max(k,i),w+=M,g[n]={left:0,top:0,width:i,height:d}}),_+=k,x.push(k),m.width+=_}t.width=m.width,t.height=m.height},afterFit:s,isHorizontal:function(){return"top"===this.options.position||"bottom"===this.options.position},draw:function(){var t=this,n=t.options,a=n.labels,o=i.global,s=o.elements.line,l=t.width,u=t.lineWidths;if(n.display){var d,c=t.ctx,h=r.valueOrDefault,f=h(a.fontColor,o.defaultFontColor),g=h(a.fontSize,o.defaultFontSize),m=h(a.fontStyle,o.defaultFontStyle),p=h(a.fontFamily,o.defaultFontFamily),v=r.fontString(g,m,p);c.textAlign="left",c.textBaseline="middle",c.lineWidth=.5,c.strokeStyle=f,c.fillStyle=f,c.font=v;var y=e(a,g),b=t.legendHitBoxes,x=function(t,e,i){if(!(isNaN(y)||y<=0)){c.save(),c.fillStyle=h(i.fillStyle,o.defaultColor),c.lineCap=h(i.lineCap,s.borderCapStyle),c.lineDashOffset=h(i.lineDashOffset,s.borderDashOffset),c.lineJoin=h(i.lineJoin,s.borderJoinStyle),c.lineWidth=h(i.lineWidth,s.borderWidth),c.strokeStyle=h(i.strokeStyle,o.defaultColor);var a=0===h(i.lineWidth,s.borderWidth);if(c.setLineDash&&c.setLineDash(h(i.lineDash,s.borderDash)),n.labels&&n.labels.usePointStyle){var l=g*Math.SQRT2/2,u=l/Math.SQRT2,d=t+u,f=e+u;r.canvas.drawPoint(c,i.pointStyle,l,d,f)}else a||c.strokeRect(t,e,y,g),c.fillRect(t,e,y,g);c.restore()}},_=function(t,e,n,i){var a=g/2,r=y+a+t,o=e+a;c.fillText(n.text,r,o),n.hidden&&(c.beginPath(),c.lineWidth=2,c.moveTo(r,o),c.lineTo(r+i,o),c.stroke())},k=t.isHorizontal();d=k?{x:t.left+(l-u[0])/2,y:t.top+a.padding,line:0}:{x:t.left+a.padding,y:t.top+a.padding,line:0};var w=g+a.padding;r.each(t.legendItems,function(e,n){var i=c.measureText(e.text).width,r=y+g/2+i,o=d.x,s=d.y;k?o+r>=l&&(s=d.y+=w,d.line++,o=d.x=t.left+(l-u[d.line])/2):s+w>t.bottom&&(o=d.x=o+t.columnWidths[d.line]+a.padding,s=d.y=t.top+a.padding,d.line++),x(o,s,e),b[n].left=o,b[n].top=s,_(o,s,e,i),k?d.x+=r+a.padding:d.y+=w})}},handleEvent:function(t){var e=this,n=e.options,i="mouseup"===t.type?"click":t.type,a=!1;if("mousemove"===i){if(!n.onHover)return}else{if("click"!==i)return;if(!n.onClick)return}var r=t.x,o=t.y;if(r>=e.left&&r<=e.right&&o>=e.top&&o<=e.bottom)for(var s=e.legendHitBoxes,l=0;l=u.left&&r<=u.left+u.width&&o>=u.top&&o<=u.top+u.height){if("click"===i){n.onClick.call(e,t.native,e.legendItems[l]),a=!0;break}if("mousemove"===i){n.onHover.call(e,t.native,e.legendItems[l]),a=!0;break}}}return a}}),{id:"legend",beforeInit:function(t){var e=t.options.legend;e&&n(t,e)},beforeUpdate:function(t){var e=t.options.legend,a=t.legend;e?(r.mergeIf(e,i.global.legend),a?(o.configure(t,a,e),a.options=e):n(t,e)):a&&(o.removeBox(t,a),delete t.legend)},afterEvent:function(t,e){var n=t.legend;n&&n.handleEvent(e)}}}},{25:25,26:26,45:45}],51:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45);i._set("global",{title:{display:!1,fontStyle:"bold",fullWidth:!0,lineHeight:1.2,padding:10,position:"top",text:"",weight:2e3}}),e.exports=function(t){function e(e,i){var a=new t.Title({ctx:e.ctx,options:i,chart:e});n.configure(e,a,i),n.addBox(e,a),e.titleBlock=a}var n=t.layoutService,o=r.noop;return t.Title=a.extend({initialize:function(t){var e=this;r.extend(e,t),e.legendHitBoxes=[]},beforeUpdate:o,update:function(t,e,n){var i=this;return i.beforeUpdate(),i.maxWidth=t,i.maxHeight=e,i.margins=n,i.beforeSetDimensions(),i.setDimensions(),i.afterSetDimensions(),i.beforeBuildLabels(),i.buildLabels(),i.afterBuildLabels(),i.beforeFit(),i.fit(),i.afterFit(),i.afterUpdate(),i.minSize},afterUpdate:o,beforeSetDimensions:o,setDimensions:function(){var t=this;t.isHorizontal()?(t.width=t.maxWidth,t.left=0,t.right=t.width):(t.height=t.maxHeight,t.top=0,t.bottom=t.height),t.paddingLeft=0,t.paddingTop=0,t.paddingRight=0,t.paddingBottom=0,t.minSize={width:0,height:0}},afterSetDimensions:o,beforeBuildLabels:o,buildLabels:o,afterBuildLabels:o,beforeFit:o,fit:function(){var t=this,e=r.valueOrDefault,n=t.options,a=n.display,o=e(n.fontSize,i.global.defaultFontSize),s=t.minSize,l=r.isArray(n.text)?n.text.length:1,u=r.options.toLineHeight(n.lineHeight,o),d=a?l*u+2*n.padding:0;t.isHorizontal()?(s.width=t.maxWidth,s.height=d):(s.width=d,s.height=t.maxHeight),t.width=s.width,t.height=s.height},afterFit:o,isHorizontal:function(){var t=this.options.position;return"top"===t||"bottom"===t},draw:function(){var t=this,e=t.ctx,n=r.valueOrDefault,a=t.options,o=i.global;if(a.display){var s,l,u,d=n(a.fontSize,o.defaultFontSize),c=n(a.fontStyle,o.defaultFontStyle),h=n(a.fontFamily,o.defaultFontFamily),f=r.fontString(d,c,h),g=r.options.toLineHeight(a.lineHeight,d),m=g/2+a.padding,p=0,v=t.top,y=t.left,b=t.bottom,x=t.right;e.fillStyle=n(a.fontColor,o.defaultFontColor),e.font=f,t.isHorizontal()?(l=y+(x-y)/2,u=v+m,s=x-y):(l="left"===a.position?y+m:x-m,u=v+(b-v)/2,s=b-v,p=Math.PI*("left"===a.position?-.5:.5)),e.save(),e.translate(l,u),e.rotate(p),e.textAlign="center",e.textBaseline="middle";var _=a.text;if(r.isArray(_))for(var k=0,w=0;w<_.length;++w)e.fillText(_[w],0,k,s),k+=g;else e.fillText(_,0,0,s);e.restore()}}}),{id:"title",beforeInit:function(t){var n=t.options.title;n&&e(t,n)},beforeUpdate:function(a){var o=a.options.title,s=a.titleBlock;o?(r.mergeIf(o,i.global.title),s?(n.configure(a,s,o),s.options=o):e(a,o)):s&&(t.layoutService.removeBox(a,s),delete a.titleBlock)}}}},{25:25,26:26,45:45}],52:[function(t,e,n){"use strict";e.exports=function(t){var e={position:"bottom"},n=t.Scale.extend({getLabels:function(){var t=this.chart.data;return this.options.labels||(this.isHorizontal()?t.xLabels:t.yLabels)||t.labels},determineDataLimits:function(){var t=this,e=t.getLabels();t.minIndex=0,t.maxIndex=e.length-1;var n;void 0!==t.options.ticks.min&&(n=e.indexOf(t.options.ticks.min),t.minIndex=-1!==n?n:t.minIndex),void 0!==t.options.ticks.max&&(n=e.indexOf(t.options.ticks.max),t.maxIndex=-1!==n?n:t.maxIndex),t.min=e[t.minIndex],t.max=e[t.maxIndex]},buildTicks:function(){var t=this,e=t.getLabels();t.ticks=0===t.minIndex&&t.maxIndex===e.length-1?e:e.slice(t.minIndex,t.maxIndex+1)},getLabelForIndex:function(t,e){var n=this,i=n.chart.data,a=n.isHorizontal();return i.yLabels&&!a?n.getRightValue(i.datasets[e].data[t]):n.ticks[t-n.minIndex]},getPixelForValue:function(t,e){var n,i=this,a=i.options.offset,r=Math.max(i.maxIndex+1-i.minIndex-(a?0:1),1);if(void 0!==t&&null!==t&&(n=i.isHorizontal()?t.x:t.y),void 0!==n||void 0!==t&&isNaN(e)){var o=i.getLabels();t=n||t;var s=o.indexOf(t);e=-1!==s?s:e}if(i.isHorizontal()){var l=i.width/r,u=l*(e-i.minIndex);return a&&(u+=l/2),i.left+Math.round(u)}var d=i.height/r,c=d*(e-i.minIndex);return a&&(c+=d/2),i.top+Math.round(c)},getPixelForTick:function(t){return this.getPixelForValue(this.ticks[t],t+this.minIndex,null)},getValueForPixel:function(t){var e=this,n=e.options.offset,i=Math.max(e._ticks.length-(n?0:1),1),a=e.isHorizontal(),r=(a?e.width:e.height)/i;return t-=a?e.left:e.top,n&&(t-=r/2),(t<=0?0:Math.round(t/r))+e.minIndex},getBasePixel:function(){return this.bottom}});t.scaleService.registerScaleType("category",n,e)}},{}],53:[function(t,e,n){"use strict";var i=t(25),a=t(45),r=t(34);e.exports=function(t){var e={position:"left",ticks:{callback:r.formatters.linear}},n=t.LinearScaleBase.extend({determineDataLimits:function(){function t(t){return o?t.xAxisID===e.id:t.yAxisID===e.id}var e=this,n=e.options,i=e.chart,r=i.data.datasets,o=e.isHorizontal();e.min=null,e.max=null;var s=n.stacked;if(void 0===s&&a.each(r,function(e,n){if(!s){var a=i.getDatasetMeta(n);i.isDatasetVisible(n)&&t(a)&&void 0!==a.stack&&(s=!0)}}),n.stacked||s){var l={};a.each(r,function(r,o){var s=i.getDatasetMeta(o),u=[s.type,void 0===n.stacked&&void 0===s.stack?o:"",s.stack].join(".");void 0===l[u]&&(l[u]={positiveValues:[],negativeValues:[]});var d=l[u].positiveValues,c=l[u].negativeValues;i.isDatasetVisible(o)&&t(s)&&a.each(r.data,function(t,i){var a=+e.getRightValue(t);isNaN(a)||s.data[i].hidden||(d[i]=d[i]||0,c[i]=c[i]||0,n.relativePoints?d[i]=100:a<0?c[i]+=a:d[i]+=a)})}),a.each(l,function(t){var n=t.positiveValues.concat(t.negativeValues),i=a.min(n),r=a.max(n);e.min=null===e.min?i:Math.min(e.min,i),e.max=null===e.max?r:Math.max(e.max,r)})}else a.each(r,function(n,r){var o=i.getDatasetMeta(r);i.isDatasetVisible(r)&&t(o)&&a.each(n.data,function(t,n){var i=+e.getRightValue(t);isNaN(i)||o.data[n].hidden||(null===e.min?e.min=i:ie.max&&(e.max=i))})});e.min=isFinite(e.min)&&!isNaN(e.min)?e.min:0,e.max=isFinite(e.max)&&!isNaN(e.max)?e.max:1,this.handleTickRangeOptions()},getTickLimit:function(){var t,e=this,n=e.options.ticks;if(e.isHorizontal())t=Math.min(n.maxTicksLimit?n.maxTicksLimit:11,Math.ceil(e.width/50));else{var r=a.valueOrDefault(n.fontSize,i.global.defaultFontSize);t=Math.min(n.maxTicksLimit?n.maxTicksLimit:11,Math.ceil(e.height/(2*r)))}return t},handleDirectionalChanges:function(){this.isHorizontal()||this.ticks.reverse()},getLabelForIndex:function(t,e){return+this.getRightValue(this.chart.data.datasets[e].data[t])},getPixelForValue:function(t){var e,n=this,i=n.start,a=+n.getRightValue(t),r=n.end-i;return n.isHorizontal()?(e=n.left+n.width/r*(a-i),Math.round(e)):(e=n.bottom-n.height/r*(a-i),Math.round(e))},getValueForPixel:function(t){var e=this,n=e.isHorizontal(),i=n?e.width:e.height,a=(n?t-e.left:e.bottom-t)/i;return e.start+(e.end-e.start)*a},getPixelForTick:function(t){return this.getPixelForValue(this.ticksAsNumbers[t])}});t.scaleService.registerScaleType("linear",n,e)}},{25:25,34:34,45:45}],54:[function(t,e,n){"use strict";var i=t(45),a=t(34);e.exports=function(t){var e=i.noop;t.LinearScaleBase=t.Scale.extend({getRightValue:function(e){return"string"==typeof e?+e:t.Scale.prototype.getRightValue.call(this,e)},handleTickRangeOptions:function(){var t=this,e=t.options.ticks;if(e.beginAtZero){var n=i.sign(t.min),a=i.sign(t.max);n<0&&a<0?t.max=0:n>0&&a>0&&(t.min=0)}var r=void 0!==e.min||void 0!==e.suggestedMin,o=void 0!==e.max||void 0!==e.suggestedMax;void 0!==e.min?t.min=e.min:void 0!==e.suggestedMin&&(null===t.min?t.min=e.suggestedMin:t.min=Math.min(t.min,e.suggestedMin)),void 0!==e.max?t.max=e.max:void 0!==e.suggestedMax&&(null===t.max?t.max=e.suggestedMax:t.max=Math.max(t.max,e.suggestedMax)),r!==o&&t.min>=t.max&&(r?t.max=t.min+1:t.min=t.max-1),t.min===t.max&&(t.max++,e.beginAtZero||t.min--)},getTickLimit:e,handleDirectionalChanges:e,buildTicks:function(){var t=this,e=t.options.ticks,n=t.getTickLimit(),r={maxTicks:n=Math.max(2,n),min:e.min,max:e.max,stepSize:i.valueOrDefault(e.fixedStepSize,e.stepSize)},o=t.ticks=a.generators.linear(r,t);t.handleDirectionalChanges(),t.max=i.max(o),t.min=i.min(o),e.reverse?(o.reverse(),t.start=t.max,t.end=t.min):(t.start=t.min,t.end=t.max)},convertTicksToLabels:function(){var e=this;e.ticksAsNumbers=e.ticks.slice(),e.zeroLineIndex=e.ticks.indexOf(0),t.Scale.prototype.convertTicksToLabels.call(e)}})}},{34:34,45:45}],55:[function(t,e,n){"use strict";var i=t(45),a=t(34);e.exports=function(t){var e={position:"left",ticks:{callback:a.formatters.logarithmic}},n=t.Scale.extend({determineDataLimits:function(){function t(t){return l?t.xAxisID===e.id:t.yAxisID===e.id}var e=this,n=e.options,a=n.ticks,r=e.chart,o=r.data.datasets,s=i.valueOrDefault,l=e.isHorizontal();e.min=null,e.max=null,e.minNotZero=null;var u=n.stacked;if(void 0===u&&i.each(o,function(e,n){if(!u){var i=r.getDatasetMeta(n);r.isDatasetVisible(n)&&t(i)&&void 0!==i.stack&&(u=!0)}}),n.stacked||u){var d={};i.each(o,function(a,o){var s=r.getDatasetMeta(o),l=[s.type,void 0===n.stacked&&void 0===s.stack?o:"",s.stack].join(".");r.isDatasetVisible(o)&&t(s)&&(void 0===d[l]&&(d[l]=[]),i.each(a.data,function(t,i){var a=d[l],r=+e.getRightValue(t);isNaN(r)||s.data[i].hidden||(a[i]=a[i]||0,n.relativePoints?a[i]=100:a[i]+=r)}))}),i.each(d,function(t){var n=i.min(t),a=i.max(t);e.min=null===e.min?n:Math.min(e.min,n),e.max=null===e.max?a:Math.max(e.max,a)})}else i.each(o,function(n,a){var o=r.getDatasetMeta(a);r.isDatasetVisible(a)&&t(o)&&i.each(n.data,function(t,n){var i=+e.getRightValue(t);isNaN(i)||o.data[n].hidden||(null===e.min?e.min=i:ie.max&&(e.max=i),0!==i&&(null===e.minNotZero||ia?{start:e-n-5,end:e}:{start:e,end:e+n+5}}function l(t){var i,r,l,u=n(t),d=Math.min(t.height/2,t.width/2),c={r:t.width,l:0,t:t.height,b:0},h={};t.ctx.font=u.font,t._pointLabelSizes=[];var f=e(t);for(i=0;ic.r&&(c.r=p.end,h.r=g),v.startc.b&&(c.b=v.end,h.b=g)}t.setReductions(d,c,h)}function u(t){var e=Math.min(t.height/2,t.width/2);t.drawingArea=Math.round(e),t.setCenterPoint(0,0,0,0)}function d(t){return 0===t||180===t?"center":t<180?"left":"right"}function c(t,e,n,i){if(a.isArray(e))for(var r=n.y,o=1.5*i,s=0;s270||t<90)&&(n.y-=e.h)}function f(t){var i=t.ctx,r=a.valueOrDefault,o=t.options,s=o.angleLines,l=o.pointLabels;i.lineWidth=s.lineWidth,i.strokeStyle=s.color;var u=t.getDistanceFromCenterForValue(o.ticks.reverse?t.min:t.max),f=n(t);i.textBaseline="top";for(var g=e(t)-1;g>=0;g--){if(s.display){var m=t.getPointPosition(g,u);i.beginPath(),i.moveTo(t.xCenter,t.yCenter),i.lineTo(m.x,m.y),i.stroke(),i.closePath()}if(l.display){var v=t.getPointPosition(g,u+5),y=r(l.fontColor,p.defaultFontColor);i.font=f.font,i.fillStyle=y;var b=t.getIndexAngle(g),x=a.toDegrees(b);i.textAlign=d(x),h(x,t._pointLabelSizes[g],v),c(i,t.pointLabels[g]||"",v,f.size)}}}function g(t,n,i,r){var o=t.ctx;if(o.strokeStyle=a.valueAtIndexOrDefault(n.color,r-1),o.lineWidth=a.valueAtIndexOrDefault(n.lineWidth,r-1),t.options.gridLines.circular)o.beginPath(),o.arc(t.xCenter,t.yCenter,i,0,2*Math.PI),o.closePath(),o.stroke();else{var s=e(t);if(0===s)return;o.beginPath();var l=t.getPointPosition(0,i);o.moveTo(l.x,l.y);for(var u=1;u0&&n>0?e:0)},draw:function(){var t=this,e=t.options,n=e.gridLines,i=e.ticks,r=a.valueOrDefault;if(e.display){var o=t.ctx,s=this.getIndexAngle(0),l=r(i.fontSize,p.defaultFontSize),u=r(i.fontStyle,p.defaultFontStyle),d=r(i.fontFamily,p.defaultFontFamily),c=a.fontString(l,u,d);a.each(t.ticks,function(e,a){if(a>0||i.reverse){var u=t.getDistanceFromCenterForValue(t.ticksAsNumbers[a]);if(n.display&&0!==a&&g(t,n,u,a),i.display){var d=r(i.fontColor,p.defaultFontColor);if(o.font=c,o.save(),o.translate(t.xCenter,t.yCenter),o.rotate(s),i.showLabelBackdrop){var h=o.measureText(e).width;o.fillStyle=i.backdropColor,o.fillRect(-h/2-i.backdropPaddingX,-u-l/2-i.backdropPaddingY,h+2*i.backdropPaddingX,l+2*i.backdropPaddingY)}o.textAlign="center",o.textBaseline="middle",o.fillStyle=d,o.fillText(e,0,-u),o.restore()}}}),(e.angleLines.display||e.pointLabels.display)&&f(t)}}});t.scaleService.registerScaleType("radialLinear",y,v)}},{25:25,34:34,45:45}],57:[function(t,e,n){"use strict";function i(t,e){return t-e}function a(t){var e,n,i,a={},r=[];for(e=0,n=t.length;ee&&s=0&&o<=s;){if(i=o+s>>1,a=t[i-1]||null,r=t[i],!a)return{lo:null,hi:r};if(r[e]n))return{lo:a,hi:r};s=i-1}}return{lo:r,hi:null}}function s(t,e,n,i){var a=o(t,e,n),r=a.lo?a.hi?a.lo:t[t.length-2]:t[0],s=a.lo?a.hi?a.hi:t[t.length-1]:t[1],l=s[e]-r[e],u=l?(n-r[e])/l:0,d=(s[i]-r[i])*u;return r[i]+d}function l(t,e){var n=e.parser,i=e.parser||e.format;return"function"==typeof n?n(t):"string"==typeof t&&"string"==typeof i?p(t,i):(t instanceof p||(t=p(t)),t.isValid()?t:"function"==typeof i?i(t):t)}function u(t,e){if(y.isNullOrUndef(t))return null;var n=e.options.time,i=l(e.getRightValue(t),n);return i.isValid()?(n.round&&i.startOf(n.round),i.valueOf()):null}function d(t,e,n,i){var a,r,o,s=e-t,l=_[n],u=l.size,d=l.steps;if(!d)return Math.ceil(s/((i||1)*u));for(a=0,r=d.length;a1?e[1]:i,o=e[0],l=(s(t,"time",r,"pos")-s(t,"time",o,"pos"))/2),a.time.max||(r=e[e.length-1],o=e.length>1?e[e.length-2]:n,u=(s(t,"time",r,"pos")-s(t,"time",o,"pos"))/2)),{left:l,right:u}}function m(t,e){var n,i,a,r,o=[];for(n=0,i=t.length;n=a&&n<=o&&x.push(n);return i.min=a,i.max=o,i._unit=v,i._majorUnit=y,i._minorFormat=d[v],i._majorFormat=d[y],i._table=r(i._timestamps.data,a,o,s.distribution),i._offsets=g(i._table,x,a,o,s),m(x,y)},getLabelForIndex:function(t,e){var n=this,i=n.chart.data,a=n.options.time,r=i.labels&&t=0&&t + * @version 1.2.2 + * @licence MIT + * @preserve + */ +!function(i){if("function"==typeof define&&define.amd)define(["jquery"],i);else if("object"==typeof module&&module.exports){var t=require("jquery");i(t),module.exports=t}else i(jQuery)}(function(i){function t(i){this.init(i)}t.prototype={value:0,size:100,startAngle:-Math.PI,thickness:"auto",fill:{gradient:["#3aeabb","#fdd250"]},emptyFill:"rgba(0, 0, 0, .1)",animation:{duration:1200,easing:"circleProgressEasing"},animationStartValue:0,reverse:!1,lineCap:"butt",insertMode:"prepend",constructor:t,el:null,canvas:null,ctx:null,radius:0,arcFill:null,lastFrameValue:0,init:function(t){i.extend(this,t),this.radius=this.size/2,this.initWidget(),this.initFill(),this.draw(),this.el.trigger("circle-inited")},initWidget:function(){this.canvas||(this.canvas=i("")["prepend"==this.insertMode?"prependTo":"appendTo"](this.el)[0]);var t=this.canvas;if(t.width=this.size,t.height=this.size,this.ctx=t.getContext("2d"),window.devicePixelRatio>1){var e=window.devicePixelRatio;t.style.width=t.style.height=this.size+"px",t.width=t.height=this.size*e,this.ctx.scale(e,e)}},initFill:function(){function t(){var t=i("")[0];t.width=e.size,t.height=e.size,t.getContext("2d").drawImage(g,0,0,r,r),e.arcFill=e.ctx.createPattern(t,"no-repeat"),e.drawFrame(e.lastFrameValue)}var e=this,a=this.fill,n=this.ctx,r=this.size;if(!a)throw Error("The fill is not specified!");if("string"==typeof a&&(a={color:a}),a.color&&(this.arcFill=a.color),a.gradient){var s=a.gradient;if(1==s.length)this.arcFill=s[0];else if(s.length>1){for(var l=a.gradientAngle||0,o=a.gradientDirection||[r/2*(1-Math.cos(l)),r/2*(1+Math.sin(l)),r/2*(1+Math.cos(l)),r/2*(1-Math.sin(l))],h=n.createLinearGradient.apply(n,o),c=0;c=0&&c0&&b-1 in a)}var x=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=ha(),z=ha(),A=ha(),B=function(a,b){return a===b&&(l=!0),0},C={}.hasOwnProperty,D=[],E=D.pop,F=D.push,G=D.push,H=D.slice,I=function(a,b){for(var c=0,d=a.length;c+~]|"+K+")"+K+"*"),S=new RegExp("="+K+"*([^\\]'\"]*?)"+K+"*\\]","g"),T=new RegExp(N),U=new RegExp("^"+L+"$"),V={ID:new RegExp("^#("+L+")"),CLASS:new RegExp("^\\.("+L+")"),TAG:new RegExp("^("+L+"|[*])"),ATTR:new RegExp("^"+M),PSEUDO:new RegExp("^"+N),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+K+"*(even|odd|(([+-]|)(\\d*)n|)"+K+"*(?:([+-]|)"+K+"*(\\d+)|))"+K+"*\\)|)","i"),bool:new RegExp("^(?:"+J+")$","i"),needsContext:new RegExp("^"+K+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+K+"*((?:-\\d)?\\d*)"+K+"*\\)|)(?=[^-]|$)","i")},W=/^(?:input|select|textarea|button)$/i,X=/^h\d$/i,Y=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,$=/[+~]/,_=new RegExp("\\\\([\\da-f]{1,6}"+K+"?|("+K+")|.)","ig"),aa=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:d<0?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},ba=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ca=function(a,b){return b?"\0"===a?"\ufffd":a.slice(0,-1)+"\\"+a.charCodeAt(a.length-1).toString(16)+" ":"\\"+a},da=function(){m()},ea=ta(function(a){return a.disabled===!0&&("form"in a||"label"in a)},{dir:"parentNode",next:"legend"});try{G.apply(D=H.call(v.childNodes),v.childNodes),D[v.childNodes.length].nodeType}catch(fa){G={apply:D.length?function(a,b){F.apply(a,H.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function ga(a,b,d,e){var f,h,j,k,l,o,r,s=b&&b.ownerDocument,w=b?b.nodeType:9;if(d=d||[],"string"!=typeof a||!a||1!==w&&9!==w&&11!==w)return d;if(!e&&((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,p)){if(11!==w&&(l=Z.exec(a)))if(f=l[1]){if(9===w){if(!(j=b.getElementById(f)))return d;if(j.id===f)return d.push(j),d}else if(s&&(j=s.getElementById(f))&&t(b,j)&&j.id===f)return d.push(j),d}else{if(l[2])return G.apply(d,b.getElementsByTagName(a)),d;if((f=l[3])&&c.getElementsByClassName&&b.getElementsByClassName)return G.apply(d,b.getElementsByClassName(f)),d}if(c.qsa&&!A[a+" "]&&(!q||!q.test(a))){if(1!==w)s=b,r=a;else if("object"!==b.nodeName.toLowerCase()){(k=b.getAttribute("id"))?k=k.replace(ba,ca):b.setAttribute("id",k=u),o=g(a),h=o.length;while(h--)o[h]="#"+k+" "+sa(o[h]);r=o.join(","),s=$.test(a)&&qa(b.parentNode)||b}if(r)try{return G.apply(d,s.querySelectorAll(r)),d}catch(x){}finally{k===u&&b.removeAttribute("id")}}}return i(a.replace(P,"$1"),b,d,e)}function ha(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ia(a){return a[u]=!0,a}function ja(a){var b=n.createElement("fieldset");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function ka(a,b){var c=a.split("|"),e=c.length;while(e--)d.attrHandle[c[e]]=b}function la(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&a.sourceIndex-b.sourceIndex;if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function ma(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function na(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function oa(a){return function(b){return"form"in b?b.parentNode&&b.disabled===!1?"label"in b?"label"in b.parentNode?b.parentNode.disabled===a:b.disabled===a:b.isDisabled===a||b.isDisabled!==!a&&ea(b)===a:b.disabled===a:"label"in b&&b.disabled===a}}function pa(a){return ia(function(b){return b=+b,ia(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function qa(a){return a&&"undefined"!=typeof a.getElementsByTagName&&a}c=ga.support={},f=ga.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return!!b&&"HTML"!==b.nodeName},m=ga.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=n.documentElement,p=!f(n),v!==n&&(e=n.defaultView)&&e.top!==e&&(e.addEventListener?e.addEventListener("unload",da,!1):e.attachEvent&&e.attachEvent("onunload",da)),c.attributes=ja(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=ja(function(a){return a.appendChild(n.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=Y.test(n.getElementsByClassName),c.getById=ja(function(a){return o.appendChild(a).id=u,!n.getElementsByName||!n.getElementsByName(u).length}),c.getById?(d.filter.ID=function(a){var b=a.replace(_,aa);return function(a){return a.getAttribute("id")===b}},d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c=b.getElementById(a);return c?[c]:[]}}):(d.filter.ID=function(a){var b=a.replace(_,aa);return function(a){var c="undefined"!=typeof a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}},d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c,d,e,f=b.getElementById(a);if(f){if(c=f.getAttributeNode("id"),c&&c.value===a)return[f];e=b.getElementsByName(a),d=0;while(f=e[d++])if(c=f.getAttributeNode("id"),c&&c.value===a)return[f]}return[]}}),d.find.TAG=c.getElementsByTagName?function(a,b){return"undefined"!=typeof b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){if("undefined"!=typeof b.getElementsByClassName&&p)return b.getElementsByClassName(a)},r=[],q=[],(c.qsa=Y.test(n.querySelectorAll))&&(ja(function(a){o.appendChild(a).innerHTML="",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+K+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+K+"*(?:value|"+J+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),ja(function(a){a.innerHTML="";var b=n.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+K+"*[*^$|!~]?="),2!==a.querySelectorAll(":enabled").length&&q.push(":enabled",":disabled"),o.appendChild(a).disabled=!0,2!==a.querySelectorAll(":disabled").length&&q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=Y.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&ja(function(a){c.disconnectedMatch=s.call(a,"*"),s.call(a,"[s!='']:x"),r.push("!=",N)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=Y.test(o.compareDocumentPosition),t=b||Y.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===n||a.ownerDocument===v&&t(v,a)?-1:b===n||b.ownerDocument===v&&t(v,b)?1:k?I(k,a)-I(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,g=[a],h=[b];if(!e||!f)return a===n?-1:b===n?1:e?-1:f?1:k?I(k,a)-I(k,b):0;if(e===f)return la(a,b);c=a;while(c=c.parentNode)g.unshift(c);c=b;while(c=c.parentNode)h.unshift(c);while(g[d]===h[d])d++;return d?la(g[d],h[d]):g[d]===v?-1:h[d]===v?1:0},n):n},ga.matches=function(a,b){return ga(a,null,null,b)},ga.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(S,"='$1']"),c.matchesSelector&&p&&!A[b+" "]&&(!r||!r.test(b))&&(!q||!q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return ga(b,n,null,[a]).length>0},ga.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},ga.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&C.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},ga.escape=function(a){return(a+"").replace(ba,ca)},ga.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},ga.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=ga.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=ga.selectors={cacheLength:50,createPseudo:ia,match:V,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(_,aa),a[3]=(a[3]||a[4]||a[5]||"").replace(_,aa),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||ga.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&ga.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return V.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&T.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(_,aa).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+K+")"+a+"("+K+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||"undefined"!=typeof a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=ga.attr(d,a);return null==e?"!="===b:!b||(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(O," ")+" ").indexOf(c)>-1:"|="===b&&(e===c||e.slice(0,c.length+1)===c+"-"))}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h,t=!1;if(q){if(f){while(p){m=b;while(m=m[p])if(h?m.nodeName.toLowerCase()===r:1===m.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){m=q,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n&&j[2],m=n&&q.childNodes[n];while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if(1===m.nodeType&&++t&&m===b){k[a]=[w,n,t];break}}else if(s&&(m=b,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n),t===!1)while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if((h?m.nodeName.toLowerCase()===r:1===m.nodeType)&&++t&&(s&&(l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),k[a]=[w,t]),m===b))break;return t-=e,t===d||t%d===0&&t/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||ga.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ia(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=I(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ia(function(a){var b=[],c=[],d=h(a.replace(P,"$1"));return d[u]?ia(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ia(function(a){return function(b){return ga(a,b).length>0}}),contains:ia(function(a){return a=a.replace(_,aa),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ia(function(a){return U.test(a||"")||ga.error("unsupported lang: "+a),a=a.replace(_,aa).toLowerCase(),function(b){var c;do if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:oa(!1),disabled:oa(!0),checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return X.test(a.nodeName)},input:function(a){return W.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:pa(function(){return[0]}),last:pa(function(a,b){return[b-1]}),eq:pa(function(a,b,c){return[c<0?c+b:c]}),even:pa(function(a,b){for(var c=0;c=0;)a.push(d);return a}),gt:pa(function(a,b,c){for(var d=c<0?c+b:c;++d1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function va(a,b,c){for(var d=0,e=b.length;d-1&&(f[j]=!(g[j]=l))}}else r=wa(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):G.apply(g,r)})}function ya(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=ta(function(a){return a===b},h,!0),l=ta(function(a){return I(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];i1&&ua(m),i>1&&sa(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(P,"$1"),c,i0,e=a.length>0,f=function(f,g,h,i,k){var l,o,q,r=0,s="0",t=f&&[],u=[],v=j,x=f||e&&d.find.TAG("*",k),y=w+=null==v?1:Math.random()||.1,z=x.length;for(k&&(j=g===n||g||k);s!==z&&null!=(l=x[s]);s++){if(e&&l){o=0,g||l.ownerDocument===n||(m(l),h=!p);while(q=a[o++])if(q(l,g||n,h)){i.push(l);break}k&&(w=y)}c&&((l=!q&&l)&&r--,f&&t.push(l))}if(r+=s,c&&s!==r){o=0;while(q=b[o++])q(t,u,g,h);if(f){if(r>0)while(s--)t[s]||u[s]||(u[s]=E.call(i));u=wa(u)}G.apply(i,u),k&&!f&&u.length>0&&r+b.length>1&&ga.uniqueSort(i)}return k&&(w=y,j=v),t};return c?ia(f):f}return h=ga.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=ya(b[c]),f[u]?d.push(f):e.push(f);f=A(a,za(e,d)),f.selector=a}return f},i=ga.select=function(a,b,c,e){var f,i,j,k,l,m="function"==typeof a&&a,n=!e&&g(a=m.selector||a);if(c=c||[],1===n.length){if(i=n[0]=n[0].slice(0),i.length>2&&"ID"===(j=i[0]).type&&9===b.nodeType&&p&&d.relative[i[1].type]){if(b=(d.find.ID(j.matches[0].replace(_,aa),b)||[])[0],!b)return c;m&&(b=b.parentNode),a=a.slice(i.shift().value.length)}f=V.needsContext.test(a)?0:i.length;while(f--){if(j=i[f],d.relative[k=j.type])break;if((l=d.find[k])&&(e=l(j.matches[0].replace(_,aa),$.test(i[0].type)&&qa(b.parentNode)||b))){if(i.splice(f,1),a=e.length&&sa(i),!a)return G.apply(c,e),c;break}}}return(m||h(a,n))(e,b,!p,c,!b||$.test(a)&&qa(b.parentNode)||b),c},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=ja(function(a){return 1&a.compareDocumentPosition(n.createElement("fieldset"))}),ja(function(a){return a.innerHTML="","#"===a.firstChild.getAttribute("href")})||ka("type|href|height|width",function(a,b,c){if(!c)return a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&ja(function(a){return a.innerHTML="",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||ka("value",function(a,b,c){if(!c&&"input"===a.nodeName.toLowerCase())return a.defaultValue}),ja(function(a){return null==a.getAttribute("disabled")})||ka(J,function(a,b,c){var d;if(!c)return a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),ga}(a);r.find=x,r.expr=x.selectors,r.expr[":"]=r.expr.pseudos,r.uniqueSort=r.unique=x.uniqueSort,r.text=x.getText,r.isXMLDoc=x.isXML,r.contains=x.contains,r.escapeSelector=x.escape;var y=function(a,b,c){var d=[],e=void 0!==c;while((a=a[b])&&9!==a.nodeType)if(1===a.nodeType){if(e&&r(a).is(c))break;d.push(a)}return d},z=function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c},A=r.expr.match.needsContext;function B(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()}var C=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i,D=/^.[^:#\[\.,]*$/;function E(a,b,c){return r.isFunction(b)?r.grep(a,function(a,d){return!!b.call(a,d,a)!==c}):b.nodeType?r.grep(a,function(a){return a===b!==c}):"string"!=typeof b?r.grep(a,function(a){return i.call(b,a)>-1!==c}):D.test(b)?r.filter(b,a,c):(b=r.filter(b,a),r.grep(a,function(a){return i.call(b,a)>-1!==c&&1===a.nodeType}))}r.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?r.find.matchesSelector(d,a)?[d]:[]:r.find.matches(a,r.grep(b,function(a){return 1===a.nodeType}))},r.fn.extend({find:function(a){var b,c,d=this.length,e=this;if("string"!=typeof a)return this.pushStack(r(a).filter(function(){for(b=0;b1?r.uniqueSort(c):c},filter:function(a){return this.pushStack(E(this,a||[],!1))},not:function(a){return this.pushStack(E(this,a||[],!0))},is:function(a){return!!E(this,"string"==typeof a&&A.test(a)?r(a):a||[],!1).length}});var F,G=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,H=r.fn.init=function(a,b,c){var e,f;if(!a)return this;if(c=c||F,"string"==typeof a){if(e="<"===a[0]&&">"===a[a.length-1]&&a.length>=3?[null,a,null]:G.exec(a),!e||!e[1]&&b)return!b||b.jquery?(b||c).find(a):this.constructor(b).find(a);if(e[1]){if(b=b instanceof r?b[0]:b,r.merge(this,r.parseHTML(e[1],b&&b.nodeType?b.ownerDocument||b:d,!0)),C.test(e[1])&&r.isPlainObject(b))for(e in b)r.isFunction(this[e])?this[e](b[e]):this.attr(e,b[e]);return this}return f=d.getElementById(e[2]),f&&(this[0]=f,this.length=1),this}return a.nodeType?(this[0]=a,this.length=1,this):r.isFunction(a)?void 0!==c.ready?c.ready(a):a(r):r.makeArray(a,this)};H.prototype=r.fn,F=r(d);var I=/^(?:parents|prev(?:Until|All))/,J={children:!0,contents:!0,next:!0,prev:!0};r.fn.extend({has:function(a){var b=r(a,this),c=b.length;return this.filter(function(){for(var a=0;a-1:1===c.nodeType&&r.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?r.uniqueSort(f):f)},index:function(a){return a?"string"==typeof a?i.call(r(a),this[0]):i.call(this,a.jquery?a[0]:a):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(r.uniqueSort(r.merge(this.get(),r(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function K(a,b){while((a=a[b])&&1!==a.nodeType);return a}r.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return y(a,"parentNode")},parentsUntil:function(a,b,c){return y(a,"parentNode",c)},next:function(a){return K(a,"nextSibling")},prev:function(a){return K(a,"previousSibling")},nextAll:function(a){return y(a,"nextSibling")},prevAll:function(a){return y(a,"previousSibling")},nextUntil:function(a,b,c){return y(a,"nextSibling",c)},prevUntil:function(a,b,c){return y(a,"previousSibling",c)},siblings:function(a){return z((a.parentNode||{}).firstChild,a)},children:function(a){return z(a.firstChild)},contents:function(a){return B(a,"iframe")?a.contentDocument:(B(a,"template")&&(a=a.content||a),r.merge([],a.childNodes))}},function(a,b){r.fn[a]=function(c,d){var e=r.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=r.filter(d,e)),this.length>1&&(J[a]||r.uniqueSort(e),I.test(a)&&e.reverse()),this.pushStack(e)}});var L=/[^\x20\t\r\n\f]+/g;function M(a){var b={};return r.each(a.match(L)||[],function(a,c){b[c]=!0}),b}r.Callbacks=function(a){a="string"==typeof a?M(a):r.extend({},a);var b,c,d,e,f=[],g=[],h=-1,i=function(){for(e=e||a.once,d=b=!0;g.length;h=-1){c=g.shift();while(++h-1)f.splice(c,1),c<=h&&h--}),this},has:function(a){return a?r.inArray(a,f)>-1:f.length>0},empty:function(){return f&&(f=[]),this},disable:function(){return e=g=[],f=c="",this},disabled:function(){return!f},lock:function(){return e=g=[],c||b||(f=c=""),this},locked:function(){return!!e},fireWith:function(a,c){return e||(c=c||[],c=[a,c.slice?c.slice():c],g.push(c),b||i()),this},fire:function(){return j.fireWith(this,arguments),this},fired:function(){return!!d}};return j};function N(a){return a}function O(a){throw a}function P(a,b,c,d){var e;try{a&&r.isFunction(e=a.promise)?e.call(a).done(b).fail(c):a&&r.isFunction(e=a.then)?e.call(a,b,c):b.apply(void 0,[a].slice(d))}catch(a){c.apply(void 0,[a])}}r.extend({Deferred:function(b){var c=[["notify","progress",r.Callbacks("memory"),r.Callbacks("memory"),2],["resolve","done",r.Callbacks("once memory"),r.Callbacks("once memory"),0,"resolved"],["reject","fail",r.Callbacks("once memory"),r.Callbacks("once memory"),1,"rejected"]],d="pending",e={state:function(){return d},always:function(){return f.done(arguments).fail(arguments),this},"catch":function(a){return e.then(null,a)},pipe:function(){var a=arguments;return r.Deferred(function(b){r.each(c,function(c,d){var e=r.isFunction(a[d[4]])&&a[d[4]];f[d[1]](function(){var a=e&&e.apply(this,arguments);a&&r.isFunction(a.promise)?a.promise().progress(b.notify).done(b.resolve).fail(b.reject):b[d[0]+"With"](this,e?[a]:arguments)})}),a=null}).promise()},then:function(b,d,e){var f=0;function g(b,c,d,e){return function(){var h=this,i=arguments,j=function(){var a,j;if(!(b=f&&(d!==O&&(h=void 0,i=[a]),c.rejectWith(h,i))}};b?k():(r.Deferred.getStackHook&&(k.stackTrace=r.Deferred.getStackHook()),a.setTimeout(k))}}return r.Deferred(function(a){c[0][3].add(g(0,a,r.isFunction(e)?e:N,a.notifyWith)),c[1][3].add(g(0,a,r.isFunction(b)?b:N)),c[2][3].add(g(0,a,r.isFunction(d)?d:O))}).promise()},promise:function(a){return null!=a?r.extend(a,e):e}},f={};return r.each(c,function(a,b){var g=b[2],h=b[5];e[b[1]]=g.add,h&&g.add(function(){d=h},c[3-a][2].disable,c[0][2].lock),g.add(b[3].fire),f[b[0]]=function(){return f[b[0]+"With"](this===f?void 0:this,arguments),this},f[b[0]+"With"]=g.fireWith}),e.promise(f),b&&b.call(f,f),f},when:function(a){var b=arguments.length,c=b,d=Array(c),e=f.call(arguments),g=r.Deferred(),h=function(a){return function(c){d[a]=this,e[a]=arguments.length>1?f.call(arguments):c,--b||g.resolveWith(d,e)}};if(b<=1&&(P(a,g.done(h(c)).resolve,g.reject,!b),"pending"===g.state()||r.isFunction(e[c]&&e[c].then)))return g.then();while(c--)P(e[c],h(c),g.reject);return g.promise()}});var Q=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;r.Deferred.exceptionHook=function(b,c){a.console&&a.console.warn&&b&&Q.test(b.name)&&a.console.warn("jQuery.Deferred exception: "+b.message,b.stack,c)},r.readyException=function(b){a.setTimeout(function(){throw b})};var R=r.Deferred();r.fn.ready=function(a){return R.then(a)["catch"](function(a){r.readyException(a)}),this},r.extend({isReady:!1,readyWait:1,ready:function(a){(a===!0?--r.readyWait:r.isReady)||(r.isReady=!0,a!==!0&&--r.readyWait>0||R.resolveWith(d,[r]))}}),r.ready.then=R.then;function S(){d.removeEventListener("DOMContentLoaded",S), +a.removeEventListener("load",S),r.ready()}"complete"===d.readyState||"loading"!==d.readyState&&!d.documentElement.doScroll?a.setTimeout(r.ready):(d.addEventListener("DOMContentLoaded",S),a.addEventListener("load",S));var T=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===r.type(c)){e=!0;for(h in c)T(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,r.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(r(a),c)})),b))for(;h1,null,!0)},removeData:function(a){return this.each(function(){X.remove(this,a)})}}),r.extend({queue:function(a,b,c){var d;if(a)return b=(b||"fx")+"queue",d=W.get(a,b),c&&(!d||Array.isArray(c)?d=W.access(a,b,r.makeArray(c)):d.push(c)),d||[]},dequeue:function(a,b){b=b||"fx";var c=r.queue(a,b),d=c.length,e=c.shift(),f=r._queueHooks(a,b),g=function(){r.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return W.get(a,c)||W.access(a,c,{empty:r.Callbacks("once memory").add(function(){W.remove(a,[b+"queue",c])})})}}),r.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length\x20\t\r\n\f]+)/i,la=/^$|\/(?:java|ecma)script/i,ma={option:[1,""],thead:[1,"","
"],col:[2,"","
"],tr:[2,"","
"],td:[3,"","
"],_default:[0,"",""]};ma.optgroup=ma.option,ma.tbody=ma.tfoot=ma.colgroup=ma.caption=ma.thead,ma.th=ma.td;function na(a,b){var c;return c="undefined"!=typeof a.getElementsByTagName?a.getElementsByTagName(b||"*"):"undefined"!=typeof a.querySelectorAll?a.querySelectorAll(b||"*"):[],void 0===b||b&&B(a,b)?r.merge([a],c):c}function oa(a,b){for(var c=0,d=a.length;c-1)e&&e.push(f);else if(j=r.contains(f.ownerDocument,f),g=na(l.appendChild(f),"script"),j&&oa(g),c){k=0;while(f=g[k++])la.test(f.type||"")&&c.push(f)}return l}!function(){var a=d.createDocumentFragment(),b=a.appendChild(d.createElement("div")),c=d.createElement("input");c.setAttribute("type","radio"),c.setAttribute("checked","checked"),c.setAttribute("name","t"),b.appendChild(c),o.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,b.innerHTML="",o.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue}();var ra=d.documentElement,sa=/^key/,ta=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,ua=/^([^.]*)(?:\.(.+)|)/;function va(){return!0}function wa(){return!1}function xa(){try{return d.activeElement}catch(a){}}function ya(a,b,c,d,e,f){var g,h;if("object"==typeof b){"string"!=typeof c&&(d=d||c,c=void 0);for(h in b)ya(a,h,c,d,b[h],f);return a}if(null==d&&null==e?(e=c,d=c=void 0):null==e&&("string"==typeof c?(e=d,d=void 0):(e=d,d=c,c=void 0)),e===!1)e=wa;else if(!e)return a;return 1===f&&(g=e,e=function(a){return r().off(a),g.apply(this,arguments)},e.guid=g.guid||(g.guid=r.guid++)),a.each(function(){r.event.add(this,b,e,d,c)})}r.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=W.get(a);if(q){c.handler&&(f=c,c=f.handler,e=f.selector),e&&r.find.matchesSelector(ra,e),c.guid||(c.guid=r.guid++),(i=q.events)||(i=q.events={}),(g=q.handle)||(g=q.handle=function(b){return"undefined"!=typeof r&&r.event.triggered!==b.type?r.event.dispatch.apply(a,arguments):void 0}),b=(b||"").match(L)||[""],j=b.length;while(j--)h=ua.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n&&(l=r.event.special[n]||{},n=(e?l.delegateType:l.bindType)||n,l=r.event.special[n]||{},k=r.extend({type:n,origType:p,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&r.expr.match.needsContext.test(e),namespace:o.join(".")},f),(m=i[n])||(m=i[n]=[],m.delegateCount=0,l.setup&&l.setup.call(a,d,o,g)!==!1||a.addEventListener&&a.addEventListener(n,g)),l.add&&(l.add.call(a,k),k.handler.guid||(k.handler.guid=c.guid)),e?m.splice(m.delegateCount++,0,k):m.push(k),r.event.global[n]=!0)}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=W.hasData(a)&&W.get(a);if(q&&(i=q.events)){b=(b||"").match(L)||[""],j=b.length;while(j--)if(h=ua.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n){l=r.event.special[n]||{},n=(d?l.delegateType:l.bindType)||n,m=i[n]||[],h=h[2]&&new RegExp("(^|\\.)"+o.join("\\.(?:.*\\.|)")+"(\\.|$)"),g=f=m.length;while(f--)k=m[f],!e&&p!==k.origType||c&&c.guid!==k.guid||h&&!h.test(k.namespace)||d&&d!==k.selector&&("**"!==d||!k.selector)||(m.splice(f,1),k.selector&&m.delegateCount--,l.remove&&l.remove.call(a,k));g&&!m.length&&(l.teardown&&l.teardown.call(a,o,q.handle)!==!1||r.removeEvent(a,n,q.handle),delete i[n])}else for(n in i)r.event.remove(a,n+b[j],c,d,!0);r.isEmptyObject(i)&&W.remove(a,"handle events")}},dispatch:function(a){var b=r.event.fix(a),c,d,e,f,g,h,i=new Array(arguments.length),j=(W.get(this,"events")||{})[b.type]||[],k=r.event.special[b.type]||{};for(i[0]=b,c=1;c=1))for(;j!==this;j=j.parentNode||this)if(1===j.nodeType&&("click"!==a.type||j.disabled!==!0)){for(f=[],g={},c=0;c-1:r.find(e,this,null,[j]).length),g[e]&&f.push(d);f.length&&h.push({elem:j,handlers:f})}return j=this,i\x20\t\r\n\f]*)[^>]*)\/>/gi,Aa=/\s*$/g;function Ea(a,b){return B(a,"table")&&B(11!==b.nodeType?b:b.firstChild,"tr")?r(">tbody",a)[0]||a:a}function Fa(a){return a.type=(null!==a.getAttribute("type"))+"/"+a.type,a}function Ga(a){var b=Ca.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function Ha(a,b){var c,d,e,f,g,h,i,j;if(1===b.nodeType){if(W.hasData(a)&&(f=W.access(a),g=W.set(b,f),j=f.events)){delete g.handle,g.events={};for(e in j)for(c=0,d=j[e].length;c1&&"string"==typeof q&&!o.checkClone&&Ba.test(q))return a.each(function(e){var f=a.eq(e);s&&(b[0]=q.call(this,e,f.html())),Ja(f,b,c,d)});if(m&&(e=qa(b,a[0].ownerDocument,!1,a,d),f=e.firstChild,1===e.childNodes.length&&(e=f),f||d)){for(h=r.map(na(e,"script"),Fa),i=h.length;l")},clone:function(a,b,c){var d,e,f,g,h=a.cloneNode(!0),i=r.contains(a.ownerDocument,a);if(!(o.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||r.isXMLDoc(a)))for(g=na(h),f=na(a),d=0,e=f.length;d0&&oa(g,!i&&na(a,"script")),h},cleanData:function(a){for(var b,c,d,e=r.event.special,f=0;void 0!==(c=a[f]);f++)if(U(c)){if(b=c[W.expando]){if(b.events)for(d in b.events)e[d]?r.event.remove(c,d):r.removeEvent(c,d,b.handle);c[W.expando]=void 0}c[X.expando]&&(c[X.expando]=void 0)}}}),r.fn.extend({detach:function(a){return Ka(this,a,!0)},remove:function(a){return Ka(this,a)},text:function(a){return T(this,function(a){return void 0===a?r.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=a)})},null,a,arguments.length)},append:function(){return Ja(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=Ea(this,a);b.appendChild(a)}})},prepend:function(){return Ja(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=Ea(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return Ja(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return Ja(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},empty:function(){for(var a,b=0;null!=(a=this[b]);b++)1===a.nodeType&&(r.cleanData(na(a,!1)),a.textContent="");return this},clone:function(a,b){return a=null!=a&&a,b=null==b?a:b,this.map(function(){return r.clone(this,a,b)})},html:function(a){return T(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a&&1===b.nodeType)return b.innerHTML;if("string"==typeof a&&!Aa.test(a)&&!ma[(ka.exec(a)||["",""])[1].toLowerCase()]){a=r.htmlPrefilter(a);try{for(;c1)}});function _a(a,b,c,d,e){return new _a.prototype.init(a,b,c,d,e)}r.Tween=_a,_a.prototype={constructor:_a,init:function(a,b,c,d,e,f){this.elem=a,this.prop=c,this.easing=e||r.easing._default,this.options=b,this.start=this.now=this.cur(),this.end=d,this.unit=f||(r.cssNumber[c]?"":"px")},cur:function(){var a=_a.propHooks[this.prop];return a&&a.get?a.get(this):_a.propHooks._default.get(this)},run:function(a){var b,c=_a.propHooks[this.prop];return this.options.duration?this.pos=b=r.easing[this.easing](a,this.options.duration*a,0,1,this.options.duration):this.pos=b=a,this.now=(this.end-this.start)*b+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),c&&c.set?c.set(this):_a.propHooks._default.set(this),this}},_a.prototype.init.prototype=_a.prototype,_a.propHooks={_default:{get:function(a){var b;return 1!==a.elem.nodeType||null!=a.elem[a.prop]&&null==a.elem.style[a.prop]?a.elem[a.prop]:(b=r.css(a.elem,a.prop,""),b&&"auto"!==b?b:0)},set:function(a){r.fx.step[a.prop]?r.fx.step[a.prop](a):1!==a.elem.nodeType||null==a.elem.style[r.cssProps[a.prop]]&&!r.cssHooks[a.prop]?a.elem[a.prop]=a.now:r.style(a.elem,a.prop,a.now+a.unit)}}},_a.propHooks.scrollTop=_a.propHooks.scrollLeft={set:function(a){a.elem.nodeType&&a.elem.parentNode&&(a.elem[a.prop]=a.now)}},r.easing={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},_default:"swing"},r.fx=_a.prototype.init,r.fx.step={};var ab,bb,cb=/^(?:toggle|show|hide)$/,db=/queueHooks$/;function eb(){bb&&(d.hidden===!1&&a.requestAnimationFrame?a.requestAnimationFrame(eb):a.setTimeout(eb,r.fx.interval),r.fx.tick())}function fb(){return a.setTimeout(function(){ab=void 0}),ab=r.now()}function gb(a,b){var c,d=0,e={height:a};for(b=b?1:0;d<4;d+=2-b)c=ca[d],e["margin"+c]=e["padding"+c]=a;return b&&(e.opacity=e.width=a),e}function hb(a,b,c){for(var d,e=(kb.tweeners[b]||[]).concat(kb.tweeners["*"]),f=0,g=e.length;f1)},removeAttr:function(a){return this.each(function(){r.removeAttr(this,a)})}}),r.extend({attr:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return"undefined"==typeof a.getAttribute?r.prop(a,b,c):(1===f&&r.isXMLDoc(a)||(e=r.attrHooks[b.toLowerCase()]||(r.expr.match.bool.test(b)?lb:void 0)),void 0!==c?null===c?void r.removeAttr(a,b):e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:(a.setAttribute(b,c+""),c):e&&"get"in e&&null!==(d=e.get(a,b))?d:(d=r.find.attr(a,b), +null==d?void 0:d))},attrHooks:{type:{set:function(a,b){if(!o.radioValue&&"radio"===b&&B(a,"input")){var c=a.value;return a.setAttribute("type",b),c&&(a.value=c),b}}}},removeAttr:function(a,b){var c,d=0,e=b&&b.match(L);if(e&&1===a.nodeType)while(c=e[d++])a.removeAttribute(c)}}),lb={set:function(a,b,c){return b===!1?r.removeAttr(a,c):a.setAttribute(c,c),c}},r.each(r.expr.match.bool.source.match(/\w+/g),function(a,b){var c=mb[b]||r.find.attr;mb[b]=function(a,b,d){var e,f,g=b.toLowerCase();return d||(f=mb[g],mb[g]=e,e=null!=c(a,b,d)?g:null,mb[g]=f),e}});var nb=/^(?:input|select|textarea|button)$/i,ob=/^(?:a|area)$/i;r.fn.extend({prop:function(a,b){return T(this,r.prop,a,b,arguments.length>1)},removeProp:function(a){return this.each(function(){delete this[r.propFix[a]||a]})}}),r.extend({prop:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return 1===f&&r.isXMLDoc(a)||(b=r.propFix[b]||b,e=r.propHooks[b]),void 0!==c?e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:a[b]=c:e&&"get"in e&&null!==(d=e.get(a,b))?d:a[b]},propHooks:{tabIndex:{get:function(a){var b=r.find.attr(a,"tabindex");return b?parseInt(b,10):nb.test(a.nodeName)||ob.test(a.nodeName)&&a.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),o.optSelected||(r.propHooks.selected={get:function(a){var b=a.parentNode;return b&&b.parentNode&&b.parentNode.selectedIndex,null},set:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}}),r.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){r.propFix[this.toLowerCase()]=this});function pb(a){var b=a.match(L)||[];return b.join(" ")}function qb(a){return a.getAttribute&&a.getAttribute("class")||""}r.fn.extend({addClass:function(a){var b,c,d,e,f,g,h,i=0;if(r.isFunction(a))return this.each(function(b){r(this).addClass(a.call(this,b,qb(this)))});if("string"==typeof a&&a){b=a.match(L)||[];while(c=this[i++])if(e=qb(c),d=1===c.nodeType&&" "+pb(e)+" "){g=0;while(f=b[g++])d.indexOf(" "+f+" ")<0&&(d+=f+" ");h=pb(d),e!==h&&c.setAttribute("class",h)}}return this},removeClass:function(a){var b,c,d,e,f,g,h,i=0;if(r.isFunction(a))return this.each(function(b){r(this).removeClass(a.call(this,b,qb(this)))});if(!arguments.length)return this.attr("class","");if("string"==typeof a&&a){b=a.match(L)||[];while(c=this[i++])if(e=qb(c),d=1===c.nodeType&&" "+pb(e)+" "){g=0;while(f=b[g++])while(d.indexOf(" "+f+" ")>-1)d=d.replace(" "+f+" "," ");h=pb(d),e!==h&&c.setAttribute("class",h)}}return this},toggleClass:function(a,b){var c=typeof a;return"boolean"==typeof b&&"string"===c?b?this.addClass(a):this.removeClass(a):r.isFunction(a)?this.each(function(c){r(this).toggleClass(a.call(this,c,qb(this),b),b)}):this.each(function(){var b,d,e,f;if("string"===c){d=0,e=r(this),f=a.match(L)||[];while(b=f[d++])e.hasClass(b)?e.removeClass(b):e.addClass(b)}else void 0!==a&&"boolean"!==c||(b=qb(this),b&&W.set(this,"__className__",b),this.setAttribute&&this.setAttribute("class",b||a===!1?"":W.get(this,"__className__")||""))})},hasClass:function(a){var b,c,d=0;b=" "+a+" ";while(c=this[d++])if(1===c.nodeType&&(" "+pb(qb(c))+" ").indexOf(b)>-1)return!0;return!1}});var rb=/\r/g;r.fn.extend({val:function(a){var b,c,d,e=this[0];{if(arguments.length)return d=r.isFunction(a),this.each(function(c){var e;1===this.nodeType&&(e=d?a.call(this,c,r(this).val()):a,null==e?e="":"number"==typeof e?e+="":Array.isArray(e)&&(e=r.map(e,function(a){return null==a?"":a+""})),b=r.valHooks[this.type]||r.valHooks[this.nodeName.toLowerCase()],b&&"set"in b&&void 0!==b.set(this,e,"value")||(this.value=e))});if(e)return b=r.valHooks[e.type]||r.valHooks[e.nodeName.toLowerCase()],b&&"get"in b&&void 0!==(c=b.get(e,"value"))?c:(c=e.value,"string"==typeof c?c.replace(rb,""):null==c?"":c)}}}),r.extend({valHooks:{option:{get:function(a){var b=r.find.attr(a,"value");return null!=b?b:pb(r.text(a))}},select:{get:function(a){var b,c,d,e=a.options,f=a.selectedIndex,g="select-one"===a.type,h=g?null:[],i=g?f+1:e.length;for(d=f<0?i:g?f:0;d-1)&&(c=!0);return c||(a.selectedIndex=-1),f}}}}),r.each(["radio","checkbox"],function(){r.valHooks[this]={set:function(a,b){if(Array.isArray(b))return a.checked=r.inArray(r(a).val(),b)>-1}},o.checkOn||(r.valHooks[this].get=function(a){return null===a.getAttribute("value")?"on":a.value})});var sb=/^(?:focusinfocus|focusoutblur)$/;r.extend(r.event,{trigger:function(b,c,e,f){var g,h,i,j,k,m,n,o=[e||d],p=l.call(b,"type")?b.type:b,q=l.call(b,"namespace")?b.namespace.split("."):[];if(h=i=e=e||d,3!==e.nodeType&&8!==e.nodeType&&!sb.test(p+r.event.triggered)&&(p.indexOf(".")>-1&&(q=p.split("."),p=q.shift(),q.sort()),k=p.indexOf(":")<0&&"on"+p,b=b[r.expando]?b:new r.Event(p,"object"==typeof b&&b),b.isTrigger=f?2:3,b.namespace=q.join("."),b.rnamespace=b.namespace?new RegExp("(^|\\.)"+q.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=e),c=null==c?[b]:r.makeArray(c,[b]),n=r.event.special[p]||{},f||!n.trigger||n.trigger.apply(e,c)!==!1)){if(!f&&!n.noBubble&&!r.isWindow(e)){for(j=n.delegateType||p,sb.test(j+p)||(h=h.parentNode);h;h=h.parentNode)o.push(h),i=h;i===(e.ownerDocument||d)&&o.push(i.defaultView||i.parentWindow||a)}g=0;while((h=o[g++])&&!b.isPropagationStopped())b.type=g>1?j:n.bindType||p,m=(W.get(h,"events")||{})[b.type]&&W.get(h,"handle"),m&&m.apply(h,c),m=k&&h[k],m&&m.apply&&U(h)&&(b.result=m.apply(h,c),b.result===!1&&b.preventDefault());return b.type=p,f||b.isDefaultPrevented()||n._default&&n._default.apply(o.pop(),c)!==!1||!U(e)||k&&r.isFunction(e[p])&&!r.isWindow(e)&&(i=e[k],i&&(e[k]=null),r.event.triggered=p,e[p](),r.event.triggered=void 0,i&&(e[k]=i)),b.result}},simulate:function(a,b,c){var d=r.extend(new r.Event,c,{type:a,isSimulated:!0});r.event.trigger(d,null,b)}}),r.fn.extend({trigger:function(a,b){return this.each(function(){r.event.trigger(a,b,this)})},triggerHandler:function(a,b){var c=this[0];if(c)return r.event.trigger(a,b,c,!0)}}),r.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(a,b){r.fn[b]=function(a,c){return arguments.length>0?this.on(b,null,a,c):this.trigger(b)}}),r.fn.extend({hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),o.focusin="onfocusin"in a,o.focusin||r.each({focus:"focusin",blur:"focusout"},function(a,b){var c=function(a){r.event.simulate(b,a.target,r.event.fix(a))};r.event.special[b]={setup:function(){var d=this.ownerDocument||this,e=W.access(d,b);e||d.addEventListener(a,c,!0),W.access(d,b,(e||0)+1)},teardown:function(){var d=this.ownerDocument||this,e=W.access(d,b)-1;e?W.access(d,b,e):(d.removeEventListener(a,c,!0),W.remove(d,b))}}});var tb=a.location,ub=r.now(),vb=/\?/;r.parseXML=function(b){var c;if(!b||"string"!=typeof b)return null;try{c=(new a.DOMParser).parseFromString(b,"text/xml")}catch(d){c=void 0}return c&&!c.getElementsByTagName("parsererror").length||r.error("Invalid XML: "+b),c};var wb=/\[\]$/,xb=/\r?\n/g,yb=/^(?:submit|button|image|reset|file)$/i,zb=/^(?:input|select|textarea|keygen)/i;function Ab(a,b,c,d){var e;if(Array.isArray(b))r.each(b,function(b,e){c||wb.test(a)?d(a,e):Ab(a+"["+("object"==typeof e&&null!=e?b:"")+"]",e,c,d)});else if(c||"object"!==r.type(b))d(a,b);else for(e in b)Ab(a+"["+e+"]",b[e],c,d)}r.param=function(a,b){var c,d=[],e=function(a,b){var c=r.isFunction(b)?b():b;d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(null==c?"":c)};if(Array.isArray(a)||a.jquery&&!r.isPlainObject(a))r.each(a,function(){e(this.name,this.value)});else for(c in a)Ab(c,a[c],b,e);return d.join("&")},r.fn.extend({serialize:function(){return r.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var a=r.prop(this,"elements");return a?r.makeArray(a):this}).filter(function(){var a=this.type;return this.name&&!r(this).is(":disabled")&&zb.test(this.nodeName)&&!yb.test(a)&&(this.checked||!ja.test(a))}).map(function(a,b){var c=r(this).val();return null==c?null:Array.isArray(c)?r.map(c,function(a){return{name:b.name,value:a.replace(xb,"\r\n")}}):{name:b.name,value:c.replace(xb,"\r\n")}}).get()}});var Bb=/%20/g,Cb=/#.*$/,Db=/([?&])_=[^&]*/,Eb=/^(.*?):[ \t]*([^\r\n]*)$/gm,Fb=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,Gb=/^(?:GET|HEAD)$/,Hb=/^\/\//,Ib={},Jb={},Kb="*/".concat("*"),Lb=d.createElement("a");Lb.href=tb.href;function Mb(a){return function(b,c){"string"!=typeof b&&(c=b,b="*");var d,e=0,f=b.toLowerCase().match(L)||[];if(r.isFunction(c))while(d=f[e++])"+"===d[0]?(d=d.slice(1)||"*",(a[d]=a[d]||[]).unshift(c)):(a[d]=a[d]||[]).push(c)}}function Nb(a,b,c,d){var e={},f=a===Jb;function g(h){var i;return e[h]=!0,r.each(a[h]||[],function(a,h){var j=h(b,c,d);return"string"!=typeof j||f||e[j]?f?!(i=j):void 0:(b.dataTypes.unshift(j),g(j),!1)}),i}return g(b.dataTypes[0])||!e["*"]&&g("*")}function Ob(a,b){var c,d,e=r.ajaxSettings.flatOptions||{};for(c in b)void 0!==b[c]&&((e[c]?a:d||(d={}))[c]=b[c]);return d&&r.extend(!0,a,d),a}function Pb(a,b,c){var d,e,f,g,h=a.contents,i=a.dataTypes;while("*"===i[0])i.shift(),void 0===d&&(d=a.mimeType||b.getResponseHeader("Content-Type"));if(d)for(e in h)if(h[e]&&h[e].test(d)){i.unshift(e);break}if(i[0]in c)f=i[0];else{for(e in c){if(!i[0]||a.converters[e+" "+i[0]]){f=e;break}g||(g=e)}f=f||g}if(f)return f!==i[0]&&i.unshift(f),c[f]}function Qb(a,b,c,d){var e,f,g,h,i,j={},k=a.dataTypes.slice();if(k[1])for(g in a.converters)j[g.toLowerCase()]=a.converters[g];f=k.shift();while(f)if(a.responseFields[f]&&(c[a.responseFields[f]]=b),!i&&d&&a.dataFilter&&(b=a.dataFilter(b,a.dataType)),i=f,f=k.shift())if("*"===f)f=i;else if("*"!==i&&i!==f){if(g=j[i+" "+f]||j["* "+f],!g)for(e in j)if(h=e.split(" "),h[1]===f&&(g=j[i+" "+h[0]]||j["* "+h[0]])){g===!0?g=j[e]:j[e]!==!0&&(f=h[0],k.unshift(h[1]));break}if(g!==!0)if(g&&a["throws"])b=g(b);else try{b=g(b)}catch(l){return{state:"parsererror",error:g?l:"No conversion from "+i+" to "+f}}}return{state:"success",data:b}}r.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:tb.href,type:"GET",isLocal:Fb.test(tb.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Kb,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":r.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(a,b){return b?Ob(Ob(a,r.ajaxSettings),b):Ob(r.ajaxSettings,a)},ajaxPrefilter:Mb(Ib),ajaxTransport:Mb(Jb),ajax:function(b,c){"object"==typeof b&&(c=b,b=void 0),c=c||{};var e,f,g,h,i,j,k,l,m,n,o=r.ajaxSetup({},c),p=o.context||o,q=o.context&&(p.nodeType||p.jquery)?r(p):r.event,s=r.Deferred(),t=r.Callbacks("once memory"),u=o.statusCode||{},v={},w={},x="canceled",y={readyState:0,getResponseHeader:function(a){var b;if(k){if(!h){h={};while(b=Eb.exec(g))h[b[1].toLowerCase()]=b[2]}b=h[a.toLowerCase()]}return null==b?null:b},getAllResponseHeaders:function(){return k?g:null},setRequestHeader:function(a,b){return null==k&&(a=w[a.toLowerCase()]=w[a.toLowerCase()]||a,v[a]=b),this},overrideMimeType:function(a){return null==k&&(o.mimeType=a),this},statusCode:function(a){var b;if(a)if(k)y.always(a[y.status]);else for(b in a)u[b]=[u[b],a[b]];return this},abort:function(a){var b=a||x;return e&&e.abort(b),A(0,b),this}};if(s.promise(y),o.url=((b||o.url||tb.href)+"").replace(Hb,tb.protocol+"//"),o.type=c.method||c.type||o.method||o.type,o.dataTypes=(o.dataType||"*").toLowerCase().match(L)||[""],null==o.crossDomain){j=d.createElement("a");try{j.href=o.url,j.href=j.href,o.crossDomain=Lb.protocol+"//"+Lb.host!=j.protocol+"//"+j.host}catch(z){o.crossDomain=!0}}if(o.data&&o.processData&&"string"!=typeof o.data&&(o.data=r.param(o.data,o.traditional)),Nb(Ib,o,c,y),k)return y;l=r.event&&o.global,l&&0===r.active++&&r.event.trigger("ajaxStart"),o.type=o.type.toUpperCase(),o.hasContent=!Gb.test(o.type),f=o.url.replace(Cb,""),o.hasContent?o.data&&o.processData&&0===(o.contentType||"").indexOf("application/x-www-form-urlencoded")&&(o.data=o.data.replace(Bb,"+")):(n=o.url.slice(f.length),o.data&&(f+=(vb.test(f)?"&":"?")+o.data,delete o.data),o.cache===!1&&(f=f.replace(Db,"$1"),n=(vb.test(f)?"&":"?")+"_="+ub++ +n),o.url=f+n),o.ifModified&&(r.lastModified[f]&&y.setRequestHeader("If-Modified-Since",r.lastModified[f]),r.etag[f]&&y.setRequestHeader("If-None-Match",r.etag[f])),(o.data&&o.hasContent&&o.contentType!==!1||c.contentType)&&y.setRequestHeader("Content-Type",o.contentType),y.setRequestHeader("Accept",o.dataTypes[0]&&o.accepts[o.dataTypes[0]]?o.accepts[o.dataTypes[0]]+("*"!==o.dataTypes[0]?", "+Kb+"; q=0.01":""):o.accepts["*"]);for(m in o.headers)y.setRequestHeader(m,o.headers[m]);if(o.beforeSend&&(o.beforeSend.call(p,y,o)===!1||k))return y.abort();if(x="abort",t.add(o.complete),y.done(o.success),y.fail(o.error),e=Nb(Jb,o,c,y)){if(y.readyState=1,l&&q.trigger("ajaxSend",[y,o]),k)return y;o.async&&o.timeout>0&&(i=a.setTimeout(function(){y.abort("timeout")},o.timeout));try{k=!1,e.send(v,A)}catch(z){if(k)throw z;A(-1,z)}}else A(-1,"No Transport");function A(b,c,d,h){var j,m,n,v,w,x=c;k||(k=!0,i&&a.clearTimeout(i),e=void 0,g=h||"",y.readyState=b>0?4:0,j=b>=200&&b<300||304===b,d&&(v=Pb(o,y,d)),v=Qb(o,v,y,j),j?(o.ifModified&&(w=y.getResponseHeader("Last-Modified"),w&&(r.lastModified[f]=w),w=y.getResponseHeader("etag"),w&&(r.etag[f]=w)),204===b||"HEAD"===o.type?x="nocontent":304===b?x="notmodified":(x=v.state,m=v.data,n=v.error,j=!n)):(n=x,!b&&x||(x="error",b<0&&(b=0))),y.status=b,y.statusText=(c||x)+"",j?s.resolveWith(p,[m,x,y]):s.rejectWith(p,[y,x,n]),y.statusCode(u),u=void 0,l&&q.trigger(j?"ajaxSuccess":"ajaxError",[y,o,j?m:n]),t.fireWith(p,[y,x]),l&&(q.trigger("ajaxComplete",[y,o]),--r.active||r.event.trigger("ajaxStop")))}return y},getJSON:function(a,b,c){return r.get(a,b,c,"json")},getScript:function(a,b){return r.get(a,void 0,b,"script")}}),r.each(["get","post"],function(a,b){r[b]=function(a,c,d,e){return r.isFunction(c)&&(e=e||d,d=c,c=void 0),r.ajax(r.extend({url:a,type:b,dataType:e,data:c,success:d},r.isPlainObject(a)&&a))}}),r._evalUrl=function(a){return r.ajax({url:a,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,"throws":!0})},r.fn.extend({wrapAll:function(a){var b;return this[0]&&(r.isFunction(a)&&(a=a.call(this[0])),b=r(a,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstElementChild)a=a.firstElementChild;return a}).append(this)),this},wrapInner:function(a){return r.isFunction(a)?this.each(function(b){r(this).wrapInner(a.call(this,b))}):this.each(function(){var b=r(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=r.isFunction(a);return this.each(function(c){r(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(a){return this.parent(a).not("body").each(function(){r(this).replaceWith(this.childNodes)}),this}}),r.expr.pseudos.hidden=function(a){return!r.expr.pseudos.visible(a)},r.expr.pseudos.visible=function(a){return!!(a.offsetWidth||a.offsetHeight||a.getClientRects().length)},r.ajaxSettings.xhr=function(){try{return new a.XMLHttpRequest}catch(b){}};var Rb={0:200,1223:204},Sb=r.ajaxSettings.xhr();o.cors=!!Sb&&"withCredentials"in Sb,o.ajax=Sb=!!Sb,r.ajaxTransport(function(b){var c,d;if(o.cors||Sb&&!b.crossDomain)return{send:function(e,f){var g,h=b.xhr();if(h.open(b.type,b.url,b.async,b.username,b.password),b.xhrFields)for(g in b.xhrFields)h[g]=b.xhrFields[g];b.mimeType&&h.overrideMimeType&&h.overrideMimeType(b.mimeType),b.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest");for(g in e)h.setRequestHeader(g,e[g]);c=function(a){return function(){c&&(c=d=h.onload=h.onerror=h.onabort=h.onreadystatechange=null,"abort"===a?h.abort():"error"===a?"number"!=typeof h.status?f(0,"error"):f(h.status,h.statusText):f(Rb[h.status]||h.status,h.statusText,"text"!==(h.responseType||"text")||"string"!=typeof h.responseText?{binary:h.response}:{text:h.responseText},h.getAllResponseHeaders()))}},h.onload=c(),d=h.onerror=c("error"),void 0!==h.onabort?h.onabort=d:h.onreadystatechange=function(){4===h.readyState&&a.setTimeout(function(){c&&d()})},c=c("abort");try{h.send(b.hasContent&&b.data||null)}catch(i){if(c)throw i}},abort:function(){c&&c()}}}),r.ajaxPrefilter(function(a){a.crossDomain&&(a.contents.script=!1)}),r.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(a){return r.globalEval(a),a}}}),r.ajaxPrefilter("script",function(a){void 0===a.cache&&(a.cache=!1),a.crossDomain&&(a.type="GET")}),r.ajaxTransport("script",function(a){if(a.crossDomain){var b,c;return{send:function(e,f){b=r(" + + + + + + + + +
+
+
+
+ +
+
+
+
+ + \ No newline at end of file diff --git a/resources/views/v2/index.twig b/resources/views/v2/index.twig new file mode 100644 index 0000000000..3464da5d40 --- /dev/null +++ b/resources/views/v2/index.twig @@ -0,0 +1,1584 @@ +{% extends "./layout/default" %} +{% block content %} +
+
+
+
+
+ 6% + +
+
43
+
New Tickets
+
+
+
+
+
+
+
+ -3% + +
+
17
+
Closed Today
+
+
+
+
+
+
+
+ 9% + +
+
7
+
New Replies
+
+
+
+
+
+
+
+ 3% + +
+
27.3K
+
Followers
+
+
+
+
+
+
+
+ -2% + +
+
$95
+
Daily Earnings
+
+
+
+
+
+
+
+ -1% + +
+
621
+
Products
+
+
+
+
+
+
+

Development Activity

+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
UserCommitDate
Ronald BradleyInitial commitMay 6, 2018
BMRussell GibsonMain structureApril 22, 2018
Beverly ArmstrongLeft sidebar adjustmentsApril 15, 2018
Bobby KnightTopbar dropdown styleApril 8, 2018
Sharon WellsFixes #625April 9, 2018
+
+
+ +
+
+
Are you in trouble? Read our documentation with code samples.
+
+
+
+
+

Chart title

+
+
+
+
+
+ +
+
+
+
+

Chart title

+
+
+
+
+
+ +
+
+
+
+
New feedback
+
62
+
+
+
+
+
+
+
+
+
+
Today profit
+
$652
+
+
+
+
+
+
+
+
+
+
+
+ + + +
+

132 Sales

+ 12 waiting payments +
+
+
+
+
+
+
+ + + +
+

78 Orders

+ 32 shipped +
+
+
+
+
+
+
+ + + +
+

1,352 Members

+ 163 registered today +
+
+
+
+
+
+
+ + + +
+

132 Comments

+ 16 waiting +
+
+
+
+
+
+
+
+ +
+

And this isn't my nose. This is a false one.

+
Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...
+
+
+
+ Rose Bradley + 3 days ago +
+
+ +
+
+
+
+
+
+
+ +
+

Well, I didn't vote for you.

+
Well, we did do the nose. Why? Shut up! Will you shut up?! You don't frighten us, English pig-dog...
+
+
+
+ Peter Richards + 3 days ago +
+
+ +
+
+
+
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
UserUsagePaymentActivitySatisfaction
+
+ +
+ 		+
Elizabeth Martin
+
+ Registered: Mar 19, 2018 +
+ 		+
+
+ 42% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
4 minutes ago
+ 		+
+
42%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Michelle Schultz
+
+ Registered: Mar 2, 2018 +
+ 		+
+
+ 0% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
5 minutes ago
+ 		+
+
0%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Crystal Austin
+
+ Registered: Apr 7, 2018 +
+ 		+
+
+ 96% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
a minute ago
+ 		+
+
96%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Douglas Ray
+
+ Registered: Jan 15, 2018 +
+ 		+
+
+ 6% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
a minute ago
+ 		+
+
6%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Teresa Reyes
+
+ Registered: Mar 4, 2018 +
+ 		+
+
+ 36% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
2 minutes ago
+ 		+
+
36%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Emma Wade
+
+ Registered: Mar 20, 2018 +
+ 		+
+
+ 7% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
a minute ago
+ 		+
+
7%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Carol Henderson
+
+ Registered: Feb 22, 2018 +
+ 		+
+
+ 80% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
9 minutes ago
+ 		+
+
80%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Christopher Harvey
+
+ Registered: Jan 22, 2018 +
+ 		+
+
+ 83% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
8 minutes ago
+ 		+
+
83%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+
+
+
+
+
+

Browser Stats

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Google Chrome23%
Mozila Firefox15%
Apple Safari7%
Internet Explorer9%
Opera mini23%
Microsoft edge9%
+
+
+
+
+
+

Projects

+
+ + + + + + + + + + + + + + + + + + + + + + + + + +
Admin Template + 65% +
Landing Page + Finished +
Backend UI + Rejected +
Personal Blog + 40% +
E-mail Templates + 13% +
Corporate Website + Pending +
+
+
+
+
+
+

Members

+
+
+ +
+
+
+
+
+
+
+
+
+5%
+

423

+
Users online
+
+
+
+
+
+ +
+
+
+
+
-3%
+

423

+
Users online
+
+
+
+
+
+ +
+
+
+
+
-3%
+

423

+
Users online
+
+
+
+
+
+ +
+
+
+
+
9%
+

423

+
Users online
+
+
+
+
+
+ +
+
+
+
+
+
+

Invoices

+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
No.Invoice SubjectClientVAT No.CreatedStatusPrice
001401Design Works + Carlson Limited + + 87956621 + + 15 Dec 2017 + + Paid + $887 + Manage +
+ +
+ 		+ + + +
001402UX Wireframes + Adobe + + 87956421 + + 12 Apr 2017 + + Pending + $1200 + Manage +
+ +
+ 		+ + + +
001403New Dashboard + Bluewolf + + 87952621 + + 23 Oct 2017 + + Pending + $534 + Manage +
+ +
+ 		+ + + +
001404Landing Page + Salesforce + + 87953421 + + 2 Sep 2017 + + Due in 2 Weeks + $1500 + Manage +
+ +
+ 		+ + + +
001405Marketing Templates + Printic + + 87956621 + + 29 Jan 2018 + + Paid Today + $648 + Manage +
+ +
+ 		+ + + +
001406Sales Presentation + Tabdaq + + 87956621 + + 4 Feb 2018 + + Due in 3 Weeks + $300 + Manage +
+ +
+ 		+ + + +
+
+
+
+
+{% endblock %} +{% block scripts %} +{% endblock %} +{% block styles %} +{% endblock %} \ No newline at end of file diff --git a/resources/views/v2/layout/auth.twig b/resources/views/v2/layout/auth.twig new file mode 100644 index 0000000000..e69de29bb2 diff --git a/resources/views/v2/layout/default.twig b/resources/views/v2/layout/default.twig new file mode 100644 index 0000000000..86b2c3c748 --- /dev/null +++ b/resources/views/v2/layout/default.twig @@ -0,0 +1,273 @@ + + + + + + + + + + + + + + + + + + + + + + + + {% if subTitle %} + {{ subTitle }} » + {% endif %} + {% if title != "Firefly III" %} + {{ title }} » + {% endif %} + + Firefly III + + + + + + + + + + + + + + + + + + +
+
+
+
+
+ + tabler logo + +
+
+ Source code +
+
+ + + + +
+ + +
+ Nathan pushed new commit: Fix page load performance issue. +
10 minutes ago
+
+ + + +
+ Alice started new task: Tabler UI design. +
1 hour ago
+
+ + + +
+ Rose deployed new version of NodeJS REST Api V3 +
2 hours ago
+
+ +
+ Mark all as read +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ + Need help? + + + Sign out + +
+
+
+ + + +
+
+
+ +
+
+
+

+ Dashboard +

+
+ {% block content %}{% endblock %} +
+
+
+
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ +
+ + \ No newline at end of file diff --git a/resources/views/v2/partials/favicons.twig b/resources/views/v2/partials/favicons.twig new file mode 100644 index 0000000000..2e8f4e7bb0 --- /dev/null +++ b/resources/views/v2/partials/favicons.twig @@ -0,0 +1,12 @@ + + + + + + + + + + + + \ No newline at end of file